--- /dev/null
+!
+! XScreenSaver
+!
+! a screen saver and locker for the X window system
+! by Jamie Zawinski
+!
+! version 3.15
+! 20-Jun-99
+!
+! See "man xscreensaver" for more info. The latest version is always
+! available at http://www.jwz.org/xscreensaver/
+
+
+! These resources, when placed in the system-wide app-defaults directory
+! (e.g., /usr/lib/X11/app-defaults/XScreenSaver) will provide the default
+! settings for new users. However, if you have a ".xscreensaver" file in
+! your home directory, the settings in that file take precedence.
+
+
+*timeout: 10
+*cycle: 10
+*lockTimeout: 0
+*passwdTimeout: 30
+*nice: 10
+*lock: True
+*lockVTs: True
+*verbose: False
+*timestamp: False
+*fade: True
+*unfade: False
+*fadeSeconds: 3
+*fadeTicks: 20
+*splash: True
+*splashDuration: 5
+*visualID: default
+
+*captureStderr: True
+*overlayTextForeground: #FFFF00
+*overlayTextBackground: #000000
+*overlayStderr: True
+*font: *-medium-r-*-140-*-m-*
+
+! The default is to use these extensions if available (as noted.)
+*sgiSaverExtension: True
+*mitSaverExtension: False
+*xidleExtension: True
+*procInterrupts: True
+
+! This is what the "Demo" button on the splash screen runs (/bin/sh syntax.)
+*demoCommand: xscreensaver-demo
+
+! This is what the "Prefs" button on the splash screen runs (/bin/sh syntax.)
+*prefsCommand: xscreensaver-demo -prefs
+
+! This is the URL that the "Help" button on the splash screen loads.
+*helpURL: http://www.jwz.org/xscreensaver/man.html
+
+! This is how the "Help" button loads URLs (/bin/sh syntax.)
+! The "helpURL" will be substituted for up to two occurrences of "%s".
+*loadURL: netscape -remote 'openURL(%s)' || netscape '%s'
+
+
+! Turning on "installColormap" interacts erratically with twm and tvtwm,
+! but seems to work fine with mwm and olwm. Try it and see. If your
+! screen turns some color other than black, the window manager is buggy,
+! and you need to set this resource to False (or get a WM that works.)
+!
+*installColormap: True
+
+
+! Any program which can draw on the root window will work as a screensaver.
+! The following resource enumerates them.
+!
+! Programs are separated by newlines (specified in resource files with \n).
+! Lines may be continued with a lone \ at the end of the line.
+!
+! Each line is an `sh' command.
+!
+! If the first (non-blank) character on the line is "-", then that means
+! that this command is disabled: it's still in the list, but it won't ever
+! be used. (This is just to make it easy to disable and then re-enable
+! them later.)
+!
+! If the first word on the line is the name of a visual followed by a
+! colon, then that visual will be used for the program, if it is available.
+! If no such visual is available, then the program will be skipped. In
+! this way, you can specify that you want certain programs to run only
+! on color screens, and others only on mono screens, by making use of the
+! magic visual names "color" and "mono". Likewise, if some hacks prefer
+! colormaps, but others prefer 24-bit windows, that also can be arranged
+! (in this case, by using "PseudoColor:" versus "TrueColor:".)
+!
+! Some of the screenhacks are written using OpenGL. OpenGL programs are
+! a bit different than normal X programs, in that they prefer visuals that
+! are *half* as deep as the screen. You can tell xscreensaver to select a
+! good visual for a GL program by using the magic visual name "GL".
+!
+! All programs must be launched in such a way that they draw on the root
+! window; they should not be spawned in the background with "&". If shell
+! metacharacters are used, they must be understandable to `sh', not `csh'
+! (the $SHELL variable is not consulted, for unfortunate but good reasons.)
+!
+! Be sure to check out Demo Mode: run the `xscreensaver-demo' program to
+! edit the current list of programs interactively, try out the various modes,
+! and change other parameters. See the man page for details.
+!
+*programs: qix -root -solid -delay 0 -segments 100 \n\
+ qix -root -count 4 -solid -transparent \n\
+ qix -root -count 5 -solid -transparent -linear \
+ -segments 250 -size 100 \n\
+ attraction -root -mode balls \n\
+ attraction -root -mode lines -points 3 -segments 200 \n\
+ attraction -root -mode splines -segments 300 \n\
+ attraction -root -mode lines -radius 300 \
+ -orbit -vmult 0.5 \n\
+ pyro -root \n\
+ helix -root \n\
+ pedal -root \n\
+ rorschach -root -offset 7 \n\
+ hopalong -root \n\
+ greynetic -root \n\
+ xroger -root \n\
+ imsmap -root \n\
+ slidescreen -root \n\
+ decayscreen -root \n\
+ jigsaw -root \n\
+ blitspin -root -grab \n\
+ slip -root \n\
+ distort -root \n\
+ spotlight -root \n\
+ hypercube -root \n\
+ halo -root \n\
+ maze -root \n\
+ noseguy -root \n\
+ flame -root \n\
+ lmorph -root \n\
+ deco -root \n\
+ moire -root \n\
+ moire2 -root \n\
+ lightning -root \n\
+ strange -root \n\
+ spiral -root \n\
+ laser -root \n\
+ grav -root \n\
+ grav -root -trail -decay \n\
+ drift -root \n\
+ ifs -root \n\
+ xjulia -root \n\
+ penrose -root \n\
+ sierpinski -root \n\
+ braid -root \n\
+ galaxy -root \n\
+ bouboule -root \n\
+ swirl -root \n\
+ flag -root \n\
+ sphere -root \n\
+ forest -root \n\
+ lisa -root \n\
+ lissie -root \n\
+ goop -root \n\
+ starfish -root \n\
+ starfish -root -blob \n\
+ munch -root \n\
+ fadeplot -root \n\
+ xcoral -root \n\
+ mountain -root \n\
+ triangle -root \n\
+ worm -root \n\
+ rotor -root \n\
+ ant -root \n\
+ demon -root \n\
+ loop -root \n\
+ vines -root \n\
+ kaleidescope -root \n\
+ xjack -root \n\
+ - xlyap -root -randomize \n\
+ cynosure -root \n\
+ flow -root \n\
+ epicycle -root \n\
+ interference -root \n\
+ truchet -root -randomize \n\
+ bsod -root \n\
+ crystal -root \n\
+ discrete -root \n\
+ kumppa -root \n\
+ rd-bomb -root \n\
+ rd-bomb -root -speed 1 -size 0.1 \n\
+ sonar -root \n\
+ t3d -root \n\
+ penetrate -root \n\
+ deluxe -root \n\
+ compass -root \n\
+ squiral -root \n\
+ xflame -root \n\
+ wander -root \n\
+ wander -root -advance 0 -size 10 -circles True \
+ -length 10000 -reset 100000 \n\
+ critical -root \n\
+ phosphor -root \n\
+ xmatrix -root \n\
+ petri -root -size 1 -count 20 \n\
+ petri -root -minlifespeed 0.02 -maxlifespeed 0.03 \
+ -minlifespan 1 -maxlifespan 1 -instantdeathchan 0 \
+ -minorchan 0 -anychan 0.3 \n\
+ shadebobs -root \n\
+ default-n: webcollage -root \n\
+ - default-n webcollage -root -filter 'vidwhacker -stdin -stdout' \n\
+ - default-n vidwhacker -root \n\
+ \
+ mono: rocks -root \n\
+ color: rocks -root -fg darksalmon \n\
+ \
+ mono: qix -root -linear -count 5 -size 200 -spread 30 \
+ -segments 75 -solid -xor \n\
+ \
+ color: attraction -root -mode polygons \n\
+ color: attraction -root -mode filled-splines -segments 0 \n\
+ color: attraction -root -glow -points 10 \n\
+ color: bubbles -root \n\
+ \
+ GL: gears -root \n\
+ GL: superquadrics -root \n\
+ GL: morph3d -root \n\
+ GL: cage -root \n\
+ GL: moebius -root \n\
+ GL: stairs -root \n\
+ GL: pipes -root \n\
+ GL: sproingies -root \n\
+ GL: rubik -root \n\
+ GL: atlantis -root \n\
+ GL: lament -root \n\
+ GL: bubble3d -root \n\
+ GL: glplanet -root \n\
+ GL: pulsar -root \n\
+ - GL: pulsar -root -texture -mipmap -texture_quality \
+ -light -fog \n
+
+
+! Some other programs that you might want to track down (these work as
+! XScreenSaver helpers, but are not distributed with it):
+!
+! xdaliclock -root -builtin2 \n\
+! xswarm -r 2>&- \n\
+! xwave -root \n\
+! xbouncebits ... \n\
+! ico -r -faces -sleep 1 -obj ico \n\
+! xsplinefun \n\
+! xmountains -b -M \n\
+! color: xfishtank -c black -d -r 2 \n\
+!
+! xtacy is ok, but it only works on the default visual. We can satisfy
+! that constraint like so:
+!
+! default: xtacy -root -delay 100 -funky -number 3 \n\
+! default: xtacy -root -delay 100 -gravity \n\
+! default: xtacy -root -delay 100 -mixer \n\
+! default: xtacy -root -delay 100 -taffy -pal 4 \n\
+!
+! To display a randomized slideshow of images, you can do something like this:
+!
+! default-n: xv -root -rmode 5 -random -viewonly -wloop \
+! -wait 30 $HOME/bitmaps/*.jpg \n\
+!
+! Note that we've used "default-n" as the visual name, rather than just
+! "default": this means "default visual, no install", that is, it's like
+! specifying the command-line arguments "-visual default -no-install".
+! This is necessary because, when XV is running in "-root" mode, it always
+! assumes that the default visual and colormap are being used, rather than
+! examining the window it is drawing on to see what visual and colormap it
+! has. If we didn't force the default visual to be used, xv would get an
+! X error. If we didn't force the default colormap to be installed, the
+! colors would be all wrong. "default-i" may also be used as a visual name
+! (meaning, "-visual default -install") but you probably won't ever need
+! to use that.
+!
+! XEarth is nice, too:
+!
+! default-n: xearth -nostars -wait 0 -timewarp 400 -pos sunrel/38/-30
+!
+!
+! Some of the GL demos that SGI ships work with XScreenSaver; most don't.
+! XScreenSaver includes a program (not built or installed by default)
+! called "xscreensaver-sgigl". To use the SGI demos with XScreenSaver,
+! build that program, and use it to launch the SGI demos. For example,
+! on Irix 6.2, you can do this:
+!
+! xscreensaver-sgigl /usr/demos/bin/ep -S
+! xscreensaver-sgigl /usr/demos/bin/bongo
+!
+! On Irix 6.3, things have moved, so you need to do it like this:
+!
+! xscreensaver-sgigl /usr/sbin/ep -S
+!
+! You can also use the "ant" demo, but first you need to wrap a shell script
+! around it that cds to its home directory, so that it can find its files;
+! and also pass it the -S argument, to prevent it from forking.
+!
+!
+! Also, since these actually end up mapping their own windows instead of
+! drawing on the XScreenSaver-provided root, when they are being run from
+! demo-mode, you can't pop up the demo-mode dialog just by clicking the
+! mouse: you must first type ESC to make the SGI programs exit. This sucks.
+! Things should work properly when they are being run by xscreensaver in
+! non-demo-mode, however.
+!
+! Basically, the SGI demo writers went out of their way to make my life hell.
+
+
+
+!=============================================================================
+!
+! You probably don't want to change anything after this point.
+!
+!=============================================================================
+
+
+XScreenSaver.pointerPollTime: 5
+XScreenSaver.initialDelay: 0
+XScreenSaver.windowCreationTimeout: 30
+XScreenSaver.bourneShell: /bin/sh
+
+
+! Resources for the password and splash-screen dialog boxes of
+! the "xscreensaver" daemon.
+!
+*Dialog.headingFont: *-times-bold-r-*-*-*-180-*-*-*-iso8859-1
+*Dialog.bodyFont: *-helvetica-bold-r-*-*-*-140-*-*-*-iso8859-1
+*Dialog.labelFont: *-helvetica-bold-r-*-*-*-140-*-*-*-iso8859-1
+*Dialog.buttonFont: *-helvetica-bold-r-*-*-*-140-*-*-*-iso8859-1
+*Dialog.foreground: #000000
+*Dialog.background: #BFBFBF
+*Dialog.Button.foreground: #000000
+*Dialog.Button.background: #D0D0D0
+*Dialog.text.foreground: #000000
+*Dialog.text.background: #FFFFFF
+*Dialog.logo.foreground: #FF0000
+*Dialog.logo.background: #FFFFFF
+*Dialog.topShadowColor: #E7E7E7
+*Dialog.bottomShadowColor: #737373
+*Dialog.logo.width: 200
+*Dialog.logo.height: 200
+*Dialog.internalBorderWidth: 30
+*Dialog.borderWidth: 1
+*Dialog.shadowThickness: 4
+
+*passwd.heading.label: XScreenSaver %s
+*passwd.body.label: This display is locked.
+*passwd.user.label: User:
+*passwd.passwd.label: Password:
+*passwd.passwdFont: *-courier-medium-r-*-*-*-140-*-*-*-iso8859-1
+*passwd.thermometer.width: 8
+
+*splash.heading.label: XScreenSaver %s
+*splash.body.label: Copyright © 1991-1999 by
+*splash.body2.label: Jamie Zawinski <jwz@jwz.org>
+*splash.demo.label: Demo
+*splash.prefs.label: Prefs
+*splash.help.label: Help
+
+
+! Resources for the Motif dialog boxes of the "xscreensaver-demo" program.
+!
+*fontList: *-helvetica-medium-r-*-*-*-120-*-*-*-iso8859-1
+*demoDialog*label1.fontList: *-helvetica-medium-r-*-*-*-140-*-*-*-iso8859-1
+*XmTextField.fontList: *-courier-medium-r-*-*-*-120-*-*-*-iso8859-1
+*label0.fontList: *-helvetica-bold-r-*-*-*-140-*-*-*-iso8859-1
+XScreenSaver*XmList.fontList: *-courier-medium-r-*-*-*-120-*-*-*-iso8859-1
+! Need to fully-qualify the preceeding in the case of of *sgiMode.
+
+*XmDialogShell*foreground: #000000
+*XmDialogShell*background: #E5E5E5
+*XmDialogShell*XmTextField.foreground: #000000
+*XmDialogShell*XmTextField.background: #FFFFFF
+*XmDialogShell*demoList.foreground: #000000
+*XmDialogShell*demoList.background: #FFFFFF
+
+*XmDialogShell.title: XScreenSaver
+*versionWarning_popup.title: XScreenSaver Warning
+*demoForm_popup.title: XScreenSaver Demo
+*preferencesForm_popup.title: XScreenSaver Preferences
+*allowShellResize: True
+*autoUnmanage: False
+
+! This doesn't work. Motif ignores it if there is a scroll-list!
+*demoDialog.maxWidth: 600
+
+*label1.labelString: XScreenSaver %s
+*label1.label: XScreenSaver %s
+*label2.labelString: Copyright © 1991-1999 by Jamie Zawinski <jwz@jwz.org>
+*label2.label: Copyright © 1991-1999 by Jamie Zawinski <jwz@jwz.org>
+*demoList.visibleItemCount: 10
+*demoList.automaticSelection: True
+*next.labelString: Run Next
+*prev.labelString: Run Previous
+*edit.labelString: Preferences
+*restart.labelString: Reinitialize
+*done.labelString: Quit
+
+*preferencesLabel.labelString: XScreenSaver Parameters
+
+*timeoutLabel.labelString: Saver Timeout
+*cycleLabel.labelString: Cycle Timeout
+*fadeSecondsLabel.labelString: Fade Duration
+*fadeTicksLabel.labelString: Fade Ticks
+*lockLabel.labelString: Lock Timeout
+*passwdLabel.labelString: Password Timeout
+*preferencesForm*XmTextField.columns: 8
+
+*verboseToggle.labelString: Verbose
+*cmapToggle.labelString: Install Colormap
+*fadeToggle.labelString: Fade Colormap
+*unfadeToggle.labelString: Unfade Colormap
+*lockToggle.labelString: Require Password
+*preferencesDone.labelString: OK
+*preferencesCancel.labelString: Cancel
+
+
+! Disable Motif drag-and-drop in dialog boxes. This is kind of pathetic, but
+! in some older versions of Motif, most any attempt to drag cause immediate
+! flaming death from above. This *should* rip the legs off that bug.
+! (But sadly, Lesstif 0.86 and earlier ignore these resources *and* have
+! buggy drag-and-drop.)
+!
+XScreenSaver*dragInitiatorProtocolStyle: DRAG_NONE
+XScreenSaver*dragReceiverProtocolStyle: DRAG_NONE
+
+
+
+! Resources for the Athena dialog boxes of the "xscreensaver-demo" program.
+!
+*demo_dialog.title: XScreenSaver Demo
+*preferences_dialog.title: XScreenSaver Preferences
+*warning_dialog.title: XScreenSaver Warning
+
+! For some reason, it doesn't size correctly by itself.
+*demo_dialog.geometry: =640x400
+
+*demo_dialog*font: *-helvetica-bold-r-*-*-*-120-*-*-*-iso8859-1
+*preferences_dialog*font: *-helvetica-bold-r-*-*-*-120-*-*-*-iso8859-1
+*demo_dialog*label1.font: *-helvetica-bold-r-*-*-*-140-*-*-*-iso8859-1
+*preferences_dialog*label1.font:*-helvetica-bold-r-*-*-*-140-*-*-*-iso8859-1
+XScreenSaver*warning_dialog*label0.font: \
+ *-helvetica-bold-r-*-*-*-140-*-*-*-iso8859-1
+XScreenSaver*warning_dialog*Label.font: \
+ *-helvetica-bold-r-*-*-*-120-*-*-*-iso8859-1
+XScreenSaver*warning_dialog*Command.font: \
+ *-helvetica-bold-r-*-*-*-140-*-*-*-iso8859-1
+XScreenSaver.demo_dialog*List.font: \
+ *-courier-medium-r-*-*-*-120-*-*-*-iso8859-1
+XScreenSaver.demo_dialog*Text*font: \
+ *-courier-medium-r-*-*-*-120-*-*-*-iso8859-1
+
+XScreenSaver.demo_dialog*foreground: #000000
+XScreenSaver.demo_dialog*background: #E5E5E5
+XScreenSaver.demo_dialog*List.background: #FFFFFF
+XScreenSaver.demo_dialog*Scrollbar.background: #D9D9D9
+XScreenSaver.demo_dialog*Command.background: #D9D9D9
+XScreenSaver.demo_dialog*Text*background: #FFFFFF
+
+XScreenSaver.preferences_dialog*foreground: #000000
+XScreenSaver.preferences_dialog*background: #E5E5E5
+XScreenSaver.preferences_dialog*Command.background: #D9D9D9
+XScreenSaver.preferences_dialog*Toggle.background: #D9D9D9
+XScreenSaver.preferences_dialog*Text*background: #FFFFFF
+
+XScreenSaver.warning_dialog*foreground: #000000
+XScreenSaver.warning_dialog*background: #E5E5E5
+XScreenSaver.warning_dialog*Command.background: #D9D9D9
+
+*preferences_dialog*Dialog.value.translations: #override\n\
+ <Key>Return: beginning-of-line()\n
+
+*demo_dialog*viewport.height: 200
+*Form.borderWidth: 0
+*Box.borderWidth: 0
+*Label.borderWidth: 0
+*preferences_dialog*Dialog.borderWidth: 0
+
+*demo_dialog*run.label: Run
+*demo_dialog*next.label: Run Next
+*demo_dialog*prev.label: Run Previous
+*demo_dialog*edit.label: Preferences
+*demo_dialog*restart.label: Reinitialize
+*demo_dialog*done.label: Quit
+XScreenSaver.demo_dialog*Command.internalWidth: 10
+XScreenSaver.demo_dialog*Command.internalHeight: 4
+
+*preferences_dialog*timeout.label: Saver Timeout:
+*preferences_dialog*cycle.label: Cycle Timeout:
+*preferences_dialog*fade.label: Fade Duration:
+*preferences_dialog*ticks.label: Fade Ticks:
+*preferences_dialog*lockTime.label: Lock Timeout:
+*preferences_dialog*passwdTime.label: Password Timeout:
+XScreenSaver.preferences_dialog*Command.internalWidth: 10
+XScreenSaver.preferences_dialog*Command.internalHeight: 4
+
+*preferences_dialog*label1.label: XScreenSaver Parameters
+*preferences_dialog*buttonbox.verbose.label: Verbose
+*preferences_dialog*buttonbox.cmap.label: Install Colormap
+*preferences_dialog*buttonbox.fade.label: Fade Colormap
+*preferences_dialog*buttonbox.unfade.label: Unfade Colormap
+*preferences_dialog*buttonbox.lock.label: Require Password
+*preferences_dialog*done.label: Ok
+*preferences_dialog*cancel.label: Cancel
+
+*warning_dialog*ok.label: Ok
+
+*warning_dialog*horizDistance: 30
+*warning_dialog*vertDistance: 0
+
+*warning_dialog*Label.internalWidth: 1
+*warning_dialog*Label.internalHeight: 0
+
+*warning_dialog*label0.horizDistance: 80
+*warning_dialog*label0.vertDistance: 20
+
+*warning_dialog*Command.horizDistance: 160
+*warning_dialog*Command.vertDistance: 20
+*warning_dialog*Command.internalWidth: 20
+*warning_dialog*Command.internalHeight: 5
--- /dev/null
+#!/bin/sh
+#
+# vidwhacker, for xscreensaver. Copyright (c) 1998, 1999 Jamie Zawinski.
+#
+# Permission to use, copy, modify, distribute, and sell this software and its
+# documentation for any purpose is hereby granted without fee, provided that
+# the above copyright notice appear in all copies and that both that
+# copyright notice and this permission notice appear in supporting
+# documentation. No representations are made about the suitability of this
+# software for any purpose. It is provided "as is" without express or
+# implied warranty.
+#
+#
+# This script grabs a frame of video, then uses various pbm filters to
+# munge the image in random nefarious ways, then uses xv to put it on
+# the root window. This works out really nicely if you just feed some
+# random TV station into it...
+#
+# The video grabbing part is SGI-specific -- if you want to use this on
+# another system, add a new clause to the grab() procedure.
+
+
+# Process command-line args...
+
+onroot=false
+verbose=false
+delay=3
+use_stdin=false
+use_stdout=false
+
+pid=""
+tmp=${TMPDIR:-/tmp}/vidwhacker.$$
+tmp_rgb=$tmp-00000.rgb
+tmp_ppm0=$tmp-0.ppm
+tmp_ppm1=$tmp-1.ppm
+tmp_ppm2=$tmp-2.ppm
+tmp_ppm3=$tmp-3.ppm
+tmp_ppm4=$tmp-4.ppm
+tmp_ppmS=$tmp-S.ppm
+
+
+getargs() {
+
+ while [ $# != 0 ]; do
+ case "$1" in
+ -display | -disp | -dis | -dpy | -d )
+ shift
+ DISPLAY="$1"
+ export DISPLAY
+ ;;
+ -root )
+ onroot=true
+ ;;
+ -window )
+ onroot=false
+ ;;
+ -verbose )
+ verbose=true
+ ;;
+ -stdin )
+ use_stdin=true
+ ;;
+ -stdout )
+ use_stdout=true
+ ;;
+ -delay)
+ shift
+ delay="$1"
+ ;;
+ * )
+ echo "VidWhacker, Copyright (c) 1999 Jamie Zawinski <jwz@jwz.org>" >&2
+ echo " http://www.jwz.org/xscreensaver/" >&2
+ echo "" >&2
+ echo "usage: $0 [-display dpy] [-verbose] [-root | -window]" >&2
+ echo " [-stdin] [-stdout] [-delay secs]" >&2
+ exit 1
+ ;;
+ esac
+ shift
+ done
+
+ xvargs="-quick24"
+
+ if [ "$onroot" = true ]; then
+ xvargs="$xvargs -root -rmode 5 -noresetroot -rfg black -rbg black -viewonly"
+ else
+ xvargs="$xvargs -geom +0+0"
+ fi
+
+
+ screen_width=''
+ if [ "$use_stdout" = false ]; then
+ screen_width=`xdpyinfo 2>/dev/null |
+ sed -n 's/.* dimensions: *\([0-9]*\).*/\1/p'`
+ if [ "$screen_width" = "" ]; then
+ screen_width=800
+ fi
+ fi
+}
+
+
+clean() {
+ rm -f $tmp_rgb $tmp_ppm1 $tmp_ppm2 $tmp_ppm3 $tmp_ppm4
+}
+
+clean2() {
+ clean
+ rm -f $tmp_ppm0 $tmp_ppmS
+}
+
+
+# Grab a frame of video. leaves it in $tmp_ppm1.
+#
+grab() {
+ uname=`uname`
+ if [ $uname = IRIX ]; then
+ #
+ # SGI's "vidtomem" returns an SGI RGB image of the default video input,
+ # and has stupid non-overridable ouput-file-naming conventions. So, let
+ # it write its file; and then convert it to a pgm.
+ #
+
+ vidtomem -f $tmp
+ sgitopnm $tmp_rgb > $tmp_ppm1
+
+ # Cut off the close-captioning blips in the NTSC overscan region. YMMV.
+ # | pnmcut 12 7 695 477
+
+ elif [ $uname = Linux ]; then
+
+ # Marcus Herbert says the following works with his Connectix Qcam.
+ # Don't have qcam? Well, do something else then... and send me a patch.
+
+ qcam > $tmp_ppm1
+
+ # Friedrich Delgado Friedrichs says the following works with a
+ # Brooktree 848 or 878 tuner card:
+ #
+ # bttvgrab -Q -d q -l 1 -F /dev/null -o gif -f ${tmp}.gif -N PAL
+ # giftopnm ${tmp}.gif > $tmp_ppm1
+ # rm ${tmp}.gif
+ #
+ # He notes that you might need to run a TV application (e.g., xawtv)
+ # before the first time you run vidwhacker in order to initialize the
+ # tuner card and kernel modules.
+
+
+ else
+ echo "$0: don't know how to grab video on this OS." >&2
+ clean2
+ exit 1
+ fi
+}
+
+
+# Use perl to pick a random foreground/background color in pbm's syntax.
+#
+randcolor() {
+ perl -e 'srand;
+ printf("#%02x%02x%02x-#%02x%02x%02x",
+ int(rand()*60),
+ int(rand()*60),
+ int(rand()*60),
+ 120+int(rand()*135),
+ 120+int(rand()*135),
+ 120+int(rand()*135))'
+}
+
+# Frobnicate the image in some random way.
+#
+frob() {
+
+ w_h=`head -2 $tmp_ppm1 | tail -1`
+ width=`echo $w_h | awk '{print $1}'`
+ height=`echo $w_h | awk '{print $2}'`
+
+ N=`perl -e 'srand; print int(rand() * 17)'`
+
+ if [ "$verbose" = true ]; then
+ echo "mode $N..." >&2
+ fi
+
+ if [ $N = 0 ]; then
+ ppmtopgm $tmp_ppm1 | pgmedge | pgmtoppm `randcolor` | ppmnorm
+
+ elif [ $N = 1 ]; then
+ ppmtopgm $tmp_ppm1 |
+ pgmenhance |
+ pgmtoppm `randcolor`
+
+ elif [ $N = 2 ]; then
+ ppmtopgm $tmp_ppm1 | pgmoil | pgmtoppm `randcolor`
+
+ elif [ $N = 3 ]; then
+ ppmrelief $tmp_ppm1 | ppmtopgm | pgmedge | ppmrelief | ppmtopgm |
+ pgmedge | pnminvert | pgmtoppm `randcolor`
+
+ elif [ $N = 4 ]; then
+ ppmspread 71 $tmp_ppm1 > $tmp_ppm2
+ pnmarith -add $tmp_ppm1 $tmp_ppm2
+
+ elif [ $N = 5 ]; then
+ pnmflip -lr $tmp_ppm1 > $tmp_ppm2
+ pnmarith -multiply $tmp_ppm1 $tmp_ppm2 > $tmp_ppm3
+ pnmflip -tb $tmp_ppm3 | ppmnorm > $tmp_ppm2
+ pnmarith -multiply $tmp_ppm1 $tmp_ppm2
+
+ elif [ $N = 6 ]; then
+ N2=`perl -e 'srand; print int(rand() * 3)'`
+ if [ $N2 = 0 ]; then
+ pnmflip -lr $tmp_ppm1 > $tmp_ppm2
+ elif [ $N2 = 1 ]; then
+ pnmflip -tb $tmp_ppm1 > $tmp_ppm2
+ else
+ pnmflip -lr $tmp_ppm1 > $tmp_ppm2
+ pnmflip -tb $tmp_ppm2 > $tmp_ppm3
+ cp $tmp_ppm3 $tmp_ppm2
+ fi
+
+ pnmarith -difference $tmp_ppm1 $tmp_ppm2
+
+ elif [ $N = 7 ]; then
+
+ for i in 1 2 3 ; do
+ ppmtopgm $tmp_ppm1 | pgmedge > $tmp_ppm2
+ pnmarith -difference $tmp_ppm1 $tmp_ppm2 > $tmp_ppm3
+ cp $tmp_ppm3 $tmp_ppm1
+ done
+ ppmnorm < $tmp_ppm1
+
+ elif [ $N = 8 ]; then
+ pnmflip -lr $tmp_ppm1 > $tmp_ppm2
+ pnmarith -multiply $tmp_ppm1 $tmp_ppm2 | ppmrelief | ppmnorm | pnminvert
+
+ elif [ $N = 9 ]; then
+ pnmflip -lr $tmp_ppm1 > $tmp_ppm2
+ pnmarith -subtract $tmp_ppm1 $tmp_ppm2 | ppmrelief | ppmtopgm | pgmedge
+
+ elif [ $N = 10 ]; then
+ ppmtopgm $tmp_ppm1 | pgmbentley | pgmtoppm `randcolor`
+
+ elif [ $N = 11 ]; then
+ pgmcrater -number 20000 -height $height -width $width | pgmtoppm `randcolor` > $tmp_ppm2
+ pnmarith -difference $tmp_ppm1 $tmp_ppm2 > $tmp_ppm3
+ pnmflip -tb $tmp_ppm3 | ppmnorm > $tmp_ppm2
+ pnmarith -multiply $tmp_ppm1 $tmp_ppm2
+
+ elif [ $N = 12 ]; then
+ ppmshift 30 $tmp_ppm1 | ppmtopgm | pgmoil | pgmedge | pgmtoppm `randcolor` > $tmp_ppm2
+ pnmarith -difference $tmp_ppm1 $tmp_ppm2
+
+ elif [ $N = 13 ]; then
+ ppmpat -madras $width $height | pnmdepth 255 > $tmp_ppm2
+ pnmarith -difference $tmp_ppm1 $tmp_ppm2
+
+ elif [ $N = 14 ]; then
+ ppmpat -tartan $width $height | pnmdepth 255 > $tmp_ppm2
+ pnmarith -difference $tmp_ppm1 $tmp_ppm2
+
+ elif [ $N = 15 ]; then
+ ppmpat -camo $width $height | pnmdepth 255 | ppmshift 50 > $tmp_ppm2
+ pnmarith -multiply $tmp_ppm1 $tmp_ppm2
+
+ elif [ $N = 16 ]; then
+ pgmnoise $width $height | pgmedge | pgmtoppm `randcolor` > $tmp_ppm2
+ pnmarith -difference $tmp_ppm1 $tmp_ppm2 | pnmdepth 255 | pnmsmooth
+
+ else cat $tmp_ppm1
+ fi
+}
+
+
+# Grab a frame and frob it. leave it in $tmp_ppm3.
+#
+whack() {
+ clean
+
+ while [ ! -f $tmp_ppm1 ]; do
+ if [ "$use_stdin" != true ]; then
+ grab
+ else
+ cp $tmp_ppmS $tmp_ppm0
+ cp $tmp_ppm0 $tmp_ppm1
+ fi
+ done
+
+ rm -f $tmp_rgb
+
+ if [ "$screen_width" != "" ]; then
+ frob | pnmscale -width $screen_width > $tmp_ppm3
+ else
+ frob > $tmp_ppm3
+ fi
+
+ rm -f $tmp_ppm1 $tmp_ppm2
+}
+
+
+# Kill off the xv subprocess, if it's running
+#
+kill_pid() {
+ if [ "$pid" != "" ]; then
+
+ if [ "$verbose" = true ]; then
+ echo "killing pid $pid..." >&2
+ fi
+
+ # need to do this to avoid "6898 Terminated" messages!
+ # apparently one can't redirect the output of the builtin `kill' command.
+# ( sh -c "kill $pid" ) >/dev/null 2>/dev/null </dev/null
+
+ # wtf? that doesn't work either. Is it writing to /dev/tty??
+ kill $pid >/dev/null 2>&1
+
+ pid=""
+ fi
+}
+
+# called when this process is signalled (for cleanup)
+#
+my_trap() {
+ if [ "$verbose" = true ]; then
+ echo "trapped signal!" >&2
+ fi
+ kill_pid
+ clean2
+ exit 1
+}
+
+main() {
+
+ getargs $@
+
+ trap my_trap 1 2 3 6 9 13 15
+
+ if [ "$use_stdin" = true ]; then
+ cat > $tmp_ppmS
+ fi
+
+ while true; do
+
+ # Loop grabbing and frobbing images.
+ #
+ # If we're running on the root, run xv in the foreground (with -exit)
+ # and then wait.
+ #
+ # If we're running in a window, spawn xv in the background; then when
+ # it's time to put up the new image, kill off the currently-running xv.
+
+ if [ "$verbose" = true ]; then
+ whack
+ else
+ whack >/dev/null 2>&1
+ fi
+
+ kill_pid
+
+ if [ ! -s $tmp_ppm3 ]; then
+ echo "$0: no image grabbed" >&2
+
+ elif [ "$use_stdout" = true ]; then
+
+ cat $tmp_ppm3
+ clean2
+ exit 0
+
+ else
+
+ pnmtosgi < $tmp_ppm3 > $tmp_ppm2
+ rm -f $tmp_ppm3
+
+ if [ -s $tmp_ppm2 ]; then
+ if [ "$verbose" = true ]; then
+ echo "launching xv $xvargs $tmp_ppm2" >&2
+ ls -lF $tmp_ppm2
+ fi
+
+ mv $tmp_ppm2 $tmp_ppm0
+ xv $xvargs $tmp_ppm0 &
+
+# this doesn't work -- leaves xv processes around, instead of stray xset
+# data. Sigh.
+#
+# # cat the file so that we can nuke it without racing against xv.
+# cat $tmp_ppm2 | xv $xvargs - &
+
+ pid=$!
+ fi
+ fi
+
+ clean
+ sleep $delay
+
+ done
+ exit 1
+}
+
+main $@
+
+# to find stray xv data:
+# xwininfo -root -children|grep 'xv image comments' | awk '{print "xkill -id ", $1}'
--- /dev/null
+#!/usr/local/bin/perl5 -w
+#
+# webcollage, for xscreensaver, Copyright (c) 1999 Jamie Zawinski <jwz@jwz.org>
+#
+# Permission to use, copy, modify, distribute, and sell this software and its
+# documentation for any purpose is hereby granted without fee, provided that
+# the above copyright notice appear in all copies and that both that
+# copyright notice and this permission notice appear in supporting
+# documentation. No representations are made about the suitability of this
+# software for any purpose. It is provided "as is" without express or
+# implied warranty.
+#
+#
+# This program decorate the screen with random images from the web.
+
+
+use Socket;
+
+my $progname = "$0";
+my $version = "1.0";
+
+$progname =~ s@^.*/([^/]+)$@$1@;
+
+my $random_redirector = "http://random.yahoo.com/bin/ryl";
+my $image_randomizer_a = "http://image.altavista.com/";
+my $image_randomizer = $image_randomizer_a . "cgi-bin/avncgi" .
+ "?do=3&verb=no&oshape=n&oorder=" .
+ "&ophoto=1&oart=1&ocolor=1&obw=1" .
+ "&stype=simage&oprem=0&query=";
+
+my $http_timeout = 30;
+my $ppm_to_root_window_cmd = "xv -root -rmode 5 -viewonly" .
+ " +noresetroot %%PPM%% -quit";
+my $filter_cmd = undef;
+my $post_filter_cmd = undef;
+my $background = undef;
+my $no_output_p = 0;
+my $delay = 0;
+
+my $wordlist = "/usr/dict/words";
+
+if (!-r $wordlist) {
+ $wordlist = "/usr/share/lib/dict/words"; # irix
+}
+
+
+my $min_width = 50;
+my $min_height = 50;
+
+my $DEBUG = 0;
+
+
+# returns three values: the HTTP response line; the document headers;
+# and the document body.
+#
+sub get_document_1 {
+ my ( $url ) = @_;
+
+ if ( $DEBUG > 2 ) {
+ print STDERR "get_document_1 $url\n";
+ }
+
+ my($dummy, $dummy, $serverstring, $path) = split(/\//, $url, 4);
+ my($them,$port) = split(/:/, $serverstring);
+ $port = 80 unless $port;
+ my $size="";
+
+ my ($remote, $iaddr, $paddr, $proto, $line);
+ $remote = $them;
+ if ($port =~ /\D/) { $port = getservbyname($port, 'tcp') }
+ return unless $port;
+ $iaddr = inet_aton($remote) || return;
+ $paddr = sockaddr_in($port, $iaddr);
+
+ @_ =
+ eval {
+ local $SIG{ALRM} = sub {
+ if ($DEBUG > 0) {
+ print STDERR "timed out for $url\n";
+ }
+ die "alarm\n" };
+ alarm $http_timeout;
+
+ $proto = getprotobyname('tcp');
+ socket(S, PF_INET, SOCK_STREAM, $proto) || return;
+ connect(S, $paddr) || return;
+
+ select(S); $| = 1; select(STDOUT);
+
+ print S ("GET /$path HTTP/1.0\n" .
+ "Host: $them\n" .
+ "User-Agent: $progname/$version\n" .
+ "\n");
+
+ my $http = <S>;
+
+ my $head = "";
+ my $body = "";
+ while (<S>) {
+ $head .= $_;
+ last if m@^[\r\n]@;
+ }
+ while (<S>) {
+ $body .= $_;
+ }
+
+ close S;
+
+ return ( $http, $head, $body );
+ };
+ die if ($@ && $@ ne "alarm\n"); # propagate errors
+ if ($@) {
+ # timed out
+ return undef;
+ } else {
+ # didn't
+ alarm 0;
+ return @_;
+ }
+}
+
+
+# returns two values: the document headers; and the document body.
+# if the given URL did a redirect, returns the redirected-to document.
+#
+sub get_document {
+ my ( $url ) = @_;
+
+ do {
+ my ( $http, $head, $body ) = get_document_1 $url;
+
+ return undef if ( ! $body );
+
+ if ( $http =~ m@HTTP/[0-9.]+ 30[23]@ ) {
+ $_ = $head;
+ my ( $location ) = m@^location:[ \t]*(.*)$@im;
+ if ( $location ) {
+
+ if ( $DEBUG > 2 ) {
+ print STDERR "redirect from $url to $location\n";
+ }
+ $url = $location;
+ } else {
+ return ( $url, $body );
+ }
+
+ } elsif ( $http =~ m@HTTP/[0-9.]+ [4-9][0-9][0-9]@ ) {
+ # http errors -- return nothing.
+ return undef;
+
+ } else {
+
+ return ( $url, $body );
+ }
+
+ } while (1);
+}
+
+
+# given a URL and the body text at that URL, selects and returns a random
+# image from it. returns undef if no suitable images found.
+#
+sub pick_image_from_body {
+ my ( $base, $body ) = @_;
+
+ $_ = $base;
+
+ # if there's at least one slash after the host, take off the last
+ # pathname component
+ if ( m@^http://[^/]+/@io ) {
+ ( $base = $base ) =~ s@[^/]+$@@go;
+ }
+
+ # if there are no slashes after the host at all, put one on the end.
+ if ( m@^http://[^/]+$@io ) {
+ $base .= "/";
+ }
+
+ if ( $DEBUG > 2 ) {
+ print STDERR "base is $base\n";
+ }
+
+
+ $_ = $body;
+
+ # strip out newlines, compress whitespace
+ s/[\r\n\t ]+/ /go;
+
+ # nuke comments
+ s/<!--.*?-->//go;
+
+ my @urls;
+ my %unique_urls;
+
+ foreach (split(/ *</)) {
+ if ( m/^(img|a) .*(src|href) ?= ?\"? ?(.*?)[ >\"]/io ) {
+
+ my $was_inline = ( "$1" eq "a" || "$1" eq "A" );
+ my $link = $3;
+ my ( $width ) = m/width ?= ?([0-9]+)/oi;
+ my ( $height ) = m/height ?= ?([0-9]+)/oi;
+ $_ = $link;
+
+ if ( m@^/@o ) {
+ my $site;
+ ( $site = $base ) =~ s@^(http://[^/]*).*@$1@gio;
+ $_ = "$site$link";
+ } elsif ( ! m/:/ ) {
+ $_ = "$base$link";
+ s@/\./@/@;
+ while (s@/\.\./@/@g) {
+ }
+ }
+
+ # skip non-http
+ if ( ! m@^http://@io ) {
+ next;
+ }
+
+ # skip non-image
+ if ( ! m@[.](gif|jpg|jpeg|pjpg|pjpeg)@io ) {
+ next;
+ }
+
+ # skip GIF!
+# if ( m@[.](gif)@io ) {
+## if ( $DEBUG > 2 ) { print "skip GIF $_\n"; }
+# next;
+# }
+
+ # skip really short or really narrow images
+ if ( $width && $width < $min_width) {
+ if ( $DEBUG > 2 ) {
+ print STDERR "skip narrow image $_ ($width x $height)\n";
+ }
+ next;
+ }
+
+ if ( $height && $height < $min_height) {
+ if ( $DEBUG > 2 ) {
+ print STDERR "skip short image $_ ($width x $height)\n";
+ }
+ next;
+ }
+
+ my $url = $_;
+
+ if ( $unique_urls{$url} ) {
+ if ( $DEBUG > 2 ) { print STDERR "skip duplicate image $_\n"; }
+ next;
+ }
+
+ if ( $DEBUG > 2 ) {
+ print STDERR "got $url" .
+ ($width && $height ? " (${width}x${height})" : "") .
+ ($was_inline ? " (inline)" : "") . "\n";
+ }
+
+ $urls[++$#urls] = $url;
+ $unique_urls{$url}++;
+
+ # pointers to images are preferable to inlined images
+ if ( ! $was_inline ) {
+ $urls[++$#urls] = $url;
+ }
+ }
+ }
+
+ if ( $#urls == 0 ) {
+ if ( $DEBUG > 2 ) {
+ print STDERR "no images on $base\n";
+ }
+ return undef;
+ }
+
+ return undef if ( $#urls < 1 );
+
+ # pick a random element of the table
+ my $i = ((rand() * 99999) % $#urls);
+
+ # if the page has several images on it, prefer the later ones most of
+ # the time.
+ my $fudge = 4;
+ if ($#urls > ($fudge * 2) && $i <= $fudge && ((rand() < 0.9))) {
+ if ( $DEBUG > 2 ) {
+ print STDERR "skipping first $fudge of $#urls images.\n";
+ }
+ $i += ($fudge - $i);
+ }
+
+ my $url = $urls[$i];
+
+ if ( $DEBUG > 2 ) {
+ print STDERR "picked $url\n";
+ }
+
+ return $url;
+}
+
+
+# Using the URL-randomizer, picks a random image on a random page, and
+# returns two URLs: the page containing the image, and the image.
+# Returns undef if nothing found this time.
+#
+sub pick_from_url_randomizer {
+
+ if ( $DEBUG > 2 ) {
+ print STDERR "\n\npicking from $random_redirector...\n\n";
+ }
+
+ my ( $base, $body ) = get_document $random_redirector;
+
+ return if (!$base || !$body);
+ my $img = pick_image_from_body ($base, $body);
+
+ if ($img) {
+ return ($base, $img);
+ } else {
+ return undef;
+ }
+}
+
+
+sub random_word {
+
+ my $word = 0;
+ if (open (IN, "<$wordlist")) {
+ my $size = (stat(IN))[7];
+ my $pos = rand $size;
+ if (seek (IN, $pos, 0)) {
+ $word = <IN>; # toss partial line
+ $word = <IN>; # keep next line
+ }
+ close (IN);
+ }
+
+ return 0 if (!$word);
+
+ $word =~ s/^[ \t\n\r]+//;
+ $word =~ s/[ \t\n\r]+$//;
+ $word =~ s/ly$//;
+ $word =~ s/ies$/y/;
+ $word =~ s/ally$/al/;
+
+ return $word;
+}
+
+
+
+# Using the image-randomizer, picks a random image on a random page, and
+# returns two URLs: the page containing the image, and the image.
+# Returns undef if nothing found this time.
+#
+sub pick_from_image_randomizer {
+
+ my $words = random_word;
+ $words .= "%20" . random_word;
+ $words .= "%20" . random_word;
+
+ my $search_url = $image_randomizer . $words;
+
+ if ( $DEBUG > 2 ) {
+ print STDERR "\n\npicking from $search_url\n";
+ }
+
+ my ( $base, $body ) = get_document $search_url;
+
+ return if (! $body);
+
+
+ my @subpages;
+ my $skipped = 0;
+
+ $_ = $body;
+ s/(<A )/\n$1/gi;
+ foreach (split(/\n/)) {
+
+ if ( m@<A HREF=([^>]+)><IMG SRC=http://image\.altavista\.com@i ) {
+
+ my $u = $1;
+ if (m/^"(.*)"$/) { $u = $1; }
+
+ if (m@\.corbis\.com/@) {
+ $skipped = 1;
+ if ( $DEBUG > 2 ) {
+ print STDERR "skipping corbis URL: $_\n";
+ }
+ next;
+ } elsif ( $DEBUG > 2 ) {
+ print STDERR "sub-page: $1\n";
+ }
+
+ $subpages[++$#subpages] = $u;
+ }
+ }
+
+ if ( $#subpages <= 0 ) {
+ if (!$skipped) {
+ print STDERR "Found nothing on $base\n";
+ }
+ return undef;
+ }
+
+ # pick a random element of the table
+ my $i = ((rand() * 99999) % $#subpages);
+ my $subpage = $subpages[$i];
+
+ if ( $DEBUG > 2 ) {
+ print STDERR "picked page $subpage\n";
+ }
+
+
+
+ my ( $base2, $body2 ) = get_document $subpage;
+
+ return undef if (!$base2 || !body2);
+
+ my $img = pick_image_from_body ($base2, $body2);
+
+ if ($img) {
+ return ($base2, $img);
+ } else {
+ return undef;
+ }
+}
+
+
+# Picks a random image on a random page, and returns two URLs:
+# the page containing the image, and the image.
+# Returns undef if nothing found this time.
+# Uses the url-randomizer 1 time in 5, else the image randomizer.
+#
+sub pick_image {
+ if (int(rand 5) == 0) {
+ return pick_from_url_randomizer;
+ } else {
+ return pick_from_image_randomizer;
+ }
+}
+
+
+# returns the full path of the named program, or undef.
+#
+sub which {
+ my ($prog) = @_;
+ foreach (split (/:/, $ENV{PATH})) {
+ if (-x "$_/$prog") {
+ return $prog;
+ }
+ }
+ return undef;
+}
+
+
+
+#################################
+#
+# running as a CGI
+#
+#################################
+
+
+sub do_html_output {
+
+ $| = 1;
+
+ if ( $progname =~ m/nph-/o ) {
+ print "HTTP/1.0 200 OK\n";
+ print "Content-type: text/html\n";
+ print "\n";
+ }
+
+ print "<TITLE>random images</TITLE>\n";
+ print "<BODY BGCOLOR=\"#FFFFFF\" TEXT=\"#000000\"";
+ print " LINK=\"#0000EE\" VLINK=\"#551A8B\" ALINK=\"#FF0000\">\n";
+ print "<H1 ALIGN=CENTER>random images</H1><P>\n";
+ print "<P><BLOCKQUOTE><BLOCKQUOTE>\n";
+ print "These images have been selected randomly from the web,\n";
+ print "by using both <A HREF=\"$random_redirector\">\n";
+ print "$random_redirector</A> and <A HREF=\"$image_randomizer_a\">\n";
+ print "$image_randomizer_a</A> as a source of URLs from which\n";
+ print "images are extracted.\n";
+ print "<P>\n";
+ print "Note: if you leave this running\n";
+ print "long enough, your browser will undoubtedly run out of memory\n";
+ print "and crash...\n";
+ print "</BLOCKQUOTE></BLOCKQUOTE><P><HR><P ALIGN=CENTER>\n";
+
+ do {
+ my ($base, $img) = pick_image;
+ if ($img) {
+ if ($DEBUG > 0) {
+ print STDERR "$img\n";
+ }
+ print "<A HREF=\"$base\">";
+ print "<IMG ALIGN=MIDDLE BORDER=0 SRC=\"$img\"></A>\n";
+ }
+
+ sleep $delay;
+
+ } while (1);
+}
+
+
+#################################
+#
+# running as an xscreensaver mode
+#
+#################################
+
+
+my $image = ($ENV{TMPDIR} ? $ENV{TMPDIR} : "/tmp") . "/webcollage." . $$;
+my $tmp = $image . "-1";
+my $tmp2 = $image . "-2";
+my $tmp3 = $image . "-3";
+
+sub x_cleanup {
+ if ($DEBUG > 0) { print STDERR "caught signal\n"; }
+ unlink $image, $tmp, $tmp2, $tmp3;
+ exit 1;
+}
+
+my $screen_width = undef;
+my $screen_height = undef;
+
+sub do_x_output {
+
+ my $win_cmd = $ppm_to_root_window_cmd;
+ $win_cmd =~ s/^([^ \t\r\n]+).*$/$1/;
+
+ # make sure the various programs we execute exist, right up front.
+ foreach ("ppmmake", "giftopnm", "djpeg", "pnmpaste", $win_cmd) {
+ which ($_) || die "$progname: $_ not found on \$PATH.\n";
+ }
+
+ $SIG{HUP} = \&x_cleanup;
+ $SIG{INT} = \&x_cleanup;
+ $SIG{QUIT} = \&x_cleanup;
+ $SIG{ABRT} = \&x_cleanup;
+ $SIG{KILL} = \&x_cleanup;
+ $SIG{TERM} = \&x_cleanup;
+
+ # Need this so that if giftopnm dies, we don't die.
+ $SIG{PIPE} = 'IGNORE';
+
+ if (!$screen_width || !$screen_height) {
+ $_ = `xdpyinfo`;
+ ($screen_width, $screen_height) = m/dimensions: *([0-9]+)x([0-9]+) /;
+ }
+
+ my $bgcolor = "#000000";
+ my $bgimage = undef;
+
+ if ($background) {
+ if ($background =~ m/^\#[0-9a-f]+$/i) {
+ $bgcolor = $background;
+ } elsif (-r $background) {
+ $bgimage = $background;
+
+ } elsif (! $background =~ m@^[-a-z0-9 ]+$@i) {
+ print STDERR "not a color or readable file: $background\n";
+ exit 1;
+ } else {
+ # default to assuming it's a color
+ $bgcolor = $background;
+ }
+ }
+
+ # Create the sold-colored base image.
+ #
+ $_ = "ppmmake '$bgcolor' $screen_width $screen_height";
+ if ($DEBUG > 1) {
+ print STDERR "creating base image: $_\n";
+ }
+ system "$_ > $image";
+
+ # Paste the default background image in the middle of it.
+ #
+ if ($bgimage) {
+ my ($iw, $ih);
+ if (open(IMG, "<$bgimage")) {
+ $_ = <IMG>;
+ $_ = <IMG>;
+ ($iw, $ih) = m/^([0-9]+) ([0-9]+)$/;
+ close (IMG);
+ }
+ my $x = int (($screen_width - $iw) / 2);
+ my $y = int (($screen_height - $ih) / 2);
+ if ($DEBUG > 1) {
+ print STDERR "pasting $bgimage into base image at $x, $y\n";
+ }
+ system "pnmpaste $bgimage $x $y $image > $tmp2 && mv $tmp2 $image";
+ }
+
+
+ do {
+ my ($base, $img) = pick_image;
+
+ my ($headers, $body);
+ if ($img) {
+ ($headers, $body) = get_document ($img);
+ }
+
+ if ($body) {
+
+ if ($DEBUG > 0) {
+ print STDERR "got $img (" . length($body) . ")\n";
+ }
+
+ my $cmd;
+ if ($img =~ m/\.gif/i) {
+ $cmd = "giftopnm";
+ } else {
+ $cmd = "djpeg";
+ }
+
+ if ($DEBUG == 0) {
+ $cmd .= " 2>/dev/null";
+ }
+
+ if (open(PIPE, "| $cmd > $tmp")) {
+ print PIPE $body;
+ close PIPE;
+
+ if ($DEBUG > 1) {
+ print STDERR "created $tmp ($cmd)\n";
+ }
+ }
+
+ if (-s $tmp) {
+
+ if ($filter_cmd) {
+ if ($DEBUG > 1) {
+ print STDERR "running $filter_cmd\n";
+ }
+ system "($filter_cmd) < $tmp > $tmp3 && mv $tmp3 $tmp";
+ }
+
+ my ($iw, $ih);
+ if (open(IMG, "<$tmp")) {
+ $_ = <IMG>;
+ $_ = <IMG>;
+ ($iw, $ih) = m/^([0-9]+) ([0-9]+)$/;
+ close (IMG);
+ }
+
+ if ($iw && $ih) {
+
+ if ($DEBUG > 1) {
+ print STDERR "image size is $iw x $ih\n";
+ }
+
+ if ($iw > $screen_width || $ih > $screen_height) {
+ while ($iw > $screen_width ||
+ $ih > $screen_height) {
+ $iw = int($iw / 2);
+ $ih = int($ih / 2);
+ }
+ if ($DEBUG > 1) {
+ print STDERR "scaling to $iw x $ih\n";
+ }
+ system "pnmscale -xysize $iw $ih $tmp > $tmp2" .
+ " 2>/dev/null && mv $tmp2 $tmp";
+ }
+
+ my $x = int (rand() * ($screen_width - $iw));
+ my $y = int (rand() * ($screen_height - $ih));
+
+ if ($DEBUG > 1) {
+ print STDERR "pasting at $x, $y in $image\n";
+ }
+
+ system "pnmpaste $tmp $x $y $image > $tmp2 " .
+ "&& mv $tmp2 $image";
+
+
+ my $target = $image;
+ if ($post_filter_cmd) {
+ if ($DEBUG > 1) {
+ print STDERR "running $post_filter_cmd\n";
+ }
+ system "($post_filter_cmd) < $image > $tmp3";
+ $target = $tmp3;
+ }
+
+ if (!$no_output_p) {
+
+ my $tsize = (stat($target))[7];
+ if ($tsize > 200) {
+ $_ = $ppm_to_root_window_cmd;
+ s/%%PPM%%/$target/;
+
+ if ($DEBUG > 1) {
+ print STDERR "running $_\n";
+ }
+ system $_;
+
+ } elsif ($DEBUG > 1) {
+ print STDERR "$target size is $tsize\n";
+ }
+ }
+ }
+ }
+ unlink $tmp, $tmp2, $tmp3;
+ }
+
+ sleep $delay;
+
+ } while (1);
+}
+
+
+#################################
+#
+# decide how to run
+#
+#################################
+
+sub main {
+ srand(time ^ $$);
+
+ my $usage ="WebCollage, Copyright (c) 1999" .
+ " Jamie Zawinski <jwz\@jwz.org>\n" .
+ " http://www.jwz.org/xscreensaver/\n";
+
+ if ( $progname =~ m/\.cgi$/i ) {
+ $#ARGV == -1 || die "$usage\nusage: $progname (no arguments)\n";
+ do_html_output;
+
+ } else {
+ my $root_p = 0;
+
+ while ($_ = $ARGV[0]) {
+ shift @ARGV;
+ if ($_ eq "-display" ||
+ $_ eq "-displ" ||
+ $_ eq "-disp" ||
+ $_ eq "-dis" ||
+ $_ eq "-dpy" ||
+ $_ eq "-d") {
+ $ENV{DISPLAY} = shift @ARGV;
+ } elsif ($_ eq "-root") {
+ $root_p = 1;
+ } elsif ($_ eq "-no-output") {
+ $no_output_p = 1;
+ } elsif ($_ eq "-verbose") {
+ $DEBUG++;
+ } elsif (m/^-v+$/) {
+ $DEBUG += length($_)-1;
+ } elsif ($_ eq "-delay") {
+ $delay = shift @ARGV;
+ } elsif ($_ eq "-timeout") {
+ $http_timeout = shift @ARGV;
+ } elsif ($_ eq "-filter") {
+ $filter_cmd = shift @ARGV;
+ } elsif ($_ eq "-filter2") {
+ $post_filter_cmd = shift @ARGV;
+ } elsif ($_ eq "-background" || $_ eq "-bg") {
+ $background = shift @ARGV;
+ } elsif ($_ eq "-size") {
+ $_ = shift @ARGV;
+ if (m@^([0-9]+)x([0-9]+)$@) {
+ $screen_width = $1;
+ $screen_height = $2;
+ } else {
+ die "$progname: argument to \"-size\" must be" .
+ " of the form \"640x400\"\n";
+ }
+ } else {
+ die "$usage\nusage: $progname [-root]" .
+ " [-display dpy] [-root] [-verbose] [-timeout secs]\n" .
+ "\t\t [-delay secs] [-filter cmd] [-filter2 cmd]\n";
+ }
+ }
+ if (!$root_p && !$no_output_p) {
+ die "$progname: the -root argument is manditory (for now.)\n";
+ }
+
+ if (!$no_output_p && !$ENV{DISPLAY}) {
+ die "$progname: \$DISPLAY is not set.\n";
+ }
+
+ do_x_output;
+ }
+}
+
+main;
+exit 0;
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ attraction - interactions of opposing forces
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ a\bat\btt\btr\bra\bac\bct\bti\bio\bon\bn [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-points _\bi_\bn_\bt] [-threshold _\bi_\bn_\bt]
+ [-mode balls | lines | polygons | splines | filled-splines
+ | tails ] [-size _\bi_\bn_\bt] [-segments _\bi_\bn_\bt] [-delay _\bu_\bs_\be_\bc_\bs]
+ [-color-shift _\bi_\bn_\bt] [-radius _\bi_\bn_\bt] [-vx _\bi_\bn_\bt] [-vy _\bi_\bn_\bt]
+ [-glow] [-noglow] [-orbit] [-viscosity _\bf_\bl_\bo_\ba_\bt] [-mouse]
+ [-no-mouse] [-mouse-size]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\ba_\bt_\bt_\br_\ba_\bc_\bt_\bi_\bo_\bn program has several visually different
+ modes of operation, all of which are based on the interac-
+ tions of a set of control points which attract each other
+ up to a certain distance, and then begin to repel each
+ other. The attraction/repulsion is proportional to the
+ distance between any two particles.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\ba_\bt_\bt_\br_\ba_\bc_\bt_\bi_\bo_\bn accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-p\bpo\boi\bin\bnt\bts\bs i\bin\bnt\bte\beg\bge\ber\br
+ How many control points should be used, or 0 to
+ select the number randomly. Default 0. Between 3
+ and 15 works best.
+
+ -\b-t\bth\bhr\bre\bes\bsh\bho\bol\bld\bd i\bin\bnt\bte\beg\bge\ber\br
+ The distance (in pixels) from each particle at
+ which the attractive force becomes repulsive.
+ Default 100.
+
+ -\b-m\bmo\bod\bde\be b\bba\bal\bll\bls\bs |\b| l\bli\bin\bne\bes\bs |\b| p\bpo\bol\bly\byg\bgo\bon\bns\bs |\b| t\bta\bai\bil\bls\bs |\b| s\bsp\bpl\bli\bin\bne\bes\bs |\b| f\bfi\bil\bll\ble\bed\bd-\b-
+ s\bsp\bpl\bli\bin\bne\bes\bs
+ In _\bb_\ba_\bl_\bl_\bs mode (the default) the control points are
+ drawn as filled circles. The larger the circle,
+
+
+
+X Version 11 14-Jun-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ the more massive the particle.
+
+ In _\bl_\bi_\bn_\be_\bs mode, the control points are connected by
+ straight lines; the effect is something like _\bq_\bi_\bx.
+
+ In _\bp_\bo_\bl_\by_\bg_\bo_\bn_\bs mode, the control points are connected
+ by straight lines, and filled in. This is most
+ interesting in color.
+
+ In _\bs_\bp_\bl_\bi_\bn_\be_\bs mode, a closed spline is interpolated
+ from the control points.
+
+ In _\bf_\bi_\bl_\bl_\be_\bd_\b-_\bs_\bp_\bl_\bi_\bn_\be_\bs mode, the splines are filled in
+ instead of being outlines. This is most interest-
+ ing in color.
+
+ In _\bt_\ba_\bi_\bl_\bs mode, the path which each particle fol-
+ lows is indicated by a worm-like trail, whose
+ length is controlled by the _\bs_\be_\bg_\bm_\be_\bn_\bt_\bs parameter.
+
+ -\b-s\bsi\biz\bze\be i\bin\bnt\bte\beg\bge\ber\br
+ The size of the balls in pixels, or 0, meaning to
+ select the sizes randomly (the default.) If this
+ is specified, then all balls will be the same
+ size. This option has an effect in all modes,
+ since the ``size'' of the balls controls their
+ mass.
+
+ -\b-s\bse\beg\bgm\bme\ben\bnt\bts\bs i\bin\bnt\bte\beg\bge\ber\br
+ If in _\bl_\bi_\bn_\be_\bs or _\bp_\bo_\bl_\by_\bg_\bo_\bn_\bs mode, how many sets of
+ line segments or polygons should be drawn. Default
+ 100. This has no effect in _\bb_\ba_\bl_\bl_\bs mode. If _\bs_\be_\bg_\b-
+ _\bm_\be_\bn_\bt_\bs is 0, then no segments will ever be erased
+ (this is only useful in color.)
+
+ -\b-d\bde\bel\bla\bay\by m\bmi\bic\bcr\bro\bos\bse\bec\bco\bon\bnd\bds\bs
+ How much of a delay should be introduced between
+ steps of the animation. Default 10000, or about
+ 0.01 seconds.
+
+ -\b-c\bco\bol\blo\bor\br-\b-s\bsh\bhi\bif\bft\bt i\bin\bnt\bt
+ If on a color display, the color of the line seg-
+ ments or polygons will cycle through the color
+ map. This specifies how many lines will be drawn
+ before a new color is chosen. (When a small num-
+ ber of colors are available, increasing this value
+ will yield smoother transitions.) Default 3.
+ This has no effect in _\bb_\ba_\bl_\bl_\bs mode.
+
+ -\b-r\bra\bad\bdi\biu\bus\bs The size in pixels of the circle on which the
+ points are initially positioned. The default is
+ slightly smaller than the size of the window.
+
+ -\b-g\bgl\blo\bow\bw This is consulted only in _\bb_\ba_\bl_\bl_\bs mode. If this is
+
+
+
+X Version 11 14-Jun-97 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ specified, then the saturation of the colors of
+ the points will vary according to their current
+ acceleration. This has the effect that the balls
+ flare brighter when they are reacting to each
+ other most strongly.
+
+ In _\bg_\bl_\bo_\bw mode, all of the balls will be drawn the
+ same (random) color, modulo the saturation shifts.
+ In non-glow mode, the balls will each be drawn in
+ a random color that doesn't change.
+
+ -\b-n\bno\bog\bgl\blo\bow\bw Don't do ``glowing.'' This is the default.
+
+ -\b-v\bvx\bx p\bpi\bix\bxe\bel\bls\bs
+
+ -\b-v\bvy\by p\bpi\bix\bxe\bel\bls\bs
+ Initial velocity of the balls. This has no effect
+ in -\b-o\bor\brb\bbi\bit\bt mode.
+
+ -\b-o\bor\brb\bbi\bit\bt Make the initial force on each ball be tangential
+ to the circle on which they are initially placed,
+ with the right velocity to hold them in orbit
+ about each other. After a while, roundoff errors
+ will cause the orbit to decay.
+
+ -\b-v\bvm\bmu\bul\blt\bt f\bfl\blo\boa\bat\bt
+ In orbit mode, the initial velocity of the balls
+ is multiplied by this; a number less than 1 will
+ make the balls pull closer together, and a larger
+ number will make them move apart. The default is
+ 0.9, meaning a slight inward pull.
+
+ -\b-v\bvi\bis\bsc\bco\bos\bsi\bit\bty\by f\bfl\blo\boa\bat\bt
+ This sets the viscosity of the hypothetical fluid
+ through which the control points move; the default
+ is 1, meaning no resistance. Values higher than 1
+ aren't interesting; lower values cause less
+ motion.
+
+ One interesting thing to try is
+
+ attraction -viscosity 0.8 -points 75 \
+ -mouse -geometry =500x500
+
+ Give it a few seconds to settle down into a stable
+ clump, and then move the mouse through it to make
+ "waves".
+
+ -\b-m\bmo\bou\bus\bse\be This will cause the mouse to be considered a con-
+ trol point; it will not be drawn, but it will
+ influence the other points, so you can wave the
+ mouse and influence the images being created.
+
+
+
+
+
+X Version 11 14-Jun-97 3
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-n\bno\bo-\b-m\bmo\bou\bus\bse\be
+ Turns off -\b-m\bmo\bou\bus\bse\be.
+
+ -\b-m\bmo\bou\bus\bse\be-\b-s\bsi\biz\bze\be i\bin\bnt\bte\beg\bge\ber\br
+ In -\b-m\bmo\bou\bus\bse\be mode, this sets the mass of the mouse
+ (analagously to the -\b-s\bsi\biz\bze\be parameter.)
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992, 1993, 1997 by Jamie Zawinski. Permis-
+ sion to use, copy, modify, distribute, and sell this soft-
+ ware and its documentation for any purpose is hereby
+ granted without fee, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation. No representations are made about the
+ suitability of this software for any purpose. It is pro-
+ vided "as is" without express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+ Viscosity and mouse support by Philip Edward Cutone, III.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 14-Jun-97 4
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ blitspin - rotate a bitmap in an interesting way
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ b\bbl\bli\bit\bts\bsp\bpi\bin\bn [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-bitmap _\bf_\bi_\bl_\be_\bn_\ba_\bm_\be] [-delay
+ _\bu_\bs_\be_\bc_\bs] [-delay2 _\bu_\bs_\be_\bc_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bb_\bl_\bi_\bt_\bs_\bp_\bi_\bn program repeatedly rotates a bitmap by 90
+ degrees by using logical operations: the bitmap is divided
+ into quadrants, and the quadrants are shifted clockwise.
+ Then the same thing is done again with progressively
+ smaller quadrants, except that all sub-quadrants of a
+ given size are rotated in parallel. So this takes
+ O\bO(\b(1\b16\b6*\b*l\blo\bog\bg2\b2(\b(N\bN)\b))\b) blits of size NxN, with the limitation that
+ the image must be square, and the size must be a power of
+ 2.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bb_\bl_\bi_\bt_\bs_\bp_\bi_\bn accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-b\bbi\bit\btm\bma\bap\bp _\bf_\bi_\bl_\be_\bn_\ba_\bm_\be
+ The file name of a bitmap to rotate. It need not
+ be square: it will be padded with the background
+ color. If unspecified or the string _\b(_\bd_\be_\bf_\ba_\bu_\bl_\bt_\b), a
+ builtin bitmap is used.
+
+ If support for the _\bX_\bP_\bM library was enabled at com-
+ pile-time, the specified file may be in _\bX_\bP_\bM format
+ as well as _\bX_\bB_\bM, and thus may be a color image.
+
+ The *\b*b\bbi\bit\btm\bma\bap\bpF\bFi\bil\ble\beP\bPa\bat\bth\bh resource will be searched if
+ the bitmap name is not a fully-qualified pathname.
+
+ -\b-g\bgr\bra\bab\bb-\b-s\bsc\bcr\bre\bee\ben\bn
+ If this option is specified, then the image which
+
+
+
+X Version 11 24-Nov-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ is spun will be grabbed from the portion of the
+ screen underlying the blitspin window. (Or, it
+ may come from an external video source: see
+ below.)
+
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to delay between steps of the rotation
+ process, in microseconds. Default is 500000, one-
+ half second.
+
+
+ -\b-d\bde\bel\bla\bay\by2\b2 _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to delay between each 90-degree rotation,
+ in microseconds. Default is 500000, one-half sec-
+ ond. D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display
+ number.
+
+R\bRE\bES\bSO\bOU\bUR\bRC\bCE\bES\bS
+ On some systems (currently, only SGIs), this program can,
+ instead of grabbing a desktop image, grab a frame of video
+ from an external camera and manipulate that instead. The
+ following resources control that.
+
+
+ g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by (Float)
+ What portion of the time to grab video rather than
+ a screen image, between 0.0 and 1.0. Defaults to
+ 0.5, or half the time.
+
+ v\bvi\bid\bde\beo\boD\bDe\bev\bvi\bic\bce\be (Integer)
+ The number of the default video input device to
+ check first. If unspecified, the default camera
+ (from videopanel(1)) will be checked first. After
+ that, all other available video input devices will
+ be checked in order.
+
+ The first one which produces a non-black image
+ will be used. If all images are black, the others
+ will be re-checked a few times before giving up
+ and falling back to simply grabbing a desktop
+ image (but note that this takes a few seconds, so
+ if you don't actually have any video sources
+ hooked up, you should consider turning off video
+ grabbing by setting g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by to 0.0.)
+
+ v\bvi\bid\bde\beo\boG\bGa\bai\bin\bn (Float)
+ The amount by which to brighten the grabbed image.
+ This defaults to 2.2.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT to get the name of a resource file that over-
+ rides the global resources stored in the RESOURCE_MANAGER
+ property.
+
+
+
+X Version 11 24-Nov-97 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992, 1993, 1997 by Jamie Zawinski. Permis-
+ sion to use, copy, modify, distribute, and sell this soft-
+ ware and its documentation for any purpose is hereby
+ granted without fee, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation. No representations are made about the
+ suitability of this software for any purpose. It is pro-
+ vided "as is" without express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 17-aug-92.
+
+ Based on SmallTalk code which appeared in the August 1981
+ issue of Byte magazine.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 24-Nov-97 3
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ bouboule - draws spinning 3D blobs
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ b\bbo\bou\bub\bbo\bou\bul\ble\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay
+ _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs] [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br] [-3d]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bb_\bo_\bu_\bb_\bo_\bu_\bl_\be program draws spinning 3D blobs.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bb_\bo_\bu_\bb_\bo_\bu_\bl_\be accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors used cycle through the
+ hue, making N stops around the color wheel.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-3\b3d\bd Do red/blue 3d separations (for 3d glasses.)
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+
+
+
+X Version 11 15-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1996 by Jeremie Petit.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jeremie Petit <jpetit@essi.fr>, 1996.
+
+ 3D support by Henrik Theiling <theiling@coli-uni-sb.de>,
+ 04-Sep-96.
+
+ VMS support by Jouk Jansen <joukj@alpha.chem.uva.nl>,
+ 01-Feb-96.
+
+ TrueColor support by David Bagley <bagleyd@bigfoot.com>,
+ 01-Feb-96.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 15-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 15-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ braid - draws random color-cycling braids around a circle
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ b\bbr\bra\bai\bid\bd [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bb_\br_\ba_\bi_\bd program draws random color-cycling braids around
+ a circle.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bb_\br_\ba_\bi_\bd accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors used cycle through the
+ hue, making N stops around the color wheel.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1995 by John Neil.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ John Neil <neil@math.idbsu.edu>, 29-Aug-95.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ bsod - Blue Screen of Death emulator
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ b\bbs\bso\bod\bd [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-delay _\bs_\be_\bc_\bo_\bn_\bd_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bb_\bs_\bo_\bd program is the finest in personal computer emula-
+ tion.
+
+ _\bb_\bs_\bo_\bd steps through a set of screens, each one a recreation
+ of a different failure mode of an operating system. Sys-
+ tems depicted include Microsoft's Windows 95 and Windows
+ NT, Commodore-Amiga's AmigaDOS 1.3, SPARC Linux, SCO UNIX,
+ the Apple Macintosh (both the MacsBug debugger and the
+ rarer "Sad Mac"), and the Atari ST.
+
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bb_\bs_\bo_\bd accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bd_\be_\bl_\ba_\by
+ The delay between displaying one crash and
+ another.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+X\bX R\bRE\bES\bSO\bOU\bUR\bRC\bCE\bES\bS
+ Notable X resources supported include the following, which
+ control which hacks are displayed and which aren't.
+
+
+
+X Version 11 28-Oct-98 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ d\bdo\boW\bWi\bin\bnd\bdo\bow\bws\bs, d\bdo\boN\bNT\bT, d\bdo\boA\bAm\bmi\big\bga\ba, d\bdo\boM\bMa\bac\bc, d\bdo\boM\bMa\bac\bcs\bsB\bBu\bug\bg, d\bdo\boS\bSC\bCO\bO,
+ d\bdo\boA\bAt\bta\bar\bri\bi, and d\bdo\boS\bSp\bpa\bar\brc\bcL\bLi\bin\bnu\bux\bx. Each of these is a Boolean
+ resource, they all default to true, except for doSpar-
+ cLinux and doAtari, which are turned off by default,
+ because they're really not all that interesting looking
+ unless you're a fan of those systems. There aren't com-
+ mand-line options for these, so to change them, you'll
+ need to add entries to your .Xdefaults file, or use the
+ -xrm option. For example, to tell bsod not to show the NT
+ crash:
+
+ bsod -xrm '*doNT: false'
+
+
+B\bBU\bUG\bGS\bS
+ Unlike the systems that the images are borrowed from, _\bb_\bs_\bo_\bd
+ does not require a reboot after running.
+
+ _\bb_\bs_\bo_\bd should also emulate more systems, but systems with
+ interesting crash graphics are not as common as one might
+ hope.
+
+ One I'd really like to see is a Unix system getting a ker-
+ nel panic, rebooting, and running f\bfs\bsc\bck\bk(8).
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), h\bht\btt\btp\bp:\b:/\b//\b/w\bww\bww\bw.\b.m\bmi\bic\bcr\bro\bos\bso\bof\bft\bt.\b.c\bco\bom\bm/\b/,
+ h\bht\btt\btp\bp:\b:/\b//\b/w\bww\bww\bw.\b.a\bap\bpp\bpl\ble\be.\b.c\bco\bom\bm/\b/, and h\bht\btt\btp\bp:\b:/\b//\b/w\bww\bww\bw.\b.s\bsc\bco\bo.\b.c\bco\bom\bm/\b/,
+ h\bht\btt\btp\bp:\b:/\b//\b/w\bww\bww\bw.\b.k\bke\ber\brn\bne\bel\bl.\b.o\bor\brg\bg/\b/, and h\bht\btt\btp\bp:\b:/\b//\b/w\bww\bww\bw.\b.a\bam\bmi\big\bga\ba.\b.d\bde\be/\b/.
+
+T\bTR\bRA\bAD\bDE\bEM\bMA\bAR\bRK\bKS\bS
+ Microsoft Windows, Microsoft Windows 95, and Microsoft
+ Windows NT are all registered trademarks of Microsoft Cor-
+ poration. Apple Macintosh is a registered trademark of
+ Apple Computer. Amiga is a registered trademark of Amiga
+ International, Inc. Atari ST is probably a trademark,
+ too, but it's hard to tell who owns it. Linux is a regis-
+ tered trademark of Linus Torvalds, but it isn't his fault.
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1998 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty. No animals were harmed dur-
+ ing the testing of these simulations. Always mount a
+ scratch monkey.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Concept cribbed from Stephen Martin <smartin@mks.com>.
+
+
+
+X Version 11 28-Oct-98 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ This version is by Jamie Zawinski <jwz@jwz.org>.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 28-Oct-98 3
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ bubbles - frying pan / soft drink simulation
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ b\bbu\bub\bbb\bbl\ble\bes\bs [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-simple] [-broken] [-3D] [-file file-
+ name] [-directory directoryname]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ _\bB_\bu_\bb_\bb_\bl_\be_\bs sprays lots of little random bubbles all over the
+ window which then grow until they reach their maximum size
+ and go pop. The inspiration for this was watching little
+ globules of oil on the bottom of a frying pan and it also
+ looks a little like bubbles in fizzy soft drink. The
+ default mode uses fancy ray-traced bubbles but there is
+ also a mode which just draws circles in case the default
+ mode is too taxing on your hardware.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ Depending on how your _\bb_\bu_\bb_\bb_\bl_\be_\bs was compiled, it accepts the
+ following options:
+
+ -\b-f\bfo\bor\bre\beg\bgr\bro\bou\bun\bnd\bd
+ Colour of circles if _\b-_\bs_\bi_\bm_\bp_\bl_\be mode is selected.
+
+ -\b-b\bba\bac\bck\bkg\bgr\bro\bou\bun\bnd\bd
+ Colour of window background.
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by m\bmi\bic\bcr\bro\bos\bse\bec\bco\bon\bnd\bds\bs
+ How much of a delay should be introduced between
+ steps of the animation. Default 1, or about 1
+ microsecond. Actually, this is the delay between
+ each group of 15 new bubbles since such a delay
+ between each step results in a very slow animation
+ rate.
+
+
+
+
+
+X Version 11 14-Dec-95 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-n\bno\bod\bde\bel\bla\bay\by
+ Same as _\b-_\bd_\be_\bl_\ba_\by _\b0.
+
+ -\b-s\bsi\bim\bmp\bpl\ble\be Don't use the default fancy pixmap bubbles. Just
+ draw circles instead. This may give more bearable
+ performance if your hardware wasn't made for this
+ sort of thing.
+
+ -\b-b\bbr\bro\bok\bke\ben\bn Don't hide bubbles when they pop. This was a bug
+ during development but the results were actually
+ quite attractive. (This option is only available
+ if you have the XPM library available and the
+ imake generated Makefile has defined HAVE_XPM).
+
+ -\b-3\b3D\bD Normally, the simulation is done completely in two
+ dimensions. When a bubble swallows up another
+ bubble, the areas of each are added to get the
+ area of the resulting bubble. This option changes
+ the algorithm to instead add volume (imagining
+ each to be a sphere in 3D space). The whole thing
+ looks more realistic but I find it attracts atten-
+ tion to the flickering of each bubble as they are
+ move and are redrawn. Your mileage may vary.
+
+ -\b-f\bfi\bil\ble\be f\bfi\bil\ble\ben\bna\bam\bme\be
+ Use the pixmap definitions in the given file,
+ instead of the default (if one is compiled in).
+ This is ignored if _\b-_\bs_\bi_\bm_\bp_\bl_\be is specified. If the
+ file is compressed (either with compress or gzip),
+ it is decompressed before use. (This option only
+ works if you have XPM compiled into your binary
+ and you have compiled with BUBBLES_IO set in bub-
+ bles.h. This is n\bno\bot\bt the default).
+
+ -\b-d\bdi\bir\bre\bec\bct\bto\bor\bry\by d\bdi\bir\bre\bec\bct\bto\bor\bry\byn\bna\bam\bme\be
+ Similar to _\b-_\bf_\bi_\bl_\be except the file is taken randomly
+ from the contents of the specified directory.
+ (Again, this option is only available if you have
+ XPM and BUBBLES_IO was set when compiling. See
+ above).
+
+ -\b-q\bqu\bui\bie\bet\bt Don't print messages explaining why one or several
+ command line options were ignored. This is dis-
+ abled by default.
+
+N\bNO\bOT\bTE\bES\bS
+ If you find the pace of things too slow, remember that
+ there is a delay even though you specify no _\b-_\bd_\be_\bl_\ba_\by option.
+ Try using _\b-_\bn_\bo_\bd_\be_\bl_\ba_\by although beware of the effects of irri-
+ tation of other users if you're on a shared system as you
+ bleed their CPU time away.
+
+ Some tools to assist in creation of new bubbles are
+ included in the source distribution. These can either be
+
+
+
+X Version 11 14-Dec-95 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ loaded with the _\b-_\bf_\bi_\bl_\be or _\b-_\bd_\bi_\br_\be_\bc_\bt_\bo_\br_\by options (if available)
+ or they can be used in place of the distributed default
+ bubble (bubble_default.c). You might like to copy these
+ scripts to a permanent location and use them. Read bub-
+ bles.README.
+
+ Rendered bubbles are not supported on monochrome displays.
+ I'm not convinced that small bubbles, even dithered prop-
+ erly are going to look like anything more than a jumble of
+ random dots.
+
+B\bBU\bUG\bGS\bS
+ There is a delay before something appears on the screen
+ when using rendered bubbles. The XPM library seems to
+ take a l\blo\bon\bng\bg time to make pixmaps out of raw data. This
+ can be irritating on slower systems.
+
+ The movement of the bubbles looks jerky if an incomplete
+ set of bubbles is used.
+
+ The hide/display algorithm could do with some work to
+ avoid flickering when _\b-_\bn_\bo_\bd_\be_\bl_\ba_\by is set.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+D\bDI\bIS\bST\bTR\bRI\bIB\bBU\bUT\bTI\bIO\bON\bN P\bPO\bOL\bLI\bIC\bCY\bY
+ This work is Copyright (C) 1995, 1996 by James Macnicol.
+ Distribution is allowed under the terms of the GNU General
+ Public License. Look at the sources for the legalese.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ James Macnicol <J.Macnicol@student.anu.edu.au>.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 14-Dec-95 3
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ critical - Draw a system showing self-organizing critical-
+ ity
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ c\bcr\bri\bit\bti\bic\bca\bal\bl [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-delay _\bs_\be_\bc_\bo_\bn_\bd_\bs] [-random
+ _\bb_\bo_\bo_\bl_\be_\ba_\bn] [-ncolors _\bi_\bn_\bt] [-offset _\bi_\bn_\bt]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bc_\br_\bi_\bt_\bi_\bc_\ba_\bl program displays a self-organizing critical
+ system that gradually emerges from chaos.
+
+ _\bc_\br_\bi_\bt_\bi_\bc_\ba_\bl performs a simulation on a two-dimensional array
+ of integers. The array is initialized to random values.
+ On each iteration, it draws a line to the array position
+ with the greatest value. It then replaces that location
+ and the eight neighboring locations with randomly-selected
+ values.
+
+ The lines are initially random, but over time a chaotic
+ self-organizing system evolves: areas of the screen which
+ happen to have lower values are less likely to be updated
+ to new values, and so the line tends to avoid those areas.
+ Eventually, the histogram of changes approaches the power-
+ law curve typical of such systems.
+
+ The simplest documented self-organizing system is the one-
+ dimensional equivalent of _\bc_\br_\bi_\bt_\bi_\bc_\ba_\bl.
+
+ I heard about this algorithm second-hand: apparently there
+ was an article in _\bS_\bc_\bi_\be_\bn_\bt_\bi_\bf_\bi_\bc _\bA_\bm_\be_\br_\bi_\bc_\ba_\bn describing it some-
+ time in 1997.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bc_\br_\bi_\bt_\bi_\bc_\ba_\bl accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+
+
+
+X Version 11 13-Nov-98 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-d\bde\bel\bla\bay\by _\bu_\bs_\be_\bc_\bs
+ Number of microseconds to wait after drawing each
+ line.
+
+ -\b-r\bra\ban\bnd\bdo\bom\bm _\bb_\bo_\bo_\bl_\be_\ba_\bn
+ Whether to use randomly selected colours rather
+ than a cycle around the colour wheel.
+
+ -\b-o\bof\bff\bfs\bse\bet\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ The maximum random radius increment to use.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be allocated in the color
+ ramp (note that this value interacts with _\bo_\bf_\bf_\bs_\be_\bt.)
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1) x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-c\bco\bom\bmm\bma\ban\bnd\bd(1) x\bxs\bsc\bcr\bre\bee\ben\bn-\b-
+ s\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1998 by Martin Pool.
+
+ Permission to use, copy, modify, distribute, and sell this
+ software and its documentation for any purpose is hereby
+ granted without fee, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation. No representations are made about the
+ suitability of this software for any purpose. It is pro-
+ vided "as is" without express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Martin Pool <mbp@humbug.org.au>, 13-Nov-1998. Based in
+ part on the XScreenSaver code by Jamie Zawinski
+ <jwz@jwz.org>.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 13-Nov-98 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ decayscreen - make a screen meltdown.
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ d\bde\bec\bca\bay\bys\bsc\bcr\bre\bee\ben\bn [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-window]
+ [-root] [-mono] [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-delay _\bu_\bs_\be_\bc_\bs]
+ [-mode _\bm_\bo_\bd_\be]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bd_\be_\bc_\ba_\by_\bs_\bc_\br_\be_\be_\bn program creates a melting effect by ran-
+ domly shifting rectangles around the screen.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bd_\be_\bc_\ba_\by_\bs_\bc_\br_\be_\be_\bn accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ Slow it down.
+
+ -\b-m\bmo\bod\bde\be _\bm_\bo_\bd_\be
+ The direction in which the image should tend to
+ slide. Legal values are _\br_\ba_\bn_\bd_\bo_\bm (meaning pick
+ one), _\bu_\bp, _\bl_\be_\bf_\bt, _\br_\bi_\bg_\bh_\bt, _\bd_\bo_\bw_\bn, _\bu_\bp_\bl_\be_\bf_\bt, _\bd_\bo_\bw_\bn_\bl_\be_\bf_\bt,
+ _\bu_\bp_\br_\bi_\bg_\bh_\bt, _\bd_\bo_\bw_\bn_\br_\bi_\bg_\bh_\bt, _\bs_\bh_\bu_\bf_\bf_\bl_\be (meaning perfer no
+ particular direction), _\bi_\bn (meaning move things
+ toward the center), _\bo_\bu_\bt (meaning move things away
+ from the center), _\bm_\be_\bl_\bt (meaning melt straight
+ downward), and _\bs_\bt_\br_\be_\bt_\bc_\bh (meaning stretch the screen
+ downward).
+
+R\bRE\bES\bSO\bOU\bUR\bRC\bCE\bES\bS
+ On some systems (currently, only SGIs), this program can,
+ instead of grabbing a desktop image, grab a frame of video
+ from an external camera and manipulate that instead. The
+ following resources control that.
+
+
+ g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by (Float)
+ What portion of the time to grab video rather than
+
+
+
+X Version 11 05-Apr-1999 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ a screen image, between 0.0 and 1.0. Defaults to
+ 0.5, or half the time.
+
+ v\bvi\bid\bde\beo\boD\bDe\bev\bvi\bic\bce\be (Integer)
+ The number of the default video input device to
+ check first. If unspecified, the default camera
+ (from videopanel(1)) will be checked first. After
+ that, all other available video input devices will
+ be checked in order.
+
+ The first one which produces a non-black image
+ will be used. If all images are black, the others
+ will be re-checked a few times before giving up
+ and falling back to simply grabbing a desktop
+ image (but note that this takes a few seconds, so
+ if you don't actually have any video sources
+ hooked up, you should consider turning off video
+ grabbing by setting g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by to 0.0.)
+
+ v\bvi\bid\bde\beo\boG\bGa\bai\bin\bn (Float)
+ The amount by which to brighten the grabbed image.
+ This defaults to 2.2.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X(1), xscreensaver(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright 1992 by Vivek Khera. Permission to use, copy,
+ modify, distribute, and sell this software and its docu-
+ mentation for any purpose is hereby granted without fee,
+ provided that the above copyright notice appear in all
+ copies and that both that copyright notice and this per-
+ mission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Vivek Khera <khera@cs.duke.edu>, 05-Aug-93; based on code
+ by David Wald, 1988. Modified by jwz, 28-Nov-97. Modi-
+ fied by Rick Schultz <rick@skapunx.net> 05-Apr-1999.
+
+
+
+
+
+
+
+
+X Version 11 05-Apr-1999 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ deco - draw tacky 70s basement wall panelling
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ d\bde\bec\bco\bo [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-delay _\bs_\be_\bc_\bo_\bn_\bd_\bs] [-max-depth _\bi_\bn_\bt]
+ [-min-width _\bi_\bn_\bt] [-min-height _\bi_\bn_\bt] [-cycle] [-no-cycle]
+ [-cycle-delay]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bd_\be_\bc_\bo program subdivides and colors rectangles ran-
+ domly. It looks kind of like Brady-Bunch-era rec-room
+ wall paneling. (Raven says: "this screensaver is ugly
+ enough to peel paint.")
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bd_\be_\bc_\bo accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to wait before starting over. Default 5
+ seconds.
+
+ -\b-m\bma\bax\bx-\b-d\bde\bep\bpt\bth\bh _\bi_\bn_\bt_\be_\bg_\be_\br
+ How deep to subdivide. Default 12. Default 8.
+
+ -\b-m\bmi\bin\bn-\b-w\bwi\bid\bdt\bth\bh _\bi_\bn_\bt_\be_\bg_\be_\br
+ -\b-m\bmi\bin\bn-\b-h\bhe\bei\big\bgh\bht\bt _\bi_\bn_\bt_\be_\bg_\be_\br The size of the smallest rect-
+ angle to draw. Default 20x20.
+
+ -\b-c\bcy\byc\bcl\ble\be
+
+ -\b-n\bno\bo-\b-c\bcy\byc\bcl\ble\be
+ Whether to do color cycling. Default False.
+
+ -\b-c\bcy\byc\bcl\ble\be-\b-d\bde\bel\bla\bay\by _\bu_\bs_\be_\bc_\bs
+ If color cycling, how often to change the colors.
+ Default 1000000, or 1 second.
+
+
+
+X Version 11 27-Apr-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 26-Apr-97, based on code by
+ Michael D. Bayne <mdb@go2net.com>.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 27-Apr-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ drift - draws drifting recursive fractal cosmic flames
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ d\bdr\bri\bif\bft\bt [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-count _\bi_\bn_\bt_\be_\bg_\be_\br] [-grow] [-no-grow] [-liss] [-no-liss]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bd_\br_\bi_\bf_\bt program draws drifting recursive fractal cosmic
+ flames
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bd_\br_\bi_\bf_\bt accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 200. The colors used cycle through the
+ hue, making N stops around the color wheel.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-g\bgr\bro\bow\bw
+
+ -\b-n\bno\bo-\b-g\bgr\bro\bow\bw
+ Whether fractals should grow; otherwise, they are
+ animated.
+
+
+ -\b-l\bli\bis\bss\bs
+
+ -\b-n\bno\bo-\b-l\bli\bis\bss\bs
+ Whether we should use lissojous figures to get
+ points.
+
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ f\bfl\bla\bam\bme\be(1), X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1991, 1995 by Scott Draves.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Scott Draves <spot@cs.cmu.edu>, 06-Jun-91, 01-Jun-95.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ epicycle - draws a point moving around a circle which
+ moves around a cicle which...
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ e\bep\bpi\bic\bcy\byc\bcl\ble\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-root] [-window]
+ [-mono] [-install] [-noinstall] [-visual _\bv_\bi_\bz] [-colors _\bN]
+ [-foreground _\bn_\ba_\bm_\be] [-color-shift _\bN] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-holdtime _\bs_\be_\bc_\bo_\bn_\bd_\bs] [-linewidth _\bN] [-min_circles _\bN]
+ [-max_circles _\bN] [-min_speed _\bn_\bu_\bm_\bb_\be_\br] [-max_speed _\bn_\bu_\bm_\bb_\be_\br]
+ [-harmonics _\bN] [-timestep _\bn_\bu_\bm_\bb_\be_\br] [-divisor_poisson _\bp_\br_\bo_\bb_\ba_\b-
+ _\bb_\bi_\bl_\bi_\bt_\by] [-size_factor_min _\bn_\bu_\bm_\bb_\be_\br] [-size_factor_max _\bn_\bu_\bm_\b-
+ _\bb_\be_\br]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The epicycle program draws the path traced out by a point
+ on the edge of a circle. That circle rotates around a
+ point on the rim of another circle, and so on, several
+ times. The random curves produced can be simple or com-
+ plex, convex or concave, but they are always closed curves
+ (they never go in indefinitely).
+
+ You can configure both the way the curves are drawn and
+ the way in which the random sequence of circles is gener-
+ ated, either with command-line options or X resources.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ -\b-d\bdi\bis\bsp\bpl\bla\bay\by _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn
+ Specifies which X display we should use (see the
+ section DISPLAY NAMES in X\bX(1) for more information
+ about this option).
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display. If we're on a mono display,
+ we have no choice.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-n\bno\boi\bin\bns\bst\bta\bal\bll\bl
+ Don't install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bz
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual. Possible choices
+ include
+
+ default, best, mono, monochrome, gray, grey,
+
+
+
+X Version 11 27-Apr-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ color, staticgray, staticcolor, truecolor,
+ grayscale, greyscale, pseudocolor, directcolor,
+ _\bn_\bu_\bm_\bb_\be_\br
+
+ If a decimal or hexadecimal number is used,
+ X\bXG\bGe\bet\btV\bVi\bis\bsu\bua\bal\blI\bIn\bnf\bfo\bo(3X) is consulted to obtain the
+ required visual.
+
+ -\b-c\bco\bol\blo\bor\brs\bs _\bN
+ How many colors should be used (if possible). The
+ colors are chosen randomly.
+
+ -\b-f\bfo\bor\bre\beg\bgr\bro\bou\bun\bnd\bd _\bn_\ba_\bm_\be
+ With -\b-m\bmo\bon\bno\bo, this option selects the foreground
+ colour.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ Specifies the delay between drawing successive
+ line segments of the path. If you do not specify
+ -\b-s\bsy\byn\bnc\bc, some X servers may batch up several drawing
+ operations together, producing a less smooth
+ effect. This is more likely to happen in
+ monochrome mode (on monochrome servers or when
+ -\b-m\bmo\bon\bno\bo is specified).
+
+ -\b-h\bho\bol\bld\bdt\bti\bim\bme\be _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ When the figure is complete, _\be_\bp_\bi_\bc_\by_\bc_\bl_\be pauses this
+ number of seconds.
+
+ -\b-l\bli\bin\bne\bew\bwi\bid\bdt\bth\bh _\bN
+ Width in pixels of the body's track. Specifying
+ values greater than one may cause slower drawing.
+ The fastest value is usually zero, meaning one
+ pixel.
+
+ -\b-m\bmi\bin\bn_\b_c\bci\bir\brc\bcl\ble\bes\bs _\bN
+ Smallest number of epicycles in the figure.
+
+ -\b-m\bma\bax\bx_\b_c\bci\bir\brc\bcl\ble\bes\bs _\bN
+ Largest number of epicycles in the figure.
+
+ -\b-m\bmi\bin\bn_\b_s\bsp\bpe\bee\bed\bd _\bn_\bu_\bm_\bb_\be_\br
+ Smallest possible value for the base speed of rev-
+ olution of the epicycles. The actual speeds of
+ the epicycles vary from this down to _\bm_\bi_\bn_\b__\bs_\bp_\be_\be_\bd _\b/
+ _\bh_\ba_\br_\bm_\bo_\bn_\bi_\bc_\bs.\b.
+
+ -\b-m\bma\bax\bx_\b_s\bsp\bpe\bee\bed\bd _\bn_\bu_\bm_\bb_\be_\br
+ Smallest possible value for the base speed of rev-
+ olution of the epicycles.
+
+ -\b-h\bha\bar\brm\bmo\bon\bni\bic\bcs\bs _\bN
+ Number of possible harmonics; the larger this
+ value is, the greater the possible variety of
+
+
+
+X Version 11 27-Apr-97 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ possible speeds of epicycle.
+
+ -\b-t\bti\bim\bme\bes\bst\bte\bep\bp _\bn_\bu_\bm_\bb_\be_\br
+ Decreasing this value will reduce the distance the
+ body moves for each line segment, possibly produc-
+ ing a smoother figure. Increasing it may produce
+ faster results.
+
+ -\b-d\bdi\biv\bvi\bis\bso\bor\br_\b_p\bpo\boi\bis\bss\bso\bon\bn _\bp_\br_\bo_\bb_\ba_\bb_\bi_\bl_\bi_\bt_\by
+ Each epicycle rotates at a rate which is a factor
+ of the base speed. The speed of each epicycle is
+ the base speed divided by some integer between 1
+ and the value of the -\b-h\bha\bar\brm\bmo\bon\bni\bic\bcs\bs option. This
+ integer is decided by starting at 1 and tossing a
+ biased coin. For each consecutive head, the value
+ is incremented by one. The integer will not be
+ incremented above the value of the -\b-h\bha\bar\brm\bmo\bon\bni\bic\bcs\bs
+ option. The argument of this option decides the
+ bias of the coin; it is the probability that that
+ coin will produce a head at any given toss.
+
+ -\b-s\bsi\biz\bze\be_\b_f\bfa\bac\bct\bto\bor\br_\b_m\bmi\bin\bn _\bn_\bu_\bm_\bb_\be_\br
+ Epicycles are always at least this factor smaller
+ than their parents.
+
+ -\b-s\bsi\biz\bze\be_\b_f\bfa\bac\bct\bto\bor\br_\b_m\bma\bax\bx _\bn_\bu_\bm_\bb_\be_\br
+ Epicycles are never more than this factor smaller
+ than their parents.
+
+R\bRE\bES\bSO\bOU\bUR\bRC\bCE\bES\bS
+ Option Resource Default Value
+ ------ -------- -------------
+ -colors .colors 100
+ -delay .delay 1000
+ -holdtime .holdtime 2
+ -linewidth .lineWidth 4
+ -min_circles .minCircles 2
+ -max_circles .maxCircles 10
+ -min_speed .minSpeed 0.003
+ -max_speed .maxSpeed 0.005
+ -harmonics .harmonics 8
+ -timestep .timestep 1.0
+ -divisor_poisson .divisorPoisson 0.4
+ -size_factor_min .sizeFactorMin 1.05
+ -size_factor_max .sizeFactorMax 2.05
+ .timestepCoarseFactor 1.0
+
+ Before the drawing of the figure is begun, a preliminary
+ calculation of the path is done in order to scale the
+ radii of the epicycles so as to fit the figure on the
+ screen or window. For the sake of speed, This calculation
+ is done with a larger timestep than the actual drawing.
+ The time-step used is the value of the -\b-t\bti\bim\bme\bes\bst\bte\bep\bp option
+ multiplied by the timestepCoarseFactor resource. The
+
+
+
+X Version 11 27-Apr-97 3
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ default value of 1 will almost always work fast enough and
+ so this resource is not available as a command-line
+ option.
+
+U\bUS\bSE\bER\bR I\bIN\bNT\bTE\bER\bRF\bFA\bAC\bCE\bE
+ The program runs mostly without user interaction. When
+ running on the root window, no input is accepted. When
+ running in its own window, the program will exit if mouse
+ button 3 is pressed. If any other mouse button is
+ pressed, the current figure will be abandoned and another
+ will be started.
+
+H\bHI\bIS\bST\bTO\bOR\bRY\bY
+ The geometry of epicycles was perfected by Hipparchus of
+ Rhodes at some time around 125 B.C., 185 years after the
+ birth of Aristarchus of Samos, the inventor of the helio-
+ centric universe model. Hipparchus applied epicycles to
+ the Sun and the Moon. Ptolemy of Alexandria went on to
+ apply them to what was then the known universe, at around
+ 150 A.D. Copernicus went on to apply them to the helio-
+ centric model at the beginning of the sixteenth century.
+ Johannes Kepler discovered that the planets actually move
+ in elliptical orbits in about 1602. The inverse-square
+ law of gravity was suggested by Boulliau in 1645. Isaac
+ Newton's _\bP_\br_\bi_\bn_\bc_\bi_\bp_\bi_\ba _\bM_\ba_\bt_\bh_\be_\bm_\ba_\bt_\bi_\bc_\ba was published in 1687, and
+ proved that Kepler's laws derived from Newtonian gravita-
+ tion.
+
+B\bBU\bUG\bGS\bS
+ The colour selection is re-done for every figure. This
+ may generate too much network traffic for this program to
+ work well over slow or long links.
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1998, James Youngman. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ James Youngman <jay@gnu.org>, April 1998.
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 27-Apr-97 4
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ flag - draws a waving flag, containing text or an image
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ f\bfl\bla\bag\bg [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-size _\bi_\bn_\bt_\be_\bg_\be_\br] [-text _\bs_\bt_\br_\bi_\bn_\bg] [-font
+ _\bf_\bo_\bn_\bt] [-bitmap _\bx_\bb_\bm_\b-_\bf_\bi_\bl_\be]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bf_\bl_\ba_\bg program draws a waving flag that contains text or
+ a bitmap.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bf_\bl_\ba_\bg accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 200.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-s\bsi\biz\bze\be _\bi_\bn_\bt_\be_\bg_\be_\br
+ How large the pixels in the flag should be, from 1
+ to 8. If this is a negative number, the pixel
+ size is chosen randomly from the range 1 to -size.
+ Default -7.
+
+ -\b-t\bte\bex\bxt\bt _\bt_\be_\bx_\bt
+ The text to display in the flag. Multiple lines
+ of text are allowed; the lines will be displayed
+ centered atop one another. Default: none. If the
+
+
+
+X Version 11 24-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ text is the magic string _\b"_\b(_\bd_\be_\bf_\ba_\bu_\bl_\bt_\b)_\b", then the
+ text used will be the local machine name; a new-
+ line; and the local OS version.
+
+ -\b-b\bbi\bit\btm\bma\bap\bp _\bx_\bb_\bm_\b-_\bf_\bi_\bl_\be
+ The bitmap to display in the flag; this must be an
+ XBM file (color XPMs are not allowed.) Default:
+ none. If the bitmap is the magic string
+ _\b"_\b(_\bd_\be_\bf_\ba_\bu_\bl_\bt_\b)_\b", then the bitmap used will be a charm-
+ ing little picture of J. R. "Bob" Dobbs.
+
+ If neither _\b-_\bt_\be_\bx_\bt nor _\b-_\bb_\bi_\bt_\bm_\ba_\bp are specified, then
+ either the builtin text or the builtin bitmap will
+ be chosen randomly.
+
+ -\b-f\bfo\bon\bnt\bt _\bf_\bo_\bn_\bt
+ The font in which to draw the text; the default is
+ "-*-helvetica-bold-r-*-240-*".
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1996 Charles Vidal.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Charles Vidal <vidalc@univ-mlv.fr>, 1996.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br, and the
+ -text and -bitmap options, added by Jamie Zawinski
+ <jwz@jwz.org>, 24-May-97.
+
+
+
+
+
+
+
+
+
+
+X Version 11 24-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ flame - draw weird cosmic fractals
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ f\bfl\bla\bam\bme\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-colors _\bi_\bn_\bt_\be_\bg_\be_\br] [-iterations _\bi_\bn_\bt_\be_\bg_\be_\br]
+ [-points _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs] [-delay2 _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\b-
+ _\bo_\bn_\bd_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bf_\bl_\ba_\bm_\be program generates colorful fractal displays.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bf_\bl_\ba_\bm_\be accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-c\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64.
+
+ -\b-i\bit\bte\ber\bra\bat\bti\bio\bon\bns\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many fractals to generate. Default 25.
+
+ -\b-p\bpo\boi\bin\bnt\bts\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many pixels to draw for each fractal. Default
+ 10000.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long we should wait between drawing each frac-
+ tal. Default 50000, or about 1/20th second.
+
+ -\b-d\bde\bel\bla\bay\by2\b2 _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long we should wait before clearing the screen
+ when each run ends. Default 2000000, or two sec-
+ onds.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+
+
+X Version 11 13-aug-92 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1991 by Patrick J. Naughton
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Scott Graves <spot@cs.cmu.edu>, 06-Jun-91.n
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 18-Oct-93.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 13-aug-92 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ forest - draws a fractal forest
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ f\bfo\bor\bre\bes\bst\bt [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bf_\bo_\br_\be_\bs_\bt program draws a fractal forest.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bf_\bo_\br_\be_\bs_\bt accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 100.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+
+
+
+
+X Version 11 27-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1995 by Pascal Pensa.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Pascal Pensa <pensa@aurora.unice.fr>, 1995.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 27-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 27-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ galaxy - draws spinning galaxies
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ g\bga\bal\bla\bax\bxy\by [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br] [-size _\bi_\bn_\bt_\be_\bg_\be_\br]
+ [-trail] [-no-trail]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bg_\ba_\bl_\ba_\bx_\by program draws spinning galaxies.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bg_\ba_\bl_\ba_\bx_\by accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors used cycle through the
+ hue, making N stops around the color wheel.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-s\bsi\biz\bze\be _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-t\btr\bra\bai\bil\bl
+
+ -\b-n\bno\bo-\b-t\btr\bra\bai\bil\bl
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1994 by Hubert Feyrer.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Original Amiga version by Uli Siegmund <uli@wom-
+ bat.okapi.sub.org>
+ for EGS in Cluster.
+
+ Ported from Cluster/EGS to C/Intuition by Harald Backert.
+
+ Ported to X11 and xlockmore by Hubert Feyrer
+ <hubert.feyrer@rz.uni-regensburg.de>, 30-Sep-94.
+
+ Modified by David Bagley <bagleyd@bigfoot.com>, 23-Oct-94.
+
+ Modified by Dave Mitchell <davem@magnet.com>, 7-Apr-97.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ goop - squishy transparent oil and bubble screenhack
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ g\bgo\boo\bop\bp [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-transparent] [-non-transparent] [-addi-
+ tive] [-subtractive] [-xor] [-no-xor]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bg_\bo_\bo_\bp program draws a simulation of bubbles in layers
+ of overlapping multicolored translucent fluid.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bg_\bo_\bo_\bp accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many bubbles to draw per layer. Default: ran-
+ dom.
+
+ -\b-l\bla\bay\bye\ber\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many layers to draw. Default: random, based
+ on screen depth.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How much of a delay should be introduced between
+ steps of the animation. Default 100000, or about
+ 1/10th second.
+
+ -\b-t\btr\bra\ban\bns\bsp\bpa\bar\bre\ben\bnt\bt
+ If _\b-_\bl_\ba_\by_\be_\br_\bs is greater than 1, then each layer will
+ be drawn in one color, and when they overlap, the
+ colors will be mixed. This is the default.
+
+ -\b-n\bno\bon\bn-\b-t\btr\bra\ban\bns\bsp\bpa\bar\bre\ben\bnt\bt
+ Turns off _\b-_\bt_\br_\ba_\bn_\bs_\bp_\ba_\br_\be_\bn_\bt.
+
+
+
+
+
+X Version 11 11-Jun-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-a\bad\bdd\bdi\bit\bti\biv\bve\be
+ If _\b-_\bt_\br_\ba_\bn_\bs_\bp_\ba_\br_\be_\bn_\bt is specified, then this option
+ means that the colors will be mixed using an addi-
+ tive color model, as if the blobs were projected
+ light. This is the default.
+
+ -\b-s\bsu\bub\bbt\btr\bra\bac\bct\bti\biv\bve\be
+ If _\b-_\bt_\br_\ba_\bn_\bs_\bp_\ba_\br_\be_\bn_\bt is specified, then this option
+ means that the colors will be mixed using a sub-
+ tractive color model, as if the blobs were
+ translucent filters.
+
+ -\b-x\bxo\bor\br Draw with xor instead of the other color tricks.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 11-Jun-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 11-Jun-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ grav - draws a simple orbital simulation
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ g\bgr\bra\bav\bv [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-count _\bi_\bn_\bt_\be_\bg_\be_\br] [-decay] [-no-decay] [-trail] [-no-trail]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bg_\br_\ba_\bv program draws a simple orbital simulation
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bg_\br_\ba_\bv accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 200. The colors are chosen randomly.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ Default 12.
+
+ -\b-d\bde\bec\bca\bay\by
+
+ -\b-n\bno\bo-\b-e\bec\bca\bay\by
+ Whether orbits should decay.
+
+
+ -\b-t\btr\bra\bai\bil\bl
+
+ -\b-n\bno\bo-\b-t\btr\bra\bai\bil\bl
+ Whether the objects should leave trails behind
+ them (makes it look vaguely like a cloud-chamber.
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1993 by Greg Bowering.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Greg Bowering <greg@smug.student.adelaide.edu.au>, 1993.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ greynetic - draw random stippled/color rectangles
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ g\bgr\bre\bey\byn\bne\bet\bti\bic\bc [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-delay _\bu_\bs_\be_\bc_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bg_\br_\be_\by_\bn_\be_\bt_\bi_\bc program draws random rectangles.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bg_\br_\be_\by_\bn_\be_\bt_\bi_\bc accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ Slow it down.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+
+
+X Version 11 13-aug-92 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 13-aug-92 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ halo - draw circular patterns
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ h\bha\bal\blo\bo [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-count _\bi_\bn_\bt] [-delay _\bu_\bs_\be_\bc_\bs] [-mode seuss
+ | ramp | random ] [-animate] [-colors _\bi_\bn_\bt_\be_\bg_\be_\br] [-cycle]
+ [-no-cycle] [-cycle-delay _\bu_\bs_\be_\bc_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bh_\ba_\bl_\bo program draws cool patterns based on circles.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bh_\ba_\bl_\bo accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many circles to draw. Default 0, meaning ran-
+ dom.
+
+ -\b-m\bmo\bod\bde\be s\bse\beu\bus\bss\bs |\b| r\bra\bam\bmp\bp |\b| r\bra\ban\bnd\bdo\bom\bm
+ In _\bs_\be_\bu_\bs_\bs mode, alternating striped curves will be
+ drawn.
+
+ In _\br_\ba_\bm_\bp mode, a color ramp will be drawn.
+
+ _\br_\ba_\bn_\bd_\bo_\bm means pick the mode randomly.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How much of a delay should be introduced between
+ steps of the animation. Default 100000, or about
+ 0.1 second.
+
+ -\b-c\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors to use. Default 100.
+
+ -\b-a\ban\bni\bim\bma\bat\bte\be
+ If specified, then the centerpoints of the circles
+
+
+
+X Version 11 12-Jun-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ will bounce around. Otherwise, the circles will
+ be drawn once, erased, and a new set of circles
+ will be drawn.
+
+ -\b-c\bcy\byc\bcl\ble\be
+
+ -\b-n\bno\bo-\b-c\bcy\byc\bcl\ble\be
+ Whether to do colormap cycling. Default is to
+ cycle.
+
+ -\b-c\bcy\byc\bcl\ble\be-\b-d\bde\bel\bla\bay\by
+ Number of microseconds between shifts of the col-
+ ormap; default 100000, or 1/10th second.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1993 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 6-jul-93.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 12-Jun-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ helix - draw helical string-art patterns
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ h\bhe\bel\bli\bix\bx [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-erase-speed _\bu_\bs_\be_\bc_\bs] [-erase-mode _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bs_\be_\bc_\b-
+ _\bo_\bn_\bd_\bs] [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bh_\be_\bl_\bi_\bx program draws interesting patterns composed of
+ line segments in random colors.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bh_\be_\bl_\bi_\bx accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-e\ber\bra\bas\bse\be-\b-s\bsp\bpe\bee\bed\bd _\bu_\bs_\be_\bc_\bs
+ This controls the speed at which the screen will
+ be erased. Lower numbers erase faster.
+
+ -\b-e\ber\bra\bas\bse\be-\b-m\bmo\bod\bde\be _\bi_\bn_\bt_\be_\bg_\be_\br
+ This sets the erase mode. Mode -1 chooses a random
+ mode each time. There are currently 6 modes
+ defined (0-5).
+
+ -\b-d\bde\bel\bla\bay\by _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ This sets the number of seconds that the helix
+ will be on the screen.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+
+
+
+
+X Version 11 18-sep-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92. Screen eraser
+ improved by Johannes Keukelaar <johannes@nada.kth.se>,
+ 18-sep-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 18-sep-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ hopalong - draw real plane fractals
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ h\bho\bop\bpa\bal\blo\bon\bng\bg [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay
+ _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs] [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br] [-jong]
+ [-no-jong] [-jong] [-no-sine]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bh_\bo_\bp_\ba_\bl_\bo_\bn_\bg program generates real plane fractals as
+ described in the September 1986 issue of Scientific Ameri-
+ can.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bh_\bo_\bp_\ba_\bl_\bo_\bn_\bg accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 200. The colors used cycle through the
+ hue, making N stops around the color wheel.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How long to run each batch. Default 2500 pixels.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many pixels should be drawn before a color
+ change. Default 1000.
+
+ -\b-j\bjo\bon\bng\bg _\bi_\bn_\bt_\be_\bg_\be_\br
+
+ -\b-n\bno\bo-\b-j\bjo\bon\bng\bg _\bi_\bn_\bt_\be_\bg_\be_\br
+ Whether to use the Jong format (default is to
+ choose randomly.)
+
+
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-s\bsi\bin\bne\be _\bi_\bn_\bt_\be_\bg_\be_\br
+
+ -\b-n\bno\bo-\b-s\bsi\bin\bne\be _\bi_\bn_\bt_\be_\bg_\be_\br
+ Whether to use the Sine format (default is to
+ choose randomly.)
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1988-91 by Patrick J. Naughton.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Patrick J. Naughton <naughton@eng.sun.com>, 23-mar-88.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92, and again on
+ 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ hypercube - 2d projection of a 4d object
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ h\bhy\byp\bpe\ber\brc\bcu\bub\bbe\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-color[0-7] _\bc_\bo_\bl_\bo_\br] [-xy _\bf_\bl_\bo_\ba_\bt]
+ [-xz _\bf_\bl_\bo_\ba_\bt] [-yz _\bf_\bl_\bo_\ba_\bt] [-xw _\bf_\bl_\bo_\ba_\bt] [-yw _\bf_\bl_\bo_\ba_\bt] [-zw
+ _\bf_\bl_\bo_\ba_\bt] [-observer-z _\bi_\bn_\bt] [-delay _\bu_\bs_\be_\bc_\bs] [-window] [-root]
+ [-mono] [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bh_\by_\bp_\be_\br_\bc_\bu_\bb_\be program displays a wireframe projection of a
+ hypercube which is rotating at user-specified rates around
+ any or all of its four axes.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bh_\by_\bp_\be_\br_\bc_\bu_\bb_\be accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How much of a delay should be introduced between
+ steps of the animation. Default 100000, or about
+ 1/10th second.
+
+ -\b-o\bob\bbs\bse\ber\brv\bve\ber\br-\b-z\bz _\bi_\bn_\bt
+ How far away the observer is from the center of
+ the cube (the cube is one unit per side.) Default
+ 5.
+
+ -\b-c\bco\bol\blo\bor\br0\b0 _\bc_\bo_\bl_\bo_\br
+
+ -\b-c\bco\bol\blo\bor\br1\b1 _\bc_\bo_\bl_\bo_\br
+
+ -\b-c\bco\bol\blo\bor\br2\b2 _\bc_\bo_\bl_\bo_\br
+
+ -\b-c\bco\bol\blo\bor\br3\b3 _\bc_\bo_\bl_\bo_\br
+
+ -\b-c\bco\bol\blo\bor\br4\b4 _\bc_\bo_\bl_\bo_\br
+
+
+
+
+X Version 11 6-dec-92 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-c\bco\bol\blo\bor\br5\b5 _\bc_\bo_\bl_\bo_\br
+
+ -\b-c\bco\bol\blo\bor\br6\b6 _\bc_\bo_\bl_\bo_\br
+
+ -\b-c\bco\bol\blo\bor\br7\b7 _\bc_\bo_\bl_\bo_\br
+ The colors used to draw the line segments border-
+ ing the eight faces of the cube. Some of the
+ faces have only two of their border-lines drawn in
+ the specified color, and some have all four.
+
+ -\b-x\bxw\bw _\bf_\bl_\bo_\ba_\bt
+
+ -\b-x\bxy\by _\bf_\bl_\bo_\ba_\bt
+
+ -\b-x\bxz\bz _\bf_\bl_\bo_\ba_\bt
+
+ -\b-y\byw\bw _\bf_\bl_\bo_\ba_\bt
+
+ -\b-y\byz\bz _\bf_\bl_\bo_\ba_\bt
+
+ -\b-z\bzw\bw _\bf_\bl_\bo_\ba_\bt
+ The amount that the cube should be rotated around
+ the specified axis at each frame of the animation,
+ expressed in radians. These should be small
+ floating-point values (less than 0.05 works best.)
+ Default: xy=0.01, xz=0.005, yw=0.01.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 6-dec-92.
+
+
+
+
+
+
+X Version 11 6-dec-92 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ ifs - draws spinning, colliding iterated-function-system
+ images
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ i\bif\bfs\bs [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bi_\bf_\bs program draws spinning, colliding iterated-func-
+ tion-system images.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bi_\bf_\bs accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 200. The colors used cycle through the
+ hue, making N stops around the color wheel.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Massimino Pascal.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Massimino Pascal <Pascal.Massimon@ens.fr>, 1997.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ imsmap - generate fractal maps
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ i\bim\bms\bsm\bma\bap\bp [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt] [-delay _\bs_\be_\bc_\bo_\bn_\bd_\bs] [-itera-
+ tions _\bi_\bn_\bt] [-mode h|s|v|random] [-cycle] [-no-cycle]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bi_\bm_\bs_\bm_\ba_\bp program generates map or cloud-like patterns.
+ It looks quite different in monochrome and color.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bi_\bm_\bs_\bm_\ba_\bp accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors to use. Default 50.
+
+ -\b-d\bde\bel\bla\bay\by _\bi_\bn_\bt_\be_\bg_\be_\br
+ How long to delay between images. Default 10 sec-
+ onds.
+
+ -\b-i\bit\bte\ber\bra\bat\bti\bio\bon\bns\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ A measure of the resolution of the resultant
+ image, from 0 to 7. Default 7.
+
+ -\b-m\bmo\bod\bde\be [\b[ h\bhu\bue\be |\b| s\bsa\bat\btu\bur\bra\bat\bti\bio\bon\bn |\b| v\bva\bal\blu\bue\be |\b| r\bra\ban\bnd\bdo\bom\bm ]\b]
+ The axis upon which colors should be interpolated
+ between the foreground and background color.
+ Default random.
+
+ -\b-c\bcy\byc\bcl\ble\be
+
+ -\b-n\bno\bo-\b-c\bcy\byc\bcl\ble\be
+ Whether to do colormap cycling. Default is to
+ cycle.
+
+
+
+
+X Version 11 17-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-c\bcy\byc\bcl\ble\be-\b-d\bde\bel\bla\bay\by
+ Number of microseconds between shifts of the col-
+ ormap; default 100000, or 1/10th second.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Juergen Nickelsen <nickel@cs.tu-berlin.de>, 23-aug-92.
+
+ Hacked on by Jamie Zawinski <jwz@jwz.org>, 24-aug-92,
+ 17-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 17-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ jigsaw - permute the screen image like a jigsaw puzzle
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ j\bji\big\bgs\bsa\baw\bw [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-background _\bc_\bo_\bl_\bo_\br]
+ [-delay _\bu_\bs_\be_\bc_\bs] [-window] [-root] [-install] [-visual
+ _\bv_\bi_\bs_\bu_\ba_\bl]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bj_\bi_\bg_\bs_\ba_\bw program takes an image of the screen, carves it
+ up into a jigsaw puzzle, shuffles it, and then solves it.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bj_\bi_\bg_\bs_\ba_\bw accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to wait between shuffling pieces; default
+ 700000, or 0.7 seconds.
+
+R\bRE\bES\bSO\bOU\bUR\bRC\bCE\bES\bS
+ On some systems (currently, only SGIs), this program can,
+ instead of grabbing a desktop image, grab a frame of video
+ from an external camera and manipulate that instead. The
+ following resources control that.
+
+
+ g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by (Float)
+ What portion of the time to grab video rather than
+ a screen image, between 0.0 and 1.0. Defaults to
+ 0.5, or half the time.
+
+ v\bvi\bid\bde\beo\boD\bDe\bev\bvi\bic\bce\be (Integer)
+ The number of the default video input device to
+ check first. If unspecified, the default camera
+ (from videopanel(1)) will be checked first. After
+ that, all other available video input devices will
+ be checked in order.
+
+ The first one which produces a non-black image
+ will be used. If all images are black, the others
+ will be re-checked a few times before giving up
+
+
+
+X Version 11 25-Nov-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ and falling back to simply grabbing a desktop
+ image (but note that this takes a few seconds, so
+ if you don't actually have any video sources
+ hooked up, you should consider turning off video
+ grabbing by setting g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by to 0.0.)
+
+ v\bvi\bid\bde\beo\boG\bGa\bai\bin\bn (Float)
+ The amount by which to brighten the grabbed image.
+ This defaults to 2.2.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 25-Nov-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 25-Nov-97 2
+
+
--- /dev/null
+
+
+
+Kaleidescpe(1) Kaleidescpe(1)
+
+
+N\bNA\bAM\bME\bE
+ Kaleidescope - rotating line segments
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ k\bka\bal\ble\bei\bid\bde\bes\bsc\bco\bop\bpe\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-color_mode _\bm_\bo_\bn_\bo _\b| _\bn_\bi_\bc_\be _\b| _\bg_\br_\be_\be_\bd_\by]
+ [-nsegments _\bi_\bn_\bt] [-ntrails _\bi_\bn_\bt] [-local_rotation _\bi_\bn_\bt]
+ [-global_rotation _\bi_\bn_\bt] [-delay _\bu_\bs_\be_\bc_\bs] [-redmin _\bi_\bn_\bt]
+ [-greenmin _\bi_\bn_\bt] [-bluemin _\bi_\bn_\bt] [-redrange _\bi_\bn_\bt] [-green-
+ range _\bi_\bn_\bt] [-bluerange _\bi_\bn_\bt]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bk_\ba_\bl_\be_\bi_\bd_\be_\bs_\bc_\bo_\bp_\be program draws line segments in a symmet-
+ ric pattern that evolves over time.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bk_\ba_\bl_\be_\bi_\bd_\be_\bs_\bc_\bo_\bp_\be accepts the following options:
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-c\bco\bol\blo\bor\br_\b_m\bmo\bod\bde\be m\bmo\bon\bno\bo |\b| n\bni\bic\bce\be |\b| g\bgr\bre\bee\bed\bdy\by
+ Specify how kaleidescope uses colors. Mono uses
+ just the default foreground and background colors.
+ Nice uses one color for each segment (specified by
+ nsegments). Greedy uses (ntrails * nsegments) + 1
+ colors.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bns\bse\beg\bgm\bme\ben\bnt\bts\bs i\bin\bnt\bte\beg\bge\ber\br
+ The number of segments to draw. Default is 7.
+
+ -\b-n\bnt\btr\bra\bai\bil\bls\bs i\bin\bnt\bte\beg\bge\ber\br
+ The number of trails to draw. Default is 100.
+
+ -\b-l\blo\boc\bca\bal\bl_\b_r\bro\bot\bta\bat\bti\bio\bon\bn i\bin\bnt\bte\beg\bge\ber\br
+ The rate at which segments rotate around their
+ center. Default is -59.
+
+ -\b-g\bgl\blo\bob\bba\bal\bl_\b_r\bro\bot\bta\bat\bti\bio\bon\bn i\bin\bnt\bte\beg\bge\ber\br
+ The rate at which segments rotate around the cen-
+ ter of the window. Default is 1.
+
+ -\b-r\bre\bed\bdm\bmi\bin\bn,\b, -\b-g\bgr\bre\bee\ben\bnm\bmi\bin\bn,\b, -\b-b\bbl\blu\bue\bem\bmi\bin\bn,\b, -\b-r\bre\bed\bdr\bra\ban\bng\bge\be,\b, -\b-g\bgr\bre\bee\ben\bnr\bra\ban\bng\bge\be,\b,
+ -\b-b\bbl\blu\bue\ber\bra\ban\bng\bge\be
+ All take an integer argument. When colors are ran-
+ domly chosen, they are chosen from the interval
+
+
+
+X Version 11 14-Dec-95 1
+
+
+
+
+
+Kaleidescpe(1) Kaleidescpe(1)
+
+
+ min to min plus range. The minimums default to
+ 30000. The ranges default to 20000.
+
+ -\b-d\bde\bel\bla\bay\by m\bmi\bic\bcr\bro\bos\bse\bec\bco\bon\bnd\bds\bs
+ How much of a delay should be introduced between
+ steps of the animation. Default is 20000, or
+ about 5 frames a second.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), k\bka\bal\ble\bei\bid\bde\bes\bsc\bco\bop\bpe\be(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Ron Tapia. Permission to use, copy,
+ modify, distribute, and sell this software and its docu-
+ mentation for any purpose is hereby granted without fee,
+ provided that the above copyright notice appear in all
+ copies and that both that copyright notice and this per-
+ mission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Ron Tapia <tapia@nmia.com>, 20-Mar-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 14-Dec-95 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ lament - animates the Lament Configuration
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ l\bla\bam\bme\ben\bnt\bt [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-window] [-root]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-texture] [-no-texture]
+ [-wireframe]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bl_\ba_\bm_\be_\bn_\bt program draws an animation of a particular puz-
+ zle box repeatedly solving itself.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bl_\ba_\bm_\be_\bn_\bt accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-t\bte\bex\bxt\btu\bur\bre\be
+ Use texture maps. This is the default.
+
+ -\b-n\bno\bo-\b-t\bte\bex\bxt\btu\bur\bre\be
+ Do not use texture maps. This is boring and
+ wrong.
+
+ -\b-w\bwi\bir\bre\bef\bfr\bra\bam\bme\be
+ Only draw outlines.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+B\bBU\bUG\bGS\bS
+ This hack is glacially slow on machines lacking hardware
+ texture support.
+
+ Occasionally opens doors, admitting theologians of the
+ Order of the Gash.
+
+
+
+
+
+X Version 11 25-Jul-98 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1998 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 25-Jul-98.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 25-Jul-98 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ laser - draws vaguely laser-like moving lines
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ l\bla\bas\bse\ber\br [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bl_\ba_\bs_\be_\br program draws vaguely laser-like moving lines
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bl_\ba_\bs_\be_\br accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors used cycle through the
+ hue, making N stops around the color wheel.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ Default 200.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ Default 10.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1995 by Pascal Pensa.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Pascal Pensa <pensa@aurora.unice.fr>, 1995.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ lightning - draws fractal lightning bolts
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ l\bli\big\bgh\bht\btn\bni\bin\bng\bg [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay
+ _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bl_\bi_\bg_\bh_\bt_\bn_\bi_\bn_\bg program draws fractal lightning bolts
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bl_\bi_\bg_\bh_\bt_\bn_\bi_\bn_\bg accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors are chosen randomly.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1996 by Keith Romberg.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Keith Romberg <kromberg@saxe.com>, 27-Jun-96.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ lisa - draws animated full-loop lisajous figures
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ l\bli\bis\bsa\ba [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br] [-size _\bi_\bn_\bt_\be_\bg_\be_\br]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bl_\bi_\bs_\ba program draws animated full-loop lisajous fig-
+ ures.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bl_\bi_\bs_\ba accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 200. The colors are chosen randomly.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-s\bsi\biz\bze\be _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+
+
+
+X Version 11 27-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Caleb Cullen.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Caleb Cullen, 1997.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 27-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 27-May-97 2
+
+
--- /dev/null
+
+
+
+LMORPH(1) LMORPH(1)
+
+
+N\bNA\bAM\bME\bE
+ lmorph - morphing lines
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ l\blm\bmo\bor\brp\bph\bh [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-points _\bi_\bn_\bt] [-steps _\bi_\bn_\bt] [-delay _\bu_\bs_\be_\bc_\bs]
+ [-figtype _\bt_\by_\bp_\be]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bl_\bm_\bo_\br_\bp_\bh program morphs between simple linedrawings
+ using bilinear interpolation.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bl_\bm_\bo_\br_\bp_\bh accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-p\bpo\boi\bin\bnt\bts\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ Number of points in each line drawing. Default is
+ 150 points.
+
+ -\b-s\bst\bte\bep\bps\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ Interpolation steps from one drawing to the next.
+ Default is 0, which means a random number between
+ 100 and 500.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How much of a delay should be introduced between
+ steps of the animation. Default 50000.
+
+ -\b-f\bfi\big\bgt\bty\byp\bpe\be _\bt_\by_\bp_\be
+ Limit the figures to only open or closed figures.
+ Possible types are "all" (default), "open" and
+ "closed".
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+
+
+
+
+ xscreensaver hack 1
+
+
+
+
+
+LMORPH(1) LMORPH(1)
+
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Sverre H. Huseby <sverrehu@online.no> and Glenn T. Lines
+ <gtl@si.sintef.no>, built on top of the screen saver rou-
+ tines by Jamie Zawinski <jwz@jwz.org>.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ xscreensaver hack 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ maze - an automated X11 demo repeatedly creating and solv-
+ ing a random maze
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ m\bma\baz\bze\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-install] [-visual
+ _\bv_\bi_\bs_\bu_\ba_\bl] [-grid-size _\bp_\bi_\bx_\be_\bl_\bs] [-live-color _\bc_\bo_\bl_\bo_\br]
+ [-dead-color _\bc_\bo_\bl_\bo_\br] [-solve-delay _\bu_\bs_\be_\bc_\bs] [-pre-delay
+ _\bu_\bs_\be_\bc_\bs] [-post-delay _\bu_\bs_\be_\bc_\bs] [-generator _\bi_\bn_\bt_\be_\bg_\be_\br]
+ [-max-length _\bi_\bn_\bt_\be_\bg_\be_\br] [-bridge] [-no-bridge]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bm_\ba_\bz_\be program creates a "random" maze and then solves
+ it with graphical feedback.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bm_\ba_\bz_\be accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-g\bgr\bri\bid\bd-\b-s\bsi\biz\bze\be _\bp_\bi_\bx_\be_\bl_\bs
+ The size of each block of the maze, in pixels;
+ default is 0, meaning pick a random grid size.
+
+ -\b-l\bli\biv\bve\be-\b-c\bco\bol\blo\bor\br _\bc_\bo_\bl_\bo_\br
+ The color of the path.
+
+ -\b-d\bde\bea\bad\bd-\b-c\bco\bol\blo\bor\br _\bc_\bo_\bl_\bo_\br
+ The color of the failed path (it is also stippled
+ with a 50% pattern.)
+
+ -\b-s\bsk\bki\bip\bp-\b-c\bco\bol\blo\bor\br _\bc_\bo_\bl_\bo_\br
+ The maze solver will choose to not go down a path
+ if it can "see" (in a straight line) that it is a
+ dead end. This is the color to use for paths that
+ are skipped for this reason.
+
+ -\b-s\bsu\bur\brr\bro\bou\bun\bnd\bd-\b-c\bco\bol\blo\bor\br _\bc_\bo_\bl_\bo_\br
+ If the maze solver ever completely encloses an
+ area within the maze, then it knows that the exit
+ is not in there (and in fact the interior of that
+ area might not even be reachable.) It will mark
+
+
+
+X Version 11 7-mar-93 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ out those cells using this color.
+
+ -\b-s\bso\bol\blv\bve\be-\b-d\bde\bel\bla\bay\by _\bi_\bn_\bt_\be_\bg_\be_\br
+ Delay (in microseconds) between each step of the
+ solution path. Default 5000, or about 1/200th
+ second.
+
+ -\b-p\bpr\bre\be-\b-d\bde\bel\bla\bay\by _\bi_\bn_\bt_\be_\bg_\be_\br
+ Delay (in microseconds) between generating a maze
+ and starting to solve it. Default 2000000 (2 sec-
+ onds.)
+
+ -\b-p\bpo\bos\bst\bt-\b-d\bde\bel\bla\bay\by _\bi_\bn_\bt_\be_\bg_\be_\br
+ Delay (in microseconds) after solving a maze and
+ before generating a new one. Default 4000000 (4
+ seconds.)
+
+ -\b-g\bge\ben\bne\ber\bra\bat\bto\bor\br _\bn_\bu_\bm
+ Sets the algorithm that will be used to generate
+ the mazes. The default is -1, which randomly
+ selects an algorithm for each maze that is gener-
+ ated. Generator 0 is the original one, and works
+ by walking around randomly until we hit a place
+ we've been before, then backtracking and trying a
+ new direction somewhere. Generator 1 picks a ran-
+ dom spot in the maze, then draws a straight wall
+ from that spot in a random direction until it hits
+ another wall (and continues until the maze is com-
+ plete). Generator 2 is based on sets. Initially
+ all cells are in different sets. Then two neigh-
+ boring cells are chosen and if they are in differ-
+ ent sets, their sets are joined. If they were in
+ the same set, a wall is built between them. This
+ continues until the maze is complete.
+
+ All generators generate mazes with a certain
+ 'characteristic'. See if you can spot them!
+
+ -\b-m\bma\bax\bx-\b-l\ble\ben\bng\bgt\bth\bh _\bn_\bu_\bm
+ Controls the maximum length of walls drawn in one
+ go by generator 1.
+
+ -\b-b\bbr\bri\bid\bdg\bge\be
+
+ -\b-n\bno\bo-\b-b\bbr\bri\bid\bdg\bge\be
+ Controls whether or not a 'bridge' will appear
+ over the logo.
+
+ Clicking the mouse in the maze window controls it.
+
+ L\bLe\bef\bft\btB\bBu\but\btt\bto\bon\bn Clears the window and restarts maze.
+
+ M\bMi\bid\bdd\bdl\ble\beB\bBu\but\btt\bto\bon\bn Pause or unpause the program.
+
+
+
+
+X Version 11 7-mar-93 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ R\bRi\big\bgh\bht\btB\bBu\but\btt\bto\bon\bn Exit.
+
+B\bBU\bUG\bGS\bS
+ Expose events force a restart of maze.
+
+ Mouse actions are based on "raw" values (Button1, Button2
+ and Button3) instead of using the pointer map.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1988 by Sun Microsystems, Inc. Mountain
+ View, CA.
+
+ All Rights Reserved
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation, and that the names of Sun or MIT not be
+ used in advertising or publicity pertaining to distribu-
+ tion of the software without specific prior written per-
+ mission. Sun and M.I.T. make no representations about the
+ suitability of this software for any purpose. It is pro-
+ vided "as is" without any express or implied warranty.
+
+ SUN DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE,
+ INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND
+ FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SUN BE
+ LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES
+ OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA
+ OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE
+ OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION
+ WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+
+A\bAU\bUT\bTH\bHO\bOR\bR(\b(s\bs)\b)
+ Zack Weinberg [ Smarter maze-solver ] zack@rabi.phys.columbia.edu
+ Johannes Keukelaar [ Generators 1 and 2 ] johannes@nada.kth.se
+ Royal Institute of Technology, Stockholm, Sweden
+ Jim Randell [ XScreenSaver version ] jmr@mddjmr.fc.hp.com
+ HPLabs, Bristol
+ Richard Hess [ X11 extensions ] {...}!uunet!cimshop!rhess
+ Consilium, Mountain View, CA
+
+
+
+X Version 11 7-mar-93 3
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ Dave Lemke [ X11 version ] lemke@sun.COM
+ Sun MicroSystems, Mountain View, CA
+ Martin Weiss [ SunView version ]
+ Sun MicroSystems, Mountain View, CA
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 7-mar-93 4
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ halo - draw circular interference patterns
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ h\bha\bal\blo\bo [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-delay _\bs_\be_\bc_\bo_\bn_\bd_\bs] [-random _\bb_\bo_\bo_\bl_\be_\ba_\bn]
+ [-ncolors _\bi_\bn_\bt] [-offset _\bi_\bn_\bt]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bm_\bo_\bi_\br_\be program draws cool circular interference pat-
+ terns.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bm_\bo_\bi_\br_\be accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to wait before starting over. Default 5
+ seconds.
+
+ -\b-r\bra\ban\bnd\bdo\bom\bm _\bb_\bo_\bo_\bl_\be_\ba_\bn
+ Whether to ignore the foreground/background col-
+ ors, and pick them randomly instead.
+
+ -\b-o\bof\bff\bfs\bse\bet\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ The maximum random radius increment to use.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be allocated in the color
+ ramp (note that this value interacts with _\bo_\bf_\bf_\bs_\be_\bt.)
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+
+
+X Version 11 27-Apr-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 27-Apr-97, based on code by
+ Michael D. Bayne <mdb@go2net.com>.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 27-Apr-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ munch - munching squares screen hack
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ m\bmu\bun\bnc\bch\bh [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-delay _\bs_\be_\bc_\bo_\bn_\bd_\bs] [-xor] [-noxor] [-shift]
+ [-noshift] [-logminwidth _\bm_\bi_\bn_\bi_\bm_\bu_\bm _\bw_\bi_\bd_\bt_\bh]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bm_\bu_\bn_\bc_\bh program preforms the munching squares hack until
+ killed. It picks square size, position, and gravity ran-
+ domly; configurable options are listed below.
+
+ The munching squares hack cosists of drawing Y = X XOR T
+ for a range of X and T over and over until all the possi-
+ ble combinations of X and T have come up. It was report-
+ edly discovered by Jackson Wright in 1962 and took 5
+ instructions of PDP-6 code.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bm_\bu_\bn_\bc_\bh accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to wait before starting over. Default 5
+ seconds.
+
+ -\b-x\bxo\bor\br Use the XOR drawing function. (Default.)
+
+ -\b-n\bno\bo-\b-x\bxo\bor\br Don't use the XOR drawing function.
+
+ -\b-s\bsh\bhi\bif\bft\bt Start drawing the square at weird starting points.
+ (Default.)
+
+ -\b-n\bno\bo-\b-s\bsh\bhi\bif\bft\bt
+ Don't shift and start drawing the square at weird
+ starting points.
+
+
+
+
+X Version 11 17-Jun-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-l\blo\bog\bgm\bmi\bin\bnw\bwi\bid\bdt\bth\bh _\bm_\bi_\bn_\bi_\bm_\bu_\bm_\b-_\bw_\bi_\bd_\bt_\bh
+ The logarithm (base 2) of the minimum with of a
+ square (must be a power of 2, or some parts of the
+ square aren't.)
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1),
+ h\bht\btt\btp\bp:\b:/\b//\b/w\bww\bww\bw.\b.i\bin\bnw\bwa\bap\bp.\b.c\bco\bom\bm/\b/p\bpd\bdp\bp1\b10\b0/\b/h\bhb\bba\bak\bke\ber\br/\b/h\bha\bak\bkm\bme\bem\bm/\b/h\bha\bak\bkm\bme\bem\bm.\b.h\bht\btm\bml\bl,\b,
+ h\bht\btt\btp\bp:\b:/\b//\b/w\bww\bww\bw.\b.c\bco\bom\bme\bed\bdi\bia\ba.\b.c\bco\bom\bm/\b/H\bHo\bot\bt/\b/j\bja\bar\brg\bgo\bon\bn_\b_3\b3.\b.0\b0/\b/J\bJA\bAR\bRG\bGO\bON\bN_\b_M\bM/\b/M\bMU\bUN\bNC\bCH\bH-\b-
+ S\bSQ\bQR\bR.\b.H\bHT\bTM\bML\bL
+
+H\bHI\bIS\bST\bTO\bOR\bRY\bY
+ Quoted from HAKMEM, for historical interest. As that doc-
+ ument says, "Unless otherwise stated, all computer pro-
+ grams are in PDP-6/10 assembly language."
+
+ ITEM 146: MUNCHING SQUARES
+ Another simple display program. It is thought that
+ this was discovered by Jackson Wright on the RLE
+ PDP-1 circa 1962.
+
+
+ DATAI 2
+ ADDB 1,2
+ ROTC 2,-22
+ XOR 1,2
+ JRST .-4
+
+ 2=X, 3=Y. Try things like 1001002 in data
+ switches. This also does interesting things with
+ operations other than XOR, and rotations other
+ than -22. (Try IOR; AND; TSC; FADR; FDV(!); ROT
+ -14, -9, -20, ...)
+
+ ITEM 147 (Schroeppel):
+ Munching squares is just views of the graph Y = X
+ XOR T for consecutive values of T = time.
+
+ ITEM 148 (Cohen, Beeler):
+ A modification to munching squares which reveals
+ them in frozen states through opening and closing
+ curtains: insert FADR 2,1 before the XOR. Try data
+ switches =
+
+
+
+
+
+
+X Version 11 17-Jun-97 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ 4000,,4 1000,,2002 2000,,4 0,,1002
+
+ (Notation: <left half>,,<right half>)
+
+ Also try the FADR after the XOR, switches =
+ 1001,,1.
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Tim Showalter. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Tim Showalter <tjs@andrew.cmu.edu>, 17-Jun-97, based on
+ what's in the Jargon File and stealing stuff from existing
+ xscreensaver modules.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 17-Jun-97 3
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ noseguy - a little guy with a big nose wanders around
+ being witty
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ n\bno\bos\bse\beg\bgu\buy\by [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-text-foreground _\bc_\bo_\bl_\bo_\br] [-text-back-
+ ground _\bc_\bo_\bl_\bo_\br] [-font _\bf_\bo_\bn_\bt] [-window] [-root] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-mode _\bm_\bo_\bd_\be] [-program _\bp_\br_\bo_\bg_\br_\ba_\bm] [-file-
+ name le_\b] _\b[_\b-_\bt_\be_\bx_\bt _\bt_\be_\bx_\bt_\b]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ A little man with a big nose and a hat runs around spewing
+ out messages to the screen. This code (and its bitmaps)
+ were extracted from the _\bx_\bn_\bl_\bo_\bc_\bk program.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bn_\bo_\bs_\be_\bg_\bu_\by accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-f\bfo\bon\bnt\bt _\bf_\bo_\bn_\bt
+ The font used for the messages.
+
+ -\b-m\bmo\bod\bde\be [\b[ p\bpr\bro\bog\bgr\bra\bam\bm |\b| f\bfi\bil\ble\be |\b| s\bst\btr\bri\bin\bng\bg ]\b]
+ In _\bp_\br_\bo_\bg_\br_\ba_\bm mode, the messages are gotten by run-
+ ning a program. The program used is controlled by
+ the _\b-_\bp_\br_\bo_\bg_\br_\ba_\bm option, and the _\b._\bp_\br_\bo_\bg_\br_\ba_\bm resource.
+
+ In _\bf_\bi_\bl_\be_\bn_\ba_\bm_\be mode, the message used is the contents
+ of a file. The file used is controlled by the
+ _\b-_\bf_\bi_\bl_\be option, and the _\b._\bf_\bi_\bl_\be_\bn_\ba_\bm_\be resource.
+
+ In _\bs_\bt_\br_\bi_\bn_\bg mode, the message is whatever was speci-
+ fied on the command line as the _\b-_\bt_\be_\bx_\bt option, or
+ in the resource database as the _\b._\bt_\be_\bx_\bt resource.
+
+ -\b-p\bpr\bro\bog\bgr\bra\bam\bm _\bp_\br_\bo_\bg_\br_\ba_\bm
+ If _\bm_\bo_\bd_\be is _\bp_\br_\bo_\bg_\br_\ba_\bm (the default), then this pro-
+ gram will be run periodically, and its output will
+ be the text of the messages. The default program
+ is _\b"_\bf_\bo_\br_\bt_\bu_\bn_\be _\b-_\bs_\b", but _\by_\bo_\bw is also a good choice.
+
+
+
+
+X Version 11 13-aug-92 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-f\bfi\bil\ble\ben\bna\bam\bme\be _\bf_\bi_\bl_\be
+ If _\bm_\bo_\bd_\be is _\bf_\bi_\bl_\be, then the contents of this file
+ will be used for all messages.
+
+ -\b-t\bte\bex\bxt\bt _\bs_\bt_\br_\bi_\bn_\bg
+ If _\bm_\bo_\bd_\be is _\bs_\bt_\br_\bi_\bn_\bg, then this text will be used for
+ all messages.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxn\bnl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright 1985, 1990 by Dan Heller <argv@sun.com>.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Dan Heller <argv@sun.com>, 1985.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 13-aug-92 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ pedal - pretty geometric picture program
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ p\bpe\bed\bda\bal\bl [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-delay _\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-maxlines _\bn_\bu_\bm_\bb_\be_\br] [-fadedelay _\bu_\bs_\be_\bc_\bo_\bn_\bd_\bs] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bp_\be_\bd_\ba_\bl program displays pretty geometric pictures.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bp_\be_\bd_\ba_\bl accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-f\bfo\bor\bre\beg\bgr\bro\bou\bun\bnd\bd _\bc_\bo_\bl_\bo_\br
+ The color for the foreground. Default is white.
+
+ -\b-b\bba\bac\bck\bkg\bgr\bro\bou\bun\bnd\bd _\bc_\bo_\bl_\bo_\br
+ The color for the background. Default is black.
+
+ -\b-d\bde\bel\bla\bay\by _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ The number of seconds to pause between each pic-
+ ture.
+
+ -\b-m\bma\bax\bxl\bli\bin\bne\bes\bs _\bn_\bu_\bm_\bb_\be_\br
+ The maximum number of lines in the drawing. Good
+ values are between 20 and 2000. Maximum value is
+ 16K.
+
+ -\b-f\bfa\bad\bde\bed\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ The number of micro seconds to take when fading in
+ and out.
+
+ -\b-m\bmo\bon\bno\bo Don't do fading. Pretend we're on a monochrome
+ display.
+
+ To make your X server grunt under load, and to impress
+ your friends, try _\bp_\be_\bd_\ba_\bl _\b-_\bm_\bo_\bn_\bo _\b-_\bd_\be_\bl_\ba_\by _\b0 _\b-_\bm_\ba_\bx_\bl_\bi_\bn_\be_\bs _\b1_\b0_\b0_\b.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+
+
+
+
+X Version 11 24-Jun-94 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1994, by Carnegie Mellon University. Per-
+ mission to use, copy, modify, distribute, and sell this
+ software and its documentation for any purpose is hereby
+ granted without fee, provided fnord that the above copy-
+ right notice appear in all copies and that both that copy-
+ right notice and this permission notice appear in support-
+ ing documentation. No representations are made about the
+ suitability of fnord this software for any purpose. It is
+ provided "as is" without express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Dale Moore <Dale.Moore@cs.cmu.edu>, 24-Jun-1994.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 24-Jun-94 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ penrose - draws quasiperiodic tilings
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ p\bpe\ben\bnr\bro\bos\bse\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-redoDelay _\bs_\be_\bc_\bo_\bn_\bd_\bs] [-size _\bi_\bn_\bt_\be_\bg_\be_\br] [-ammann]
+ [-no-ammann]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bp_\be_\bn_\br_\bo_\bs_\be program draws quasiperiodic tilings.
+
+ See Onoda, Steinhardt, DiVincenzo and Socolar in Phys.
+ Rev. Lett. 60, #25, 1988 or Strandburg in Computers in
+ Physics, Sep/Oct 1991.
+
+ This implementation uses the simpler version of the growth
+ algorithm, i.e., if there are no forced vertices, a ran-
+ domly chosen tile is added to a randomly chosen vertex (no
+ preference for those 108 degree angles).
+
+ There are two essential differences to the algorithm pre-
+ sented in the literature: First, we do not allow the
+ tiling to enclose an untiled area. Whenever this is in
+ danger of happening, we just do not add the tile, hoping
+ for a better random choice the next time. Second, when
+ choosing a vertex randomly, we will take one that lies
+ withing the viewport if available. If this seems to cause
+ enclosures in the forced rule case, we will allow invisi-
+ ble vertices to be chosen.
+
+ Tiling is restarted whenever one of the following happens:
+ there are no incomplete vertices within the viewport or
+ the tiling has extended a window's length beyond the edge
+ of the window horizontally or vertically or forced rule
+ choice has failed 100 times due to areas about to become
+ enclosed.
+
+ Although quasiperiodic tilings are produced, the tiles
+ themselves are not penrose tiles (darts and kites). In
+ contrast to penrose tiles, these tiles can be arranged to
+ form a periodic tiling.
+
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bp_\be_\bn_\br_\bo_\bs_\be accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors are chosen randomly.
+
+ -\b-s\bsi\biz\bze\be _\bi_\bn_\bt_\be_\bg_\be_\br
+ How big the tiles should be. Default 40 pixels.
+
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bl_\bl_\bi_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long (in 1/1,000,000'ths of a second) to wait
+ between drawing each tile. Default 10,000 or .01
+ seconds.
+
+
+ -\b-r\bre\bed\bdo\boD\bDe\bel\bla\bay\by _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to wait between starting a completely new
+ tiling. Default 3 seconds.
+
+
+ -\b-a\bam\bmm\bma\ban\bnn\bn _\bi_\bn_\bt_\be_\bg_\be_\br
+
+ -\b-n\bno\bo-\b-a\bam\bmm\bma\ban\bnn\bn _\bi_\bn_\bt_\be_\bg_\be_\br
+ Whether Ammann lines should be added.
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1996 by Timo Korvola.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+
+
+
+X Version 11 10-May-97 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Timo Korvola <tkorvola@dopey.hut.fi>, 1996.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 3
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ pyro - simulate fireworks
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ p\bpy\byr\bro\bo [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-count _\bi_\bn_\bt_\be_\bg_\be_\br] [-frequency _\bi_\bn_\bt_\be_\bg_\be_\br]
+ [-scatter _\bi_\bn_\bt_\be_\bg_\be_\br]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bp_\by_\br_\bo program simulates fireworks, in a way similar to
+ a Macintosh program of the same name.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bp_\by_\br_\bo accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many particles should be allowed on the screen
+ at once. Default 100.
+
+ -\b-f\bfr\bre\beq\bqu\bue\ben\bnc\bcy\by _\bi_\bn_\bt_\be_\bg_\be_\br
+ How often new missiles should launch. Default 30.
+
+ -\b-s\bsc\bca\bat\btt\bte\ber\br _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many particles should appear when a missile
+ explodes. Default 20. The actual number used is
+ between _\bN and _\bN_\b+_\b(_\bN_\b/_\b2_\b).
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+
+
+X Version 11 13-aug-92 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 13-aug-92 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ qix - bounce colored lines around a window
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ q\bqi\bix\bx [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-segments _\bi_\bn_\bt] [-spread _\bp_\bi_\bx_\be_\bl_\bs] [-size
+ _\bp_\bi_\bx_\be_\bl_\bs] [-count _\bi_\bn_\bt] [-color-shift _\bd_\be_\bg_\br_\be_\be_\bs] [-delay _\bu_\bs_\be_\bc_\bs]
+ [-random] [-linear] [-solid] [-hollow] [-xor] [-no-xor]
+ [-transparent] [-non-transparent] [-additive] [-subtrac-
+ tive] [-poly _\bi_\bn_\bt] [-gravity] [-no-gravity]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bq_\bi_\bx program bounces a series of line segments around
+ its window. This is truly the swiss army chainsaw of qix
+ programs. If you know of one with more display modes, I
+ want to know about it.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bq_\bi_\bx accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-s\bse\beg\bgm\bme\ben\bnt\bts\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many line segments should be drawn. Default
+ 50.
+
+ -\b-s\bsp\bpr\bre\bea\bad\bd _\bi_\bn_\bt_\be_\bg_\be_\br
+ How far apart the endpoints of one segment should
+ be from the next. Default 8.
+
+ -\b-s\bsi\biz\bze\be _\bi_\bn_\bt_\be_\bg_\be_\br
+ The maximum distance one endpoint of a segment is
+ allowed to be from the opposite end of that seg-
+ ment. Default 0, meaning unlimited.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many qixes to draw. Default 1.
+
+
+
+
+
+X Version 11 27-Apr-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-c\bco\bol\blo\bor\br-\b-s\bsh\bhi\bif\bft\bt _\bd_\be_\bg_\br_\be_\be_\bs
+ If on a color display, the color of the line seg-
+ ments will cycle through the spectrum. This spec-
+ ifies how far the hue of each segment should be
+ from the next, in degrees on the HSV wheel.
+ Default 3.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How much of a delay should be introduced between
+ steps of the animation. Default 25000, or about
+ 0.025 seconds.
+
+ -\b-r\bra\ban\bnd\bdo\bom\bm The _\bq_\bi_\bx will wander around the screen semi-ran-
+ domly. This is the default.
+
+ -\b-l\bli\bin\bne\bea\bar\br The opposite of _\b-_\br_\ba_\bn_\bd_\bo_\bm: the _\bq_\bi_\bx will travel in
+ straight lines until it reaches a wall, and then
+ it will bounce.
+
+ -\b-s\bso\bol\bli\bid\bd If this is specified, then the area between the
+ line segments will be filled in with the appropri-
+ ate color, instead of the _\bq_\bi_\bx simply being com-
+ posed of one-pixel-wide line segments. This
+ option looks really good in color.
+
+ -\b-h\bho\bol\bll\blo\bow\bw The opposite of _\b-_\bs_\bo_\bl_\bi_\bd; this is the default.
+
+ -\b-x\bxo\bor\br If this is specified, then qix segments will be
+ drawn and erased with xor, instead of being drawn
+ in some color and erased in the background color.
+ This implies _\b-_\bm_\bo_\bn_\bo, in that only two colors can be
+ used.
+
+ -\b-t\btr\bra\ban\bns\bsp\bpa\bar\bre\ben\bnt\bt
+ If this is specified, and _\b-_\bc_\bo_\bu_\bn_\bt is greater than
+ 1, then each qix will be drawn in one color, and
+ when they overlap, the colors will be mixed. This
+ looks best in conjuction with _\b-_\bs_\bo_\bl_\bi_\bd.
+
+ -\b-n\bno\bon\bn-\b-t\btr\bra\ban\bns\bsp\bpa\bar\bre\ben\bnt\bt
+ Turns off _\b-_\bt_\br_\ba_\bn_\bs_\bp_\ba_\br_\be_\bn_\bt.
+
+ -\b-a\bad\bdd\bdi\bit\bti\biv\bve\be
+ If _\b-_\bt_\br_\ba_\bn_\bs_\bp_\ba_\br_\be_\bn_\bt is specified, then this option
+ means that the colors will be mixed using an addi-
+ tive color model, as if the qixes were projected
+ light. This is the default.
+
+ -\b-s\bsu\bub\bbt\btr\bra\bac\bct\bti\biv\bve\be
+ If _\b-_\bt_\br_\ba_\bn_\bs_\bp_\ba_\br_\be_\bn_\bt is specified, then this option
+ means that the colors will be mixed using a sub-
+ tractive color model, as if the qixes were
+ translucent filters.
+
+
+
+
+X Version 11 27-Apr-97 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-p\bpo\bol\bly\by _\bi_\bn_\bt
+ How many vertices each qix-line should have: the
+ default is 2, meaning the traditional qix line
+ shape. Three will yield triangles, and so on.
+
+ -\b-g\bgr\bra\bav\bvi\bit\bty\by
+
+ -\b-n\bno\bo-\b-g\bgr\bra\bav\bvi\bit\bty\by
+ Whether there should be downward attraction. For
+ example, the options -\b-g\bgr\bra\bav\bvi\bit\bty\by -\b-l\bli\bin\bne\bea\bar\br will make
+ everything move in nice smooth parabolas. Gravity
+ is off by default.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+ Thanks to Ariel Scolnicov for the -poly and -gravity
+ options.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 27-Apr-97 3
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ rd-bomb - reaction/diffusion textures
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ r\brd\bd-\b-b\bbo\bom\bmb\bb [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-install] [-visual
+ _\bv_\bi_\bs_\bu_\ba_\bl] [-width _\bn] [-height _\bn] [-reaction _\bn] [-diffusion
+ _\bn] [-size _\bf] [-speed _\bf] [-delay _\bu_\bs_\be_\bc_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\br_\bd_\b-_\bb_\bo_\bm_\bb program draws reaction/diffusion textures.
+ The code is derived from the 'd' mode of the "bomb" visual
+ musical instrument (see
+ http://www.cs.cmu.edu/~spot/bomb.html). I got the equa-
+ tions from xmorphia (http://www.ccsf.cal-
+ tech.edu/ismap/image.html), which is based on a version of
+ the Gray-Scott model taken from:
+ John E. Pearson "Complex Patterns in a Simple System"
+ Science, 261,189, 9 July 1993.
+
+ If the frame-rate is too low, consider decreasing the
+ width and height of the tile, or decreasing the size of
+ the active part of the screen.
+
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ If one of the reaction, diffusion, radius, and palette
+ options is set to a negative value, then that option will
+ be set to a random appropriate value.
+
+ Be sure to try "-speed 1 -size 0.1 -epoch 3000".
+
+ _\br_\bd_\b-_\bb_\bo_\bm_\bb accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-w\bwi\bid\bdt\bth\bh _\bn
+
+ -\b-h\bhe\bei\big\bgh\bht\bt _\bn
+ Specify the size of the tile, in pixels.
+
+ -\b-r\bre\bea\bac\bct\bti\bio\bon\bn _\bn
+
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-d\bdi\bif\bff\bfu\bus\bsi\bio\bon\bn _\bn
+ These are constants in the equations that effect
+ its visual nature. Each may be one of 0, 1, or 2.
+
+ -\b-r\bra\bad\bdi\biu\bus\bs _\bn
+ Size of the seed.
+
+ -\b-p\bpa\bal\ble\bet\btt\bte\be _\bn
+ Selects a palette. Must be between 0 and 80,
+ inclusive.
+
+ -\b-s\bsi\biz\bze\be _\bf What fraction of the window is actively drawn, a
+ floating point number between 0 (exclusive) and 1
+ (inclusive). Default is 0.66.
+
+ -\b-s\bsp\bpe\bee\bed\bd _\bf
+ When a fraction of the screen is active, the
+ active area moves at this rate (a floating point
+ number). Default is zero. Suggested value: 1.0.
+
+ -\b-d\bde\bel\bla\bay\by _\bu_\bs_\be_\bc_\bs
+ How many microseconds to delay between frames;
+ default 1000, or about 1/1000th of a second.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Scott Draves.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Scott Draves <spot@cs.cmu.edu>, 9/97
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ rocks - animation of flying through an asteroid field
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ r\bro\boc\bck\bks\bs [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-ncolors _\bn]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-count _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay
+ _\bu_\bs_\be_\bc_\bs] [-speed _\bi_\bn_\bt_\be_\bg_\be_\br] [-norotate] [-nomove] [-3d]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\br_\bo_\bc_\bk_\bs program draws an animation of an asteroid field
+ moving past the observer (or vice versa). Sometimes the
+ observer picks up spin on Z axis.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\br_\bo_\bc_\bk_\bs accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo Make all the rocks the same color.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs c\bco\bol\blo\bor\brs\bs
+ How many different colors to use. Default 5.
+ Colors are chosen randomly.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ Maximum number of rocks to draw on the screen at
+ once. Default 100.
+
+ -\b-s\bsp\bpe\bee\bed\bd _\bi_\bn_\bt_\be_\bg_\be_\br
+ A measure of the speed with which the observer and
+ the rocks pass each other, from 1 to 100. Default
+ 100, meaning ``very fast.'' If you're on a slow
+ display connection (the animation looks jerky)
+ then try making this number smaller, and/or
+ decreasing the number of rocks.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ Number of microseconds to delay between each
+ frame. Default 50000, meaning about 1/20th sec-
+ ond. Compare and contrast with _\b-_\bs_\bp_\be_\be_\bd, above.
+
+
+
+
+
+X Version 11 13-aug-92 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-n\bno\bor\bro\bot\bta\bat\bte\be
+ Don't rotate the observer; just fly through the
+ field on the level.
+
+ -\b-n\bno\bom\bmo\bov\bve\be Don't turn the observer; just fly straight ahead
+ through the field.
+
+ -\b-3\b3d\bd Do red/blue 3d separations: if you look at the
+ screen with 3d glasses, the rocks will be _\bj_\bu_\bm_\bp_\bi_\bn_\bg
+ right _\bo_\bu_\bt at you. Oooooh, scaaary!
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+B\bBU\bUG\bGS\bS
+ There should be an option to display doppler shift (a
+ gravity rainbow.)
+
+ Speed of rotation should be settable.
+
+ Default speed of rotation should be relative to forward
+ velocity.
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Based on Lisp Machine code copyright 1988 John Nguyen
+ <johnn@hx.lcs.mit.edu>.
+
+ Ported to C and X by Jamie Zawinski <jwz@jwz.org>,
+ 13-aug-92.
+
+ Steering code by Jeremie Petit; 3D code by theil-
+ ing@coli.uni-sb.de.
+
+
+
+
+
+
+X Version 11 13-aug-92 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ rorschach - simulate ink-blot patterns
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ r\bro\bor\brs\bsc\bch\bha\bac\bch\bh [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-iterations _\bi_\bn_\bt_\be_\bg_\be_\br] [-offset
+ _\bi_\bn_\bt_\be_\bg_\be_\br] [-xsymmetry] [-ysymmetry] [-erase-mode _\bi_\bn_\bt_\be_\bg_\be_\br]
+ [-erase-speed _\bu_\bs_\be_\bc_\bs] [-delay _\bs_\be_\bc_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\br_\bo_\br_\bs_\bc_\bh_\ba_\bc_\bh program draws random patterns reminiscent of
+ the psychological test of same name.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\br_\bo_\br_\bs_\bc_\bh_\ba_\bc_\bh accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-i\bit\bte\ber\bra\bat\bti\bio\bon\bns\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many dots should be drawn each time. Default
+ 4000.
+
+ -\b-o\bof\bff\bfs\bse\bet\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ How far apart the dots should be. Default 4 pix-
+ els.
+
+ -\b-x\bxs\bsy\bym\bmm\bme\bet\btr\bry\by
+ Whether the images should be horizontally symmet-
+ rical. Default true.
+
+ -\b-y\bys\bsy\bym\bmm\bme\bet\btr\bry\by
+ Whether the images should be vertically symmetri-
+ cal. Default false.
+
+ -\b-e\ber\bra\bas\bse\be-\b-m\bmo\bod\bde\be _\bi_\bn_\bt_\be_\bg_\be_\br
+ This sets the erase mode. Mode -1 chooses a random
+ mode each time. There are currently 6 modes
+ defined (0-5).
+
+
+
+
+X Version 11 13-aug-92 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-e\ber\bra\bas\bse\be-\b-s\bsp\bpe\bee\bed\bd _\bu_\bs_\be_\bc_\bs
+ This controls the speed at which the screen will
+ be erased. (Delay between erasing of individual
+ lines.)
+
+ -\b-d\bde\bel\bla\bay\by _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ This sets the number of seconds that the figure
+ will be on the screen.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+B\bBU\bUG\bGS\bS
+ May call your sanity into question.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 13-aug-92 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ sierpinski - draws Sierpinski triangle fractals
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bsi\bie\ber\brp\bpi\bin\bns\bsk\bki\bi [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay
+ _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs] [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bi_\be_\br_\bp_\bi_\bn_\bs_\bk_\bi program draws Sierpinski triangle fractals.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bi_\be_\br_\bp_\bi_\bn_\bs_\bk_\bi accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors are chosen randomly.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1996 by Desmond Daignault.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Desmond Daignault <tekdd@dtol.datatimes.com>, 05-Sep-96.
+ (Original xlock version was called tri.c.)
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97. (Renamed to
+ sierpinski.)
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ slidescreen - permute the screen image like an 8-puzzle
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bsl\bli\bid\bde\bes\bsc\bcr\bre\bee\ben\bn [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-background
+ _\bc_\bo_\bl_\bo_\br] [-grid-size _\bp_\bi_\bx_\be_\bl_\bs] [-ibw _\bp_\bi_\bx_\be_\bl_\bs] [-increment _\bp_\bi_\bx_\b-
+ _\be_\bl_\bs] [-delay _\bu_\bs_\be_\bc_\bs] [-delay2 _\bu_\bs_\be_\bc_\bs] [-window] [-root]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bl_\bi_\bd_\be_\bs_\bc_\br_\be_\be_\bn program takes an image of the screen,
+ divides it into a grid, deletes a random square of that
+ grid, and then randomly slides one of the neighbors of
+ this "hole" into the hole (and repeat.)
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bl_\bi_\bd_\be_\bs_\bc_\br_\be_\be_\bn accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-g\bgr\bri\bid\bd-\b-s\bsi\biz\bze\be _\bp_\bi_\bx_\be_\bl_\bs
+ The size of the grid cells. Default 70 pixels.
+
+ -\b-i\bib\bbw\bw _\bp_\bi_\bx_\be_\bl_\bs
+ The size of the "gutter" between grid cells.
+ Default 1 pixel.
+
+ -\b-i\bin\bnc\bcr\bre\bem\bme\ben\bnt\bt _\bp_\bi_\bx_\be_\bl_\bs
+ How many pixels by which a piece should be moved
+ when sliding to a new location. Default 10 pix-
+ els.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How much of a delay should be introduced between
+ steps of the animation of the motion of each seg-
+ ment. Default 50000, which is 0.05 seconds. This
+ is closely related to the _\b-_\bi_\bn_\bc_\br_\be_\bm_\be_\bn_\bt parameter.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How much of a delay should be introduced between
+ the end of the motion of one segment and the
+ beginning of the motion of another. Default
+ 1000000, which is one second.
+
+
+
+X Version 11 24-Nov-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+R\bRE\bES\bSO\bOU\bUR\bRC\bCE\bES\bS
+ On some systems (currently, only SGIs), this program can,
+ instead of grabbing a desktop image, grab a frame of video
+ from an external camera and manipulate that instead. The
+ following resources control that.
+
+
+ g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by (Float)
+ What portion of the time to grab video rather than
+ a screen image, between 0.0 and 1.0. Defaults to
+ 0.5, or half the time.
+
+ v\bvi\bid\bde\beo\boD\bDe\bev\bvi\bic\bce\be (Integer)
+ The number of the default video input device to
+ check first. If unspecified, the default camera
+ (from videopanel(1)) will be checked first. After
+ that, all other available video input devices will
+ be checked in order.
+
+ The first one which produces a non-black image
+ will be used. If all images are black, the others
+ will be re-checked a few times before giving up
+ and falling back to simply grabbing a desktop
+ image (but note that this takes a few seconds, so
+ if you don't actually have any video sources
+ hooked up, you should consider turning off video
+ grabbing by setting g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by to 0.0.)
+
+ v\bvi\bid\bde\beo\boG\bGa\bai\bin\bn (Float)
+ The amount by which to brighten the grabbed image.
+ This defaults to 2.2.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+
+
+
+X Version 11 24-Nov-97 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 3-dec-92.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 24-Nov-97 3
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ slip - sucks your screen into a jet engine
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bsl\bli\bip\bp [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-iterations _\bi_\bn_\bt_\be_\bg_\be_\br]
+ [-points _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs] [-delay2 _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\b-
+ _\bo_\bn_\bd_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bl_\bi_\bp program does lots of blits and chews up your
+ screen image.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bl_\bi_\bp accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 128. The colors used cycle through the
+ hue, making N stops around the color wheel.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many whooziwhatsis to generate. Default 35.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How long to frobnicate. Default 50.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long we should wait between drawing each step.
+ Default 50000, or about 1/20th second.
+
+
+R\bRE\bES\bSO\bOU\bUR\bRC\bCE\bES\bS
+ On some systems (currently, only SGIs), this program can,
+ instead of grabbing a desktop image, grab a frame of video
+ from an external camera and manipulate that instead. The
+ following resources control that.
+
+
+
+X Version 11 24-Nov-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by (Float)
+ What portion of the time to grab video rather than
+ a screen image, between 0.0 and 1.0. Defaults to
+ 0.5, or half the time.
+
+ v\bvi\bid\bde\beo\boD\bDe\bev\bvi\bic\bce\be (Integer)
+ The number of the default video input device to
+ check first. If unspecified, the default camera
+ (from videopanel(1)) will be checked first. After
+ that, all other available video input devices will
+ be checked in order.
+
+ The first one which produces a non-black image
+ will be used. If all images are black, the others
+ will be re-checked a few times before giving up
+ and falling back to simply grabbing a desktop
+ image (but note that this takes a few seconds, so
+ if you don't actually have any video sources
+ hooked up, you should consider turning off video
+ grabbing by setting g\bgr\bra\bab\bbV\bVi\bid\bde\beo\boP\bPr\bro\bob\bba\bab\bbi\bil\bli\bit\bty\by to 0.0.)
+
+ v\bvi\bid\bde\beo\boG\bGa\bai\bin\bn (Float)
+ The amount by which to brighten the grabbed image.
+ This defaults to 2.2.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992 by Scott Draves.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Scott Graves <spot@cs.cmu.edu>.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 18-Oct-93.
+
+
+
+
+
+
+X Version 11 24-Nov-97 2
+
+
--- /dev/null
+
+
+
+Sonar(1) Sonar(1)
+
+
+N\bNA\bAM\bME\bE
+ sonar - display a sonar scope
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bso\bon\bna\bar\br [-background _\bc_\bo_\bl_\bo_\br] [-sweep-color _\bc_\bo_\bl_\bo_\br] [-low-color
+ _\bc_\bo_\bl_\bo_\br] [-scope-color _\bc_\bo_\bl_\bo_\br] [-grid-color _\bc_\bo_\bl_\bo_\br]
+ [-text-color _\bc_\bo_\bl_\bo_\br] [-ttl _\bi_\bn_\bt_\be_\bg_\be_\br] [-mode ping] [-font
+ _\bf_\bo_\bn_\bt] [-ping-timeout _\bi_\bn_\bt] [-ping-source list | file | sub-
+ net ] [-ping-file _\bh_\bo_\bs_\bt_\bs_\b-_\bf_\bi_\bl_\be] [-ping-list _\bh_\bo_\bs_\bt_\b-_\bn_\ba_\bm_\be_\b-_\bl_\bi_\bs_\bt]
+ [-team-a-name _\bs_\bt_\br_\bi_\bn_\bg] [-team-b-name _\bs_\bt_\br_\bi_\bn_\bg] [-team-a-count
+ _\bi_\bn_\bt] [-team-b-count _\bi_\bn_\bt]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bo_\bn_\ba_\br program displays a sonar scope on the computer's
+ screen. This scope polls a sensor as the sweep goes
+ around the scope and displays what it finds as bogies on
+ the screen. The program is designed to support different
+ modes representing different types of sensors. Currently
+ the only implemented sensors are a simulator, and a net-
+ work ping function that pings hosts and plots the results
+ on the scope.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bo_\bn_\ba_\br understands the following options:
+
+ -\b-b\bba\bac\bck\bkg\bgr\bro\bou\bun\bnd\bd _\bC_\bo_\bl_\bo_\br
+ The background Color of the screen not covered by
+ the scope.
+
+ -\b-s\bsw\bwe\bee\bep\bp-\b-c\bco\bol\blo\bor\br _\bC_\bo_\bl_\bo_\br
+ The color of the brightest part of the sweep.
+
+ -\b-s\bsc\bco\bop\bpe\be-\b-c\bco\bol\blo\bor\br _\bC_\bo_\bl_\bo_\br
+ The color of the circular part of the scope.
+
+ -\b-g\bgr\bri\bid\bd-\b-c\bco\bol\blo\bor\br _\bC_\bo_\bl_\bo_\br
+ The color to the grid lines overlaying the scope.
+
+ -\b-t\bte\bex\bxt\bt-\b-c\bco\bol\blo\bor\br _\bC_\bo_\bl_\bo_\br
+ The color of the text identifying bogies on the
+ scope.
+
+ -\b-t\btt\btl\bl _\bi_\bn_\bt_\be_\bg_\be_\br
+ "Time to live": visible time of a Bogie. Try val-
+ ues between 10 (very short) and 100.
+
+ -\b-m\bmo\bod\bde\be _\bs_\bi_\bm_\bu_\bl_\ba_\bt_\bi_\bo_\bn _\b| _\bp_\bi_\bn_\bg
+ The sensor mode to use, the currently supported
+ modes _\bs_\bi_\bm_\bu_\bl_\ba_\bt_\be (the default) and _\bp_\bi_\bn_\bg.
+
+ -\b-f\bfo\bon\bnt\bt _\bf_\bo_\bn_\bt
+ The font used to display text on the scope.
+ Default "fixed".
+
+
+
+
+X Version 11 3-Nov-98 1
+
+
+
+
+
+Sonar(1) Sonar(1)
+
+
+ -\b-p\bpi\bin\bng\bg-\b-t\bti\bim\bme\beo\bou\but\bt _\bi_\bn_\bt
+ The amount of time in milliseconds the program
+ will wait for an answer to a ping.
+
+ -\b-p\bpi\bin\bng\bg-\b-s\bso\bou\bur\brc\bce\be l\bli\bis\bst\bt |\b| f\bfi\bil\ble\be |\b| s\bsu\bub\bbn\bne\bet\bt
+ Th source of the list of hosts to ping. Valid val-
+ ues are: _\bl_\bi_\bs_\bt, _\bf_\bi_\bl_\be, _\bs_\bu_\bb_\bn_\be_\bt. The first two values
+ are described below; and _\bs_\bu_\bb_\bn_\be_\bt indicates that the
+ sonar should ping all hosts in the same subnet as
+ the current machine. (All addresses are treated
+ as class C nets, therefore this will at most ping
+ 254 hosts.)
+
+ -\b-p\bpi\bin\bng\bg-\b-f\bfi\bil\ble\be _\bf_\bi_\bl_\be_\bn_\ba_\bm_\be
+ The path to a file listing the hosts to ping.
+ This file can be in the format used by _\b/_\be_\bt_\bc_\b/_\bh_\bo_\bs_\bt_\bs,
+ or it can be any file that has host names as the
+ first element on each line. If you use ssh, try
+ this:
+
+ sonar -mode ping -ping-file $HOME/.ssh/known_hosts
+
+ This is used only used when _\bp_\bi_\bn_\bg_\bS_\bo_\bu_\br_\bc_\be is set to
+ f\bfi\bil\ble\be.
+
+ -\b-p\bpi\bin\bng\bg-\b-l\bli\bis\bst\bt _\bl_\bi_\bs_\bt
+ A comma separated list of hostnames, eg
+ _\b"_\bp_\bi_\bn_\bk_\by_\b,_\bb_\br_\ba_\bi_\bn_\b,_\bd_\bo_\bt_\b". Only used when _\bp_\bi_\bn_\bg_\bS_\bo_\bu_\br_\bc_\be is
+ set to l\bli\bis\bst\bt.
+
+ -\b-t\bte\bea\bam\bm-\b-a\ba-\b-n\bna\bam\bme\be _\bs_\bt_\br_\bi_\bn_\bg
+ The name of team A, in simulation-mode.
+
+ -\b-t\bte\bea\bam\bm-\b-b\bb-\b-n\bna\bam\bme\be _\bs_\bt_\br_\bi_\bn_\bg
+ The name of team B, in simulation-mode.
+
+ -\b-t\bte\bea\bam\bm-\b-a\ba-\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt
+ The number of bogies on team A, in simulation-
+ mode.
+
+ -\b-t\bte\bea\bam\bm-\b-b\bb-\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt
+ The number of bogies on team B, in simulation-
+ mode.
+
+R\bRE\bES\bSO\bOU\bUR\bRC\bCE\bES\bS
+ Configuration of the targets to ping is best done by set-
+ ting X Resources.
+
+
+ b\bba\bac\bck\bkg\bgr\bro\bou\bun\bnd\bd _\b(_\bC_\bo_\bl_\bo_\br_\b)
+ See option -background, above; default value is
+ _\bb_\bl_\ba_\bc_\bk.
+
+
+
+
+
+X Version 11 3-Nov-98 2
+
+
+
+
+
+Sonar(1) Sonar(1)
+
+
+ s\bsw\bwe\bee\bep\bpC\bCo\bol\blo\bor\br _\b(_\bC_\bo_\bl_\bo_\br_\b)
+ See option -sweep-color, above; default value is
+ _\b#_\b0_\b0_\bf_\bf_\b0_\b0.
+
+ s\bsc\bco\bop\bpe\beC\bCo\bol\blo\bor\br _\b(_\bC_\bo_\bl_\bo_\br_\b)
+ See option -scope-color, above; default value is
+ _\b#_\b0_\b0_\b3_\b3_\b0_\b0.
+
+ g\bgr\bri\bid\bdC\bCo\bol\blo\bor\br _\b(_\bC_\bo_\bl_\bo_\br_\b)
+ See option -grid-color, above; default value is
+ _\b#_\b0_\b0_\ba_\ba_\b0_\b0.
+
+ t\bte\bex\bxt\btC\bCo\bol\blo\bor\br _\b(_\bC_\bo_\bl_\bo_\br_\b)
+ See option -text-color, above; default value is
+ _\b#_\bf_\bf_\bf_\bf_\b0_\b0.
+
+ t\btt\btl\bl _\b(_\bi_\bn_\bt_\be_\bg_\be_\br_\b)
+ See option -ttl, above; default value is _\b9_\b0 or one
+ sweep.
+
+ m\bmo\bod\bde\be _\b(_\bp_\bi_\bn_\bg_\b)
+ See option -mode, above. If set to d\bde\bef\bfa\bau\bul\blt\bt, it
+ will ping hosts if possible, otherwise, will run
+ in simulation-mode.
+
+ f\bfo\bon\bnt\bt _\b(_\bf_\bo_\bn_\bt_\b)
+ See option -font, above; default value is _\bf_\bi_\bx_\be_\bd.
+
+ p\bpi\bin\bng\bgT\bTi\bim\bme\beo\bou\but\bt _\b(_\bI_\bn_\bt_\be_\bg_\be_\br_\b)
+ See option -pingtimeout, above; default value is
+ 3000.
+
+ p\bpi\bin\bng\bgS\bSo\bou\bur\brc\bce\be _\bl_\bi_\bs_\bt _\b| _\bf_\bi_\bl_\be _\b| _\bs_\bu_\bb_\bn_\be_\bt
+ See option -ping-source, above. Default value is
+ _\bf_\bi_\bl_\be.
+
+ p\bpi\bin\bng\bgF\bFi\bil\ble\be _\bp_\ba_\bt_\bh_\bn_\ba_\bm_\be
+ See option -ping-file, above. Default value is
+ _\b/_\be_\bt_\bc_\b/_\bh_\bo_\bs_\bt_\bs.
+
+ p\bpi\bin\bng\bgL\bLi\bis\bst\bt _\bh_\bo_\bs_\bt_\b,_\bh_\bo_\bs_\bt_\b,_\bh_\bo_\bs_\bt_\b._\b._\b.
+ See option -ping-list, above; default value is
+ l\blo\boc\bca\bal\blh\bho\bos\bst\bt.
+
+ t\bte\bea\bam\bmA\bAN\bNa\bam\bme\be _\bs_\bt_\br_\bi_\bn_\bg
+ See option -team-a-name, above. Default value is
+ F\bF1\b18\b8.
+
+ t\bte\bea\bam\bmB\bBN\bNa\bam\bme\be _\bs_\bt_\br_\bi_\bn_\bg
+ See option -teamBName, above. Default value is
+ M\bMI\bIG\bG.
+
+ t\bte\bea\bam\bmA\bAC\bCo\bou\bun\bnt\bt _\bi_\bn_\bt
+ See option -teamACount, above. Default value is
+
+
+
+X Version 11 3-Nov-98 3
+
+
+
+
+
+Sonar(1) Sonar(1)
+
+
+ 4.
+
+ t\bte\bea\bam\bmB\bBC\bCo\bou\bun\bnt\bt _\bi_\bn_\bt
+ See option -teamBCount, above. Default value is
+ 4.
+
+N\bNO\bOT\bTE\bES\bS
+ In order to use the ping sensor, this program must be
+ installed as setuid root, so that it can create an ICMP
+ socket.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), p\bpi\bin\bng\bg(8)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1998 by Stephen Martin. (smartin@canada.com)
+
+ Permission to use, copy, modify, distribute, and sell this
+ software and its documentation for any purpose is hereby
+ granted without fee, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation. No representations are made about the
+ suitability of this software for any purpose. It is pro-
+ vided "as is" without express or implied warranty.
+
+
+A\bAU\bUT\bTH\bHO\bOR\bRS\bS
+ Stephen Martin <smartin@canada.com>, 3-nov-98.
+
+ Thanks to Tom Kelly for suggesting a modular approach to
+ the sensor amoung other things.
+
+ Thomas Bahls <thommy@cs.tu-berlin.de> hacked the "ttl"
+ option, 12-jul-98.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 3-Nov-98 4
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ sphere - draws shaded spheres
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bsp\bph\bhe\ber\bre\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bp_\bh_\be_\br_\be program draws shaded spheres.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bp_\bh_\be_\br_\be accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors are chosen randomly.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1988 by Sun Microsystems, Inc.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+
+
+
+X Version 11 27-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Sun Microsystems, Inc, 1988.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 27-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 27-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ spiral - draws moving circular spiral patterns
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bsp\bpi\bir\bra\bal\bl [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-count _\bi_\bn_\bt_\be_\bg_\be_\br]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bp_\bi_\br_\ba_\bl program draws moving circular spiral patterns
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bp_\bi_\br_\ba_\bl accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors are chosen randomly.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+ Default 40.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ Default 350.
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1994 by Darrick Brown.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Darrick Brown, 1994.
+
+ Improved by Peter Schmitzberger <schmitz@coma.sbg.ac.at>,
+ 24-Jul-95.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ spotlight - move spotlight around desktop
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bsp\bpo\bot\btl\bli\big\bgh\bht\bt [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-delay _\bu_\bs_\be_\bc_\bs] [-radius _\bp_\bi_\bx_\b-
+ _\be_\bl_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bp_\bo_\bt_\bl_\bi_\bg_\bh_\bt program draws random rectangles.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bp_\bo_\bt_\bl_\bi_\bg_\bh_\bt accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ Slow it down.
+
+ -\b-r\bra\bad\bdi\biu\bus\bs _\bp_\bi_\bx_\be_\bl_\bs
+ Radius of the spotlight in pixels.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1999 by Rick Schultz. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+
+
+
+X Version 11 05-Apr-1999 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+C\bCR\bRE\bED\bDI\bIT\bTS\bS
+ Hacked together by Rick Schultz <rick@skapunx.net>, based
+ on StefView for BackSpace by Darcy Brockbank and on sev-
+ eral other xscreensaver hacks.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 05-Apr-1999 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ squiral - square spirals screensaver
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bsq\bqu\bui\bir\bra\bal\bl [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-noinstall] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-fill _\bp_\be_\br_\bc_\be_\bn_\bt] [-count _\bn_\bu_\bm_\b-
+ _\bb_\be_\br] [-delay _\bu_\bs_\be_\bc] [-disorder _\bf_\br_\ba_\bc_\bt_\bi_\bo_\bn] [-handedness _\bf_\br_\ba_\bc_\b-
+ _\bt_\bi_\bo_\bn] [-cycle]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bq_\bu_\bi_\br_\ba_\bl program displays interacting, spiral-producing
+ automata
+
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bq_\bu_\bi_\br_\ba_\bl accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-f\bfi\bil\bll\bl _\bp_\be_\br_\bc_\be_\bn_\bt
+ Specify the percent (0-100) of the screen which
+ must be filled before the screen is cleared.
+ 60-80 percent are good values.
+
+ -\b-c\bco\bou\bun\bnt\bt _\bn_\bu_\bm_\bb_\be_\br
+ The number of squiralies. By default, the screen
+ width divided by 32.
+
+ -\b-d\bde\bel\bla\bay\by _\bu_\bs_\be_\bc
+ The wait between steps. The default is 1000.
+
+ -\b-d\bdi\bis\bso\bor\brd\bde\ber\br _\bf_\br_\ba_\bc_\bt_\bi_\bo_\bn
+ The fraction of the time a squiraly will choose a
+ new direction. The default is 0.005.
+
+ -\b-h\bha\ban\bnd\bde\bed\bdn\bne\bes\bss\bs _\bf_\br_\ba_\bc_\bt_\bi_\bo_\bn
+ The fraction of the time a squiraly will choose to
+ enter lefthanded mode. 0.0 means exclusively
+ right-handed behavior, 0.5 (the default) is a
+
+
+
+X Version 11 18-mar-1999 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ balance between the two, and 1.0 is exclusively
+ left-handed behaviour.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+B\bBU\bUG\bGS\bS
+ None known
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1999, by Jeff Epler. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided fnord that the above copyright notice appear
+ in all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of fnord
+ this software for any purpose. It is provided "as is"
+ without express or fnord implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jeff Epler <jepler@inetnebr.com>, 18-mar-1999
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 18-mar-1999 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ starfish - radially-symmetric throbbing colormap-hacking
+ graphics demo
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bst\bta\bar\brf\bfi\bis\bsh\bh [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground
+ _\bc_\bo_\bl_\bo_\br] [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono]
+ [-install] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-delay _\bu_\bs_\be_\bc_\bs] [-delay2 _\bs_\be_\bc_\bs]
+ [-cycle-delay2 _\bu_\bs_\be_\bc_\bs] [-thickness _\bp_\bi_\bx_\be_\bl_\bs] [-rotation
+ _\bd_\be_\bg_\br_\be_\be_\bs] [-duration _\bs_\be_\bc_\bo_\bn_\bd_\bs] [-colors _\bi_\bn_\bt] [-cycle]
+ [-no-cycle] [-blob] [-no-blob]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bt_\ba_\br_\bf_\bi_\bs_\bh program draws radially symmetric objects,
+ which expand, contract, rotate, and turn inside out. It
+ uses these shapes to lay down a field of smooth colors,
+ and then rotates the colormap.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bt_\ba_\br_\bf_\bi_\bs_\bh accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How much of a delay should be introduced between
+ steps of the animation. Default 10000, or about
+ 1/100th second.
+
+ -\b-c\bcy\byc\bcl\ble\be-\b-d\bde\bel\bla\bay\by _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to wait between shifing the colormap by
+ one step. Default 100000, or about 1/10th second.
+
+ -\b-t\bth\bhi\bic\bck\bkn\bne\bes\bss\bs _\bp_\bi_\bx_\be_\bl_\bs
+ How wide each color band should be. Default 0,
+ meaning random (the chosen value will be between 0
+ and 15.)
+
+ -\b-r\bro\bot\bta\bat\bti\bio\bon\bn _\bd_\be_\bg_\br_\be_\be_\bs
+ How quickly the objects should rotate at each
+ step. Default 0, meaning random (the chosen value
+
+
+
+X Version 11 14-Jun-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ will be between 0 and 12 degrees.)
+
+ -\b-c\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt
+ How many colors to use. Default 200. The more
+ colors, the smoother the transitions will be, and
+ the nicer the resultant images.
+
+ -\b-c\bcy\byc\bcl\ble\be
+
+ -\b-n\bno\bo-\b-c\bcy\byc\bcl\ble\be
+ Whether to do colormap cycling. Default true.
+
+ -\b-d\bdu\bur\bra\bat\bti\bio\bon\bn _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to run before choosing a new shape.
+ Default 30 seconds.
+
+ -\b-d\bde\bel\bla\bay\by2\b2 _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ When _\bd_\bu_\br_\ba_\bt_\bi_\bo_\bn expires, how long to wait before
+ starting a new run. Default 5 seconds.
+
+ -\b-b\bbl\blo\bob\bb
+
+ -\b-n\bno\bo-\b-b\bbl\blo\bob\bb
+ If _\bb_\bl_\bo_\bb option is specified, then the raw shapes
+ will be shown, instead of a field of colors gener-
+ ated from them.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Jamie Zawinski. Permission to use,
+ copy, modify, distribute, and sell this software and its
+ documentation for any purpose is hereby granted without
+ fee, provided that the above copyright notice appear in
+ all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 14-Jun-97.
+
+
+
+
+
+
+X Version 11 14-Jun-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ strange - draws strange attractors
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bst\btr\bra\ban\bng\bge\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bt_\br_\ba_\bn_\bg_\be program draws strange attractors
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bt_\br_\ba_\bn_\bg_\be accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 64. The colors are chosen randomly.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Massimino Pascal.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Massimino Pascal <Pascal.Massimon@ens.fr>, 1997.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ swirl - draws swirly color-cycling patterns
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ s\bsw\bwi\bir\brl\bl [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bs_\bw_\bi_\br_\bl program draws swirly color-cycling patterns.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bs_\bw_\bi_\br_\bl accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 200.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+
+
+
+
+X Version 11 13-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1994 M. Dobie.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ M.Dobie <mrd@ecs.soton.ac.uk>, 1994.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 13-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 13-May-97 2
+
+
--- /dev/null
+
+
+
+t3d(1) t3d(1)
+
+
+N\bNA\bAM\bME\bE
+ t3d - clock using flying balls to display the time
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ t3d [ _\bo_\bp_\bt_\bi_\bo_\bn_\bs ]...
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ Time 3D is a clock. It uses flying balls to display the
+ time. This balls move and wobble around to give you the
+ impression your graphic workstation with its many XStones
+ is doing something.
+
+ t3d uses mouse and keyboard to let you fly through the
+ balls. Hit S\bS to speed up, A\bA to slow down, Z\bZ to zoom in and
+ X\bX to zoom out. Use the l\ble\bef\bft\bt m\bmo\bou\bus\bse\be b\bbu\but\btt\bto\bon\bn to rotate to the
+ left and the r\bri\big\bgh\bht\bt m\bmo\bou\bus\bse\be b\bbu\but\btt\bto\bon\bn to rotate the view to the
+ right. Use the m\bmi\bid\bdd\bdl\ble\be m\bmo\bou\bus\bse\be b\bbu\but\btt\bto\bon\bn to change the optical
+ axis and the moving direction. 0\b0 (zero) will stop you. Q\bQ
+ quits.
+
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ -\b-m\bmo\bov\bve\be _\bf_\ba_\bc_\bt_\bo_\br
+ Modifies the direction move of t3d. The clock looks
+ 30 degrees* _\bf_\ba_\bc_\bt_\bo_\br to the left and to the right
+ periodically.
+
+ -\b-w\bwo\bob\bbb\bbl\ble\be _\bf_\ba_\bc_\bt_\bo_\br
+ Modifies the wobbling (sounds nice :-) of t3d by
+ multiplying the default deformation of the clock
+ with _\bf_\ba_\bc_\bt_\bo_\br_\b.
+
+ -\b-m\bmi\bin\bnu\but\bte\bes\bs
+ Shows one small ball for every minute, instead of
+ one for every 2.5 minutes.
+
+ -\b-m\bma\bag\bg _\bf_\ba_\bc_\bt_\bo_\br
+ Changes the magnification of t3d. By default, t3d
+ draws a 200x200 image. A .I factor of 2 means, it
+ will use a 400x400 image.
+
+ -\b-c\bcy\byc\bcl\ble\be _\bp_\be_\br_\bi_\bo_\bd
+ Sets the moving cycle to _\bp_\be_\br_\bi_\bo_\bd seconds. By
+ default, this value is 10 seconds.
+
+ -\b-w\bwa\bai\bit\bt _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc
+ Inserts a wait after drawing one view of the clock.
+ By default, t3d waits 40 ms after each drawing.
+ This helps you to keep the performance loss small.
+
+ -\b-f\bfa\bas\bst\bt _\bp_\br_\be_\bc_\ba_\bl_\bc_\b__\br_\ba_\bd_\bi_\bu_\bs
+ t3d uses bitmap copy to draw precalculated balls.
+ You can specify the radius in pixels up to which
+ t3d should precalculate balls. t3d will set a
+
+
+
+Time 3D Version 1.1 1
+
+
+
+
+
+t3d(1) t3d(1)
+
+
+ useful range by itself using the magnification when
+ it is started.
+
+ -\b-c\bco\bol\blc\bcy\byc\bcl\ble\be
+ Draws cyclic the color scale used for the balls in
+ the background instead of the normal black.
+
+ -\b-r\brg\bgb\bb _\br_\be_\bd _\bg_\br_\be_\be_\bn _\bb_\bl_\bu_\be
+ Selects the color in RGB color space of the light-
+ ning spot on the balls. All the other colors used
+ for balls or -\b-c\bco\bol\blc\bcy\byc\bcl\ble\be are less intensive colors of
+ the same hue and saturation. All values in range of
+ 0 to 1.
+
+ -\b-h\bhs\bsv\bv _\bh_\bu_\be _\bs_\ba_\bt_\bu_\br_\ba_\bt_\bi_\bo_\bn _\bv_\ba_\bl_\bu_\be
+ Selects the color in HSV color space. _\bh_\bu_\be is in
+ degrees from 0 to 360, all other values in range
+ from 0 to 1. It gives nice but rather unpredictable
+ results, if you use a saturation of e.g. 2. Try it
+ at your own risk.
+
+ -\b-h\bhs\bsv\bvc\bcy\byc\bcl\ble\be _\bs_\bp_\be_\be_\bd
+ Rotates the hue axis every 10 seconds* _\bs_\bp_\be_\be_\bd_\b.
+
+ -\b-h\bhe\bel\blp\bp Prints a short usage message.
+
+
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Bernd Paysan
+
+ Email: bernd.paysan@gmx.de
+
+ Hacked on by jwz@jwz.org for xscreensaver.
+
+
+A\bAC\bCK\bKN\bNO\bOW\bWL\bLE\bED\bDG\bGE\bEM\bME\bEN\bNT\bT
+ Acknowledgement to Georg Acher, who wrote the initial pro-
+ gram displaying balls.
+
+
+C\bCO\bOP\bPY\bYI\bIN\bNG\bG
+ Copy, modify, and distribute T3D either under GPL version
+ 2 or newer, or under the standard MIT/X license notice.
+
+
+D\bDI\bIS\bSC\bCL\bLA\bAI\bIM\bME\bER\bR
+ T3D is not related to T3D(tm), the massive parallel
+ Alpha--based supercomputer from Cray Research. T3D's name
+ was invented in 1991, years before the project at Cray
+ Research started. There is no relation from T3D to Cray's
+ T3D, even the balls surrounding T3D on some posters
+ weren't an inspiration for T3D. I don't know anything
+ about the other way round.
+
+
+
+Time 3D Version 1.1 2
+
+
+
+
+
+t3d(1) t3d(1)
+
+
+ The programming style of T3D isn't intented as example of
+ good style, but as example of how a fast prototyped demo
+ may look like. T3D wasn't created to be useful, it was
+ created to be nice.
+
+
+K\bKN\bNO\bOW\bWN\bN B\bBU\bUG\bGS\bS
+ There are no known bugs in T3D. Maybe there are bugs in X.
+ Slight changes in the T3D sources are known to show these
+ bugs, e.g. if you remove the (int) casting at the XFillArc
+ x,y,w,h-coordinates...
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+Time 3D Version 1.1 3
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ vidwhacker - grab images and apply random filters to them
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ v\bvi\bid\bdw\bwh\bha\bac\bck\bke\ber\br [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-root] [-win-
+ dow] [-verbose] [-stdin] [-stdout] [-delay seconds]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bv_\bi_\bd_\bw_\bh_\ba_\bc_\bk_\be_\br program grabs a image from the system's
+ video input, applies random image filters to it, and dis-
+ plays the result. The _\bv_\bi_\bd_\bw_\bh_\ba_\bc_\bk_\be_\br program does not termi-
+ nate until killed. It depends heavily on x\bxv\bv(1) and the
+ various PBM tools (e.g., p\bpp\bpm\bmr\bre\bel\bli\bie\bef\bf(1).)
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bv_\bi_\bd_\bw_\bh_\ba_\bc_\bk_\be_\br accepts the following options:
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Pop up a new window displaying the image. When a
+ new image has been fully processed, destroy that
+ window and pop up a new one. This is the default.
+
+ -\b-v\bve\ber\brb\bbo\bos\bse\be
+ Print diagnostics.
+
+ -\b-s\bst\btd\bdi\bin\bn Instead of grabbing an image from the system's
+ video input, read an image to maniupulate from
+ stdin. This image must be in
+
+ -\b-d\bde\bel\bla\bay\by _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to sleep between images. Default 3 sec-
+ onds (the actual elapsed time is significantly
+ longer, due to processing time.) p\bpp\bpm\bm(5) format.
+ The program will still perform repeated random
+ image transformations, but it will always use this
+ one image as its starting point.
+
+ -\b-s\bst\btd\bdo\bou\but\bt Instead of displaying the image on a window or on
+ the root, write the new image on stdout, and exit.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+B\bBU\bUG\bGS\bS
+ Grabbing video images is, of course, very system-depen-
+ dent. It works on SGIs, and on Linux systems that have
+ the q\bqc\bca\bam\bm(1) program. If your system does things differ-
+ ently, you'll need to edit the vidwhacker script (look for
+
+
+
+X Version 11 17-Jun-99 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ the _\bg_\br_\ba_\bb_\b(_\b) function.)
+
+ It's slow.
+
+T\bTO\bO D\bDO\bO
+ It might be interesting to rewrite this to use g\bgi\bim\bmp\bp(1)
+ plugins instead of the pbm tools. It probably wouldn't be
+ any faster, but there would be a wider variety of effects
+ available.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxv\bv(1), p\bpp\bpm\bmt\bto\bog\bgi\bif\bf(1), c\bcj\bjp\bpe\beg\bg(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1998, 1999 by Jamie Zawinski. Permission to
+ use, copy, modify, distribute, and sell this software and
+ its documentation for any purpose is hereby granted with-
+ out fee, provided that the above copyright notice appear
+ in all copies and that both that copyright notice and this
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 18-Jan-98.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 17-Jun-99 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ vines - draws pseudo-fractal geometric patterns
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ v\bvi\bin\bne\bes\bs [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bv_\bi_\bn_\be_\bs program is yet another geometric pattern genera-
+ tor, this one's claim to fame being a pseudo-fractal look-
+ ing vine like pattern that creates nifty whorls and loops.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bv_\bi_\bn_\be_\bs accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 200. The colors are chosen randomly.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Tracy Camp.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+
+
+
+X Version 11 10-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Tracy Camp <campt@hurrah.com>, 1997.
+
+ Tweaked by David Hansen <dhansen@metapath.com>, 21-Mar-97.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 10-May-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ webcollage - decorate the screen with random images from
+ the web
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ w\bwe\beb\bbc\bco\bol\bll\bla\bag\bge\be [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-root] [-ver-
+ bose] [-delay _\bs_\be_\bc_\bs] [-timeout _\bs_\be_\bc_\bs] [-background _\bb_\bg]
+ [-filter _\bc_\bo_\bm_\bm_\ba_\bn_\bd] [-filter2 _\bc_\bo_\bm_\bm_\ba_\bn_\bd]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bw_\be_\bb_\bc_\bo_\bl_\bl_\ba_\bg_\be program pulls random image off of the World
+ Wide Web and scatters them on the root window. It finds
+ these images by doing random web searches, and extracting
+ images from the returned pages. It places the images on
+ the root window by using the x\bxv\bv(1), g\bgi\bif\bft\bto\bop\bpn\bnm\bm(1), and
+ d\bdj\bjp\bpe\beg\bg(1) tools.
+
+ _\bw_\be_\bb_\bc_\bo_\bl_\bl_\ba_\bg_\be also works as a CGI program: simply make a sym-
+ bolic link to the _\bw_\be_\bb_\bc_\bo_\bl_\bl_\ba_\bg_\be executable called _\bn_\bp_\bh_\b-_\bw_\be_\bb_\bc_\bo_\bl_\b-
+ _\bl_\ba_\bg_\be_\b._\bc_\bg_\bi. If this program sees that it is being run as a
+ CGI, then it will behave appropriately. (The generated
+ web page will list the images one after another, rather
+ than tiling them together.)
+
+ _\bw_\be_\bb_\bc_\bo_\bl_\bl_\ba_\bg_\be is written in p\bpe\ber\brl\bl(1) and requires Perl 5.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bw_\be_\bb_\bc_\bo_\bl_\bl_\ba_\bg_\be accepts the following options:
+
+ -\b-r\bro\boo\bot\bt Draw on the root window. This option is mandi-
+ tory: drawing to a window other than the root win-
+ dow is not yet supported.
+
+ -\b-v\bve\ber\brb\bbo\bos\bse\be or -\b-v\bv
+ Print diagnostics to stderr. Multiple _\b-_\bv switches
+ increase the amount of output. _\b-_\bv will print out
+ only the URLs of the images; _\b-_\bv_\bv will print all
+ the commands being run; and _\b-_\bv_\bv_\bv will print more
+ than you care about.
+
+ -\b-d\bde\bel\bla\bay\by _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to sleep between images. Default 1 sec-
+ ond. (Remember that this program probably spends
+ a lot of time waiting for the network.)
+
+ -\b-b\bba\bac\bck\bkg\bgr\bro\bou\bun\bnd\bd _\bc_\bo_\bl_\bo_\br_\b-_\bo_\br_\b-_\bp_\bp_\bm
+ What to use for the background onto which images
+ are pasted. This may be a color name, a hexadeci-
+ mal RGB specification in the form '#rrggbb', or
+ the name of a PPM file.
+
+ -\b-t\bti\bim\bme\beo\bou\but\bt _\bs_\be_\bc_\bo_\bn_\bd_\bs
+ How long to wait for a URL to complete before giv-
+ ing up on it and moving on to the next one.
+
+
+
+X Version 11 17-Jun-99 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ Default 30 seconds.
+
+ -\b-f\bfi\bil\blt\bte\ber\br _\bc_\bo_\bm_\bm_\ba_\bn_\bd
+ Filter all source images through this command.
+ The command must take a PPM file on stdin, and
+ write a new PPM file to stdout. One good choice
+ for a filter would be:
+
+ webcollage -root -filter 'vidwhacker -stdin -stdout'
+
+
+ -\b-f\bfi\bil\blt\bte\ber\br2\b2 _\bc_\bo_\bm_\bm_\ba_\bn_\bd
+ Filter the _\bc_\bo_\bm_\bp_\bo_\bs_\bi_\bt_\be image through this command.
+ The _\b-_\bf_\bi_\bl_\bt_\be_\br option applies to the sub-images; the
+ _\b-_\bf_\bi_\bl_\bt_\be_\br_\b2 applies to the final, full-screen image.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+F\bFI\bIL\bLE\bES\bS A\bAN\bND\bD U\bUR\bRL\bLS\bS
+ _\b/_\bu_\bs_\br_\b/_\bd_\bi_\bc_\bt_\b/_\bw_\bo_\br_\bd_\bs or _\b/_\bu_\bs_\br_\b/_\bs_\bh_\ba_\br_\be_\b/_\bl_\bi_\bb_\b/_\bd_\bi_\bc_\bt_\b/_\bw_\bo_\br_\bd_\bs
+ To find the random words to feed to search engines.
+
+ _\bh_\bt_\bt_\bp_\b:_\b/_\b/_\br_\ba_\bn_\bd_\bo_\bm_\b._\by_\ba_\bh_\bo_\bo_\b._\bc_\bo_\bm_\b/_\bb_\bi_\bn_\b/_\br_\by_\bl_\b,
+ _\bh_\bt_\bt_\bp_\b:_\b/_\b/_\bi_\bm_\ba_\bg_\be_\b._\ba_\bl_\bt_\ba_\bv_\bi_\bs_\bt_\ba_\b._\bc_\bo_\bm_\b/ To find random web pages.
+
+B\bBU\bUG\bGS\bS
+ When drawing on the root window, it always uses the
+ default colormap. This is actually a limitation of xv.
+ But regardless, when using this program with xscreensaver,
+ it must be given the d\bde\bef\bfa\bau\bul\blt\bt-\b-n\bn visual specification (see
+ the x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1) manual for more details.)
+
+ Only the GIF and JPEG image formats are supported.
+
+ Transparent and animating GIFs are not supported.
+
+ It's slow.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxv\bv(1), g\bgi\bif\bft\bto\bop\bpn\bnm\bm(1), d\bdj\bjp\bpe\beg\bg(1), v\bvi\bid\bd-\b-
+ w\bwh\bha\bac\bck\bke\ber\br(1), p\bpe\ber\brl\bl(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1998, 1999 by Jamie Zawinski. Permission to
+ use, copy, modify, distribute, and sell this software and
+ its documentation for any purpose is hereby granted with-
+ out fee, provided that the above copyright notice appear
+ in all copies and that both that copyright notice and this
+
+
+
+X Version 11 17-Jun-99 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ permission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 24-May-98.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 17-Jun-99 3
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ xjack - all work and no play makes jack a dull boy
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ x\bxj\bja\bac\bck\bk [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-delay _\bu_\bs_\be_\bc_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ All work and no play makes jack a dull boy. All work and
+ no play makes jack a dull boy. All work and no play makes
+ jack a dull boy. All work and no play makes jack a dull
+ boy. All work and no play makes jack a dull boy. All
+ work and no play makes jack a dull boy.
+
+ All work and no play makes jack a dull boy. All
+ work and no play makes jack a dull boy. All work
+ and no play makes jack a dull boy. All work and
+ no play makes jack a dull boy. All work and no
+ play makes jack a dull boy. All work and no play
+ makes jack a dull boy.
+
+ All work and no play makes jack a dull boy. All
+ work and no play makes jack a dull boy. All work
+ and no play makes jack a dull boy. All work and
+ no play makes jack a dull boy. All work and no
+ play makes jack a dull boy. All work and no play
+ makes jack a dull boy. All work and no play makes
+ jack a dull boy. All work and no play makes jack
+ a dull boy.
+
+ All work and no play makes jack a dull boy. All work and
+ no play makes jack a dull boy. All work and no play makes
+ jack a dull boy. All work and no play makes jack a dull
+ boy. All work and no play makes jack a dull boy. All
+ work and no play makes jack a dull boy. All work and no
+ play makes jack a dull boy. All work and no play makes
+ jack a dull boy.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY All work and no play makes jack a dull boy.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ All work and no play makes jack a dull boy. All
+ work and no play makes jack a dull boy.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1997 by Jamie Zawinski. All work and no
+ play makes jack a dull boy. All work and no play makes
+ jack a dull boy. All work and no play makes jack a dull
+ boy. All work and no play makes jack a dull boy. All
+ work and no play makes jack a fnord dull boy. All work
+
+
+
+X Version 11 18-sep-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ and no play makes jack a dull boy.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 15-Nov-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 18-sep-97 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ julia - draws spinning, animating julia-set fractals
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ j\bju\bul\bli\bia\ba [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-ncolors _\bi_\bn_\bt_\be_\bg_\be_\br] [-delay _\bm_\bi_\bc_\br_\bo_\bs_\be_\bc_\bo_\bn_\bd_\bs]
+ [-cycles _\bi_\bn_\bt_\be_\bg_\be_\br] [-count _\bi_\bn_\bt_\be_\bg_\be_\br] [-mouse] [-nomouse]
+
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bj_\bu_\bl_\bi_\ba program draws spinning, animating julia-set
+ fractals.
+
+ It uses ifs {w0 = sqrt(x-c), w1 = -sqrt(x-c)} with random
+ iteration to plot the julia set, and sinusoidially varied
+ parameters for the set, and plots parameters with a cir-
+ cle.
+
+ One thing to note is that count is the _\bd_\be_\bp_\bt_\bh of the search
+ tree, so the number of points computed is (2^count)-1. I
+ use 8 or 9 on a dx266 and it looks okay. The sinusoidal
+ variation of the parameter might not be as interesting as
+ it could, but it still gives an idea of the effect of the
+ parameter.
+
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bj_\bu_\bl_\bi_\ba accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+ -\b-n\bnc\bco\bol\blo\bor\brs\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+ How many colors should be used (if possible).
+ Default 200. The colors used cycle through the
+ hue, making N stops around the color wheel.
+
+ -\b-c\bcy\byc\bcl\ble\bes\bs _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+
+
+
+X Version 11 28-May-97 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-c\bco\bou\bun\bnt\bt _\bi_\bn_\bt_\be_\bg_\be_\br
+
+
+ -\b-m\bmo\bou\bus\bse\be
+
+ -\b-n\bno\bom\bmo\bou\bus\bse\be
+ If _\b-_\bm_\bo_\bu_\bs_\be is specified, the control point of the
+ Julia set will be derived from the position of the
+ mouse in the window. When the mouse is not in the
+ window, the control point is chosen the normal
+ way.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxl\blo\boc\bck\bk(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1995 by Sean McCullough.
+
+ Permission to use, copy, modify, and distribute this soft-
+ ware and its documentation for any purpose and without fee
+ is hereby granted, provided that the above copyright
+ notice appear in all copies and that both that copyright
+ notice and this permission notice appear in supporting
+ documentation.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Sean McCullough <bankshot@mailhost.nmt.edu>, 1995.
+
+ Ability to run standalone or with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br added by
+ Jamie Zawinski <jwz@jwz.org>, 10-May-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 28-May-97 2
+
+
--- /dev/null
+
+
+
+XLYAP(6X) XLYAP(6X)
+
+
+N\bNA\bAM\bME\bE
+ xlyap - display an array of Lyapunov exponents graphically
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ _\bx_\bl_\by_\ba_\bp [-BLps][-W width][-H height][-o filename][-a _\bn ] [-b
+ _\bn ] [-w _\bn ] [-h _\bn ] [-i xstart] [-M _\bn ] [-R _\bp ]
+ [-S _\bn ] [-D _\bn ] [-F string][-f string][-r _\bn ] [-O
+ _\bn ] [-C _\bn ] [-c _\bn ] [-m _\bn ] [-x xpos] [-y ypos]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ _\bx_\bl_\by_\ba_\bp generates and graphically displays an array of Lya-
+ punov exponents for a variety of iterated periodically
+ forced non-linear maps of the unit interval.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ -random A good choice for use with xscreensaver: picks
+ random parameters from a built-in list.
+
+ -C _\bn Specifies the minimum color index to be used for
+ negative exponents
+
+ -D _\bn Specifies the "dwell" or number of iterations over
+ which to average in order to calculate the Lya-
+ punov exponent. Default is 400.
+
+ -B Causes the stop, go, spin and quit buttons to be
+ displayed.
+
+ -H _\bn Specifies the height of the window. Default is
+ 256.
+
+ -L Indicates use log(x) + log(y) rather than log(xy).
+
+ -M _\br Specifies the real value to compare exponent val-
+ ues to for indexing into a color wheel. The
+ default value is 1.0.
+
+ -O _\bn Specifies the minimum color index to be used for
+ positive exponents
+
+ -R _\bp Specifies pseudo-random forcing with probability _\bp
+ of using parameter value 'a'.
+
+ -S _\bn Specifies the "settle" or number of iterations
+ prior to the beginning of the calculation of the
+ Lyapunov exponent. Default is 200.
+
+ -W _\bn Specifies the width of the window. Default is 256.
+
+ -a _\br Specifies the real value to use as the minimum
+ parameter value of the horizontal axis. Default is
+ 3.0 for the logistic map.
+
+ -b _\bn Specifies the real value to use as the minimum
+
+
+
+ 1
+
+
+
+
+
+XLYAP(6X) XLYAP(6X)
+
+
+ parameter value of the vertical axis. Default is
+ 3.0 for the logistic map.
+
+ -c _\bn Selects one of six different color wheels to use.
+ The default color wheel is a rainbow palette.
+
+ -F _\b1_\b0_\b1_\b0_\b1_\b0_\b1_\b0
+ Specifies the "Function" forcing function to use.
+ The example above would alternate between iterat-
+ ing the circle and logistic maps. An argument of
+ "-F 2323" would alternate between left and right
+ logistic maps. The default is to only use the sin-
+ gle specified map (see the description of -m).
+
+ -f _\ba_\bb_\bb_\ba_\bb_\ba_\ba_\bb
+ Specifies the forcing function to use. The default
+ is to alternate between the "a" parameter and the
+ "b" parameter.
+
+ -h _\br Specifies the real value to be used as the range
+ over which the vertical parameter values vary. The
+ default is 1.0.
+
+ -i _\br Specifies the real value of the initial condition
+ to use. Default is 0.05.
+
+ -m _\bn Selects between available non-linear maps of the
+ unit interval. A value of 0 specifies the logistic
+ map. A value of 1, the circle map. A value of 2,
+ the left-logistic. A value of 3, the right-logis-
+ tic. A value of 4, the double-logistic. The
+ default is 0, the logistic map.
+
+ -o _\bf_\bi_\bl_\be_\bn_\ba_\bm_\be
+ Specifies the output filename to be used. If the
+ -o option is given, this file will automatically
+ be written out at the completion of the drawing.
+ If it is not specified, a default filename of
+ lyap.out is used and only written if the 'f' or
+ 'F' keys are pressed during a run. The format of
+ the output file is PPM for color and PGM for
+ monochrom. The parameters used to calculate the
+ picture are included as comments at the beginning
+ of the output file.
+
+ -p Switches color indices for negative and positive
+ exponents. Generally, causes negative exponents to
+ be displayed in more detail while darkening and
+ narrowing the color range for positive exponents.
+ This can be toggled during runtime by pressing the
+ 'p' key.
+
+ -r _\bn Specifies the maximum rgb value to be used.
+ Default is 35000.
+
+
+
+ 2
+
+
+
+
+
+XLYAP(6X) XLYAP(6X)
+
+
+ -s _\bn Specifies the length of the color wheel spin.
+
+ -u Produces a usage message.
+
+ -v Prints out the various values to be used and
+ exits.
+
+ -w _\br Specifies the real value to be used as the range
+ over which the horizontal parameter values vary.
+ The default is 1.0.
+
+ -x _\bn Specifies the x screen coordinate of the window
+ (default is 256).
+
+ -y _\bn Specifies the y screen coordinate of the window
+ (default is 256).
+
+
+
+N\bNO\bOT\bTE\bES\bS
+ During display, pressing any mouse button allows you to
+ select the area to be investigated with the mouse. The
+ upper left hand corner of the desired area is the location
+ of the cursor when the button is pressed. The lower right
+ hand corner is specified by the cursor when the button is
+ released.
+
+
+ Use of the keys _\bb_\bB_\be_\bE_\bf_\bF_\bk_\bK_\bj_\bJ_\bm_\bn_\br_\bR_\bs_\bS_\bw_\bW_\bx_\bX_\bq_\bQ indicates:
+
+ (<) Halve dwell value.
+ (>) Double dwell value.
+ ([) Halve settle value.
+ (]) Double settle value.
+ (B or b) Toggle button display on/off
+ (E or e) Recalculate the indices into the color wheel
+ using a different method
+ (F or f) Save current screen to ouput file (not yet
+ implemented)
+ (H or h or ?) Display brief help message
+ (i) Decrement the interval between stripes for the
+ striped color map.
+ (I) Increment the interval between stripes for the
+ striped color map.
+ (K) Decrease value exponents are compared against by
+ 0.05.
+ (J) Increase value exponents are compared against by
+ 0.05.
+ (M) Decrease value exponents are compared against by
+ 0.005.
+ (N) Increase value exponents are compared against by
+ 0.005.
+ (m) Increment the map index, changing the map to be
+ iterated.
+
+
+
+ 3
+
+
+
+
+
+XLYAP(6X) XLYAP(6X)
+
+
+ (P or p) Toggle positive/negative exponent display.
+ (r) Redraw the window using previously calculated expo-
+ nents.
+ (R) Redraw the window using the newly set dwell and/or
+ settle values.
+ (S) Spin the color wheel
+ (s) Halve the length of the spin and spin the color
+ wheel
+ (u) Go up to the window just prior to the most recent
+ zoom.
+ (U) Go all the way up to the original window.
+ (V or v) Display values of various parameters currently
+ in use
+ (W or w) Use next color map.
+ (X or x) Clear window
+ (Q or q) quit
+
+
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Ronald Joe Record
+ The Santa Cruz Operation
+ P.O. Box 1900
+ Santa Cruz, CA 95061
+ rr@sco.com
+
+
+
+A\bAC\bCK\bKN\bNO\bOW\bWL\bLE\bED\bDG\bGE\bEM\bME\bEN\bNT\bTS\bS
+ The algorithm was taken from the September 1991 Scientific
+ American article by A. K. Dewdney who gives credit to
+ Mario Markus of the Max Planck Institute for its creation.
+ Additional information and ideas were gleaned from the
+ discussion on alt.fractals involving Stephen Hall, Ed
+ Kubaitis, Dave Platt and Baback Moghaddam. Assistance with
+ colormaps and spinning color wheels and X was gleaned from
+ Hiram Clawson. Rubber banding code was adapted from an
+ existing Mandelbrot program written by Stacey Campbell.
+
+ Viciously hacked for xscreensaver by Jamie Zawinski,
+ 20-Nov-97.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ 4
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ xroger - throbbing X logo, of a sort
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ x\bxr\bro\bog\bge\ber\br [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-foreground _\bc_\bo_\bl_\bo_\br]
+ [-background _\bc_\bo_\bl_\bo_\br] [-window] [-root] [-mono] [-install]
+ [-visual _\bv_\bi_\bs_\bu_\ba_\bl]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bx_\br_\bo_\bg_\be_\br program displays a replacement for the X logo
+ with a more accurate Look and Feel.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bx_\br_\bo_\bg_\be_\br accepts the following options:
+
+ -\b-w\bwi\bin\bnd\bdo\bow\bw Draw on a newly-created window. This is the
+ default.
+
+ -\b-r\bro\boo\bot\bt Draw on the root window.
+
+ -\b-m\bmo\bon\bno\bo If on a color display, pretend we're on a
+ monochrome display.
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Install a private colormap for the window.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Specify which visual to use. Legal values are the
+ name of a visual class, or the id number (decimal
+ or hex) of a specific visual.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+B\bBU\bUG\bGS\bS
+ It should also drip blood while making a horrible screech-
+ ing noise.
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992, 1993 by Jamie Zawinski. Permission to
+ use, copy, modify, distribute, and sell this software and
+ its documentation for any purpose is hereby granted with-
+ out fee, provided fnord that the above copyright notice
+ appear in all copies and that both that copyright notice
+ and this permission notice appear in supporting documenta-
+ tion. No representations are made about the suitability
+
+
+
+X Version 11 22-mar-93 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ of fnord this software for any purpose. It is provided
+ "as is" without express or fnord implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 22-mar-93 2
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ xscreensaver-command - control a running xscreensaver pro-
+ cess
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-c\bco\bom\bmm\bma\ban\bnd\bd [-help] [-demo] [-prefs] [-activate]
+ [-deactivate] [-cycle] [-next] [-prev] [-select _\bn] [-exit]
+ [-restart] [-lock] [-throttle] [-unthrottle] [-version]
+ [-time]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bc_\bo_\bm_\bm_\ba_\bn_\bd program controls a running
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br process by sending it client-messages.
+
+ x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1) has a client-server model: the xscreen-
+ saver process is a daemon that runs in the background; it
+ is controlled by other foreground programs such as
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bc_\bo_\bm_\bm_\ba_\bn_\bd and x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo(1).
+
+ This program, _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bc_\bo_\bm_\bm_\ba_\bn_\bd, is a command-line-ori-
+ ented tool; the x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo(1). program is a graph-
+ ical tool.
+
+O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bc_\bo_\bm_\bm_\ba_\bn_\bd accepts the following command-line
+ options:
+
+ -\b-h\bhe\bel\blp\bp Prints a brief summary of command-line options.
+
+ -\b-d\bde\bem\bmo\bo This just launches the x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo(1) pro-
+ gram, in which one can experiment with the various
+ graphics hacks available, and edit parameters.
+
+ -\b-d\bde\bem\bmo\bo _\bn_\bu_\bm_\bb_\be_\br
+ When the _\b-_\bd_\be_\bm_\bo option is followed by an integer,
+ it instructs the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br daemon to run that
+ hack, and wait for the user to click the mouse
+ before deactivating (i.e., mouse motion does not
+ deactivate.) This is the mechanism by which
+ x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo(1) communicates with the
+ x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1) daemon. (The first hack in the
+ list is numbered 1, not 0.)
+
+ -\b-p\bpr\bre\bef\bfs\bs Like the no-argument form of _\b-_\bd_\be_\bm_\bo, but brings up
+ that program's Preferences panel by default.
+
+ -\b-a\bac\bct\bti\biv\bva\bat\bte\be
+ Tell xscreensaver to turn on immediately (that is,
+ blank the screen, as if the user had been idle for
+ long enough.) The screensaver will deactivate as
+ soon as there is any user activity, as usual.
+
+ It is useful to run this from a menu; you may wish
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ to run it as
+
+ sleep 5 ; xscreensaver-command -activate
+
+ to be sure that you have time to take your hand
+ off the mouse before the screensaver comes on.
+ (Because if you jiggle the mouse, xscreensaver
+ will notice, and deactivate.)
+
+ -\b-d\bde\bea\bac\bct\bti\biv\bva\bat\bte\be
+ If the screensaver is active (the screen is
+ blanked), this command will deactivate it just as
+ if there had been keyboard or mouse activity. If
+ locking is enabled, then the screensaver will
+ prompt for a password as usual.
+
+ -\b-c\bcy\byc\bcl\ble\be If the screensaver is active (the screen is
+ blanked), then stop the current graphics demo and
+ run a new one (chosen randomly.)
+
+ -\b-n\bne\bex\bxt\bt This is like either _\b-_\ba_\bc_\bt_\bi_\bv_\ba_\bt_\be or _\b-_\bc_\by_\bc_\bl_\be, depending
+ on which is more appropriate, except that the
+ graphics hack that will be run is the next one in
+ the list, instead of a randomly-chosen one. In
+ other words, repeatedly executing -next will cause
+ the xscreensaver process to invoke each graphics
+ demo sequentially. (Though using the _\b-_\bd_\be_\bm_\bo option
+ is probably an easier way to accomplish that.)
+
+ -\b-p\bpr\bre\bev\bv This is like _\b-_\bn_\be_\bx_\bt, but cycles in the other direc-
+ tion.
+
+ -\b-s\bse\bel\ble\bec\bct\bt _\bn_\bu_\bm_\bb_\be_\br
+ Like _\b-_\ba_\bc_\bt_\bi_\bv_\ba_\bt_\be, but runs the _\bNth element in the
+ list of hacks. By knowing what is in the _\bp_\br_\bo_\bg_\br_\ba_\bm_\bs
+ list, and in what order, you can use this to acti-
+ vate the screensaver with a particular graphics
+ demo. (The first element in the list is numbered
+ 1, not 0.)
+
+ -\b-e\bex\bxi\bit\bt Causes the xscreensaver process to exit grace-
+ fully. This is roughly the same as killing the
+ process with k\bki\bil\bll\bl(1), but it is easier, since you
+ don't need to first figure out the pid.
+
+ W\bWa\bar\brn\bni\bin\bng\bg:\b: never use _\bk_\bi_\bl_\bl _\b-_\b9 with _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br while
+ the screensaver is active. If you are using a
+ virtual root window manager, that can leave things
+ in an inconsistent state, and you may need to
+ restart your window manager to repair the damage.
+
+ -\b-l\blo\boc\bck\bk Tells the running xscreensaver process to lock the
+ screen immediately. This is like _\b-_\ba_\bc_\bt_\bi_\bv_\ba_\bt_\be, but
+ forces locking as well, even if locking is not the
+
+
+
+X Version 11 20-Jun-99 (3.15) 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ default (that is, even if xscreensaver's _\bl_\bo_\bc_\bk
+ resource is false, and even if the _\bl_\bo_\bc_\bk_\bT_\bi_\bm_\be_\bo_\bu_\bt
+ resource is non-zero.)
+
+ Note that locking doesn't work unless the _\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br process is running as you. See x\bxs\bsc\bcr\bre\bee\ben\bn-\b-
+ s\bsa\bav\bve\ber\br(1) for details.
+
+ -\b-t\bth\bhr\bro\bot\btt\btl\ble\be
+ Temporarily switch to ``blank screen'' mode, and
+ don't run any display modes at all, until the
+ screensaver is next de-activated. This is useful
+ if you're using a machine remotely, and you find
+ that some display modes are using too much CPU.
+
+ (If you want to do this _\bp_\be_\br_\bm_\ba_\bn_\be_\bn_\bt_\bl_\by, that is, you
+ want the screen saver to only blank the screen and
+ not run demos at all, then set the _\bp_\br_\bo_\bg_\br_\ba_\bm_\bs
+ resource to an empty list: See x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1)
+ for details.)
+
+ -\b-u\bun\bnt\bth\bhr\bro\bot\btt\btl\ble\be
+ Turn `-throttle' mode off and resume normal behav-
+ ior.
+
+ -\b-v\bve\ber\brs\bsi\bio\bon\bn
+ Prints the version of xscreensaver that is cur-
+ rently running on the display: that is, the actual
+ version number of the running xscreensaver back-
+ ground process, rather than the version number of
+ xscreensaver-command. (To see the version number
+ of _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bc_\bo_\bm_\bm_\ba_\bn_\bd itself, use the _\b-_\bh_\be_\bl_\bp
+ option.)
+
+ -\b-t\bti\bim\bme\be Prints the time at which the screensaver last
+ activated or deactivated (roughly, how long the
+ user has been idle or non-idle: but not quite,
+ since it only tells you when the screen became
+ blanked or un-blanked.)
+
+ -\b-r\bre\bes\bst\bta\bar\brt\bt
+ Causes the screensaver process to exit and then
+ restart with the same command line arguments as
+ last time. Do this after you've changed the
+ resource database, to cause xscreensaver to notice
+ the changes.
+
+ W\bWa\bar\brn\bni\bin\bng\bg:\b: if you have a _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file, this
+ might not do what you expect. You're probably
+ better off killing the existing xscreensaver (with
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bc_\bo_\bm_\bm_\ba_\bn_\bd _\b-_\be_\bx_\bi_\bt) and then launching it
+ again.
+
+ The important point is, you need to make sure that
+
+
+
+X Version 11 20-Jun-99 (3.15) 3
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ the xscreensaver process is running as you. If
+ it's not, it won't be reading the right _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br file.
+
+D\bDI\bIA\bAG\bGN\bNO\bOS\bST\bTI\bIC\bCS\bS
+ If an error occurs while communicating with the _\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br daemon, or if the daemon reports an error, a diag-
+ nostic message will be printed to stderr, and _\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br_\b-_\bc_\bo_\bm_\bm_\ba_\bn_\bd will exit with a non-zero value. If the
+ command is accepted, an indication of this will be printed
+ to stdout, and the exit value will be zero.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the host and display number of the screen
+ whose saver is to be manipulated.
+
+ P\bPA\bAT\bTH\bH to find the executable to restart (for the
+ _\b-_\br_\be_\bs_\bt_\ba_\br_\bt command). Note that this variable is
+ consulted in the environment of the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br
+ process, not the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bc_\bo_\bm_\bm_\ba_\bn_\bd process.
+
+U\bUP\bPG\bGR\bRA\bAD\bDE\bES\bS
+ The latest version of x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1) and related tools
+ can always be found at http://www.jwz.org/xscreensaver/
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1) x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992, 1993, 1997, 1998, 1999 by Jamie Zawin-
+ ski. Permission to use, copy, modify, distribute, and
+ sell this software and its documentation for any purpose
+ is hereby granted without fee, provided that the above
+ copyright notice appear in all copies and that both that
+ copyright notice and this permission notice appear in sup-
+ porting documentation. No representations are made about
+ the suitability of this software for any purpose. It is
+ provided "as is" without express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+ Please let me know if you find any bugs or make any
+ improvements.
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 4
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ xscreensaver-demo - interactively control the background
+ xscreensaver daemon
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-prefs]
+ [-xrm _\br_\be_\bs_\bo_\bu_\br_\bc_\be_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bd_\be_\bm_\bo program is a graphical front-end for
+ setting the parameters used by the background x\bxs\bsc\bcr\bre\bee\ben\bn-\b-
+ s\bsa\bav\bve\ber\br(1) daemon. It is essentially two things: a tool for
+ editing the _\b~_\b/_\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file; and a tool for demoing
+ the various graphics hacks that the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br daemon
+ will launch.
+
+ The main dialog box contains a scrolling list, a text
+ field, and a number of buttons.
+
+ Double-clicking on one of the programs in the list will
+ run it. The screen will go black, and the program will
+ run in full-screen mode, just as it would if the _\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br daemon had launched it. Clicking the mouse again
+ will stop the demo and un-blank the screen, making the
+ dialog box visible again.
+
+ Single-clicking in the list will place the indicated pro-
+ gram and its args in the text field to be edited. Edit
+ the arguments and hit return to run the program with the
+ parameters you have specified. This will also save your
+ changes to your _\b~_\b/_\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file: so any changes you
+ make in this way are persistent.
+
+ If one of the lines in the scrolling list begins with the
+ character "-", then that means that the program is dis-
+ abled: _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br will not select it to be run (though
+ you can still try it out by clicking on it.) Rather than
+ just deleting the programs you don't want to run, you
+ might want to disable them in this way instead, so that
+ you can more easily change your mind later.
+
+ If the line begins with the name of a visual, followed by
+ a colon, then that program will only be run on that kind
+ of visual. For example, you can specify that a particular
+ program should only be run if color is available, and
+ another should only be run in monochrome. See the discus-
+ sion of the _\bp_\br_\bo_\bg_\br_\ba_\bm_\bs parameter in the _\bC_\bo_\bn_\bf_\bi_\bg_\bu_\br_\ba_\bt_\bi_\bo_\bn sec-
+ tion of the x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1) manual.
+
+ The buttons are:
+
+ R\bRu\bun\bn N\bNe\bex\bxt\bt
+ Clicking this button will run the next program in
+ the list after the currently-selected one, and
+
+
+
+X Version 11 20-Jun-99 (3.15) 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ will wrap around to the top when it reaches the
+ bottom.
+
+ R\bRu\bun\bn P\bPr\bre\bev\bvi\bio\bou\bus\bs
+ Opposite of Run Next; at the top, it wraps around
+ to the bottom.
+
+ P\bPr\bre\bef\bfe\ber\bre\ben\bnc\bce\bes\bs
+ This pops up a second dialog box, in which you
+ have the option to interactively change most of
+ the screensaver's operational parameters, such as
+ its timeouts, and whether it should lock the
+ screen. When you click OK, your chosen settings
+ will take effect immediately, and will also be
+ saved to the _\b~_\b/_\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file in your home
+ directory, so that the settings will persist next
+ time.
+
+ Q\bQu\bui\bit\bt Exits the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bd_\be_\bm_\bo program. The back-
+ ground _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br daemon will continue running
+ as before.
+
+ The Preferences dialog box lets you change the following
+ settings.
+
+ (There are more settings available, but these are the most
+ commonly used ones; see the manual for x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1) for
+ other parameters that can be set by editing the
+ _\b~_\b/_\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file, or the X resource database.)
+
+ S\bSa\bav\bve\ber\br T\bTi\bim\bme\beo\bou\but\bt
+ After the user has been idle this long, the
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br daemon will blank the screen.
+
+ C\bCy\byc\bcl\ble\be T\bTi\bim\bme\beo\bou\but\bt
+ After the screensaver has been running for this
+ long, the currently running graphics demo will be
+ killed, and a new one started. If this is 0, then
+ the graphics demo will never be changed: only one
+ demo will run until the screensaver is deactivated
+ by user activity.
+
+ V\bVe\ber\brb\bbo\bos\bse\be
+ Whether to print lots of debugging information.
+
+ I\bIn\bns\bst\bta\bal\bll\bl C\bCo\bol\blo\bor\brm\bma\bap\bp
+ Whether to install a private colormap while the
+ screensaver is active, so that the graphics hacks
+ can get as many colors as possible. (This only
+ applies when the screen's default visual is being
+ used, since non-default visuals get their own col-
+ ormaps automatically.) This can also be overrid-
+ den on a per-demo basis.
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ F\bFa\bad\bde\be C\bCo\bol\blo\bor\brm\bma\bap\bp
+ If selected, then when the screensaver activates,
+ the current contents of the screen will fade to
+ black instead of simply winking out. This only
+ works on displays with writable colormaps, that
+ is, if the screen's default visual is a Pseudo-
+ Color visual. A fade will also be done when
+ switching graphics hacks (when the _\bC_\by_\bc_\bl_\be _\bT_\bi_\bm_\be_\bo_\bu_\bt
+ expires.)
+
+ U\bUn\bnf\bfa\bad\bde\be C\bCo\bol\blo\bor\brm\bma\bap\bp
+ The complement to _\bF_\ba_\bd_\be _\bC_\bo_\bl_\bo_\br_\bm_\ba_\bp: if selected, then
+ when the screensaver deactivates, the original
+ contents of the screen will fade in from black
+ instead of appearing immediately. This only works
+ on displays with writable colormaps, and when _\bF_\ba_\bd_\be
+ _\bC_\bo_\bl_\bo_\br_\bm_\ba_\bp is also selected.
+
+ F\bFa\bad\bde\be D\bDu\bur\bra\bat\bti\bio\bon\bn
+ When fading or unfading are selected, this con-
+ trols how long the fade will take.
+
+ F\bFa\bad\bde\be T\bTi\bic\bck\bks\bs
+ This controls how many times a second the colormap
+ will be changed to effect a fade. Higher numbers
+ yield smoother fades, but may make the fades take
+ longer than the specified number of seconds, if
+ your server isn't fast enough to keep up.
+
+ R\bRe\beq\bqu\bui\bir\bre\be P\bPa\bas\bss\bsw\bwo\bor\brd\bd
+ Whether the screen saver should lock the screen
+ when it activates.
+
+ L\bLo\boc\bck\bk T\bTi\bim\bme\beo\bou\but\bt
+ If _\bR_\be_\bq_\bu_\bi_\br_\be _\bP_\ba_\bs_\bs_\bw_\bo_\br_\bd is selected, this controls the
+ length of the ``grace period'' between when the
+ screensaver activates, and when the screen becomes
+ locked. For example, if this is 0:05:00, and
+ _\bS_\ba_\bv_\be_\br _\bT_\bi_\bm_\be_\bo_\bu_\bt is 0:10:00, then after 10 minutes,
+ the screen would blank. If there was user activ-
+ ity at 12 minutes, no password would be required
+ to un-blank the screen. But, if there was user
+ activity at 15 minutes or later (that is, _\bL_\bo_\bc_\bk
+ _\bT_\bi_\bm_\be_\bo_\bu_\bt minutes after activation) then a password
+ would be required. The default is 0, meaning that
+ if locking is enabled, then a password will be
+ required as soon as the screen blanks.
+
+ P\bPa\bas\bss\bsw\bwo\bor\brd\bd T\bTi\bim\bme\beo\bou\but\bt
+ When the screensaver is prompting for a password,
+ the prompt dialog box will stay on the screen for
+ this long before giving up, and reverting to
+ screen-saving mode.
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 3
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+C\bCO\bOM\bMM\bMA\bAN\bND\bD-\b-L\bLI\bIN\bNE\bE O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bd_\be_\bm_\bo accepts the following command line
+ options.
+
+ -\b-d\bdi\bis\bsp\bpl\bla\bay\by _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn
+ The X display to use. The _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bd_\be_\bm_\bo pro-
+ gram will open its window on that display, and
+ also control the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br daemon that is man-
+ aging that same display.
+
+ -\b-p\bpr\bre\bef\bfs\bs Start up in Preferences mode: this is just like
+ launching the program with no arguments, and then
+ pressing the _\bP_\br_\be_\bf_\be_\br_\be_\bn_\bc_\be_\bs button.
+
+ It is important that the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br and _\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br_\b-_\bd_\be_\bm_\bo processes be running on the same machine, or at
+ least, on two machines that share a file system. When
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bd_\be_\bm_\bo writes a new version of the _\b~_\b/_\b._\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br file, it's important that the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br see that
+ same file. If the two processes are seeing different
+ _\b~_\b/_\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br files, things will malfunction.
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number.
+
+ P\bPA\bAT\bTH\bH to find the sub-programs to run. However, note
+ that the sub-programs are actually launched by the
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br daemon, not by _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bd_\be_\bm_\bo
+ itself. So, what matters is what $\b$P\bPA\bAT\bTH\bH the
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br program sees.
+
+ H\bHO\bOM\bME\bE for the directory in which to read and write the
+ _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+U\bUP\bPG\bGR\bRA\bAD\bDE\bES\bS
+ The latest version can always be found at
+ http://www.jwz.org/xscreensaver/
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-c\bco\bom\bmm\bma\ban\bnd\bd(1)
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1992, 1993, 1997, 1998, 1999 by Jamie Zawin-
+ ski. Permission to use, copy, modify, distribute, and
+ sell this software and its documentation for any purpose
+ is hereby granted without fee, provided that the above
+ copyright notice appear in all copies and that both that
+ copyright notice and this permission notice appear in sup-
+ porting documentation. No representations are made about
+
+
+
+X Version 11 20-Jun-99 (3.15) 4
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ the suitability of this software for any purpose. It is
+ provided "as is" without express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+ Please let me know if you find any bugs or make any
+ improvements.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 5
+
+
--- /dev/null
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+N\bNA\bAM\bME\bE
+ xscreensaver - graphics hack and screen locker, launched
+ when the user is idle
+
+S\bSY\bYN\bNO\bOP\bPS\bSI\bIS\bS
+ x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br [-display _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn] [-timeout _\bi_\bn_\bt]
+ [-cycle _\bi_\bn_\bt] [-lock-mode] [-no-lock-mode] [-lock-timeout
+ _\bi_\bn_\bt] [-visual _\bv_\bi_\bs_\bu_\ba_\bl] [-install] [-no-install] [-verbose]
+ [-silent] [-timestamp] [-capture-stderr] [-no-cap-
+ ture-stderr] [-splash] [-no-splash] [-nice _\bi_\bn_\bt]
+ [-mit-extension] [-no-mit-extension] [-sgi-extension]
+ [-no-sgi-extension] [-xidle-extension] [-no-xidle-exten-
+ sion] [-proc-interrupts] [-no-proc-interrupts] [-xrm
+ _\br_\be_\bs_\bo_\bu_\br_\bc_\be_\bs]
+
+D\bDE\bES\bSC\bCR\bRI\bIP\bPT\bTI\bIO\bON\bN
+ The _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br program waits until the keyboard and
+ mouse have been idle for a period, and then runs a graph-
+ ics demo chosen at random. It turns off as soon as there
+ is any mouse or keyboard activity.
+
+ This program can lock your terminal in order to prevent
+ others from using it, though its default mode of operation
+ is merely to display pretty pictures on your screen when
+ it is not in use.
+
+ The benefit that this program has over the combination of
+ the x\bxl\blo\boc\bck\bk(1) and x\bxa\bau\but\bto\bol\blo\boc\bck\bk(1) programs is the ease with
+ which new graphics hacks can be installed. You don't need
+ to recompile (or even re-run) this program to add a new
+ display mode.
+
+G\bGE\bET\bTT\bTI\bIN\bNG\bG S\bST\bTA\bAR\bRT\bTE\bED\bD
+ For the impatient, try this:
+
+ xscreensaver &
+ xscreensaver-demo
+
+ The x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo(1) program should pop up a dialog
+ box that lets you experiment with the xscreensaver set-
+ tings and graphics modes.
+
+ N\bNo\bot\bte\be:\b: unlike x\bxl\blo\boc\bck\bk(1), xscreensaver has a client-server
+ model: the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br program is a daemon that runs in
+ the background; it is controlled by the foreground
+ x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo(1) and x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-c\bco\bom\bmm\bma\ban\bnd\bd(1) programs.
+
+C\bCO\bON\bNF\bFI\bIG\bGU\bUR\bRA\bAT\bTI\bIO\bON\bN
+ Options to _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br are specified in one of two
+ places: in a _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file in your home directory; or
+ in the X resource database. If the _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file
+ exists, it overrides any settings in the resource
+ database.
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 1
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ The syntax of the _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file is similar to that of
+ the _\b._\bX_\bd_\be_\bf_\ba_\bu_\bl_\bt_\bs file; for example, to set the _\bt_\bi_\bm_\be_\bo_\bu_\bt
+ paramter in the _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file, you would write the
+ following:
+
+ timeout: 5
+
+ whereas, in the _\b._\bX_\bd_\be_\bf_\ba_\bu_\bl_\bt_\bs file, you would write
+
+ xscreensaver.timeout: 5
+
+ If you change a setting in the _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file while
+ xscreensaver is already running, it will notice this, and
+ reload the file. (The file will be reloaded the next time
+ the screen saver needs to take some action, such as blank-
+ ing or unblanking the screen, or picking a new graphics
+ mode.)
+
+ If you change a setting in your X resource database, or if
+ you want xscreensaver to notice your changes immediately
+ instead of the next time it wakes up, then you will need
+ to tell the running xscreensaver process to re-initialize
+ itself, like so:
+
+ xscreensaver-command -restart
+
+ Note that if you changed the _\b._\bX_\bd_\be_\bf_\ba_\bu_\bl_\bt_\bs file, you might
+ also need to run x\bxr\brd\bdb\bb(1):
+
+ xrdb < ~/.Xdefaults
+
+ If you want to set the system-wide defaults, then make
+ your edits to the xscreensaver app-defaults file, which
+ should have been installed when xscreensaver itself was
+ installed. The app-defaults file will usually be named
+ /usr/lib/X11/app-defaults/XScreenSaver, but different sys-
+ tems might keep it in a different place (for example,
+ /usr/openwin/lib/app-defaults/XScreenSaver on Solaris.)
+
+ When settings are changed in the Preferences dialog box
+ (see above) the current settings will be written to the
+ _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file. (The _\b._\bX_\bd_\be_\bf_\ba_\bu_\bl_\bt_\bs file and the app-
+ defaults file will never be written by xscreensaver
+ itself.)
+
+
+ t\bti\bim\bme\beo\bou\but\bt (class T\bTi\bim\bme\be)
+ The screensaver will activate (blank the screen)
+ after the keyboard and mouse have been idle for
+ this many minutes. Default 10 minutes.
+
+ c\bcy\byc\bcl\ble\be (class T\bTi\bim\bme\be)
+ After the screensaver has been running for this
+ many minutes, the currently running graphics-hack
+
+
+
+X Version 11 20-Jun-99 (3.15) 2
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ sub-process will be killed (with S\bSI\bIG\bGT\bTE\bER\bRM\bM), and a
+ new one started. If this is 0, then the graphics
+ hack will never be changed: only one demo will run
+ until the screensaver is deactivated by user
+ activity. Default 10 minutes.
+
+ l\blo\boc\bck\bk (class B\bBo\boo\bol\ble\bea\ban\bn)
+ Enable locking: before the screensaver will turn
+ off, it will require you to type the password of
+ the logged-in user (really, the person who ran
+ xscreensaver), or the root password. (N\bNo\bot\bte\be:\b: this
+ doesn't work if the screensaver is launched by
+ x\bxd\bdm\bm(1) because it can't know the user-id of the
+ logged-in user. See the ``_\bU_\bs_\bi_\bn_\bg _\bX_\bD_\bM_\b(_\b1_\b)'' section,
+ below.
+
+ l\blo\boc\bck\bkT\bTi\bim\bme\beo\bou\but\bt (class T\bTi\bim\bme\be)
+ If locking is enabled, this controls the length of
+ the ``grace period'' between when the screensaver
+ activates, and when the screen becomes locked.
+ For example, if this is 5, and _\b-_\bt_\bi_\bm_\be_\bo_\bu_\bt is 10,
+ then after 10 minutes, the screen would blank. If
+ there was user activity at 12 minutes, no password
+ would be required to un-blank the screen. But, if
+ there was user activity at 15 minutes or later
+ (that is, _\b-_\bl_\bo_\bc_\bk_\b-_\bt_\bi_\bm_\be_\bo_\bu_\bt minutes after activation)
+ then a password would be required. The default is
+ 0, meaning that if locking is enabled, then a
+ password will be required as soon as the screen
+ blanks.
+
+ p\bpa\bas\bss\bsw\bwd\bdT\bTi\bim\bme\beo\bou\but\bt (class T\bTi\bim\bme\be)
+ If the screen is locked, then this is how many
+ seconds the password dialog box should be left on
+ the screen before giving up (default 30 seconds.)
+ This should not be too large: the X server is
+ grabbed for the duration that the password dialog
+ box is up (for security purposes) and leaving the
+ server grabbed for too long can cause problems.
+
+ v\bvi\bis\bsu\bua\bal\blI\bID\bD (class V\bVi\bis\bsu\bua\bal\blI\bID\bD)
+ Specify which X visual to use by default. (Note
+ carefully that this resource is called v\bvi\bis\bsu\bua\bal\blI\bID\bD,
+ not merely v\bvi\bis\bsu\bua\bal\bl; if you set the v\bvi\bis\bsu\bua\bal\bl resource
+ instead, things will malfunction in obscure ways
+ for obscure reasons.)
+
+ Legal values for the V\bVi\bis\bsu\bua\bal\blI\bID\bD resource are:
+
+ d\bde\bef\bfa\bau\bul\blt\bt Use the screen's default visual (the
+ visual of the root window.) This is the
+ default.
+
+ b\bbe\bes\bst\bt Use the visual which supports the most
+
+
+
+X Version 11 20-Jun-99 (3.15) 3
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ colors. Note, however, that the visual
+ with the most colors might be a TrueColor
+ visual, which does not support colormap
+ animation. Some programs have more inter-
+ esting behavior when run on PseudoColor
+ visuals than on TrueColor.
+
+ m\bmo\bon\bno\bo Use a monochrome visual, if there is one.
+
+ g\bgr\bra\bay\by Use a grayscale or staticgray visual, if
+ there is one and it has more than one
+ plane (that is, it's not monochrome.)
+
+ c\bco\bol\blo\bor\br Use the best of the color visuals, if
+ there are any.
+
+ G\bGL\bL Use the visual that is best for OpenGL
+ programs. (OpenGL programs have somewhat
+ different requirements than other X pro-
+ grams.)
+
+ _\bc_\bl_\ba_\bs_\bs where _\bc_\bl_\ba_\bs_\bs is one of S\bSt\bta\bat\bti\bic\bcG\bGr\bra\bay\by, S\bSt\bta\bat\bti\bic\bc-\b-
+ C\bCo\bol\blo\bor\br, T\bTr\bru\bue\beC\bCo\bol\blo\bor\br, G\bGr\bra\bay\byS\bSc\bca\bal\ble\be, P\bPs\bse\beu\bud\bdo\boC\bCo\bol\blo\bor\br,
+ or D\bDi\bir\bre\bec\bct\btC\bCo\bol\blo\bor\br. Selects the deepest
+ visual of the given class.
+
+ _\bn_\bu_\bm_\bb_\be_\br where _\bn_\bu_\bm_\bb_\be_\br (decimal or hex) is inter-
+ preted as a visual id number, as reported
+ by the x\bxd\bdp\bpy\byi\bin\bnf\bfo\bo(1) program; in this way
+ you can have finer control over exactly
+ which visual gets used, for example, to
+ select a shallower one than would other-
+ wise have been chosen.
+
+ Note that this option specifies only the _\bd_\be_\bf_\ba_\bu_\bl_\bt
+ visual that will be used: the visual used may be
+ overridden on a program-by-program basis. See the
+ description of the p\bpr\bro\bog\bgr\bra\bam\bms\bs resource, below.
+
+ i\bin\bns\bst\bta\bal\bll\blC\bCo\bol\blo\bor\brm\bma\bap\bp (class B\bBo\boo\bol\ble\bea\ban\bn)
+ Install a private colormap while the screensaver
+ is active, so that the graphics hacks can get as
+ many colors as possible. This is the default.
+ (This only applies when the screen's default
+ visual is being used, since non-default visuals
+ get their own colormaps automatically.) This can
+ also be overridden on a per-hack basis: see the
+ discussion of the d\bde\bef\bfa\bau\bul\blt\bt-\b-n\bn name in the section
+ about the p\bpr\bro\bog\bgr\bra\bam\bms\bs resource.
+
+ v\bve\ber\brb\bbo\bos\bse\be (class B\bBo\boo\bol\ble\bea\ban\bn)
+ Whether to print diagnostics. Default false.
+
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 4
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ t\bti\bim\bme\bes\bst\bta\bam\bmp\bp (class B\bBo\boo\bol\ble\bea\ban\bn)
+ Whether to print the time of day along with any
+ other diagnostic messages. Default false.
+
+ s\bsp\bpl\bla\bas\bsh\bh (class B\bBo\boo\bol\ble\bea\ban\bn)
+ Whether to display a splash screen at startup.
+ Default true.
+
+ s\bsp\bpl\bla\bas\bsh\bhD\bDu\bur\bra\bat\bti\bio\bon\bn (class T\bTi\bim\bme\be)
+ How long the splash screen should remain visible;
+ default 5 seconds.
+
+ h\bhe\bel\blp\bpU\bUR\bRL\bL (class U\bUR\bRL\bL)
+ The splash screen has a _\bH_\be_\bl_\bp button on it. When
+ you press it, it will display the web page indi-
+ cated here in your web browser.
+
+ l\blo\boa\bad\bdU\bUR\bRL\bL (class L\bLo\boa\bad\bdU\bUR\bRL\bL)
+ This is the shell command used to load a URL into
+ your web browser. The default setting will load
+ it into Netscape if it is already running, other-
+ wise, will launch a new Netscape looking at the
+ _\bh_\be_\bl_\bp_\bU_\bR_\bL.
+
+ d\bde\bem\bmo\boC\bCo\bom\bmm\bma\ban\bnd\bd (class D\bDe\bem\bmo\boC\bCo\bom\bmm\bma\ban\bnd\bd)
+ This is the shell command run when the _\bD_\be_\bm_\bo button
+ on the splash window is pressed. It defaults to
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bd_\be_\bm_\bo.
+
+ p\bpr\bre\bef\bfs\bsC\bCo\bom\bmm\bma\ban\bnd\bd (class P\bPr\bre\bef\bfs\bsC\bCo\bom\bmm\bma\ban\bnd\bd)
+ This is the shell command run when the _\bP_\br_\be_\bf_\bs but-
+ ton on the splash window is pressed. It defaults
+ to _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br_\b-_\bd_\be_\bm_\bo _\b-_\bp_\br_\be_\bf_\bs.
+
+ n\bni\bic\bce\be (class N\bNi\bic\bce\be)
+ The sub-processes created by _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br will be
+ ``niced'' to this level, so that they are given
+ lower priority than other processes on the system,
+ and don't increase the load unnecessarily. The
+ default is 10.
+
+ (Higher numbers mean lower priority; see n\bni\bic\bce\be(1)
+ for details.)
+
+ f\bfa\bad\bde\be (class B\bBo\boo\bol\ble\bea\ban\bn)
+ If this is true, then when the screensaver acti-
+ vates, the current contents of the screen will
+ fade to black instead of simply winking out. This
+ only works on displays with writable colormaps,
+ that is, if the screen's default visual is a Pseu-
+ doColor visual. A fade will also be done when
+ switching graphics hacks (when the _\bc_\by_\bc_\bl_\be timer
+ expires.) Default: true.
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 5
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ u\bun\bnf\bfa\bad\bde\be (class B\bBo\boo\bol\ble\bea\ban\bn)
+ If this is true, then when the screensaver deacti-
+ vates, the original contents of the screen will
+ fade in from black instead of appearing immedi-
+ ately. This only works on displays with writable
+ colormaps, and if _\bf_\ba_\bd_\be is true as well. Default
+ false.
+
+ f\bfa\bad\bde\beS\bSe\bec\bco\bon\bnd\bds\bs (class T\bTi\bim\bme\be)
+ If _\bf_\ba_\bd_\be is true, this is how long the fade will be
+ in seconds (default 3 seconds.)
+
+ f\bfa\bad\bde\beT\bTi\bic\bck\bks\bs (class I\bIn\bnt\bte\beg\bge\ber\br)
+ If _\bf_\ba_\bd_\be is true, this is how many times a second
+ the colormap will be changed to effect a fade.
+ Higher numbers yield smoother fades, but may make
+ the fades take longer than the specified _\bf_\ba_\bd_\be_\bS_\be_\bc_\b-
+ _\bo_\bn_\bd_\bs if your server isn't fast enough to keep up.
+ Default 20.
+
+ c\bca\bap\bpt\btu\bur\bre\beS\bSt\btd\bde\ber\brr\br (class B\bBo\boo\bol\ble\bea\ban\bn)
+ Whether _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br should redirect its stdout
+ and stderr streams to the window itself. Since
+ its nature is to take over the screen, you would
+ not normally see error messages generated by
+ xscreensaver or the sub-programs it runs; this
+ resource will cause the output of all relevant
+ programs to be drawn on the screensaver window
+ itself, as well as being written to the control-
+ ling terminal of the screensaver driver process.
+ Default true.
+
+ f\bfo\bon\bnt\bt (class F\bFo\bon\bnt\bt)
+ The font used for the stdout/stderr text, if c\bca\bap\bp-\b-
+ t\btu\bur\bre\beS\bSt\btd\bde\ber\brr\br is true. Default
+ *\b*-\b-m\bme\bed\bdi\biu\bum\bm-\b-r\br-\b-*\b*-\b-1\b14\b40\b0-\b-*\b*-\b-m\bm-\b-*\b* (a 14 point fixed-width
+ font.)
+
+ p\bpr\bro\bog\bgr\bra\bam\bms\bs (class P\bPr\bro\bog\bgr\bra\bam\bms\bs)
+ The graphics hacks which _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br runs when
+ the user is idle. The value of this resource is a
+ string, one _\bs_\bh-syntax command per line. Each line
+ must contain exactly one command: no semicolons,
+ no ampersands.
+
+ When the screensaver starts up, one of these is
+ selected at random, and run. After the _\bc_\by_\bc_\bl_\be
+ period expires, it is killed, and another is
+ selected and run.
+
+ If the value of this resource is empty, then no
+ programs will be run; the screen will simply be
+ made black.
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 6
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ If the display has multiple screens, then a dif-
+ ferent program will be run for each screen. (All
+ screens are blanked and unblanked simultaniously.)
+
+ Note that you must escape the newlines; here is an
+ example of how you might set this in your
+ _\b~_\b/_\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file:
+
+
+ programs: \
+ qix -root \n\
+ ico -r -faces -sleep 1 -obj ico \n\
+ xdaliclock -builtin2 -root \n\
+ xv -root -rmode 5 image.gif -quit \n
+
+ Make sure your $\b$P\bPA\bAT\bTH\bH environment variable is set
+ up correctly _\bb_\be_\bf_\bo_\br_\be xscreensaver is launched, or
+ it won't be able to find the programs listed in
+ the _\bp_\br_\bo_\bg_\br_\ba_\bm_\bs resource.
+
+ To use a program as a screensaver, two things are
+ required: that that program draw on the root win-
+ dow (or be able to be configured to draw on the
+ root window); and that that program understand
+ ``virtual root'' windows, as used by virtual win-
+ dow managers such as t\btv\bvt\btw\bwm\bm(1). (Generally, this
+ is accomplished by just including the _\b"_\bv_\br_\bo_\bo_\bt_\b._\bh_\b"
+ header file in the program's source.)
+
+ If there are some programs that you want to run
+ only when using a color display, and others that
+ you want to run only when using a monochrome dis-
+ play, you can specify that like this:
+
+ mono: mono-program -root \n\
+ color: color-program -root \n\
+
+ More generally, you can specify the kind of visual
+ that should be used for the window on which the
+ program will be drawing. For example, if one pro-
+ gram works best if it has a colormap, but another
+ works best if it has a 24-bit visual, both can be
+ accommodated:
+
+ PseudoColor: cmap-program -root \n\
+ TrueColor: 24bit-program -root \n\
+
+ In addition to the symbolic visual names described
+ above (in the discussion of the _\bv_\bi_\bs_\bu_\ba_\bl_\bI_\bD resource)
+ one other visual name is supported in the _\bp_\br_\bo_\bg_\br_\ba_\bm_\bs
+ list:
+
+ d\bde\bef\bfa\bau\bul\blt\bt-\b-n\bn
+ This is like d\bde\bef\bfa\bau\bul\blt\bt, but also requests the
+
+
+
+X Version 11 20-Jun-99 (3.15) 7
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ use of the default colormap, instead of a
+ private colormap. (That is, it behaves as if
+ the _\b-_\bn_\bo_\b-_\bi_\bn_\bs_\bt_\ba_\bl_\bl command-line option was spec-
+ ified, but only for this particular hack.)
+ This is provided because some third-party
+ programs that draw on the root window
+ (notably: x\bxv\bv(1), and x\bxe\bea\bar\brt\bth\bh(1)) make assump-
+ tions about the visual and colormap of the
+ root window: assumptions which xscreensaver
+ can violate.
+
+ If you specify a particular visual for a program,
+ and that visual does not exist on the screen, then
+ that program will not be chosen to run. This
+ means that on displays with multiple screens of
+ different depths, you can arrange for appropriate
+ hacks to be run on each. For example, if one
+ screen is color and the other is monochrome, hacks
+ that look good in mono can be run on one, and
+ hacks that only look good in color will show up on
+ the other.
+
+
+ Normally you won't need to change the following resources:
+
+
+ p\bpo\boi\bin\bnt\bte\ber\brP\bPo\bol\bll\blT\bTi\bim\bme\be (class T\bTi\bim\bme\be)
+ When server extensions are not in use, this con-
+ trols how frequently _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br checks to see if
+ the mouse position or buttons have changed.
+ Default 5 seconds.
+
+ w\bwi\bin\bnd\bdo\bow\bwC\bCr\bre\bea\bat\bti\bio\bon\bnT\bTi\bim\bme\beo\bou\but\bt (class T\bTi\bim\bme\be)
+ When server extensions are not in use, this con-
+ trols the delay between when windows are created
+ and when _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br selects events on them.
+ Default 30 seconds.
+
+ i\bin\bni\bit\bti\bia\bal\blD\bDe\bel\bla\bay\by (class T\bTi\bim\bme\be)
+ When server extensions are not in use, _\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br will wait this many seconds before selecting
+ events on existing windows, under the assumption
+ that _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br is started during your login
+ procedure, and the window state may be in flux.
+ Default 0. (This used to default to 30, but that
+ was back in the days when slow machines and X ter-
+ minals were more common...)
+
+ s\bsg\bgi\biS\bSa\bav\bve\ber\brE\bEx\bxt\bte\ben\bns\bsi\bio\bon\bn (class B\bBo\boo\bol\ble\bea\ban\bn)
+ There are a number of different X server exten-
+ sions which can make xscreensaver's job easier.
+ The next few resources specify whether these
+ extensions should be utilized if they are avail-
+ able.
+
+
+
+X Version 11 20-Jun-99 (3.15) 8
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ This resource controls whether the SGI
+ S\bSC\bCR\bRE\bEE\bEN\bN_\b_S\bSA\bAV\bVE\bER\bR server extension will be used to
+ decide whether the user is idle. This is the
+ default if _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br has been compiled with
+ support for this extension (which is the default
+ on SGI systems.). If it is available, the
+ S\bSC\bCR\bRE\bEE\bEN\bN_\b_S\bSA\bAV\bVE\bER\bR method is faster and more reliable
+ than what will be done otherwise, so use it if you
+ can. (This extension is only available on Silicon
+ Graphics systems, unfortunately.)
+
+ m\bmi\bit\btS\bSa\bav\bve\ber\brE\bEx\bxt\bte\ben\bns\bsi\bio\bon\bn (class B\bBo\boo\bol\ble\bea\ban\bn)
+ This resource controls whether the
+ M\bMI\bIT\bT-\b-S\bSC\bCR\bRE\bEE\bEN\bN-\b-S\bSA\bAV\bVE\bER\bR server extension will be used to
+ decide whether the user is idle. However, the
+ default for this resource is _\bf_\ba_\bl_\bs_\be, because even
+ if this extension is available, it is flaky (and
+ it also makes the f\bfa\bad\bde\be option not work properly.)
+ Use of this extension is not recommended.
+
+ x\bxi\bid\bdl\ble\beE\bEx\bxt\bte\ben\bns\bsi\bio\bon\bn (class B\bBo\boo\bol\ble\bea\ban\bn)
+ This resource controls whether the X\bXI\bID\bDL\bLE\bE server
+ extension will be used to decide whether the user
+ is idle. This is the default if _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br has
+ been compiled with support for this extension.
+ (This extension is only available for X11R4 and
+ X11R5 systems, unfortunately.)
+
+ p\bpr\bro\boc\bcI\bIn\bnt\bte\ber\brr\bru\bup\bpt\bts\bs (class B\bBo\boo\bol\ble\bea\ban\bn)
+ This resource controls whether the /\b/p\bpr\bro\boc\bc/\b/i\bin\bnt\bte\ber\br-\b-
+ r\bru\bup\bpt\bts\bs file should be consulted to decide whether
+ the user is idle. This is the default if _\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br has been compiled on a system which supports
+ this mechanism (i.e., Linux systems.)
+
+ The benefit to doing this is that _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br can
+ note that the user is active even when the X con-
+ sole is not the active one: if the user is typing
+ in another virtual console, xscreensaver will
+ notice that and will fail to activate. For exam-
+ ple, if you're playing Quake in VGA-mode, xscreen-
+ saver won't wake up in the middle of your game and
+ start competing for CPU.
+
+ The drawback to doing this is that perhaps you
+ _\br_\be_\ba_\bl_\bl_\by _\bd_\bo want idleness on the X console to cause
+ the X display to lock, even if there is activity
+ on other virtual consoles. If you want that, then
+ set this option to False. (Or just lock the X
+ console manually.)
+
+ The default value for this resource is True, on
+ systems where it works.
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 9
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ o\bov\bve\ber\brl\bla\bay\byS\bSt\btd\bde\ber\brr\br (class B\bBo\boo\bol\ble\bea\ban\bn)
+ If c\bca\bap\bpt\btu\bur\bre\beS\bSt\btd\bde\ber\brr\br is True, and your server supports
+ ``overlay'' visuals, then the text will be written
+ into one of the higher layers instead of into the
+ same layer as the running screenhack. Set this to
+ False to disable that (though you shouldn't need
+ to.)
+
+ o\bov\bve\ber\brl\bla\bay\byT\bTe\bex\bxt\btF\bFo\bor\bre\beg\bgr\bro\bou\bun\bnd\bd (class F\bFo\bor\bre\beg\bgr\bro\bou\bun\bnd\bd)
+ The foreground color used for the stdout/stderr
+ text, if c\bca\bap\bpt\btu\bur\bre\beS\bSt\btd\bde\ber\brr\br is true. Default: Yellow.
+
+ o\bov\bve\ber\brl\bla\bay\byT\bTe\bex\bxt\btB\bBa\bac\bck\bkg\bgr\bro\bou\bun\bnd\bd (class B\bBa\bac\bck\bkg\bgr\bro\bou\bun\bnd\bd)
+ The background color used for the stdout/stderr
+ text, if c\bca\bap\bpt\btu\bur\bre\beS\bSt\btd\bde\ber\brr\br is true. Default: Black.
+
+ b\bbo\bou\bur\brn\bne\beS\bSh\bhe\bel\bll\bl (class B\bBo\bou\bur\brn\bne\beS\bSh\bhe\bel\bll\bl)
+ The pathname of the shell that _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br uses
+ to start subprocesses. This must be whatever your
+ local variant of /\b/b\bbi\bin\bn/\b/s\bsh\bh is: in particular, it
+ must not be c\bcs\bsh\bh.
+
+C\bCO\bOM\bMM\bMA\bAN\bND\bD-\b-L\bLI\bIN\bNE\bE O\bOP\bPT\bTI\bIO\bON\bNS\bS
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br also accepts the following command line
+ options. Except for the _\b-_\bd_\bi_\bs_\bp_\bl_\ba_\by option, these command-
+ line options are all simply shorthand for the X resources
+ described in the _\bC_\bo_\bn_\bf_\bi_\bg_\bu_\br_\ba_\bt_\bi_\bo_\bn section, above.
+
+ -\b-d\bdi\bis\bsp\bpl\bla\bay\by _\bh_\bo_\bs_\bt_\b:_\bd_\bi_\bs_\bp_\bl_\ba_\by_\b._\bs_\bc_\br_\be_\be_\bn
+ The X display to use. For displays with multiple
+ screens, XScreenSaver will manage all screens on
+ the display simultaniously; the _\bs_\bc_\br_\be_\be_\bn argument
+ (the ``default'' screen) says which screen should
+ be used for dialog boxes (the password window,
+ _\bD_\be_\bm_\bo _\bM_\bo_\bd_\be, etc.)
+
+ -\b-t\bti\bim\bme\beo\bou\but\bt _\bm_\bi_\bn_\bu_\bt_\be_\bs
+ Same as the _\bt_\bi_\bm_\be_\bo_\bu_\bt resource.
+
+ -\b-c\bcy\byc\bcl\ble\be _\bm_\bi_\bn_\bu_\bt_\be_\bs
+ Same as the _\bc_\by_\bc_\bl_\be resource.
+
+ -\b-l\blo\boc\bck\bk-\b-m\bmo\bod\bde\be
+ Same as setting the _\bl_\bo_\bc_\bk resource to _\bt_\br_\bu_\be.
+
+ -\b-n\bno\bo-\b-l\blo\boc\bck\bk-\b-m\bmo\bod\bde\be
+ Same as setting the _\bl_\bo_\bc_\bk resource to _\bf_\ba_\bl_\bs_\be.
+
+ -\b-l\blo\boc\bck\bk-\b-t\bti\bim\bme\beo\bou\but\bt _\bm_\bi_\bn_\bu_\bt_\be_\bs
+ Same as the _\bl_\bo_\bc_\bk_\bT_\bi_\bm_\be_\bo_\bu_\bt resource.
+
+ -\b-v\bvi\bis\bsu\bua\bal\bl _\bv_\bi_\bs_\bu_\ba_\bl
+ Same as the _\bv_\bi_\bs_\bu_\ba_\bl_\bI_\bD resource.
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 10
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ -\b-i\bin\bns\bst\bta\bal\bll\bl
+ Same as setting the _\bi_\bn_\bs_\bt_\ba_\bl_\bl_\bC_\bo_\bl_\bo_\br_\bm_\ba_\bp resource to
+ _\bt_\br_\bu_\be.
+
+ -\b-n\bno\bo-\b-i\bin\bns\bst\bta\bal\bll\bl
+ Same as setting the _\bi_\bn_\bs_\bt_\ba_\bl_\bl_\bC_\bo_\bl_\bo_\br_\bm_\ba_\bp resource to
+ _\bf_\ba_\bl_\bs_\be.
+
+ -\b-v\bve\ber\brb\bbo\bos\bse\be
+ Same as setting the _\bv_\be_\br_\bb_\bo_\bs_\be resource to _\bt_\br_\bu_\be.
+
+ -\b-s\bsi\bil\ble\ben\bnt\bt Same as setting the _\bv_\be_\br_\bb_\bo_\bs_\be resource to _\bf_\ba_\bl_\bs_\be.
+
+ -\b-t\bti\bim\bme\bes\bst\bta\bam\bmp\bp
+ Same as setting the _\bt_\bi_\bm_\be_\bs_\bt_\ba_\bm_\bp resource to _\bt_\br_\bu_\be.
+
+ -\b-c\bca\bap\bpt\btu\bur\bre\be-\b-s\bst\btd\bde\ber\brr\br
+ Same as setting the _\bc_\ba_\bp_\bt_\bu_\br_\be_\bS_\bt_\bd_\be_\br_\br resource to
+ _\bt_\br_\bu_\be.
+
+ -\b-n\bno\bo-\b-c\bca\bap\bpt\btu\bur\bre\be-\b-s\bst\btd\bde\ber\brr\br
+ Same as setting the _\bc_\ba_\bp_\bt_\bu_\br_\be_\bS_\bt_\bd_\be_\br_\br resource to
+ _\bf_\ba_\bl_\bs_\be.
+
+ -\b-s\bsp\bpl\bla\bas\bsh\bh Same as setting the _\bs_\bp_\bl_\ba_\bs_\bh resource to _\bt_\br_\bu_\be.
+
+ -\b-n\bno\bo-\b-s\bsp\bpl\bla\bas\bsh\bh
+ Same as setting the _\bs_\bp_\bl_\ba_\bs_\bh resource to _\bf_\ba_\bl_\bs_\be.
+
+ -\b-n\bni\bic\bce\be _\bi_\bn_\bt_\be_\bg_\be_\br
+ Same as the _\bn_\bi_\bc_\be resource.
+
+ -\b-s\bsg\bgi\bi-\b-e\bex\bxt\bte\ben\bns\bsi\bio\bon\bn
+ Same as setting the _\bs_\bg_\bi_\bS_\ba_\bv_\be_\br_\bE_\bx_\bt_\be_\bn_\bs_\bi_\bo_\bn resource to
+ _\bt_\br_\bu_\be.
+
+ -\b-n\bno\bo-\b-s\bsg\bgi\bi-\b-e\bex\bxt\bte\ben\bns\bsi\bio\bon\bn
+ Same as setting the _\bs_\bg_\bi_\bS_\ba_\bv_\be_\br_\bE_\bx_\bt_\be_\bn_\bs_\bi_\bo_\bn resource to
+ _\bf_\ba_\bl_\bs_\be.
+
+ -\b-m\bmi\bit\bt-\b-e\bex\bxt\bte\ben\bns\bsi\bio\bon\bn
+ Same as setting the _\bm_\bi_\bt_\bS_\ba_\bv_\be_\br_\bE_\bx_\bt_\be_\bn_\bs_\bi_\bo_\bn resource to
+ _\bt_\br_\bu_\be.
+
+ -\b-n\bno\bo-\b-m\bmi\bit\bt-\b-e\bex\bxt\bte\ben\bns\bsi\bio\bon\bn
+ Same as setting the _\bm_\bi_\bt_\bS_\ba_\bv_\be_\br_\bE_\bx_\bt_\be_\bn_\bs_\bi_\bo_\bn resource to
+ _\bf_\ba_\bl_\bs_\be.
+
+ -\b-x\bxi\bid\bdl\ble\be-\b-e\bex\bxt\bte\ben\bns\bsi\bio\bon\bn
+ Same as setting the _\bx_\bi_\bd_\bl_\be_\bE_\bx_\bt_\be_\bn_\bs_\bi_\bo_\bn resource to
+ _\bt_\br_\bu_\be.
+
+ -\b-n\bno\bo-\b-x\bxi\bid\bdl\ble\be-\b-e\bex\bxt\bte\ben\bns\bsi\bio\bon\bn
+ Same as setting the _\bx_\bi_\bd_\bl_\be_\bE_\bx_\bt_\be_\bn_\bs_\bi_\bo_\bn resource to
+
+
+
+X Version 11 20-Jun-99 (3.15) 11
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ _\bf_\ba_\bl_\bs_\be.
+
+ -\b-p\bpr\bro\boc\bc-\b-i\bin\bnt\bte\ber\brr\bru\bup\bpt\bts\bs
+ Same as setting the _\bp_\br_\bo_\bc_\bI_\bn_\bt_\be_\br_\br_\bu_\bp_\bt_\bs resource to
+ _\bt_\br_\bu_\be.
+
+ -\b-n\bno\bo-\b-p\bpr\bro\boc\bc-\b-i\bin\bnt\bte\ber\brr\bru\bup\bpt\bts\bs
+ Same as setting the _\bp_\br_\bo_\bc_\bI_\bn_\bt_\be_\br_\br_\bu_\bp_\bt_\bs resource to
+ _\bf_\ba_\bl_\bs_\be.
+
+ -\b-x\bxr\brm\bm _\br_\be_\bs_\bo_\bu_\br_\bc_\be_\b-_\bs_\bp_\be_\bc_\bi_\bf_\bi_\bc_\ba_\bt_\bi_\bo_\bn
+ As with all other Xt programs, you can specify X
+ resources on the command-line using the _\b-_\bx_\br_\bm argu-
+ ment. Most of the interesting resources have com-
+ mand-line equivalents, however.
+
+H\bHO\bOW\bW I\bIT\bT W\bWO\bOR\bRK\bKS\bS
+ When it is time to activate the screensaver, a full-screen
+ black window is created on each screen of the display.
+ Each window is created in such a way that, to any subse-
+ quently-created programs, it will appear to be a ``virtual
+ root'' window. Because of this, any program which draws
+ on the root window (and which understands virtual roots)
+ can be used as a screensaver.
+
+ When the user becomes active again, the screensaver win-
+ dows are unmapped, and the running subprocesses are killed
+ by sending them S\bSI\bIG\bGT\bTE\bER\bRM\bM. This is also how the subpro-
+ cesses are killed when the screensaver decides that it's
+ time to run a different demo: the old one is killed and a
+ new one is launched.
+
+ Before launching a subprocess, _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br stores an
+ appropriate value for $\b$D\bDI\bIS\bSP\bPL\bLA\bAY\bY in the environment that the
+ child will recieve. (This is so that if you start
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br with a _\b-_\bd_\bi_\bs_\bp_\bl_\ba_\by argument, the programs which
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br launches will draw on the same display; and
+ so that the child will end up drawing on the appropriate
+ screen of a multi-headed display.)
+
+ When the screensaver turns off, or is killed, care is
+ taken to restore the ``real'' virtual root window if there
+ is one. Because of this, it is important that you not
+ kill the screensaver process with _\bk_\bi_\bl_\bl _\b-_\b9 if you are run-
+ ning a virtual-root window manager. If you kill it with
+ -9, you may need to restart your window manager to repair
+ the damage. This isn't an issue if you aren't running a
+ virtual-root window manager.
+
+ For all the gory details, see the commentary at the top of
+ xscreensaver.c.
+
+ You can control a running screensaver process by using the
+ x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-c\bco\bom\bmm\bma\ban\bnd\bd(1) program (which see.)
+
+
+
+X Version 11 20-Jun-99 (3.15) 12
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+P\bPO\bOW\bWE\bER\bR M\bMA\bAN\bNA\bAG\bGE\bEM\bME\bEN\bNT\bT
+ Modern X servers contain support to power down the monitor
+ after an idle period. If the monitor has powered down,
+ then _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br will notice this, and will not waste CPU
+ by drawing graphics demos on a black screen. An attempt
+ will also be made to explicitly power the monitor back up
+ as soon as user activity is detected.
+
+ If your X server supports power management, then x\bxs\bse\bet\bt(1)
+ will accept a d\bdp\bpm\bms\bs option. So, if you wanted _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br
+ to activate after 5 minutes, but you wanted your monitor
+ to power down after one hour (3600 seconds) you would do
+ this:
+
+ xset dpms 3600
+
+ See the man page for the x\bxs\bse\bet\bt(1) program for details.
+ (Note that power management requires both software support
+ in the X server, and hardware support in the monitor
+ itself.)
+
+U\bUS\bSI\bIN\bNG\bG X\bXD\bDM\bM(\b(1\b1)\b)
+ You can run _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br from your x\bxd\bdm\bm(1) session, so that
+ the screensaver will run even when nobody is logged in on
+ the console.
+
+ The trick to using xscreensaver with _\bx_\bd_\bm is this: keep in
+ mind the two very different states in which xscreensaver
+ will be running:
+
+ 1\b1:\b: N\bNo\bob\bbo\bod\bdy\by l\blo\bog\bgg\bge\bed\bd i\bin\bn.\b.
+
+ If you're thinking of running xscreensaver from XDM
+ at all, then it's probably because you want graph-
+ ics demos to be running on the console when nobody
+ is logged in there. In this case, xscreensaver
+ will function only as a screen saver, not a screen
+ locker: it doesn't make sense for xscreensaver to
+ lock the screen, since nobody is logged in yet!
+ The only thing on the screen is the XDM login
+ prompt.
+
+ 2\b2:\b: S\bSo\bom\bme\beb\bbo\bod\bdy\by l\blo\bog\bgg\bge\bed\bd i\bin\bn.\b.
+
+ Once someone has logged in through the XDM login
+ window, the situation is very different. For exam-
+ ple: now it makes sense to lock the screen (and
+ prompt for the logged in user's password); and now
+ xscreensaver should consult that user's _\b~_\b/_\b._\bx_\bs_\bc_\br_\be_\be_\bn_\b-
+ _\bs_\ba_\bv_\be_\br file; and so on.
+
+ The difference between these two states comes down to a
+ question of, which user is the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br process run-
+ ning as? For the first state, it doesn't matter. If you
+
+
+
+X Version 11 20-Jun-99 (3.15) 13
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ start _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br in the usual XDM way, then xscreensaver
+ will probably end up running as root, which is fine for
+ the first case (the ``nobody logged in'' case.)
+
+ However, once someone is logged in, running as root is no
+ longer fine: because xscreensaver will be consulting
+ root's _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file instead of that of the logged in
+ user, and won't be prompting for the logged in user's
+ password, and so on. (This is not a security problem,
+ it's just not what you want.)
+
+ So, once someone has logged in, you want xscreensaver to
+ be running as that user. The way to accomplish this is to
+ kill the old xscreensaver process and start a new one (as
+ the new user.)
+
+ The simplest way to accomplish all of this is as follows:
+
+ 1\b1:\b: L\bLa\bau\bun\bnc\bch\bh x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br b\bbe\bef\bfo\bor\bre\be a\ban\bny\byo\bon\bne\be l\blo\bog\bgs\bs i\bin\bn.\b.
+
+ To the file _\b/_\bu_\bs_\br_\b/_\bl_\bi_\bb_\b/_\bX_\b1_\b1_\b/_\bx_\bd_\bm_\b/_\bX_\bs_\be_\bt_\bu_\bp, add the lines
+
+ xscreensaver-command -exit
+ xscreensaver &
+
+ This will run xscreensaver as root, over the XDM
+ login window. Moving the mouse will cause the
+ screen to un-blank, and allow the user to type
+ their password at XDM to log in.
+
+ 2\b2:\b: R\bRe\bes\bst\bta\bar\brt\bt x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br w\bwh\bhe\ben\bn s\bso\bom\bme\beo\bon\bne\be l\blo\bog\bgs\bs i\bin\bn.\b.
+
+ Near the top of the file _\b/_\bu_\bs_\br_\b/_\bl_\bi_\bb_\b/_\bX_\b1_\b1_\b/_\bx_\bd_\bm_\b/_\bX_\bs_\be_\bs_\bs_\bi_\bo_\bn,
+ add those same lines:
+
+ xscreensaver-command -exit
+ xscreensaver &
+
+ When someone logs in, this will kill off the exist-
+ ing (root) xscreensaver process, and start a new
+ one, running as the user who has just logged in.
+ If the user's .xscreensaver file requests locking,
+ they'll get it. They will also get their own
+ choice of timeouts, and graphics demos, and so on.
+
+ Alternately, each user could just put those lines
+ in their personal _\b~_\b/_\b._\bx_\bs_\be_\bs_\bs_\bi_\bo_\bn files.
+
+ Make sure you have $\b$P\bPA\bAT\bTH\bH set up correctly in the _\bX_\bs_\be_\bt_\bu_\bp
+ and _\bX_\bs_\be_\bs_\bs_\bi_\bo_\bn scripts, or _\bx_\bd_\bm won't be able to find
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br, and/or _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br won't be able to find
+ its graphics demos.
+
+ (If your system does not seem to be executing the _\bX_\bs_\be_\bt_\bu_\bp
+
+
+
+X Version 11 20-Jun-99 (3.15) 14
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ file, you may need to configure it to do so: the tradi-
+ tional way to do this is to make that file the value of
+ the _\bD_\bi_\bs_\bp_\bl_\ba_\by_\bM_\ba_\bn_\ba_\bg_\be_\br_\b*_\bs_\be_\bt_\bu_\bp resource in the
+ _\b/_\bu_\bs_\br_\b/_\bl_\bi_\bb_\b/_\bX_\b1_\b1_\b/_\bx_\bd_\bm_\b/_\bx_\bd_\bm_\b-_\bc_\bo_\bn_\bf_\bi_\bg file. See the man page for
+ x\bxd\bdm\bm(1) for more details.)
+
+ It is safe to run _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br as root (as _\bx_\bd_\bm is likely
+ to do.) If run as root, _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br changes its effec-
+ tive user and group ids to something safe (like _\b"_\bn_\bo_\bb_\bo_\bd_\by_\b")
+ before connecting to the X server or launching user-speci-
+ fied programs.
+
+ An unfortunate side effect of this (important) security
+ precaution is that it may conflict with cookie-based
+ authentication.
+
+ If you get "connection refused" errors when running
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br from _\bx_\bd_\bm, then this probably means that you
+ have x\bxa\bau\but\bth\bh(1) or some other security mechanism turned on.
+ One way around this is to add "\b"x\bxh\bho\bos\bst\bt +\b+l\blo\boc\bca\bal\blh\bho\bos\bst\bt"\b" to
+ _\bX_\bs_\be_\bt_\bu_\bp, just before _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br is launched.
+
+ Note that this will give access to the X server to anyone
+ capable of logging in to the local machine, so in some
+ environments, this might not be appropriate. If turning
+ off file-system-based access control is not acceptable,
+ then running _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br from the _\bX_\bs_\be_\bt_\bu_\bp file might not
+ be possible, and xscreensaver will only work when running
+ as a normal, unprivileged user.
+
+ For more information on the X server's access control
+ mechanisms, see the man pages for X\bX(1), X\bXs\bse\bec\bcu\bur\bri\bit\bty\by(1),
+ x\bxa\bau\but\bth\bh(1), and x\bxh\bho\bos\bst\bt(1).
+
+U\bUS\bSI\bIN\bNG\bG C\bCD\bDE\bE (\b(C\bCO\bOM\bMM\bMO\bON\bN D\bDE\bES\bSK\bKT\bTO\bOP\bP E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT)\b)
+ The easiest way to use _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br on a system with CDE
+ is to simply switch off the built-in CDE screensaver, and
+ use _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br instead; and second, to tell the front
+ panel to run x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-c\bco\bom\bmm\bma\ban\bnd\bd(1) with the _\b-_\bl_\bo_\bc_\bk option
+ when the _\bL_\bo_\bc_\bk icon is clicked.
+
+ To accomplish this involves five steps:
+
+ 1\b1:\b: S\bSw\bwi\bit\btc\bch\bh o\bof\bff\bf C\bCD\bDE\bE'\b's\bs l\blo\boc\bck\bke\ber\br
+ Do this by turning off ``_\bS_\bc_\br_\be_\be_\bn _\bS_\ba_\bv_\be_\br _\ba_\bn_\bd _\bS_\bc_\br_\be_\be_\bn
+ _\bL_\bo_\bc_\bk'' in the Screen section of the Style Manager.
+
+ 2\b2:\b: E\bEd\bdi\bit\bt s\bse\bes\bss\bsi\bio\bon\bne\bet\btc\bc
+ Edit the file _\b~_\b/_\b._\bd_\bt_\b/_\bs_\be_\bs_\bs_\bi_\bo_\bn_\bs_\b/_\bs_\be_\bs_\bs_\bi_\bo_\bn_\be_\bt_\bc and add to
+ it the line
+
+ xscreensaver &
+
+ This will cause _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br to be launched when
+
+
+
+X Version 11 20-Jun-99 (3.15) 15
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ you log in. (As always, make sure that xscreen-
+ saver and the graphics demos are on your $\b$P\bPA\bAT\bTH\bH; the
+ path needs to be set in _\b._\bc_\bs_\bh_\br_\bc and/or _\b._\bd_\bt_\bp_\br_\bo_\bf_\bi_\bl_\be,
+ not _\b._\bl_\bo_\bg_\bi_\bn.)
+
+ 3\b3:\b: C\bCr\bre\bea\bat\bte\be X\bXS\bSc\bcr\bre\bee\ben\bnS\bSa\bav\bve\ber\br.\b.d\bdt\bt
+ Create a file called _\b~_\b/_\b._\bd_\bt_\b/_\bt_\by_\bp_\be_\bs_\b/_\bX_\bS_\bc_\br_\be_\be_\bn_\bS_\ba_\bv_\be_\br_\b._\bd_\bt
+ with the following contents:
+
+ ACTION XScreenSaver
+ {
+ LABEL XScreenSaver
+ TYPE COMMAND
+ EXEC_STRING xscreensaver-command -lock
+ ICON Dtkey
+ WINDOW_TYPE NO_STDIO
+ }
+
+ This defines a ``lock'' command for the CDE front
+ panel, that knows how to talk to _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br.
+
+ 4\b4:\b: C\bCr\bre\bea\bat\bte\be L\bLo\boc\bck\bk.\b.f\bfp\bp
+ Create a file called _\b~_\b/_\b._\bd_\bt_\b/_\bt_\by_\bp_\be_\bs_\b/_\bL_\bo_\bc_\bk_\b._\bf_\bp with the
+ following contents:
+
+ CONTROL Lock
+ {
+ TYPE icon
+ CONTAINER_NAME Switch
+ CONTAINER_TYPE SWITCH
+ POSITION_HINTS 1
+ ICON Fplock
+ LABEL Lock
+ PUSH_ACTION XScreenSaver
+ HELP_TOPIC FPOnItemLock
+ HELP_VOLUME FPanel
+ }
+
+ This associates the CDE front panel ``Lock'' icon
+ with the lock command we just defined in step 3.
+
+ 5\b5:\b: R\bRe\bes\bst\bta\bar\brt\bt
+ Select ``_\bR_\be_\bs_\bt_\ba_\br_\bt _\bW_\bo_\br_\bk_\bs_\bp_\ba_\bc_\be _\bM_\ba_\bn_\ba_\bg_\be_\br'' from the popup
+ menu to make your changes take effect. If things
+ seem not to be working, check the file _\b~_\b/_\b._\bd_\bt_\b/_\be_\br_\br_\bo_\br_\b-
+ _\bl_\bo_\bg for error messages.
+
+U\bUS\bSI\bIN\bNG\bG H\bHP\bP V\bVU\bUE\bE (\b(V\bVI\bIS\bSU\bUA\bAL\bL U\bUS\bSE\bER\bR E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT)\b)
+ Since CDE is a descendant of VUE, the instructions for
+ using xscreensaver under VUE are similar to the above:
+
+ 1\b1:\b: S\bSw\bwi\bit\btc\bch\bh o\bof\bff\bf V\bVU\bUE\bE'\b's\bs l\blo\boc\bck\bke\ber\br
+ Open the ``_\bS_\bt_\by_\bl_\be _\bM_\ba_\bn_\ba_\bg_\be_\br'' and select ``_\bS_\bc_\br_\be_\be_\bn.''
+ Turn off ``_\bS_\bc_\br_\be_\be_\bn _\bS_\ba_\bv_\be_\br _\ba_\bn_\bd _\bS_\bc_\br_\be_\be_\bn _\bL_\bo_\bc_\bk'' option.
+
+
+
+X Version 11 20-Jun-99 (3.15) 16
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ 2\b2:\b: M\bMa\bak\bke\be s\bsu\bur\bre\be y\byo\bou\bu h\bha\bav\bve\be a\ba S\bSe\bes\bss\bsi\bio\bon\bn
+ Next, go to the Style Manager's, ``_\bS_\bt_\ba_\br_\bt_\bu_\bp'' page.
+ Click on ``_\bS_\be_\bt _\bH_\bo_\bm_\be _\bS_\be_\bs_\bs_\bi_\bo_\bn'' to create a session,
+ then on ``_\bR_\be_\bt_\bu_\br_\bn _\bt_\bo _\bH_\bo_\bm_\be _\bS_\be_\bs_\bs_\bi_\bo_\bn'' to select this
+ session each time you log in.
+
+ 3\b3:\b: E\bEd\bdi\bit\bt v\bvu\bue\be.\b.s\bse\bes\bss\bsi\bio\bon\bn
+ Edit the file _\b~_\b/_\b._\bv_\bu_\be_\b/_\bs_\be_\bs_\bs_\bi_\bo_\bn_\bs_\b/_\bh_\bo_\bm_\be_\b/_\bv_\bu_\be_\b._\bs_\be_\bs_\bs_\bi_\bo_\bn and
+ add to it the line
+
+ vuesmcmd -screen 0 -cmd "xscreensaver"
+
+ This will cause _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br to be launched when
+ you log in. (As always, make sure that xscreen-
+ saver and the graphics demos are on your $\b$P\bPA\bAT\bTH\bH; the
+ path needs to be set in _\b._\bc_\bs_\bh_\br_\bc and/or _\b._\bp_\br_\bo_\bf_\bi_\bl_\be, not
+ _\b._\bl_\bo_\bg_\bi_\bn.)
+
+ 3\b3:\b: E\bEd\bdi\bit\bt v\bvu\bue\bew\bwm\bmr\brc\bc
+ Edit the file _\b~_\b/_\b._\bv_\bu_\be_\b/_\bv_\bu_\be_\bw_\bm_\br_\bc and add (or change)
+ the Lock control:
+
+ CONTROL Lock
+ {
+ TYPE button
+ IMAGE lock
+ PUSH_ACTION f.exec "xscreensaver-command -lock"
+ HELP_TOPIC FPLock
+ }
+
+ This associates the VUE front panel ``Lock'' icon
+ with the xscreensaver lock command.
+
+
+A\bAD\bDD\bDI\bIN\bNG\bG T\bTO\bO M\bME\bEN\bNU\bUS\bS
+ The x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-c\bco\bom\bmm\bma\ban\bnd\bd(1) program is a perfect candidate
+ for something to add to your window manager's popup menus.
+ If you use m\bmw\bwm\bm(1), 4\b4D\bDw\bwm\bm(1), t\btw\bwm\bm(1), or (probably) any of
+ _\bt_\bw_\bm's many descendants, you can do it like this:
+
+ 1\b1.\b. C\bCr\bre\bea\bat\bte\be ~\b~/\b/.\b.m\bmw\bwm\bmr\brc\bc (\b(o\bor\br ~\b~/\b/.\b.t\btw\bwm\bmr\brc\bc o\bor\br .\b..\b..\b.)\b)
+ If you don't have a _\b~_\b/_\b._\bm_\bw_\bm_\br_\bc file (or, on SGIs, a
+ _\b~_\b/_\b._\b4_\bD_\bw_\bm_\br_\bc file; or, with twm, a _\b~_\b/_\b._\bt_\bw_\bm_\br_\bc file) then
+ create one by making a copy of the _\b/_\bu_\bs_\br_\b/_\bl_\bi_\bb_\b/_\bX_\b1_\b1_\b/_\bs_\by_\bs_\b-
+ _\bt_\be_\bm_\b._\bm_\bw_\bm_\br_\bc file (or _\b/_\bu_\bs_\br_\b/_\bl_\bi_\bb_\b/_\bX_\b1_\b1_\b/_\bt_\bw_\bm_\b/_\bs_\by_\bs_\bt_\be_\bm_\b._\bt_\bw_\bm_\br_\bc, and
+ so on.)
+
+ 2\b2.\b. A\bAd\bdd\bd a\ba m\bme\ben\bnu\bu d\bde\bef\bfi\bin\bni\bit\bti\bio\bon\bn.\b.
+ Something like this:
+
+ menu XScreenSaver
+ {
+ "Blank Screen Now" !"sleep 3; xscreensaver-command -activate"
+ "Lock Screen Now" !"sleep 3; xscreensaver-command -lock"
+
+
+
+X Version 11 20-Jun-99 (3.15) 17
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ "Screen Saver Demo" !"xscreensaver-demo"
+ "Screen Saver Preferences" !"xscreensaver-demo -prefs"
+ "Reinitialize Screen Saver" !"xscreensaver-command -restart"
+ "Kill Screen Saver" !"xscreensaver-command -exit"
+ "Launch Screen Saver" !"xscreensaver &"
+ }
+
+
+ 3\b3.\b. A\bAd\bdd\bd t\bth\bhe\be m\bme\ben\bnu\bu
+ For m\bmw\bwm\bm(1) and 4\b4D\bDw\bwm\bm(1), find the section of the file
+ that says _\bM_\be_\bn_\bu _\bD_\be_\bf_\ba_\bu_\bl_\bt_\bR_\bo_\bo_\bt_\bM_\be_\bn_\bu. For t\btw\bwm\bm(1), it will
+ probably be _\bm_\be_\bn_\bu _\b"_\bd_\be_\bf_\bo_\bp_\bs_\b". If you add a line somewhere
+ in that menu definition that reads
+
+ "XScreenSaver" f.menu XScreenSaver
+
+ then this will add an XScreenSaver sub-menu to your
+ default root-window popup menu. Alternately, you could
+ just put the xscreensaver menu items directly into the
+ root menu.
+
+ Other window managers are guaranteed to do things gratu-
+ itously differently.
+
+B\bBU\bUG\bGS\bS
+ Bugs? There are no bugs. Ok, well, maybe. If you find
+ one, please let me know. http://www.jwz.org/xscreen-
+ saver/bugs.html explains how to construct the most useful
+ bug reports.
+
+ L\bLo\boc\bck\bki\bin\bng\bg a\ban\bnd\bd X\bXD\bDM\bM
+ If xscreensaver has been launched from x\bxd\bdm\bm(1)
+ before anyone has logged in, you will need to kill
+ and then restart the xscreensaver daemon after you
+ have logged in, or you will be confused by the
+ results. (For example, locking won't work, and
+ your _\b~_\b/_\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file will be ignored.)
+
+ When you are logged in, you want the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br
+ daemon to be running under _\by_\bo_\bu_\br user id, not as
+ root or some other user.
+
+ If it has already been started by _\bx_\bd_\bm, you can
+ kill it by sending it the e\bex\bxi\bit\bt command, and then
+ re-launching it as you, by putting something like
+ the following in your personal X startup script:
+
+ xscreensaver-command -exit
+ xscreensaver &
+
+ The ``_\bU_\bs_\bi_\bn_\bg _\bX_\bD_\bM_\b(_\b1_\b)'' section, above, goes into
+ more detail, and explains how to configure the
+ system to do this for all users automatically.
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 18
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ L\bLo\boc\bck\bki\bin\bng\bg a\ban\bnd\bd r\bro\boo\bot\bt l\blo\bog\bgi\bin\bns\bs
+ In order for it to be safe for xscreensaver to be
+ launched by _\bx_\bd_\bm, certain precautions had to be
+ taken, among them that xscreensaver never runs as
+ _\br_\bo_\bo_\bt. In particular, if it is launched as root
+ (as _\bx_\bd_\bm is likely to do), xscreensaver will dis-
+ avow its privileges, and switch itself to a safe
+ user id (such as _\bn_\bo_\bb_\bo_\bd_\by.)
+
+ An implication of this is that if you log in as
+ _\br_\bo_\bo_\bt on the console, xscreensaver will refuse to
+ lock the screen (because it can't tell the differ-
+ ence between _\br_\bo_\bo_\bt being logged in on the console,
+ and a normal user being logged in on the console
+ but xscreensaver having been launched by the
+ x\bxd\bdm\bm(1) _\bX_\bs_\be_\bt_\bu_\bp file.)
+
+ The solution to this is simple: you shouldn't be
+ logging in on the console as _\br_\bo_\bo_\bt in the first
+ place! (What, are you crazy or something?)
+
+ Proper Unix hygiene dictates that you should log
+ in as yourself, and s\bsu\bu(1) to _\br_\bo_\bo_\bt as necessary.
+ People who spend their day logged in as _\br_\bo_\bo_\bt are
+ just begging for disaster.
+
+ X\bXA\bAU\bUT\bTH\bH a\ban\bnd\bd X\bXD\bDM\bM
+ For xscreensaver to work when launched by x\bxd\bdm\bm(1),
+ programs running on the local machine as user
+ _\b"_\bn_\bo_\bb_\bo_\bd_\by_\b" must be able to connect to the X server.
+ This means that if you want to run xscreensaver on
+ the console while nobody is logged in, you may
+ need to disable cookie-based access control (and
+ allow all users who can log in to the local
+ machine to connect to the display.)
+
+ You should be sure that this is an acceptable
+ thing to do in your environment before doing it.
+ See the ``_\bU_\bs_\bi_\bn_\bg _\bX_\bD_\bM_\b(_\b1_\b)'' section, above, for more
+ details.
+
+ If anyone has suggestions on how xscreensaver
+ could be made to work with x\bxd\bdm\bm(1) without first
+ turning off _\b._\bX_\ba_\bu_\bt_\bh_\bo_\br_\bi_\bt_\by-based access control,
+ please let me know.
+
+ P\bPa\bas\bss\bsw\bwo\bor\brd\bds\bs
+ If you get an error message at startup like
+ ``couldn't get password of _\bu_\bs_\be_\br'' then this proba-
+ bly means that you're on a system in which the
+ g\bge\bet\btp\bpw\bwe\ben\bnt\bt(3) library routine can only be effec-
+ tively used by root. If this is the case, then
+ _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br must be installed as setuid to root
+ in order for locking to work. Care has been taken
+
+
+
+X Version 11 20-Jun-99 (3.15) 19
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ to make this a safe thing to do.
+
+ It also may mean that your system uses shadow
+ passwords instead of the standard g\bge\bet\btp\bpw\bwe\ben\bnt\bt(3)
+ interface; in that case, you may need to change
+ some options with _\bc_\bo_\bn_\bf_\bi_\bg_\bu_\br_\be and recompile.
+
+ If you change your password after xscreensaver has
+ been launched, it will continue using your old
+ password to unlock the screen until xscreensaver
+ is restarted. So, after you change your password,
+ you'll have to do
+
+ xscreensaver-command -restart
+
+ to make _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br notice.
+
+ P\bPA\bAM\bM P\bPa\bas\bss\bsw\bwo\bor\brd\bds\bs
+ If your system uses PAM (Pluggable Authentication
+ Modules), then in order for xscreensaver to use
+ PAM properly, PAM must be told about xscreensaver.
+ The xscreensaver installation process should
+ update the PAM data (on Linux, by creating the
+ file _\b/_\be_\bt_\bc_\b/_\bp_\ba_\bm_\b._\bd_\b/_\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br for you, and on
+ Solaris, by telling you what lines to add to the
+ _\b/_\be_\bt_\bc_\b/_\bp_\ba_\bm_\b._\bc_\bo_\bn_\bf file.)
+
+ If the PAM configuration files do not know about
+ xscreensaver, then you _\bm_\bi_\bg_\bh_\bt be in a situation
+ where xscreensaver will refuse to ever unlock the
+ screen.
+
+ This is a design flaw in PAM (there is no way for
+ a client to tell the difference between PAM
+ responding ``I have never heard of your module,''
+ and responding, ``you typed the wrong password.'')
+ As far as I can tell, there is no way for xscreen-
+ saver to automatically work around this, or detect
+ the problem in advance, so if you have PAM, make
+ sure it is configured correctly!
+
+ C\bCo\bol\blo\bor\brm\bma\bap\bp l\blo\bos\bss\bsa\bag\bge\be:\b: T\bTW\bWM\bM
+ The i\bin\bns\bst\bta\bal\bll\blC\bCo\bol\blo\bor\brm\bma\bap\bp option doesn't work very well
+ with the t\btw\bwm\bm(1) window manager and its descen-
+ dants.
+
+ There is a race condition between the screensaver
+ and this window manager, which can result in the
+ screensaver's colormap not getting installed prop-
+ erly, meaning the graphics hacks will appear in
+ essentially random colors. (If the screen goes
+ white instead of black, this is probably why.)
+
+ The m\bmw\bwm\bm(1) and o\bol\blw\bwm\bm(1) window managers don't have
+
+
+
+X Version 11 20-Jun-99 (3.15) 20
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ this problem. The race condition exists because X
+ (really, ICCCM) does not provide a way for an
+ OverrideRedirect window to have its own colormap,
+ short of grabbing the server (which is neither a
+ good idea, nor really possible with the current
+ design.) What happens is that, as soon as
+ xscreensaver installs its colormap, t\btw\bwm\bm responds
+ to the resultant C\bCo\bol\blo\bor\brm\bma\bap\bpN\bNo\bot\bti\bif\bfy\by event by re-
+ instaling the default colormap. Apparently, t\btw\bwm\bm
+ doesn't _\ba_\bl_\bw_\ba_\by_\bs do this; it seems to do it regu-
+ larly if the screensaver is activated from a menu
+ item, but seems to not do it if the screensaver
+ comes on of its own volition, or is activated from
+ another console.
+
+ A\bAt\btt\bte\ben\bnt\bti\bio\bon\bn,\b, w\bwi\bin\bnd\bdo\bow\bw m\bma\ban\bna\bag\bge\ber\br a\bau\but\bth\bho\bor\brs\bs!\b!
+ You should only call X\bXI\bIn\bns\bst\bta\bal\bll\blC\bCo\bol\blo\bor\brm\bma\bap\bp(3) in
+ response to user events. That is, it is
+ appropriate to install a colormap in response
+ to F\bFo\boc\bcu\bus\bsI\bIn\bn, F\bFo\boc\bcu\bus\bsO\bOu\but\bt, E\bEn\bnt\bte\ber\brN\bNo\bot\bti\bif\bfy\by, and
+ L\bLe\bea\bav\bve\beN\bNo\bot\bti\bif\bfy\by events; but it is not appropriate
+ to call it in response to C\bCo\bol\blo\bor\brm\bma\bap\bpN\bNo\bot\bti\bif\bfy\by
+ events. If you install colormaps in response
+ to _\ba_\bp_\bp_\bl_\bi_\bc_\ba_\bt_\bi_\bo_\bn actions as well as in response
+ to _\bu_\bs_\be_\br actions, then you create the situation
+ where it is impossible for override-redirect
+ applications (such as xscreensaver) to display
+ their windows in the proper colors.
+
+ C\bCo\bol\blo\bor\brm\bma\bap\bp l\blo\bos\bss\bsa\bag\bge\be:\b: X\bXV\bV,\b, X\bXA\bAn\bni\bim\bm,\b, X\bXE\bEa\bar\brt\bth\bh
+ Some programs don't operate properly on visuals
+ other than the default one, or with colormaps
+ other than the default one. See the discussion of
+ the magic "default-n" visual name in the descrip-
+ tion of the p\bpr\bro\bog\bgr\bra\bam\bms\bs resource in the _\bC_\bo_\bn_\bf_\bi_\bg_\bu_\br_\ba_\bt_\bi_\bo_\bn
+ section. When programs only work with the default
+ colormap, you need to use a syntax like this:
+
+ default-n: xv -root image-1.gif -quit \n\
+ default-n: xearth -nostars -wait 0 \n\
+
+ It would also work to turn off the i\bin\bns\bst\bta\bal\bll\blC\bCo\bol\blo\bor\brm\bma\bap\bp
+ option altogether, but that would deny extra col-
+ ors to those programs that _\bc_\ba_\bn take advantage of
+ them.
+
+ M\bMa\bac\bch\bhi\bin\bne\be L\bLo\boa\bad\bd
+ Although this program ``nices'' the subprocesses
+ that it starts, graphics-intensive subprograms can
+ still overload the machine by causing the X server
+ process itself (which is not ``niced'') to suck a
+ lot of cycles. Care should be taken to slow down
+ programs intended for use as screensavers by
+ inserting strategic calls to s\bsl\ble\bee\bep\bp(3) or u\bus\bsl\ble\bee\bep\bp(3)
+
+
+
+X Version 11 20-Jun-99 (3.15) 21
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ (or making liberal use of any _\b-_\bd_\be_\bl_\ba_\by options which
+ the programs may provide.)
+
+ Note that the OpenGL-based graphics demos are real
+ pigs on machines that don't have texture hardware.
+
+ Also, an active screensaver will cause your X
+ server to be pretty much permanently swapped in;
+ but the same is true of any program that draws
+ periodically, like x\bxc\bcl\blo\boc\bck\bk(1) or x\bxl\blo\boa\bad\bd(1).
+
+ L\bLa\bat\bte\ben\bnc\bcy\by a\ban\bnd\bd R\bRe\bes\bsp\bpo\bon\bns\bsi\biv\bve\ben\bne\bes\bss\bs
+ If the subprocess is drawing too quickly and the
+ connection to the X server is a slow one (such as
+ an X terminal running over a phone line) then the
+ screensaver might not turn off right away when the
+ user becomes active again (the i\bic\bco\bo(1) demo has
+ this problem if being run in full-speed mode).
+ This can be alleviated by inserting strategic
+ calls to X\bXS\bSy\byn\bnc\bc(3) in code intended for use as a
+ screensaver. This prevents too much graphics
+ activity from being buffered up.
+
+ X\bXF\bFr\bre\bee\be8\b86\b6'\b's\bs M\bMa\bag\bgi\bic\bc K\bKe\bey\bys\bst\btr\bro\bok\bke\bes\bs
+ The XFree86 X server traps certain magic
+ keystrokes before client programs ever see them.
+ Two that are of note are Ctrl+Alt+Backspace, which
+ causes the X server to exit; and Ctrl+Alt+F_\bn,
+ which switches virtual consoles. The X server
+ will respond to these keystrokes even if xscreen-
+ saver has the screen locked. Depending on your
+ setup, you might consider this a problem.
+
+ Unfortunately, there is no way for xscreensaver
+ itself to override the interpretation of these
+ keys. If you want to disable Ctrl+Alt+Backspace
+ globally, you need to set the _\bD_\bo_\bn_\bt_\bZ_\ba_\bp flag in your
+ _\b/_\be_\bt_\bc_\b/_\bX_\b1_\b1_\b/_\bX_\bF_\b8_\b6_\bC_\bo_\bn_\bf_\bi_\bg file. See the X\bXF\bF8\b86\b6C\bCo\bon\bnf\bfi\big\bg(5)
+ manual for details.
+
+ There is no way (as far as I can tell) to disable
+ the VT-switching keystrokes.
+
+ Some Linux systems come with a VT_LOCKSWITCH
+ ioctl, that one could theoretically use to prevent
+ VT-switching while the screen is locked; but
+ unfortunately, this ioctl can only be used by
+ root, which means that xscreensaver can't use it
+ (since xscreensaver disavows its privileges
+ shortly after startup, for security reasons.)
+
+ Any suggestions for other solutions to this prob-
+ lem are welcome.
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 22
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ X\bXV\bVi\bie\bew\bw C\bCl\bli\bie\ben\bnt\bts\bs
+ Apparently there are some problems with XView pro-
+ grams getting confused and thinking that the
+ screensaver window is the real root window even
+ when the screensaver is not active: ClientMessages
+ intended for the window manager are sent to the
+ screensaver window instead. This could be solved
+ by making xscreensaver forward all unrecognised
+ ClientMessages to the real root window, but there
+ may be other problems as well. If anyone has any
+ insight on the cause of this problem, please let
+ me know. (XView is an X11 toolkit that implements
+ the (quite abominable) Sun OpenLook look-and-
+ feel.)
+
+ M\bMI\bIT\bT E\bEx\bxt\bte\ben\bns\bsi\bio\bon\bn a\ban\bnd\bd F\bFa\bad\bdi\bin\bng\bg
+ The M\bMI\bIT\bT-\b-S\bSC\bCR\bRE\bEE\bEN\bN-\b-S\bSA\bAV\bVE\bER\bR extension is junk. Don't use
+ it.
+
+ When using the M\bMI\bIT\bT-\b-S\bSC\bCR\bRE\bEE\bEN\bN-\b-S\bSA\bAV\bVE\bER\bR extension in con-
+ junction with the f\bfa\bad\bde\be option, you'll notice an
+ unattractive flicker just before the fade begins.
+ This is because the server maps a black window
+ just before it tells the _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br process to
+ activate. The _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br process immediately
+ unmaps that window, but this results in a flicker.
+ I haven't figured a way to get around this; it
+ seems to be a fundamental property of the (mis-)
+ design of this server extension.
+
+ It sure would be nice if someone would implement
+ the S\bSG\bGI\bI S\bSC\bCR\bRE\bEE\bEN\bN_\b_S\bSA\bAV\bVE\bER\bR extension in XFree86; it's
+ dead simple, and works far better than the
+ overengineered and broken M\bMI\bIT\bT-\b-S\bSC\bCR\bRE\bEE\bEN\bN-\b-S\bSA\bAV\bVE\bER\bR exten-
+ sion.
+
+ S\bSG\bGI\bI P\bPo\bow\bwe\ber\br S\bSa\bav\bve\ber\br
+ If you're running Irix 6.3, you might find that
+ your monitor is powering down after an hour or two
+ even if you've told it not to. This is fixed by
+ SGI patches 2447 and 2537.
+
+ If you're running Irix 6.5, this bug is back. I
+ don't know a fix.
+
+ M\bMe\bes\bsa\baG\bGL\bL a\ban\bnd\bd V\bVo\boo\bod\bdo\boo\bo C\bCa\bar\brd\bds\bs
+ If you have a 3Dfx/Voodoo card, the default set-
+ tings for xscreensaver will run the GL-based
+ graphics demos in such a way that they will not
+ take advantage of the 3D acceleration hardware.
+ The solution is to change the p\bpr\bro\bog\bgr\bra\bam\bms\bs entries for
+
+
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 23
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ the GL hacks from this:
+
+ gears -root \n\
+
+ to this:
+
+ MESA_GLX_FX=fullscreen gears \n\
+
+ That is, make sure that $\b$M\bME\bES\bSA\bA_\b_G\bGL\bLX\bX_\b_F\bFX\bX is set to
+ _\bf_\bu_\bl_\bl_\bs_\bc_\br_\be_\be_\bn, and don't tell the program to draw on
+ the root window. This may seem strange, but the
+ setup used by Mesa and these kinds of cards _\bi_\bs
+ strange!
+
+ For those who don't know, these cards work by sit-
+ ting between your normal video card and the moni-
+ tor, and seizing control of the monitor when it's
+ time to do 3D. But this means that accelerated 3D
+ only happens in full-screen mode (you can't do it
+ in a window, and you can't see the output of 3D
+ and 2D programs simultaniously), and that 3D will
+ probably drive your monitor at a lower resolution,
+ as well. It's bizarre.
+
+ If you find that GL programs only work properly
+ when run as root, and not as normal users, then
+ the problem is that your _\b/_\bd_\be_\bv_\b/_\b3_\bd_\bf_\bx file is not
+ configured properly. Check the Linux 3Dfx FAQ.
+
+ K\bKe\bey\byb\bbo\boa\bar\brd\bd L\bLE\bED\bDs\bs
+ If _\bp_\br_\bo_\bc_\bI_\bn_\bt_\be_\br_\br_\bu_\bp_\bt_\bs is on (which is the default on
+ Linux systems) and you're using some program that
+ toggles the state of your keyboard LEDs, xscreen-
+ saver won't work right: turning those LEDs on or
+ off causes a keyboard interrupt, which xscreen-
+ saver will interpret as user activity. So if
+ you're using such a program, set the _\bp_\br_\bo_\bc_\bI_\bn_\bt_\be_\br_\b-
+ _\br_\bu_\bp_\bt_\bs resource to False.
+
+ E\bEx\bxt\bte\ben\bns\bsi\bio\bon\bns\bs
+ If you are not making use of one of the server
+ extensions (X\bXI\bID\bDL\bLE\bE, S\bSG\bGI\bI S\bSC\bCR\bRE\bEE\bEN\bN_\b_S\bSA\bAV\bVE\bER\bR, or M\bMI\bIT\bT-\b-
+ S\bSC\bCR\bRE\bEE\bEN\bN-\b-S\bSA\bAV\bVE\bER\bR), then it is possible, in rare situa-
+ tions, for _\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br to interfere with event
+ propagation and make another X program malfunc-
+ tion. For this to occur, that other application
+ would need to _\bn_\bo_\bt select K\bKe\bey\byP\bPr\bre\bes\bss\bs events on its
+ non-leaf windows within the first 30 seconds of
+ their existence, but then select for them later.
+ In this case, that client _\bm_\bi_\bg_\bh_\bt fail to receive
+ those events. This isn't very likely, since pro-
+ grams generally select a constant set of events
+ immediately after creating their windows and then
+ don't change them, but this is the reason that
+
+
+
+X Version 11 20-Jun-99 (3.15) 24
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ it's a good idea to install and use one of the
+ server extensions instead, to work around this
+ shortcoming in the X protocol.
+
+ In all these years, I've not heard of even a sin-
+ gle case of this happening, but it is theoreti-
+ cally possible, so I'm mentioning it for complete-
+ ness...
+
+ R\bRe\bed\bd H\bHo\bot\bt L\bLa\bav\bva\ba
+ There need to be a lot more graphics hacks. In
+ particular, there should be a simulation of a
+ Lavalite (tm).
+
+E\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ D\bDI\bIS\bSP\bPL\bLA\bAY\bY to get the default host and display number, and to
+ inform the sub-programs of the screen on which to
+ draw.
+
+ P\bPA\bAT\bTH\bH to find the sub-programs to run.
+
+ H\bHO\bOM\bME\bE for the directory in which to read and write the
+ _\b._\bx_\bs_\bc_\br_\be_\be_\bn_\bs_\ba_\bv_\be_\br file.
+
+ X\bXE\bEN\bNV\bVI\bIR\bRO\bON\bNM\bME\bEN\bNT\bT
+ to get the name of a resource file that overrides
+ the global resources stored in the RESOURCE_MAN-
+ AGER property.
+
+U\bUP\bPG\bGR\bRA\bAD\bDE\bES\bS
+ The latest version can always be found at
+ http://www.jwz.org/xscreensaver/
+
+S\bSE\bEE\bE A\bAL\bLS\bSO\bO
+ X\bX(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-d\bde\bem\bmo\bo(1), x\bxs\bsc\bcr\bre\bee\ben\bns\bsa\bav\bve\ber\br-\b-c\bco\bom\bmm\bma\ban\bnd\bd(1),
+ x\bxd\bdm\bm(1), x\bxs\bse\bet\bt(1), X\bXs\bse\bec\bcu\bur\bri\bit\bty\by(1), x\bxa\bau\but\bth\bh(1), x\bxh\bho\bos\bst\bt(1).
+ a\ban\bnt\bt(1), a\bat\btl\bla\ban\bnt\bti\bis\bs(1), a\bat\btt\btr\bra\bac\bct\bti\bio\bon\bn(1), b\bbl\bli\bit\bts\bsp\bpi\bin\bn(1),
+ b\bbo\bou\bub\bbo\bou\bul\ble\be(1), b\bbr\bra\bai\bid\bd(1), b\bbs\bso\bod\bd(1), b\bbu\bub\bbb\bbl\ble\be3\b3d\bd(1), b\bbu\bub\bbb\bbl\ble\bes\bs(1),
+ c\bca\bag\bge\be(1), c\bco\bom\bmp\bpa\bas\bss\bs(1), c\bco\bor\bra\bal\bl(1), c\bcr\bri\bit\bti\bic\bca\bal\bl(1), c\bcr\bry\bys\bst\bta\bal\bl(1),
+ c\bcy\byn\bno\bos\bsu\bur\bre\be(1), d\bde\bec\bca\bay\bys\bsc\bcr\bre\bee\ben\bn(1), d\bde\bec\bco\bo(1), d\bde\bel\blu\bux\bxe\be(1), d\bde\bem\bmo\bon\bn(1),
+ d\bdi\bis\bsc\bcr\bre\bet\bte\be(1), d\bdi\bis\bst\bto\bor\brt\bt(1), d\bdr\bri\bif\bft\bt(1), e\bep\bpi\bic\bcy\byc\bcl\ble\be(1), f\bfa\bad\bde\be-\b-
+ p\bpl\blo\bot\bt(1), f\bfl\bla\bag\bg(1), f\bfl\bla\bam\bme\be(1), f\bfl\blo\bow\bw(1), f\bfo\bor\bre\bes\bst\bt(1), g\bga\bal\bla\bax\bxy\by(1),
+ g\bge\bea\bar\brs\bs(1), g\bgl\blp\bpl\bla\ban\bne\bet\bt(1), g\bgo\boo\bop\bp(1), g\bgr\bra\bav\bv(1), g\bgr\bre\bey\byn\bne\bet\bti\bic\bc(1),
+ h\bha\bal\blo\bo(1), h\bhe\bel\bli\bix\bx(1), h\bho\bop\bpa\bal\blo\bon\bng\bg(1), h\bhy\byp\bpe\ber\brc\bcu\bub\bbe\be(1), i\bif\bfs\bs(1),
+ i\bim\bms\bsm\bma\bap\bp(1), i\bin\bnt\bte\ber\brf\bfe\ber\bre\ben\bnc\bce\be(1), j\bji\big\bgs\bsa\baw\bw(1), j\bju\bul\bli\bia\ba(1), k\bka\bal\ble\bei\bi-\b-
+ d\bde\bes\bsc\bco\bop\bpe\be(1), k\bku\bum\bmp\bpp\bpa\ba(1), l\bla\bam\bme\ben\bnt\bt(1), l\bla\bas\bse\ber\br(1), l\bli\big\bgh\bht\btn\bni\bin\bng\bg(1),
+ l\bli\bis\bsa\ba(1), l\bli\bis\bss\bsi\bie\be(1), l\blm\bmo\bor\brp\bph\bh(1), l\blo\boo\bop\bp(1), m\bma\baz\bze\be(1), m\bmo\boe\be-\b-
+ b\bbi\biu\bus\bs(1), m\bmo\boi\bir\bre\be(1), m\bmo\boi\bir\bre\be2\b2(1), m\bmo\bor\brp\bph\bh3\b3d\bd(1), m\bmo\bou\bun\bnt\bta\bai\bin\bn(1),
+ m\bmu\bun\bnc\bch\bh(1), n\bno\bos\bse\beg\bgu\buy\by(1), p\bpe\bed\bda\bal\bl(1), p\bpe\ben\bne\bet\btr\bra\bat\bte\be(1), p\bpe\ben\bnr\bro\bos\bse\be(1),
+ p\bpe\bet\btr\bri\bi(1), p\bph\bho\bos\bsp\bph\bho\bor\br(1), p\bpi\bip\bpe\bes\bs(1), p\bpu\bul\bls\bsa\bar\br(1), p\bpy\byr\bro\bo(1),
+ q\bqi\bix\bx(1), r\brd\bd-\b-b\bbo\bom\bmb\bb(1), r\bro\boc\bck\bks\bs(1), r\bro\bor\brs\bsc\bch\bha\bac\bch\bh(1), r\bro\bot\bto\bor\br(1),
+ r\bru\bub\bbi\bik\bk(1), s\bsi\bie\ber\brp\bpi\bin\bns\bsk\bki\bi(1), s\bsl\bli\bid\bde\bes\bsc\bcr\bre\bee\ben\bn(1), s\bsl\bli\bip\bp(1),
+ s\bso\bon\bna\bar\br(1), s\bsp\bph\bhe\ber\bre\be(1), s\bsp\bpi\bir\bra\bal\bl(1), s\bsp\bpo\bot\btl\bli\big\bgh\bht\bt(1), s\bsp\bpr\bro\boi\bin\bn-\b-
+ g\bgi\bie\bes\bs(1), s\bsq\bqu\bui\bir\bra\bal\bl(1), s\bst\bta\bai\bir\brs\bs(1), s\bst\bta\bar\brf\bfi\bis\bsh\bh(1), s\bst\btr\bra\ban\bng\bge\be(1),
+
+
+
+X Version 11 20-Jun-99 (3.15) 25
+
+
+
+
+
+XScreenSaver(1) XScreenSaver(1)
+
+
+ s\bsu\bup\bpe\ber\brq\bqu\bua\bad\bdr\bri\bic\bcs\bs(1), s\bsw\bwi\bir\brl\bl(1), t\bt3\b3d\bd(1), t\btr\bri\bia\ban\bng\bgl\ble\be(1),
+ t\btr\bru\buc\bch\bhe\bet\bt(1), v\bvi\bin\bne\bes\bs(1), w\bwa\ban\bnd\bde\ber\br(1), w\bwo\bor\brm\bm(1), x\bxf\bfl\bla\bam\bme\be(1),
+ x\bxj\bja\bac\bck\bk(1), x\bxl\bly\bya\bap\bp(1), x\bxm\bma\bat\btr\bri\bix\bx(1), x\bxr\bro\bog\bge\ber\br(1), b\bbo\bon\bng\bgo\bo(1),
+ i\bic\bco\bo(1), x\bxa\bao\bos\bs(1), x\bxb\bbo\bou\bun\bnc\bce\beb\bbi\bit\bts\bs(1), x\bxc\bct\bth\bhu\bug\bgh\bha\ba(1), x\bxd\bda\bal\bli\bi-\b-
+ c\bcl\blo\boc\bck\bk(1), x\bxf\bfi\bis\bsh\bht\bta\ban\bnk\bk(1), x\bxm\bmo\bou\bun\bnt\bta\bai\bin\bns\bs(1), x\bxs\bsp\bpl\bli\bin\bne\bef\bfu\bun\bn(1),
+ x\bxs\bsw\bwa\bar\brm\bm(1), x\bxt\bta\bac\bcy\by(1), x\bxv\bv(1), x\bxw\bwa\bav\bve\be(1).
+
+C\bCO\bOP\bPY\bYR\bRI\bIG\bGH\bHT\bT
+ Copyright (C) 1991, 1992, 1993, 1994, 1995, 1996, 1997,
+ 1998, 1999 by Jamie Zawinski. Permission to use, copy,
+ modify, distribute, and sell this software and its docu-
+ mentation for any purpose is hereby granted without fee,
+ provided that the above copyright notice appear in all
+ copies and that both that copyright notice and this per-
+ mission notice appear in supporting documentation. No
+ representations are made about the suitability of this
+ software for any purpose. It is provided "as is" without
+ express or implied warranty.
+
+A\bAU\bUT\bTH\bHO\bOR\bR
+ Jamie Zawinski <jwz@jwz.org>. Written in late 1991; first
+ posted to comp.sources.x on 13-Aug-1992.
+
+ Please let me know if you find any bugs or make any
+ improvements.
+
+A\bAC\bCK\bKN\bNO\bOW\bWL\bLE\bED\bDG\bGE\bEM\bME\bEN\bNT\bTS\bS
+ Thanks to the many people who have contributed graphics
+ demos to the package.
+
+ Thanks to David Wojtowicz for implementing _\bl_\bo_\bc_\bk_\bT_\bi_\bm_\be_\bo_\bu_\bt.
+
+ Thanks to Martin Kraemer for adding support for shadow
+ passwords and locking-disabled diagnostics.
+
+ Thanks to Patrick Moreau for the VMS port.
+
+ Thanks to Mark Bowyer for figuring out how to hook it up
+ to CDE.
+
+ Thanks to Nat Lanza for the Kerberos support.
+
+ Thanks to Bill Nottingham for the initial PAM support.
+
+ And thanks to Jon A. Christopher for implementing the
+ Athena dialog support, back in the days before Lesstif or
+ Gtk were viable alternatives to Motif.
+
+
+
+
+
+
+
+
+
+
+X Version 11 20-Jun-99 (3.15) 26
+
+
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH XScreenSaver 1 "14-Jun-97" "X Version 11"
+.SH NAME
+attraction - interactions of opposing forces
+.SH SYNOPSIS
+.B attraction
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-points \fIint\fP] [\-threshold \fIint\fP] [\-mode balls | lines | polygons | splines | filled-splines | tails ] [\-size \fIint\fP] [\-segments \fIint\fP] [\-delay \fIusecs\fP] [\-color-shift \fIint\fP] [\-radius \fIint\fP] [\-vx \fIint\fP] [\-vy \fIint\fP] [\-glow] [\-noglow] [\-orbit] [\-viscosity \fIfloat\fP] [\-mouse] [\-no-mouse] [\-mouse-size]
+.SH DESCRIPTION
+The \fIattraction\fP program has several visually different modes of
+operation, all of which are based on the interactions of a set of control
+points which attract each other up to a certain distance, and then begin
+to repel each other. The attraction/repulsion is proportional to the
+distance between any two particles.
+.SH OPTIONS
+.I attraction
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-points integer
+How many control points should be used, or 0 to select the number randomly.
+Default 0. Between 3 and 15 works best.
+.TP 8
+.B \-threshold integer
+The distance (in pixels) from each particle at which the attractive force
+becomes repulsive. Default 100.
+.TP 8
+.B \-mode "balls | lines | polygons | tails | splines | filled-splines"
+In \fIballs\fP mode (the default) the control points are drawn as filled
+circles. The larger the circle, the more massive the particle.
+
+In \fIlines\fP mode, the control points are connected by straight lines;
+the effect is something like \fIqix\fP.
+
+In \fIpolygons\fP mode, the control points are connected by straight
+lines, and filled in. This is most interesting in color.
+
+In \fIsplines\fP mode, a closed spline is interpolated from the control
+points.
+
+In \fIfilled-splines\fP mode, the splines are filled in instead of being
+outlines. This is most interesting in color.
+
+In \fItails\fP mode, the path which each particle follows is indicated
+by a worm-like trail, whose length is controlled by the \fIsegments\fP
+parameter.
+.TP 8
+.B \-size integer
+The size of the balls in pixels, or 0, meaning to select the sizes
+randomly (the default.) If this is specified, then all balls will be
+the same size. This option has an effect in all modes, since the ``size''
+of the balls controls their mass.
+.TP 8
+.B \-segments integer
+If in \fIlines\fP or \fIpolygons\fP mode, how many sets of line segments
+or polygons should be drawn. Default 100. This has no effect in \fIballs\fP
+mode. If \fIsegments\fP is 0, then no segments will ever be erased (this
+is only useful in color.)
+.TP 8
+.B \-delay microseconds
+How much of a delay should be introduced between steps of the animation.
+Default 10000, or about 0.01 seconds.
+.TP 8
+.B \-color-shift int
+If on a color display, the color of the line segments or polygons will
+cycle through the color map. This specifies how many lines will be drawn
+before a new color is chosen. (When a small number of colors are available,
+increasing this value will yield smoother transitions.) Default 3.
+This has no effect in \fIballs\fP mode.
+.TP 8
+.B \-radius
+The size in pixels of the circle on which the points are initially positioned.
+The default is slightly smaller than the size of the window.
+.TP 8
+.B \-glow
+This is consulted only in \fIballs\fP mode. If this is specified, then
+the saturation of the colors of the points will vary according to their
+current acceleration. This has the effect that the balls flare brighter
+when they are reacting to each other most strongly.
+
+In \fIglow\fP mode, all of the balls will be drawn the same (random)
+color, modulo the saturation shifts. In non-glow mode, the balls will
+each be drawn in a random color that doesn't change.
+.TP 8
+.B \-noglow
+Don't do ``glowing.'' This is the default.
+.TP 8
+.B \-vx pixels
+.TP 8
+.B \-vy pixels
+Initial velocity of the balls. This has no effect in \fB\-orbit\fP mode.
+.TP 8
+.B \-orbit
+Make the initial force on each ball be tangential to the circle on which
+they are initially placed, with the right velocity to hold them in orbit
+about each other. After a while, roundoff errors will cause the orbit
+to decay.
+.TP 8
+.B \-vmult float
+In orbit mode, the initial velocity of the balls is multiplied by this;
+a number less than 1 will make the balls pull closer together, and a larger
+number will make them move apart. The default is 0.9, meaning a slight
+inward pull.
+.TP 8
+.B \-viscosity float
+This sets the viscosity of the hypothetical fluid through which the control
+points move; the default is 1, meaning no resistance. Values higher than 1
+aren't interesting; lower values cause less motion.
+
+One interesting thing to try is
+.EX
+attraction -viscosity 0.8 -points 75 \\
+ -mouse -geometry =500x500
+.EE
+Give it a few seconds to settle down into a stable clump, and then move
+the mouse through it to make "waves".
+.TP 8
+.B \-mouse
+This will cause the mouse to be considered a control point; it will not be
+drawn, but it will influence the other points, so you can wave the mouse
+and influence the images being created.
+.TP 8
+.B \-no-mouse
+Turns off \fB\-mouse\fP.
+.TP 8
+.B \-mouse-size integer
+In \fB\-mouse\fP mode, this sets the mass of the mouse (analagously to the
+\fB\-size\fP parameter.)
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992, 1993, 1997 by Jamie Zawinski. Permission to use, copy,
+modify, distribute, and sell this software and its documentation for any
+purpose is hereby granted without fee, provided that the above copyright
+notice appear in all copies and that both that copyright notice and this
+permission notice appear in supporting documentation. No representations are
+made about the suitability of this software for any purpose. It is provided
+"as is" without express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+Viscosity and mouse support by Philip Edward Cutone, III.
--- /dev/null
+.TH XScreenSaver 1 "24-Nov-97" "X Version 11"
+.SH NAME
+blitspin - rotate a bitmap in an interesting way
+.SH SYNOPSIS
+.B blitspin
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-bitmap \fIfilename\fP] [\-delay \fIusecs\fP] [\-delay2 \fIusecs\fP]
+.SH DESCRIPTION
+The \fIblitspin\fP program repeatedly rotates a bitmap by 90 degrees by
+using logical operations: the bitmap is divided into quadrants, and the
+quadrants are shifted clockwise. Then the same thing is done again with
+progressively smaller quadrants, except that all sub-quadrants of a
+given size are rotated in parallel. So this takes \fBO(16*log2(N))\fP
+blits of size NxN, with the limitation that the image must be square,
+and the size must be a power of 2.
+.SH OPTIONS
+.I blitspin
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-bitmap \fIfilename\fP
+The file name of a bitmap to rotate. It need not be square: it
+will be padded with the background color. If unspecified or the
+string \fI(default)\fP, a builtin bitmap is used.
+
+If support for the \fIXPM\fP library was enabled at compile-time,
+the specified file may be in \fIXPM\fP format as well as \fIXBM\fP, and
+thus may be a color image.
+
+The \fB*bitmapFilePath\fP resource will be searched if the bitmap
+name is not a fully-qualified pathname.
+.TP 8
+.B \-grab\-screen
+If this option is specified, then the image which is spun will be grabbed
+from the portion of the screen underlying the blitspin window. (Or, it
+may come from an external video source: see below.)
+.PP
+.TP 8
+.B \-delay \fImicroseconds\fP
+How long to delay between steps of the rotation process, in microseconds.
+Default is 500000, one-half second.
+.PP
+.TP 8
+.B \-delay2 \fImicroseconds\fP
+How long to delay between each 90-degree rotation, in microseconds.
+Default is 500000, one-half second.
+.B DISPLAY
+to get the default host and display number.
+.SH RESOURCES
+On some systems (currently, only SGIs), this program can, instead of grabbing
+a desktop image, grab a frame of video from an external camera and manipulate
+that instead. The following resources control that.
+.PP
+.TP 8
+.B grabVideoProbability \fR(Float)\fP
+What portion of the time to grab video rather than a screen image,
+between 0.0 and 1.0. Defaults to 0.5, or half the time.
+.TP 8
+.B videoDevice \fR(Integer)\fP
+The number of the default video input device to check first. If unspecified,
+the default camera (from videopanel(1)) will be checked first. After that, all
+other available video input devices will be checked in order.
+
+The first one which produces a non-black image will be used. If all images
+are black, the others will be re-checked a few times before giving up and
+falling back to simply grabbing a desktop image (but note that this takes a
+few seconds, so if you don't actually have any video sources hooked up, you
+should consider turning off video grabbing by setting
+\fBgrabVideoProbability\fP to 0.0.)
+.TP 8
+.B videoGain \fR(Float)\fP
+The amount by which to brighten the grabbed image. This defaults to 2.2.
+.SH ENVIRONMENT
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992, 1993, 1997 by Jamie Zawinski.
+Permission to use, copy, modify, distribute, and sell this software and its
+documentation for any purpose is hereby granted without fee, provided that
+the above copyright notice appear in all copies and that both that copyright
+notice and this permission notice appear in supporting documentation. No
+representations are made about the suitability of this software for any
+purpose. It is provided "as is" without express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 17-aug-92.
+
+Based on SmallTalk code which appeared in the August 1981 issue of Byte
+magazine.
--- /dev/null
+.TH XScreenSaver 1 "15-May-97" "X Version 11"
+.SH NAME
+bouboule - draws spinning 3D blobs
+.SH SYNOPSIS
+.B bouboule
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP] [\-3d]
+
+.SH DESCRIPTION
+The \fIbouboule\fP program draws spinning 3D blobs.
+.SH OPTIONS
+.I bouboule
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors used cycle through the hue, making N stops around
+the color wheel.
+.TP 8
+.B \-cycles \fIinteger\fP
+
+.TP 8
+.B \-count \fIinteger\fP
+
+.TP 8
+.B \-3d
+Do red/blue 3d separations (for 3d glasses.)
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1996 by Jeremie Petit.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+
+.SH AUTHOR
+Jeremie Petit <jpetit@essi.fr>, 1996.
+
+3D support by Henrik Theiling <theiling@coli-uni-sb.de>, 04-Sep-96.
+
+VMS support by Jouk Jansen <joukj@alpha.chem.uva.nl>, 01-Feb-96.
+
+TrueColor support by David Bagley <bagleyd@bigfoot.com>, 01-Feb-96.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 15-May-97.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+braid - draws random color-cycling braids around a circle
+.SH SYNOPSIS
+.B braid
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP]
+
+.SH DESCRIPTION
+The \fIbraid\fP program draws random color-cycling braids around a circle.
+.SH OPTIONS
+.I braid
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors used cycle through the hue, making N stops around
+the color wheel.
+.TP 8
+.B \-cycles \fIinteger\fP
+
+.TP 8
+.B \-count \fIinteger\fP
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1995 by John Neil.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+John Neil <neil@math.idbsu.edu>, 29-Aug-95.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH XScreenSaver 1 "28-Oct-98" "X Version 11"
+.SH NAME
+bsod - Blue Screen of Death emulator
+.SH SYNOPSIS
+.B bsod
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP]
+[\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install]
+[\-visual \fIvisual\fP] [\-delay \fIseconds\fP]
+.SH DESCRIPTION
+The
+.I bsod
+program is the finest in personal computer emulation.
+.PP
+.I bsod
+steps through a set of screens, each one a recreation of a different failure
+mode of an operating system. Systems depicted include Microsoft's Windows 95
+and Windows NT, Commodore-Amiga's AmigaDOS 1.3, SPARC Linux, SCO UNIX, the
+Apple Macintosh (both the MacsBug debugger and the rarer "Sad Mac"), and the
+Atari ST.
+.PP
+.SH OPTIONS
+.I bsod
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fIdelay\fP
+The delay between displaying one crash and another.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH X RESOURCES
+Notable X resources supported include the following, which control which
+hacks are displayed and which aren't.
+.BR doWindows ,
+.BR doNT ,
+.BR doAmiga ,
+.BR doMac ,
+.BR doMacsBug ,
+.BR doSCO ,
+.BR doAtari ,
+and
+.BR doSparcLinux .
+Each of these is a Boolean resource, they all default to true, except for
+doSparcLinux and doAtari, which are turned off by default, because they're
+really not all that interesting looking unless you're a fan of those systems.
+There aren't command-line options for these, so to change them, you'll need
+to add entries to your .Xdefaults file, or use the -xrm option.
+For example, to tell bsod not to show the NT crash:
+.EX
+bsod -xrm '*doNT: false'
+.EE
+.SH BUGS
+Unlike the systems that the images are borrowed from,
+.I bsod
+does not require a reboot after running.
+.PP
+.I bsod
+should also emulate more systems, but systems with interesting crash
+graphics are not as common as one might hope.
+
+One I'd really like to see is a Unix system getting a kernel panic,
+rebooting, and running
+.BR fsck (8).
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR http://www.microsoft.com/ ,
+.BR http://www.apple.com/ ,
+and
+.BR http://www.sco.com/ ,
+.BR http://www.kernel.org/ ,
+and
+.BR http://www.amiga.de/ .
+.SH TRADEMARKS
+Microsoft Windows, Microsoft Windows 95, and Microsoft Windows NT are all
+registered trademarks of Microsoft Corporation. Apple Macintosh is a
+registered trademark of Apple Computer. Amiga is a registered trademark of
+Amiga International, Inc. Atari ST is probably a trademark, too, but it's
+hard to tell who owns it. Linux is a registered trademark of Linus Torvalds,
+but it isn't his fault.
+.SH COPYRIGHT
+Copyright \(co 1998 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty. No animals were harmed during the testing of
+these simulations. Always mount a scratch monkey.
+.SH AUTHOR
+Concept cribbed from Stephen Martin <smartin@mks.com>. This version is by
+Jamie Zawinski <jwz@jwz.org>.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH XScreenSaver 1 "14-Dec-95" "X Version 11"
+.SH NAME
+bubbles - frying pan / soft drink simulation
+.SH SYNOPSIS
+.B bubbles
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-simple] [\-broken] [\-3D] [\-file filename] [\-directory directoryname]
+.SH DESCRIPTION
+\fIBubbles\fP sprays lots of little random bubbles all over the window which
+then grow until they reach their maximum size and go pop. The inspiration
+for this was watching little globules of oil on the bottom of a frying pan
+and it also looks a little like bubbles in fizzy soft drink. The default
+mode uses fancy ray-traced bubbles but there is also a mode which just draws
+circles in case the default mode is too taxing on your hardware.
+.SH OPTIONS
+Depending on how your
+.I bubbles
+was compiled, it accepts the following options:
+.TP 8
+.B \-foreground
+Colour of circles if \fI\-simple\fP mode is selected.
+.TP 8
+.B \-background
+Colour of window background.
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay microseconds
+How much of a delay should be introduced between steps of the animation.
+Default 1, or about 1 microsecond. Actually, this is the delay between each
+group of 15 new bubbles since such a delay between each step results in a
+very slow animation rate.
+.TP 8
+.B \-nodelay
+Same as \fI\-delay 0\fP.
+.TP 8
+.B \-simple
+Don't use the default fancy pixmap bubbles. Just draw circles instead.
+This may give more bearable performance if your hardware wasn't made for
+this sort of thing.
+.TP 8
+.B \-broken
+Don't hide bubbles when they pop. This was a bug during development
+but the results were actually quite attractive. (This option is only
+available if you have the XPM library available and the imake generated
+Makefile has defined HAVE_XPM).
+.TP 8
+.B \-3D
+Normally, the simulation is done completely in two dimensions. When a
+bubble swallows up another bubble, the areas of each are added to get
+the area of the resulting bubble. This option changes the algorithm
+to instead add volume (imagining each to be a sphere in 3D space). The
+whole thing looks more realistic but I find it attracts attention to
+the flickering of each bubble as they are move and are redrawn. Your
+mileage may vary.
+.TP 8
+.B \-file filename
+Use the pixmap definitions in the given file, instead of the default (if
+one is compiled in). This is ignored if \fI\-simple\fP is specified. If
+the file is compressed (either with compress or gzip), it is decompressed
+before use. (This option only works if you have XPM compiled into your
+binary and you have compiled with BUBBLES_IO set in bubbles.h. This is
+\fBnot\fP the default).
+.TP 8
+.B \-directory directoryname
+Similar to \fI-file\fP except the file is taken randomly from the
+contents of the specified directory. (Again, this option is only available
+if you have XPM and BUBBLES_IO was set when compiling. See above).
+.TP 8
+.B \-quiet
+Don't print messages explaining why one or several command line options
+were ignored. This is disabled by default.
+.SH NOTES
+If you find the pace of things too slow, remember that there is a delay
+even though you specify no \fI\-delay\fP option. Try using \fI\-nodelay\fP
+although beware of the effects of irritation of other users if you're on a
+shared system as you bleed their CPU time away.
+
+Some tools to assist in creation of new bubbles are included in the source
+distribution. These can either be loaded with the \fI\-file\fP or
+\fI\-directory\fP options (if available) or they can be used in place
+of the distributed default bubble (bubble_default.c).
+You might like to copy these scripts to a permanent location and
+use them. Read bubbles.README.
+
+Rendered bubbles are not supported on monochrome displays. I'm not
+convinced that small bubbles, even dithered properly are going to look
+like anything more than a jumble of random dots.
+.SH BUGS
+There is a delay before something appears on the screen when using
+rendered bubbles. The XPM library seems to take a \fBlong\fP time to make
+pixmaps out of raw data. This can be irritating on slower systems.
+
+The movement of the bubbles looks jerky if an incomplete set of bubbles
+is used.
+
+The hide/display algorithm could do with some work to avoid flickering
+when \fI\-nodelay\fP is set.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH DISTRIBUTION POLICY
+This work is Copyright \(co 1995, 1996 by James Macnicol. Distribution is
+allowed under the terms of the GNU General Public License. Look at the
+sources for the legalese.
+.SH AUTHOR
+James Macnicol <J.Macnicol@student.anu.edu.au>.
--- /dev/null
+.TH XScreenSaver 1 "13-Nov-98" "X Version 11"
+.SH NAME
+critical - Draw a system showing self-organizing criticality
+.SH SYNOPSIS
+.B critical
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-delay \fIseconds\fP] [\-random \fIboolean\fP] [\-ncolors \fIint\fP] [\-offset \fIint\fP]
+.SH DESCRIPTION
+The \fIcritical\fP program displays a self-organizing critical system
+that gradually emerges from chaos.
+
+\fIcritical\fP performs a simulation on a two-dimensional array of
+integers. The array is initialized to random values. On each
+iteration, it draws a line to the array position with the greatest
+value. It then replaces that location and the eight neighboring
+locations with randomly-selected values.
+
+The lines are initially random, but over time a chaotic
+self-organizing system evolves: areas of the screen which happen to
+have lower values are less likely to be updated to new values, and so
+the line tends to avoid those areas. Eventually, the histogram of
+changes approaches the power-law curve typical of such systems.
+
+The simplest documented self-organizing system is the one-dimensional
+equivalent of \fIcritical\fP.
+
+I heard about this algorithm second-hand: apparently there was an
+article in \fIScientific American\fP describing it sometime in 1997.
+.SH OPTIONS
+.I critical
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fIusecs\fP
+Number of microseconds to wait after drawing each line.
+.TP 8
+.B \-random \fIboolean\fP
+Whether to use randomly selected colours rather than a cycle around
+the colour wheel.
+.TP 8
+.B \-offset \fIinteger\fP
+The maximum random radius increment to use.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be allocated in the color ramp (note that this
+value interacts with \fIoffset\fP.)
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.BR xscreensaver-command (1)
+.BR xscreensaver-demo (1)
+.SH COPYRIGHT
+Copyright \(co 1998 by Martin Pool.
+
+Permission to use, copy, modify, distribute, and sell this software
+and its documentation for any purpose is hereby granted without fee,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is"
+without express or implied warranty.
+.SH AUTHOR
+Martin Pool <mbp@humbug.org.au>, 13-Nov-1998. Based in part on the
+XScreenSaver code by Jamie Zawinski <jwz@jwz.org>.
--- /dev/null
+.TH XScreenSaver 1 "05-Apr-1999" "X Version 11"
+.SH NAME
+decayscreen - make a screen meltdown.
+.SH SYNOPSIS
+.B decayscreen
+[\-display \fIhost:display.screen\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-delay \fIusecs\fP] [\-mode \fImode\fP]
+.SH DESCRIPTION
+The \fIdecayscreen\fP program creates a melting effect by randomly
+shifting rectangles around the screen.
+.SH OPTIONS
+.I decayscreen
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fImicroseconds\fP
+Slow it down.
+.TP 8
+.B \-mode \fImode\fP
+The direction in which the image should tend to slide. Legal values are
+\fIrandom\fP (meaning pick one), \fIup\fP, \fIleft\fP, \fIright\fP,
+\fIdown\fP, \fIupleft\fP, \fIdownleft\fP, \fIupright\fP, \fIdownright\fP,
+\fIshuffle\fP (meaning perfer no particular direction), \fIin\fP (meaning
+move things toward the center), \fIout\fP (meaning move things away
+from the center), \fImelt\fP (meaning melt straight downward), and \fIstretch\fP
+(meaning stretch the screen downward).
+.SH RESOURCES
+On some systems (currently, only SGIs), this program can, instead of grabbing
+a desktop image, grab a frame of video from an external camera and manipulate
+that instead. The following resources control that.
+.PP
+.TP 8
+.B grabVideoProbability \fR(Float)\fP
+What portion of the time to grab video rather than a screen image,
+between 0.0 and 1.0. Defaults to 0.5, or half the time.
+.TP 8
+.B videoDevice \fR(Integer)\fP
+The number of the default video input device to check first. If unspecified,
+the default camera (from videopanel(1)) will be checked first. After that, all
+other available video input devices will be checked in order.
+
+The first one which produces a non-black image will be used. If all images
+are black, the others will be re-checked a few times before giving up and
+falling back to simply grabbing a desktop image (but note that this takes a
+few seconds, so if you don't actually have any video sources hooked up, you
+should consider turning off video grabbing by setting
+\fBgrabVideoProbability\fP to 0.0.)
+.TP 8
+.B videoGain \fR(Float)\fP
+The amount by which to brighten the grabbed image. This defaults to 2.2.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH "SEE ALSO"
+X(1),
+xscreensaver(1)
+.SH COPYRIGHT
+Copyright 1992 by Vivek Khera. Permission to use, copy, modify, distribute,
+and sell this software and its documentation for any purpose is hereby granted
+without fee, provided that the above copyright notice appear in all copies and
+that both that copyright notice and this permission notice appear in
+supporting documentation. No representations are made about the suitability
+of this software for any purpose. It is provided "as is" without express or
+implied warranty.
+.SH AUTHOR
+Vivek Khera <khera@cs.duke.edu>, 05-Aug-93; based on code by David Wald, 1988.
+Modified by jwz, 28-Nov-97. Modified by Rick Schultz <rick@skapunx.net> 05-Apr-1999.
+
--- /dev/null
+.TH XScreenSaver 1 "27-Apr-97" "X Version 11"
+.SH NAME
+deco - draw tacky 70s basement wall panelling
+.SH SYNOPSIS
+.B deco
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-delay \fIseconds\fP] [\-max\-depth \fIint\fP] [\-min\-width \fIint\fP] [\-min\-height \fIint\fP] [\-cycle] [\-no\-cycle] [\-cycle\-delay]
+.SH DESCRIPTION
+The \fIdeco\fP program subdivides and colors rectangles randomly.
+It looks kind of like Brady-Bunch-era rec-room wall paneling.
+(Raven says: "this screensaver is ugly enough to peel paint.")
+.SH OPTIONS
+.I deco
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fIseconds\fP
+How long to wait before starting over. Default 5 seconds.
+.TP 8
+.B \-max\-depth \fIinteger\fP
+How deep to subdivide. Default 12.
+Default 8.
+.TP 8
+.B \-min-width \fIinteger\fP
+.B \-min-height \fIinteger\fP
+The size of the smallest rectangle to draw. Default 20x20.
+.TP 8
+.B \-cycle
+.TP 8
+.B \-no\-cycle
+Whether to do color cycling. Default False.
+.TP 8
+.B \-cycle\-delay \fIusecs\fP
+If color cycling, how often to change the colors. Default 1000000,
+or 1 second.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 26-Apr-97, based on code by
+Michael D. Bayne <mdb@go2net.com>.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+drift - draws drifting recursive fractal cosmic flames
+.SH SYNOPSIS
+.B drift
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-count \fIinteger\fP] [\-grow] [\-no\-grow] [\-liss] [\-no\-liss]
+
+.SH DESCRIPTION
+The \fIdrift\fP program draws drifting recursive fractal cosmic flames
+.SH OPTIONS
+.I drift
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 200.
+The colors used cycle through the hue, making N stops around
+the color wheel.
+.TP 8
+.B \-count \fIinteger\fP
+
+.TP 8
+.B \-grow
+.TP 8
+.B \-no\-grow
+Whether fractals should grow; otherwise, they are animated.
+
+.TP 8
+.B \-liss
+.TP 8
+.B \-no\-liss
+Whether we should use lissojous figures to get points.
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR flame (1),
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1991, 1995 by Scott Draves.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Scott Draves <spot@cs.cmu.edu>, 06-Jun-91, 01-Jun-95.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH XScreenSaver 1 "27-Apr-97" "X Version 11"
+.SH NAME
+epicycle - draws a point moving around a circle which moves around a cicle which...
+.SH SYNOPSIS
+.B epicycle
+[\-display \fIhost:display.screen\fP] [\-root] [\-window] [\-mono] [\-install] [\-noinstall] [\-visual \fIviz\fP] [\-colors \fIN\fP] [\-foreground \fIname\fP] [\-color\-shift \fIN\fP] [\-delay \fImicroseconds\fP] [\-holdtime \fIseconds\fP] [\-linewidth \fIN\fP] [\-min_circles \fIN\fP] [\-max_circles \fIN\fP] [\-min_speed \fInumber\fP] [\-max_speed \fInumber\fP] [\-harmonics \fIN\fP] [\-timestep \fInumber\fP] [\-divisor_poisson \fIprobability\fP] [\-size_factor_min \fInumber\fP] [\-size_factor_max \fInumber\fP]
+.SH DESCRIPTION
+The epicycle program draws the path traced out by a point on the edge
+of a circle. That circle rotates around a point on the rim of another
+circle, and so on, several times. The random curves produced can be
+simple or complex, convex or concave, but they are always closed
+curves (they never go in indefinitely).
+
+You can configure both the way the curves are drawn and the way in
+which the random sequence of circles is generated, either with
+command-line options or X resources.
+.SH OPTIONS
+.TP 8
+.B \-display \fIhost:display.screen\fP
+Specifies which X display we should use (see the section DISPLAY NAMES in
+.BR X (1)
+for more information about this option).
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+If we're on a mono display, we have no choice.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-noinstall
+Don't install a private colormap for the window.
+.TP 8
+.B \-visual \fIviz\fP
+Specify which visual to use. Legal values are the name of a visual
+class, or the id number (decimal or hex) of a specific visual.
+Possible choices include
+
+.RS
+default, best, mono, monochrome, gray, grey, color, staticgray, staticcolor,
+truecolor, grayscale, greyscale, pseudocolor, directcolor, \fInumber\fP
+
+If a decimal or hexadecimal number is used,
+.BR XGetVisualInfo (3X)
+is consulted to obtain the required visual.
+.RE
+.TP 8
+.B \-colors \fIN\fP
+How many colors should be used (if possible). The colors are chosen
+randomly.
+.TP 8
+.B \-foreground \fIname\fP
+With
+.BR \-mono ,
+this option selects the foreground colour.
+.TP 8
+.B \-delay \fImicroseconds\fP
+Specifies the delay between drawing successive line segments of the
+path. If you do not specify
+.BR -sync ,
+some X servers may batch up several drawing operations together,
+producing a less smooth effect. This is more likely to happen
+in monochrome mode (on monochrome servers or when
+.B \-mono
+is specified).
+.TP 8
+.B \-holdtime \fIseconds\fP
+When the figure is complete,
+.I epicycle
+pauses this number of seconds.
+.TP 8
+.B \-linewidth \fIN\fP
+Width in pixels of the body's track. Specifying values greater than
+one may cause slower drawing. The fastest value is usually zero,
+meaning one pixel.
+.TP 8
+.B \-min_circles \fIN\fP
+Smallest number of epicycles in the figure.
+.TP 8
+.B \-max_circles \fIN\fP
+Largest number of epicycles in the figure.
+.TP 8
+.B \-min_speed \fInumber\fP
+Smallest possible value for the base speed of revolution of the
+epicycles. The actual speeds of the epicycles vary from this down
+to
+.IB "min_speed / harmonics" .
+.TP 8
+.B \-max_speed \fInumber\fP
+Smallest possible value for the base speed of revolution of the
+epicycles.
+.TP 8
+.B \-harmonics \fIN\fP
+Number of possible harmonics; the larger this value is, the greater
+the possible variety of possible speeds of epicycle.
+.TP 8
+.B \-timestep \fInumber\fP
+Decreasing this value will reduce the distance the body moves for
+each line segment, possibly producing a smoother figure. Increasing
+it may produce faster results.
+.TP 8
+.B \-divisor_poisson \fIprobability\fP
+Each epicycle rotates at a rate which is a factor of the base speed.
+The speed of each epicycle is the base speed divided by some integer
+between 1 and the value of the
+.B \-harmonics
+option. This integer is decided by starting at 1 and tossing
+a biased coin. For each consecutive head, the value is incremented by
+one. The integer will not be incremented above the value of the
+.B \-harmonics
+option. The argument of this option decides the bias of the coin; it
+is the probability that that coin will produce a head at any given toss.
+.TP 8
+.B \-size_factor_min \fInumber\fP
+Epicycles are always at least this factor smaller than their
+parents.
+.TP 8
+.B \-size_factor_max \fInumber\fP
+Epicycles are never more than this factor smaller than their parents.
+.SH RESOURCES
+.EX
+Option Resource Default Value
+------ -------- -------------
+-colors .colors 100
+-delay .delay 1000
+-holdtime .holdtime 2
+-linewidth .lineWidth 4
+-min_circles .minCircles 2
+-max_circles .maxCircles 10
+-min_speed .minSpeed 0.003
+-max_speed .maxSpeed 0.005
+-harmonics .harmonics 8
+-timestep .timestep 1.0
+-divisor_poisson .divisorPoisson 0.4
+-size_factor_min .sizeFactorMin 1.05
+-size_factor_max .sizeFactorMax 2.05
+ .timestepCoarseFactor 1.0
+.EE
+Before the drawing of the figure is begun, a preliminary calculation
+of the path is done in order to scale the radii of the epicycles so
+as to fit the figure on the screen or window. For the sake of speed,
+This calculation is done with a larger timestep than the actual
+drawing. The time-step used is the value of the
+.B \-timestep
+option multiplied by the timestepCoarseFactor resource. The default
+value of 1 will almost always work fast enough and so this resource
+is not available as a command-line option.
+.SH USER INTERFACE
+The program runs mostly without user interaction. When running on the
+root window, no input is accepted. When running in its own window,
+the program will exit if mouse button 3 is pressed. If any other
+mouse button is pressed, the current figure will be abandoned and
+another will be started.
+.SH HISTORY
+The geometry of epicycles was perfected by Hipparchus of Rhodes at
+some time around 125 B.C., 185 years after the birth of Aristarchus of
+Samos, the inventor of the heliocentric universe model. Hipparchus
+applied epicycles to the Sun and the Moon. Ptolemy of Alexandria went
+on to apply them to what was then the known universe, at around 150
+A.D. Copernicus went on to apply them to the heliocentric model at
+the beginning of the sixteenth century. Johannes Kepler discovered
+that the planets actually move in elliptical orbits in about 1602.
+The inverse-square law of gravity was suggested by Boulliau in 1645.
+Isaac Newton's
+.I Principia Mathematica
+was published in 1687, and proved that Kepler's laws derived from
+Newtonian gravitation.
+.SH BUGS
+The colour selection is re-done for every figure. This may
+generate too much network traffic for this program to work well
+over slow or long links.
+.SH COPYRIGHT
+Copyright \(co 1998, James Youngman. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+James Youngman <jay@gnu.org>, April 1998.
--- /dev/null
+.TH XScreenSaver 1 "24-May-97" "X Version 11"
+.SH NAME
+flag - draws a waving flag, containing text or an image
+.SH SYNOPSIS
+.B flag
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-size \fIinteger\fP] [\-text \fIstring\fP] [\-font \fIfont\fP] [\-bitmap \fIxbm-file\fP]
+
+.SH DESCRIPTION
+The \fIflag\fP program draws a waving flag that contains text or a bitmap.
+.SH OPTIONS
+.I flag
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 200.
+.TP 8
+.B \-cycles \fIinteger\fP
+
+.TP 8
+.B \-count \fIinteger\fP
+
+.TP 8
+.B \-size \fIinteger\fP
+How large the pixels in the flag should be, from 1 to 8.
+If this is a negative number, the pixel size is chosen randomly
+from the range 1 to -size. Default -7.
+.TP 8
+.B \-text \fItext\fP
+The text to display in the flag. Multiple lines of text are allowed;
+the lines will be displayed centered atop one another. Default: none.
+If the text is the magic string \fI"(default)"\fP, then the text used
+will be the local machine name; a newline; and the local OS version.
+.TP 8
+.B \-bitmap \fIxbm-file\fP
+The bitmap to display in the flag; this must be an XBM file (color XPMs
+are not allowed.) Default: none. If the bitmap is the magic
+string \fI"(default)"\fP, then the bitmap used will be a charming
+little picture of J. R. "Bob" Dobbs.
+
+If neither \fI\-text\fP nor \fI\-bitmap\fP are specified, then either
+the builtin text or the builtin bitmap will be chosen randomly.
+.TP 8
+.B \-font \fIfont\fP
+The font in which to draw the text; the default is
+"-*-helvetica-bold-r-*-240-*".
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1996 Charles Vidal.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+
+.SH AUTHOR
+Charles Vidal <vidalc@univ-mlv.fr>, 1996.
+
+Ability to run standalone or with \fIxscreensaver\fP, and the \-text
+and \-bitmap options, added by Jamie Zawinski <jwz@jwz.org>, 24-May-97.
--- /dev/null
+.TH XScreenSaver 1 "13-aug-92" "X Version 11"
+.SH NAME
+flame - draw weird cosmic fractals
+.SH SYNOPSIS
+.B flame
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-colors \fIinteger\fP] [\-iterations \fIinteger\fP] [\-points \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-delay2 \fImicroseconds\fP]
+.SH DESCRIPTION
+The \fIflame\fP program generates colorful fractal displays.
+.SH OPTIONS
+.I flame
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-colors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+.TP 8
+.B \-iterations \fIinteger\fP
+How many fractals to generate. Default 25.
+.TP 8
+.B \-points \fIinteger\fP
+How many pixels to draw for each fractal. Default 10000.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How long we should wait between drawing each fractal. Default 50000,
+or about 1/20th second.
+.TP 8
+.B \-delay2 \fImicroseconds\fP
+How long we should wait before clearing the screen when each run ends.
+Default 2000000, or two seconds.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1991 by Patrick J. Naughton
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Scott Graves <spot@cs.cmu.edu>, 06-Jun-91.n
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 18-Oct-93.
--- /dev/null
+.TH XScreenSaver 1 "27-May-97" "X Version 11"
+.SH NAME
+forest - draws a fractal forest
+.SH SYNOPSIS
+.B forest
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP]
+
+.SH DESCRIPTION
+The \fIforest\fP program draws a fractal forest.
+.SH OPTIONS
+.I forest
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 100.
+.TP 8
+.B \-cycles \fIinteger\fP
+
+.TP 8
+.B \-count \fIinteger\fP
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1995 by Pascal Pensa.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Pascal Pensa <pensa@aurora.unice.fr>, 1995.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 27-May-97.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+galaxy - draws spinning galaxies
+.SH SYNOPSIS
+.B galaxy
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP] [\-size \fIinteger\fP] [\-trail] [\-no\-trail]
+
+.SH DESCRIPTION
+The \fIgalaxy\fP program draws spinning galaxies.
+.SH OPTIONS
+.I galaxy
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors used cycle through the hue, making N stops around
+the color wheel.
+.TP 8
+.B \-cycles \fIinteger\fP
+
+.TP 8
+.B \-count \fIinteger\fP
+
+.TP 8
+.B \-size \fIinteger\fP
+
+.TP 8
+.B \-trail
+.TP 8
+.B \-no\-trail
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1994 by Hubert Feyrer.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Original Amiga version by Uli Siegmund <uli@wombat.okapi.sub.org>
+ for EGS in Cluster.
+
+Ported from Cluster/EGS to C/Intuition by Harald Backert.
+
+Ported to X11 and xlockmore by
+Hubert Feyrer <hubert.feyrer@rz.uni-regensburg.de>, 30-Sep-94.
+
+Modified by David Bagley <bagleyd@bigfoot.com>, 23-Oct-94.
+
+Modified by Dave Mitchell <davem@magnet.com>, 7-Apr-97.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.TH XScreenSaver 1 "11-Jun-97" "X Version 11"
+.SH NAME
+goop - squishy transparent oil and bubble screenhack
+.SH SYNOPSIS
+.B goop
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-transparent] [\-non\-transparent] [\-additive] [\-subtractive] [\-xor] [\-no\-xor]
+.SH DESCRIPTION
+The \fIgoop\fP program draws a simulation of bubbles in layers of
+overlapping multicolored translucent fluid.
+.SH OPTIONS
+.I goop
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-count \fIinteger\fP
+How many bubbles to draw per layer. Default: random.
+.TP 8
+.B \-layers \fIinteger\fP
+How many layers to draw. Default: random, based on screen depth.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How much of a delay should be introduced between steps of the animation.
+Default 100000, or about 1/10th second.
+.TP 8
+.B \-transparent
+If \fI\-layers\fP is greater than 1, then each layer will be drawn in one
+color, and when they overlap, the colors will be mixed. This is the default.
+.TP 8
+.B \-non\-transparent
+Turns off \fI\-transparent\fP.
+.TP 8
+.B \-additive
+If \fI\-transparent\fP is specified, then this option means that the colors
+will be mixed using an additive color model, as if the blobs were projected
+light. This is the default.
+.TP 8
+.B \-subtractive
+If \fI\-transparent\fP is specified, then this option means that the
+colors will be mixed using a subtractive color model, as if the blobs were
+translucent filters.
+.TP 8
+.B \-xor
+Draw with xor instead of the other color tricks.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 11-Jun-97.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+grav - draws a simple orbital simulation
+.SH SYNOPSIS
+.B grav
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-count \fIinteger\fP] [\-decay] [\-no\-decay] [\-trail] [\-no\-trail]
+
+.SH DESCRIPTION
+The \fIgrav\fP program draws a simple orbital simulation
+.SH OPTIONS
+.I grav
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 200.
+The colors are chosen randomly.
+.TP 8
+.B \-count \fIinteger\fP
+Default 12.
+.TP 8
+.B \-decay
+.TP 8
+.B \-no-\decay
+Whether orbits should decay.
+
+.TP 8
+.B \-trail
+.TP 8
+.B \-no\-trail
+Whether the objects should leave trails behind them (makes it look vaguely
+like a cloud-chamber.
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1993 by Greg Bowering.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Greg Bowering <greg@smug.student.adelaide.edu.au>, 1993.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.TH XScreenSaver 1 "13-aug-92" "X Version 11"
+.SH NAME
+greynetic - draw random stippled/color rectangles
+.SH SYNOPSIS
+.B greynetic
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-delay \fIusecs\fP]
+.SH DESCRIPTION
+The \fIgreynetic\fP program draws random rectangles.
+.SH OPTIONS
+.I greynetic
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fImicroseconds\fP
+Slow it down.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
--- /dev/null
+.TH XScreenSaver 1 "12-Jun-97" "X Version 11"
+.SH NAME
+halo - draw circular patterns
+.SH SYNOPSIS
+.B halo
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-count \fIint\fP] [\-delay \fIusecs\fP] [\-mode seuss | ramp | random ] [\-animate] [\-colors \fIinteger\fP] [\-cycle] [\-no\-cycle] [\-cycle\-delay \fIusecs\fP]
+.SH DESCRIPTION
+The \fIhalo\fP program draws cool patterns based on circles.
+.SH OPTIONS
+.I halo
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-count \fIinteger\fP
+How many circles to draw. Default 0, meaning random.
+.TP 8
+.B \-mode "seuss | ramp | random"
+In \fIseuss\fP mode, alternating striped curves will be drawn.
+
+In \fIramp\fP mode, a color ramp will be drawn.
+
+\fIrandom\fP means pick the mode randomly.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How much of a delay should be introduced between steps of the animation.
+Default 100000, or about 0.1 second.
+.TP 8
+.B \-colors \fIinteger\fP
+How many colors to use. Default 100.
+.TP 8
+.B \-animate
+If specified, then the centerpoints of the circles will bounce around.
+Otherwise, the circles will be drawn once, erased, and a new set of
+circles will be drawn.
+.TP 8
+.B \-cycle
+.TP 8
+.B \-no\-cycle
+Whether to do colormap cycling. Default is to cycle.
+.TP 8
+.B \-cycle\-delay
+Number of microseconds between shifts of the colormap; default 100000,
+or 1/10th second.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1993 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 6-jul-93.
--- /dev/null
+.TH XScreenSaver 1 "18-sep-97" "X Version 11"
+.SH NAME
+helix - draw helical string-art patterns
+.SH SYNOPSIS
+.B helix
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-erase\-speed \fIusecs\fP] [\-erase\-mode \fIinteger\fP] [\-delay \fIseconds\fP] [\-install] [\-visual \fIvisual\fP]
+.SH DESCRIPTION
+The \fIhelix\fP program draws interesting patterns composed of line segments
+in random colors.
+.SH OPTIONS
+.I helix
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-erase\-speed \fIusecs\fP
+This controls the speed at which the screen will be erased. Lower numbers
+erase faster.
+.TP 8
+.B \-erase\-mode \fIinteger\fP
+This sets the erase mode. Mode \-1 chooses a random mode each time. There
+are currently 6 modes defined (0\-5).
+.TP 8
+.B \-delay \fIseconds\fP
+This sets the number of seconds that the helix will be on the screen.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+Screen eraser improved by Johannes Keukelaar <johannes@nada.kth.se>,
+ 18-sep-97.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+hopalong - draw real plane fractals
+.SH SYNOPSIS
+.B hopalong
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP] [\-jong] [\-no\-jong] [\-jong] [\-no\-sine]
+
+.SH DESCRIPTION
+The \fIhopalong\fP program generates real plane fractals as described in
+the September 1986 issue of Scientific American.
+.SH OPTIONS
+.I hopalong
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 200.
+The colors used cycle through the hue, making N stops around
+the color wheel.
+.TP 8
+.B \-cycles \fIinteger\fP
+How long to run each batch. Default 2500 pixels.
+.TP 8
+.B \-count \fIinteger\fP
+How many pixels should be drawn before a color change. Default 1000.
+.TP 8
+.B \-jong \fIinteger\fP
+.TP 8
+.B \-no\-jong \fIinteger\fP
+Whether to use the Jong format (default is to choose randomly.)
+
+.TP 8
+.B \-sine \fIinteger\fP
+.TP 8
+.B \-no\-sine \fIinteger\fP
+Whether to use the Sine format (default is to choose randomly.)
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1988-91 by Patrick J. Naughton.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Patrick J. Naughton <naughton@eng.sun.com>, 23-mar-88.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92, and again on 10-May-97.
--- /dev/null
+.TH XScreenSaver 1 "6-dec-92" "X Version 11"
+.SH NAME
+hypercube - 2d projection of a 4d object
+.SH SYNOPSIS
+.B hypercube
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-color[0-7] \fIcolor\fP] [\-xy \fIfloat\fP] [\-xz \fIfloat\fP] [\-yz \fIfloat\fP] [\-xw \fIfloat\fP] [\-yw \fIfloat\fP] [\-zw \fIfloat\fP] [\-observer-z \fIint\fP] [\-delay \fIusecs\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP]
+.SH DESCRIPTION
+The \fIhypercube\fP program displays a wireframe projection of a hypercube
+which is rotating at user-specified rates around any or all of its four axes.
+.SH OPTIONS
+.I hypercube
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How much of a delay should be introduced between steps of the animation.
+Default 100000, or about 1/10th second.
+.TP 8
+.B \-observer-z \fIint\fP
+How far away the observer is from the center of the cube (the cube is one
+unit per side.) Default 5.
+.TP 8
+.B \-color0 \fIcolor\fP
+.TP 8
+.B \-color1 \fIcolor\fP
+.TP 8
+.B \-color2 \fIcolor\fP
+.TP 8
+.B \-color3 \fIcolor\fP
+.TP 8
+.B \-color4 \fIcolor\fP
+.TP 8
+.B \-color5 \fIcolor\fP
+.TP 8
+.B \-color6 \fIcolor\fP
+.TP 8
+.B \-color7 \fIcolor\fP
+The colors used to draw the line segments bordering the eight faces of
+the cube. Some of the faces have only two of their border-lines drawn in
+the specified color, and some have all four.
+.TP 8
+.B \-xw \fIfloat\fP
+.TP 8
+.B \-xy \fIfloat\fP
+.TP 8
+.B \-xz \fIfloat\fP
+.TP 8
+.B \-yw \fIfloat\fP
+.TP 8
+.B \-yz \fIfloat\fP
+.TP 8
+.B \-zw \fIfloat\fP
+The amount that the cube should be rotated around the specified axis at
+each frame of the animation, expressed in radians. These should be small
+floating-point values (less than 0.05 works best.) Default: xy=0.01,
+xz=0.005, yw=0.01.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 6-dec-92.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+ifs - draws spinning, colliding iterated-function-system images
+.SH SYNOPSIS
+.B ifs
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP]
+
+.SH DESCRIPTION
+The \fIifs\fP program draws spinning, colliding iterated-function-system images.
+.SH OPTIONS
+.I ifs
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 200.
+The colors used cycle through the hue, making N stops around
+the color wheel.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Massimino Pascal.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Massimino Pascal <Pascal.Massimon@ens.fr>, 1997.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.TH XScreenSaver 1 "17-May-97" "X Version 11"
+.SH NAME
+imsmap - generate fractal maps
+.SH SYNOPSIS
+.B imsmap
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIint\fP] [\-delay \fIseconds\fP] [\-iterations \fIint\fP] [\-mode h|s|v|random] [\-cycle] [\-no\-cycle]
+.SH DESCRIPTION
+The \fIimsmap\fP program generates map or cloud-like patterns. It looks
+quite different in monochrome and color.
+.SH OPTIONS
+.I imsmap
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors to use. Default 50.
+.TP 8
+.B \-delay \fIinteger\fP
+How long to delay between images. Default 10 seconds.
+.TP 8
+.B \-iterations \fIinteger\fP
+A measure of the resolution of the resultant image, from 0 to 7. Default 7.
+.TP 8
+.B \-mode [ hue | saturation | value | random ]
+The axis upon which colors should be interpolated between the foreground
+and background color. Default random.
+.TP 8
+.B \-cycle
+.TP 8
+.B \-no\-cycle
+Whether to do colormap cycling. Default is to cycle.
+.TP 8
+.B \-cycle\-delay
+Number of microseconds between shifts of the colormap; default 100000,
+or 1/10th second.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH AUTHOR
+Juergen Nickelsen <nickel@cs.tu-berlin.de>, 23-aug-92.
+
+Hacked on by Jamie Zawinski <jwz@jwz.org>, 24-aug-92, 17-May-97.
--- /dev/null
+.TH XScreenSaver 1 "25-Nov-97" "X Version 11"
+.SH NAME
+jigsaw - permute the screen image like a jigsaw puzzle
+.SH SYNOPSIS
+.B jigsaw
+[\-display \fIhost:display.screen\fP] [\-background \fIcolor\fP] [\-delay \fIusecs\fP] [\-window] [\-root] [\-install] [\-visual \fIvisual\fP]
+.SH DESCRIPTION
+The \fIjigsaw\fP program takes an image of the screen, carves it up into
+a jigsaw puzzle, shuffles it, and then solves it.
+.SH OPTIONS
+.I jigsaw
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How long to wait between shuffling pieces; default 700000, or 0.7 seconds.
+.SH RESOURCES
+On some systems (currently, only SGIs), this program can, instead of grabbing
+a desktop image, grab a frame of video from an external camera and manipulate
+that instead. The following resources control that.
+.PP
+.TP 8
+.B grabVideoProbability \fR(Float)\fP
+What portion of the time to grab video rather than a screen image,
+between 0.0 and 1.0. Defaults to 0.5, or half the time.
+.TP 8
+.B videoDevice \fR(Integer)\fP
+The number of the default video input device to check first. If unspecified,
+the default camera (from videopanel(1)) will be checked first. After that, all
+other available video input devices will be checked in order.
+
+The first one which produces a non-black image will be used. If all images
+are black, the others will be re-checked a few times before giving up and
+falling back to simply grabbing a desktop image (but note that this takes a
+few seconds, so if you don't actually have any video sources hooked up, you
+should consider turning off video grabbing by setting
+\fBgrabVideoProbability\fP to 0.0.)
+.TP 8
+.B videoGain \fR(Float)\fP
+The amount by which to brighten the grabbed image. This defaults to 2.2.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 25-Nov-97.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH Kaleidescpe 1 "14-Dec-95" "X Version 11"
+.SH NAME
+Kaleidescope - rotating line segments
+.SH SYNOPSIS
+.B kaleidescope
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-install] [\-visual \fIvisual\fP] [\-color_mode \fImono | nice | greedy\fP] [-nsegments \fIint\fP] [\-ntrails \fIint\fP] [\-local_rotation \fIint\fP] [\-global_rotation \fIint\fP] [\-delay \fIusecs\fP] [\-redmin \fIint\fP] [\-greenmin \fIint\fP] [\-bluemin \fIint\fP] [\-redrange \fIint\fP] [\-greenrange \fIint\fP] [\-bluerange \fIint\fP]
+.SH DESCRIPTION
+The \fIkaleidescope\fP program draws line segments in a symmetric pattern
+that evolves over time.
+.SH OPTIONS
+.I kaleidescope
+accepts the following options:
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-color_mode "mono | nice | greedy"
+Specify how kaleidescope uses colors. Mono uses
+just the default foreground and background colors. Nice uses one
+color for each segment (specified by nsegments). Greedy uses (ntrails * nsegments) + 1 colors.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-nsegments integer
+The number of segments to draw. Default is 7.
+.TP 8
+.B \-ntrails integer
+The number of trails to draw. Default is 100.
+.TP 8
+.B \-local_rotation integer
+The rate at which segments rotate around their center. Default is -59.
+.TP 8
+.B \-global_rotation integer
+The rate at which segments rotate around the center of the window.
+Default is 1.
+.TP 8
+.B \-redmin, \-greenmin, \-bluemin, \-redrange, \-greenrange, \-bluerange
+All take an integer argument. When colors are randomly chosen, they
+are chosen from the interval min to min plus range. The minimums default
+to 30000. The ranges default to 20000.
+.TP 8
+.B \-delay microseconds
+How much of a delay should be introduced between steps of the animation.
+Default is 20000, or about 5 frames a second.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR kaleidescope (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Ron Tapia. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Ron Tapia <tapia@nmia.com>, 20-Mar-97.
+
--- /dev/null
+.TH XScreenSaver 1 "25-Jul-98" "X Version 11"
+.SH NAME
+lament - animates the Lament Configuration
+.SH SYNOPSIS
+.B lament
+[\-display \fIhost:display.screen\fP] [\-window] [\-root] [\-install] [\-visual \fIvisual\fP] [\-texture] [\-no\-texture] [\-wireframe]
+.SH DESCRIPTION
+The \fIlament\fP program draws an animation of a particular puzzle box
+repeatedly solving itself.
+.SH OPTIONS
+.I lament
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-texture
+Use texture maps. This is the default.
+.TP 8
+.B \-no\-texture
+Do not use texture maps. This is boring and wrong.
+.TP 8
+.B \-wireframe
+Only draw outlines.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH BUGS
+This hack is glacially slow on machines lacking hardware texture support.
+
+Occasionally opens doors, admitting theologians of the Order of the Gash.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1998 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 25-Jul-98.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+laser - draws vaguely laser-like moving lines
+.SH SYNOPSIS
+.B laser
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP]
+
+.SH DESCRIPTION
+The \fIlaser\fP program draws vaguely laser-like moving lines
+.SH OPTIONS
+.I laser
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors used cycle through the hue, making N stops around the color wheel.
+.TP 8
+.B \-cycles \fIinteger\fP
+Default 200.
+.TP 8
+.B \-count \fIinteger\fP
+Default 10.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1995 by Pascal Pensa.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Pascal Pensa <pensa@aurora.unice.fr>, 1995.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+lightning - draws fractal lightning bolts
+.SH SYNOPSIS
+.B lightning
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP]
+
+.SH DESCRIPTION
+The \fIlightning\fP program draws fractal lightning bolts
+.SH OPTIONS
+.I lightning
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors are chosen randomly.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1996 by Keith Romberg.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Keith Romberg <kromberg@saxe.com>, 27-Jun-96.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.TH XScreenSaver 1 "27-May-97" "X Version 11"
+.SH NAME
+lisa - draws animated full-loop lisajous figures
+.SH SYNOPSIS
+.B lisa
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP] [\-size \fIinteger\fP]
+
+.SH DESCRIPTION
+The \fIlisa\fP program draws animated full-loop lisajous figures.
+.SH OPTIONS
+.I lisa
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 200.
+The colors are chosen randomly.
+.TP 8
+.B \-cycles \fIinteger\fP
+
+.TP 8
+.B \-count \fIinteger\fP
+
+.TP 8
+.B \-size \fIinteger\fP
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Caleb Cullen.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Caleb Cullen, 1997.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 27-May-97.
--- /dev/null
+.TH LMORPH 1 "xscreensaver hack"
+.SH NAME
+lmorph \- morphing lines
+.SH SYNOPSIS
+.B lmorph
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-points \fIint\fP] [\-steps \fIint\fP] [\-delay \fIusecs\fP] [\-figtype \fItype\fP]
+.SH DESCRIPTION
+The \fIlmorph\fP program morphs between simple linedrawings using bilinear
+interpolation.
+.SH OPTIONS
+.I lmorph
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-points \fIinteger\fP
+Number of points in each line drawing. Default is 150 points.
+.TP 8
+.B \-steps \fIinteger\fP
+Interpolation steps from one drawing to the next. Default is 0, which
+means a random number between 100 and 500.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How much of a delay should be introduced between steps of the animation.
+Default 50000.
+.TP 8
+.B \-figtype \fItype\fP
+Limit the figures to only open or closed figures. Possible types are
+"all" (default), "open" and "closed".
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH AUTHOR
+Sverre H. Huseby <sverrehu@online.no> and Glenn T. Lines <gtl@si.sintef.no>,
+built on top of the screen saver routines by Jamie Zawinski <jwz@jwz.org>.
--- /dev/null
+.TH XScreenSaver 1 "7-mar-93" "X Version 11"
+.SH NAME
+maze \- an automated X11 demo repeatedly creating and solving a random maze
+.SH SYNOPSIS
+.B maze
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-install] [\-visual \fIvisual\fP] [\-grid\-size \fIpixels\fP] [\-live\-color \fIcolor\fP] [\-dead\-color \fIcolor\fP] [\-solve\-delay \fIusecs\fP] [\-pre\-delay \fIusecs\fP] [\-post\-delay \fIusecs\fP] [\-generator \fIinteger\fP] [\-max\-length \fIinteger\fP] [\-bridge] [\-no\-bridge]
+.SH DESCRIPTION
+The \fImaze\fP program creates a "random" maze and then solves it with
+graphical feedback.
+.SH OPTIONS
+.I maze
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-grid\-size \fIpixels\fP
+The size of each block of the maze, in pixels; default is 0, meaning
+pick a random grid size.
+.TP 8
+.B \-live\-color \fIcolor\fP
+The color of the path.
+.TP 8
+.B \-dead\-color \fIcolor\fP
+The color of the failed path (it is also stippled with a 50% pattern.)
+.TP 8
+.B \-skip\-color \fIcolor\fP
+The maze solver will choose to not go down a path if it can "see" (in a
+straight line) that it is a dead end. This is the color to use for paths
+that are skipped for this reason.
+.TP 8
+.B \-surround\-color \fIcolor\fP
+If the maze solver ever completely encloses an area within the maze, then
+it knows that the exit is not in there (and in fact the interior of that
+area might not even be reachable.) It will mark out those cells using this
+color.
+.TP 8
+.B \-solve\-delay \fIinteger\fP
+Delay (in microseconds) between each step of the solution path.
+Default 5000, or about 1/200th second.
+.TP 8
+.B \-pre\-delay \fIinteger\fP
+Delay (in microseconds) between generating a maze and starting to solve it.
+Default 2000000 (2 seconds.)
+.TP 8
+.B \-post\-delay \fIinteger\fP
+Delay (in microseconds) after solving a maze and before generating a new one.
+Default 4000000 (4 seconds.)
+.TP 8
+.B \-generator \fInum\fP
+Sets the algorithm that will be used to generate the mazes. The
+default is \-1, which randomly selects an algorithm for each maze that
+is generated. Generator 0 is the original one, and works by walking
+around randomly until we hit a place we've been before, then
+backtracking and trying a new direction somewhere. Generator 1 picks a
+random spot in the maze, then draws a straight wall from that spot in
+a random direction until it hits another wall (and continues until the
+maze is complete). Generator 2 is based on sets. Initially all cells
+are in different sets. Then two neighboring cells are chosen and if
+they are in different sets, their sets are joined. If they were in the
+same set, a wall is built between them. This continues until the maze is
+complete.
+
+All generators generate mazes with a certain 'characteristic'. See if you
+can spot them!
+.TP 8
+.B \-max\-length \fInum\fP
+Controls the maximum length of walls drawn in one go by generator 1.
+.TP 8
+.B \-bridge
+.TP 8
+.B \-no\-bridge
+Controls whether or not a 'bridge' will appear over the logo.
+.PP
+Clicking the mouse in the maze window controls it.
+.TP 16
+.B "LeftButton
+Clears the window and restarts maze.
+.TP 16
+.B MiddleButton
+Pause or unpause the program.
+.TP 16
+.B RightButton
+Exit.
+.SH BUGS
+Expose events force a restart of maze.
+
+Mouse actions are based on "raw" values (Button1, Button2 and Button3)
+instead of using the pointer map.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+.PP
+Copyright \(co 1988 by Sun Microsystems, Inc. Mountain View, CA.
+.PP
+All Rights Reserved
+.PP
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted, provided that
+the above copyright notice appear in all copies and that both that copyright
+notice and this permission notice appear in supporting documentation, and that
+the names of Sun or MIT not be used in advertising or publicity pertaining to
+distribution of the software without specific prior written permission. Sun
+and M.I.T. make no representations about the suitability of this software for
+any purpose. It is provided "as is" without any express or implied warranty.
+.PP
+SUN DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING ALL
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. IN
+NO EVENT SHALL SUN BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL
+DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS,
+WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING
+OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+.SH AUTHOR(s)
+.nf
+Zack Weinberg [ Smarter maze-solver ] zack@rabi.phys.columbia.edu
+Johannes Keukelaar [ Generators 1 and 2 ] johannes@nada.kth.se
+ Royal Institute of Technology, Stockholm, Sweden
+Jim Randell [ XScreenSaver version ] jmr@mddjmr.fc.hp.com
+ HPLabs, Bristol
+Richard Hess [ X11 extensions ] {...}!uunet!cimshop!rhess
+ Consilium, Mountain View, CA
+Dave Lemke [ X11 version ] lemke@sun.COM
+ Sun MicroSystems, Mountain View, CA
+Martin Weiss [ SunView version ]
+ Sun MicroSystems, Mountain View, CA
+.fi
--- /dev/null
+.TH XScreenSaver 1 "27-Apr-97" "X Version 11"
+.SH NAME
+halo - draw circular interference patterns
+.SH SYNOPSIS
+.B halo
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-delay \fIseconds\fP] [\-random \fIboolean\fP] [\-ncolors \fIint\fP] [\-offset \fIint\fP]
+.SH DESCRIPTION
+The \fImoire\fP program draws cool circular interference patterns.
+.SH OPTIONS
+.I moire
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fIseconds\fP
+How long to wait before starting over. Default 5 seconds.
+.TP 8
+.B \-random \fIboolean\fP
+Whether to ignore the foreground/background colors, and pick them randomly
+instead.
+.TP 8
+.B \-offset \fIinteger\fP
+The maximum random radius increment to use.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be allocated in the color ramp (note that this
+value interacts with \fIoffset\fP.)
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 27-Apr-97, based on code by
+Michael D. Bayne <mdb@go2net.com>.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH XScreenSaver 1 "17-Jun-97" "X Version 11"
+.SH NAME
+munch - munching squares screen hack
+.SH SYNOPSIS
+.B munch
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP]
+[\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install]
+[\-visual \fIvisual\fP] [\-delay \fIseconds\fP] [\-xor] [\-noxor] [\-shift]
+[\-noshift] [\-logminwidth \fIminimum width\fP]
+.SH DESCRIPTION
+The
+.I munch
+program preforms the munching squares hack until killed. It picks square
+size, position, and gravity randomly; configurable options are listed
+below.
+.PP
+The munching squares hack cosists of drawing Y = X XOR T for a range of X
+and T over and over until all the possible combinations of X and T have
+come up. It was reportedly discovered by Jackson Wright in 1962 and took 5
+instructions of PDP-6 code.
+.SH OPTIONS
+.I munch
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fIseconds\fP
+How long to wait before starting over. Default 5 seconds.
+.TP 8
+.B \-xor
+Use the XOR drawing function. (Default.)
+.TP 8
+.B \-no\-xor
+Don't use the XOR drawing function.
+.TP 8
+.B \-shift
+Start drawing the square at weird starting points. (Default.)
+.TP 8
+.B \-no\-shift
+Don't shift and start drawing the square at weird starting points.
+.TP 8
+.B \-logminwidth \fIminimum\-width\fP
+The logarithm (base 2) of the minimum with of a square (must be a power of
+2, or some parts of the square aren't.)
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR http://www.inwap.com/pdp10/hbaker/hakmem/hakmem.html,
+.BR http://www.comedia.com/Hot/jargon_3.0/JARGON_M/MUNCHSQR.HTML
+.SH HISTORY
+Quoted from HAKMEM, for historical interest. As that document says, "Unless
+otherwise stated, all computer programs are in PDP-6/10 assembly language."
+.TP 8
+ITEM 146: MUNCHING SQUARES
+Another simple display program. It is thought that this was discovered by
+Jackson Wright on the RLE PDP-1 circa 1962.
+
+.EX
+ DATAI 2
+ ADDB 1,2
+ ROTC 2,-22
+ XOR 1,2
+ JRST .-4
+.EE
+.RS 8
+2=X, 3=Y. Try things like 1001002 in data switches. This also does
+interesting things with operations other than XOR, and rotations other
+than -22. (Try IOR; AND; TSC; FADR; FDV(!); ROT -14, -9, -20, ...)
+.RE
+.TP 8
+ITEM 147 (Schroeppel):
+Munching squares is just views of the graph Y = X XOR T for consecutive
+values of T = time.
+.TP 8
+ITEM 148 (Cohen, Beeler):
+A modification to munching squares which reveals them in frozen states
+through opening and closing curtains: insert FADR 2,1 before the XOR. Try
+data switches =
+
+.EX
+ 4000,,4 1000,,2002 2000,,4 0,,1002
+.EE
+.RS 8
+(Notation: <left half>,,<right half>)
+
+Also try the FADR after the XOR, switches = 1001,,1.
+.SH COPYRIGHT
+Copyright \(co 1997 by Tim Showalter. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Tim Showalter <tjs@andrew.cmu.edu>, 17-Jun-97, based on what's in the
+Jargon File and stealing stuff from existing xscreensaver modules.
--- /dev/null
+.TH XScreenSaver 1 "13-aug-92" "X Version 11"
+.SH NAME
+noseguy - a little guy with a big nose wanders around being witty
+.SH SYNOPSIS
+.B noseguy
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-text-foreground \fIcolor\fP] [\-text-background \fIcolor\fP] [\-font \fIfont\fP] [\-window] [\-root] [\-install] [\-visual \fIvisual\fP] [\-mode \fImode\fP] [\-program \fIprogram\fP] [\-filename \file\fP] [\-text \fItext\fP]
+.SH DESCRIPTION
+A little man with a big nose and a hat runs around spewing out messages to
+the screen. This code (and its bitmaps) were extracted from the \fIxnlock\fP
+program.
+.SH OPTIONS
+.I noseguy
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-font \fIfont\fP
+The font used for the messages.
+.TP 8
+.B \-mode [ program | file | string ]
+In \fIprogram\fP mode, the messages are gotten by running a program.
+The program used is controlled by the \fI\-program\fP option, and
+the \fI.program\fP resource.
+
+In \fIfilename\fP mode, the message used is the contents of a file.
+The file used is controlled by the \fI\-file\fP option, and
+the \fI.filename\fP resource.
+
+In \fIstring\fP mode, the message is whatever was specified on the
+command line as the \fI\-text\fP option, or in the resource database
+as the \fI.text\fP resource.
+.TP 8
+.B \-program \fIprogram\fP
+If \fImode\fP is \fIprogram\fP (the default), then this program will be
+run periodically, and its output will be the text of the messages. The
+default program is \fI"fortune -s"\fP, but \fIyow\fP is also a good choice.
+.TP 8
+.B \-filename \fIfile\fP
+If \fImode\fP is \fIfile\fP, then the contents of this file will be used
+for all messages.
+.TP 8
+.B \-text \fIstring\fP
+If \fImode\fP is \fIstring\fP, then this text will be used for all messages.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xnlock (1)
+.SH COPYRIGHT
+Copyright 1985, 1990 by Dan Heller <argv@sun.com>.
+.SH AUTHOR
+Dan Heller <argv@sun.com>, 1985.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
--- /dev/null
+.TH XScreenSaver 1 "24-Jun-94" "X Version 11"
+.SH NAME
+pedal - pretty geometric picture program
+.SH SYNOPSIS
+.B pedal
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-delay \fIseconds\fP] [-maxlines \fInumber\fP] [-fadedelay \fIuseconds\fP] [-mono] [\-install] [\-visual \fIvisual\fP]
+.SH DESCRIPTION
+The \fIpedal\fP program displays pretty geometric pictures.
+.SH OPTIONS
+.I pedal
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-foreground \fIcolor\fP
+The color for the foreground. Default is white.
+.TP 8
+.B \-background \fIcolor\fP
+The color for the background. Default is black.
+.TP 8
+.B \-delay \fIseconds\fP
+The number of seconds to pause between each picture.
+.TP 8
+.B \-maxlines \fInumber\fP
+The maximum number of lines in the drawing. Good values are
+between 20 and 2000. Maximum value is 16K.
+.TP 8
+.B \-fadedelay \fImicroseconds\fP
+The number of micro seconds to take when fading in and out.
+.TP 8
+.B \-mono
+Don't do fading. Pretend we're on a monochrome display.
+.PP
+To make your X server grunt under load, and to impress your
+friends, try \fIpedal -mono -delay 0 -maxlines 100\fp.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1994, by Carnegie Mellon University. Permission to use,
+copy, modify, distribute, and sell this software and its documentation
+for any purpose is hereby granted without fee, provided fnord that the
+above copyright notice appear in all copies and that both that copyright
+notice and this permission notice appear in supporting documentation.
+No representations are made about the suitability of fnord this software
+for any purpose. It is provided "as is" without express or implied
+warranty.
+.SH AUTHOR
+Dale Moore <Dale.Moore@cs.cmu.edu>, 24-Jun-1994.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+penrose - draws quasiperiodic tilings
+.SH SYNOPSIS
+.B penrose
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-redoDelay \fIseconds\fP] [\-size \fIinteger\fP] [\-ammann] [\-no\-ammann]
+
+.SH DESCRIPTION
+The \fIpenrose\fP program draws quasiperiodic tilings.
+
+See Onoda, Steinhardt, DiVincenzo and Socolar in
+Phys. Rev. Lett. 60, #25, 1988 or
+Strandburg in Computers in Physics, Sep/Oct 1991.
+
+This implementation uses the simpler version of the growth
+algorithm, i.e., if there are no forced vertices, a randomly chosen
+tile is added to a randomly chosen vertex (no preference for those
+108 degree angles).
+
+There are two essential differences to the algorithm presented in
+the literature: First, we do not allow the tiling to enclose an
+untiled area. Whenever this is in danger of happening, we just
+do not add the tile, hoping for a better random choice the next
+time. Second, when choosing a vertex randomly, we will take
+one that lies withing the viewport if available. If this seems to
+cause enclosures in the forced rule case, we will allow invisible
+vertices to be chosen.
+
+Tiling is restarted whenever one of the following happens: there
+are no incomplete vertices within the viewport or the tiling has
+extended a window's length beyond the edge of the window
+horizontally or vertically or forced rule choice has failed 100
+times due to areas about to become enclosed.
+
+Although quasiperiodic tilings are produced, the tiles themselves are
+not penrose tiles (darts and kites). In contrast to penrose tiles,
+these tiles can be arranged to form a periodic tiling.
+
+.SH OPTIONS
+.I penrose
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors are chosen randomly.
+.TP 8
+.B \-size \fIinteger\fP
+How big the tiles should be. Default 40 pixels.
+
+.TP 8
+.B \-delay \fImilliseconds\fP
+How long (in 1/1,000,000'ths of a second) to wait between drawing each
+tile. Default 10,000 or .01 seconds.
+
+.TP 8
+.B \-redoDelay \fIseconds\fP
+How long to wait between starting a completely new tiling. Default 3 seconds.
+
+.TP 8
+.B \-ammann \fIinteger\fP
+.TP 8
+.B \-no\-ammann \fIinteger\fP
+Whether Ammann lines should be added.
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1996 by Timo Korvola.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Timo Korvola <tkorvola@dopey.hut.fi>, 1996.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.TH XScreenSaver 1 "13-aug-92" "X Version 11"
+.SH NAME
+pyro - simulate fireworks
+.SH SYNOPSIS
+.B pyro
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-count \fIinteger\fP] [\-frequency \fIinteger\fP] [\-scatter \fIinteger\fP]
+.SH DESCRIPTION
+The \fIpyro\fP program simulates fireworks, in a way similar to a Macintosh
+program of the same name.
+.SH OPTIONS
+.I pyro
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-count \fIinteger\fP
+How many particles should be allowed on the screen at once. Default 100.
+.TP 8
+.B \-frequency \fIinteger\fP
+How often new missiles should launch. Default 30.
+.TP 8
+.B \-scatter \fIinteger\fP
+How many particles should appear when a missile explodes. Default 20.
+The actual number used is between \fIN\fP and \fIN+(N/2)\fP.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
--- /dev/null
+.TH XScreenSaver 1 "27-Apr-97" "X Version 11"
+.SH NAME
+qix - bounce colored lines around a window
+.SH SYNOPSIS
+.B qix
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-segments \fIint\fP] [\-spread \fIpixels\fP] [\-size \fIpixels\fP] [\-count \fIint\fP] [\-color-shift \fIdegrees\fP] [\-delay \fIusecs\fP] [\-random] [\-linear] [\-solid] [\-hollow] [\-xor] [\-no\-xor] [\-transparent] [\-non\-transparent] [\-additive] [\-subtractive] [\-poly \fIint\fP] [\-gravity] [\-no\-gravity]
+.SH DESCRIPTION
+The \fIqix\fP program bounces a series of line segments around its window.
+This is truly the swiss army chainsaw of qix programs. If you know of one
+with more display modes, I want to know about it.
+.SH OPTIONS
+.I qix
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-segments \fIinteger\fP
+How many line segments should be drawn. Default 50.
+.TP 8
+.B \-spread \fIinteger\fP
+How far apart the endpoints of one segment should be from the next.
+Default 8.
+.TP 8
+.B \-size \fIinteger\fP
+The maximum distance one endpoint of a segment is allowed to be from
+the opposite end of that segment. Default 0, meaning unlimited.
+.TP 8
+.B \-count \fIinteger\fP
+How many qixes to draw. Default 1.
+.TP 8
+.B \-color\-shift \fIdegrees\fP
+If on a color display, the color of the line segments will cycle through
+the spectrum. This specifies how far the hue of each segment should be
+from the next, in degrees on the HSV wheel. Default 3.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How much of a delay should be introduced between steps of the animation.
+Default 25000, or about 0.025 seconds.
+.TP 8
+.B \-random
+The \fIqix\fP will wander around the screen semi-randomly. This is the
+default.
+.TP 8
+.B \-linear
+The opposite of \fI\-random\fP: the \fIqix\fP will travel in straight lines
+until it reaches a wall, and then it will bounce.
+.TP 8
+.B \-solid
+If this is specified, then the area between the line segments will be filled
+in with the appropriate color, instead of the \fIqix\fP simply being composed
+of one-pixel-wide line segments. This option looks really good in color.
+.TP 8
+.B \-hollow
+The opposite of \fI\-solid\fP; this is the default.
+.TP 8
+.B \-xor
+If this is specified, then qix segments will be drawn and erased with xor,
+instead of being drawn in some color and erased in the background color.
+This implies \fI\-mono\fP, in that only two colors can be used.
+.TP 8
+.B \-transparent
+If this is specified, and \fI\-count\fP is greater than 1, then each qix
+will be drawn in one color, and when they overlap, the colors will be mixed.
+This looks best in conjuction with \fI\-solid\fP.
+.TP 8
+.B \-non\-transparent
+Turns off \fI\-transparent\fP.
+.TP 8
+.B \-additive
+If \fI\-transparent\fP is specified, then this option means that the colors
+will be mixed using an additive color model, as if the qixes were projected
+light. This is the default.
+.TP 8
+.B \-subtractive
+If \fI\-transparent\fP is specified, then this option means that the
+colors will be mixed using a subtractive color model, as if the qixes were
+translucent filters.
+.TP 8
+.B \-poly \fIint\fP
+How many vertices each qix-line should have: the default is 2, meaning the
+traditional qix line shape. Three will yield triangles, and so on.
+.TP 8
+.B \-gravity
+.TP 8
+.B \-no\-gravity
+Whether there should be downward attraction. For example, the
+options
+.B \-gravity \-linear
+will make everything move in nice smooth parabolas.
+Gravity is off by default.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+Thanks to Ariel Scolnicov for the \-poly and \-gravity options.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+rd-bomb - reaction/diffusion textures
+.SH SYNOPSIS
+.B rd-bomb
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP]
+[\-background \fIcolor\fP] [\-window] [\-root] [\-install]
+[\-visual \fIvisual\fP] [\-width \fIn\fP] [\-height \fIn\fP]
+[\-reaction \fIn\fP] [\-diffusion \fIn\fP]
+[\-size \fIf\fP] [\-speed \fIf\fP] [\-delay \fIusecs\fP]
+.SH DESCRIPTION
+
+The \fIrd-bomb\fP program draws reaction/diffusion textures. The code
+is derived from the 'd' mode of the "bomb" visual musical instrument
+(see http://www.cs.cmu.edu/~spot/bomb.html). I got the equations from
+xmorphia (http://www.ccsf.caltech.edu/ismap/image.html), which is
+based on a version of the Gray-Scott model taken from:
+ John E. Pearson "Complex Patterns in a Simple System"
+ Science, 261,189, 9 July 1993.
+
+If the frame-rate is too low, consider decreasing the width and height
+of the tile, or decreasing the size of the active part of the screen.
+
+.SH OPTIONS
+
+If one of the reaction, diffusion, radius, and palette options is set
+to a negative value, then that option will be set to a random
+appropriate value.
+
+Be sure to try "-speed 1 -size 0.1 -epoch 3000".
+
+.I rd-bomb
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-width \fIn\fP
+.TP 8
+.B \-height \fIn\fP
+Specify the size of the tile, in pixels.
+.TP 8
+.B \-reaction \fIn\fP
+.TP 8
+.B \-diffusion \fIn\fP
+These are constants in the equations that effect its visual nature.
+Each may be one of 0, 1, or 2.
+.TP 8
+.B \-radius \fIn\fP
+Size of the seed.
+.TP 8
+.B \-palette \fIn\fP
+Selects a palette. Must be between 0 and 80, inclusive.
+.TP 8
+.B \-size \fIf\fP
+What fraction of the window is actively drawn, a floating point number
+between 0 (exclusive) and 1 (inclusive). Default is 0.66.
+.TP 8
+.B \-speed \fIf\fP
+When a fraction of the screen is active, the active area moves at this
+rate (a floating point number). Default is zero. Suggested value: 1.0.
+.TP 8
+.B \-delay \fIusecs\fP
+How many microseconds to delay between frames; default 1000, or
+about 1/1000th of a second.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Scott Draves.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Scott Draves <spot@cs.cmu.edu>, 9/97
--- /dev/null
+.TH XScreenSaver 1 "13-aug-92" "X Version 11"
+.SH NAME
+rocks - animation of flying through an asteroid field
+.SH SYNOPSIS
+.B rocks
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-ncolors \fIn\fP] [\-install] [\-visual \fIvisual\fP] [\-count \fIinteger\fP] [\-delay \fIusecs\fP] [\-speed \fIinteger\fP] [\-norotate] [\-nomove] [\-3d]
+.SH DESCRIPTION
+The \fIrocks\fP program draws an animation of an asteroid field moving past
+the observer (or vice versa). Sometimes the observer picks up spin on Z axis.
+.SH OPTIONS
+.I rocks
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+Make all the rocks the same color.
+.TP 8
+.B \-ncolors colors
+How many different colors to use. Default 5. Colors are chosen randomly.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-count \fIinteger\fP
+Maximum number of rocks to draw on the screen at once. Default 100.
+.TP 8
+.B \-speed \fIinteger\fP
+A measure of the speed with which the observer and the rocks pass each other,
+from 1 to 100. Default 100, meaning ``very fast.'' If you're on a slow
+display connection (the animation looks jerky) then try making this number
+smaller, and/or decreasing the number of rocks.
+.TP 8
+.B \-delay \fImicroseconds\fP
+Number of microseconds to delay between each frame. Default 50000, meaning
+about 1/20th second. Compare and contrast with \fI\-speed\fP, above.
+.TP 8
+.B \-norotate
+Don't rotate the observer; just fly through the field on the level.
+.TP 8
+.B \-nomove
+Don't turn the observer; just fly straight ahead through the field.
+.TP 8
+.B \-3d
+Do red/blue 3d separations: if you look at the screen with 3d glasses,
+the rocks will be \fIjumping\fP right \fIout\fP at you. Oooooh, scaaary!
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH BUGS
+There should be an option to display doppler shift (a gravity rainbow.)
+
+Speed of rotation should be settable.
+
+Default speed of rotation should be relative to forward velocity.
+.SH COPYRIGHT
+Copyright \(co 1992 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Based on Lisp Machine code copyright 1988 John Nguyen <johnn@hx.lcs.mit.edu>.
+
+Ported to C and X by Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+Steering code by Jeremie Petit; 3D code by theiling@coli.uni-sb.de.
--- /dev/null
+.TH XScreenSaver 1 "13-aug-92" "X Version 11"
+.SH NAME
+rorschach - simulate ink-blot patterns
+.SH SYNOPSIS
+.B rorschach
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-iterations \fIinteger\fP] [\-offset \fIinteger\fP] [\-xsymmetry] [\-ysymmetry] [\-erase\-mode \fIinteger\fP] [\-erase\-speed \fIusecs\fP] [\-delay \fIsecs\fP]
+.SH DESCRIPTION
+The \fIrorschach\fP program draws random patterns reminiscent of the
+psychological test of same name.
+.SH OPTIONS
+.I rorschach
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-iterations \fIinteger\fP
+How many dots should be drawn each time. Default 4000.
+.TP 8
+.B \-offset \fIinteger\fP
+How far apart the dots should be. Default 4 pixels.
+.TP 8
+.B \-xsymmetry
+Whether the images should be horizontally symmetrical. Default true.
+.TP 8
+.B \-ysymmetry
+Whether the images should be vertically symmetrical. Default false.
+.TP 8
+.B \-erase\-mode \fIinteger\fP
+This sets the erase mode. Mode \-1 chooses a random mode each time. There
+are currently 6 modes defined (0\-5).
+.TP 8
+.B \-erase\-speed \fIusecs\fP
+This controls the speed at which the screen will be erased. (Delay between
+erasing of individual lines.)
+.TP 8
+.B \-delay \fIseconds\fP
+This sets the number of seconds that the figure will be on the screen.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH BUGS
+May call your sanity into question.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+sierpinski - draws Sierpinski triangle fractals
+.SH SYNOPSIS
+.B sierpinski
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP]
+
+.SH DESCRIPTION
+The \fIsierpinski\fP program draws Sierpinski triangle fractals.
+.SH OPTIONS
+.I sierpinski
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors are chosen randomly.
+.TP 8
+.B \-cycles \fIinteger\fP
+
+.TP 8
+.B \-count \fIinteger\fP
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1996 by Desmond Daignault.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Desmond Daignault <tekdd@dtol.datatimes.com>, 05-Sep-96. (Original
+xlock version was called tri.c.)
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97. (Renamed to sierpinski.)
--- /dev/null
+.TH XScreenSaver 1 "24-Nov-97" "X Version 11"
+.SH NAME
+slidescreen - permute the screen image like an 8-puzzle
+.SH SYNOPSIS
+.B slidescreen
+[\-display \fIhost:display.screen\fP] [\-background \fIcolor\fP] [\-grid-size \fIpixels\fP] [\-ibw \fIpixels\fP] [\-increment \fIpixels\fP] [\-delay \fIusecs\fP] [\-delay2 \fIusecs\fP] [\-window] [\-root] [\-install] [\-visual \fIvisual\fP]
+.SH DESCRIPTION
+The \fIslidescreen\fP program takes an image of the screen, divides it into
+a grid, deletes a random square of that grid, and then randomly slides
+one of the neighbors of this "hole" into the hole (and repeat.)
+.SH OPTIONS
+.I slidescreen
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-grid-size \fIpixels\fP
+The size of the grid cells. Default 70 pixels.
+.TP 8
+.B \-ibw \fIpixels\fP
+The size of the "gutter" between grid cells. Default 1 pixel.
+.TP 8
+.B \-increment \fIpixels\fP
+How many pixels by which a piece should be moved when sliding to a new
+location. Default 10 pixels.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How much of a delay should be introduced between steps of the animation of
+the motion of each segment. Default 50000, which is 0.05 seconds. This
+is closely related to the \fI\-increment\fP parameter.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How much of a delay should be introduced between the end of the motion of
+one segment and the beginning of the motion of another. Default 1000000,
+which is one second.
+.SH RESOURCES
+On some systems (currently, only SGIs), this program can, instead of grabbing
+a desktop image, grab a frame of video from an external camera and manipulate
+that instead. The following resources control that.
+.PP
+.TP 8
+.B grabVideoProbability \fR(Float)\fP
+What portion of the time to grab video rather than a screen image,
+between 0.0 and 1.0. Defaults to 0.5, or half the time.
+.TP 8
+.B videoDevice \fR(Integer)\fP
+The number of the default video input device to check first. If unspecified,
+the default camera (from videopanel(1)) will be checked first. After that, all
+other available video input devices will be checked in order.
+
+The first one which produces a non-black image will be used. If all images
+are black, the others will be re-checked a few times before giving up and
+falling back to simply grabbing a desktop image (but note that this takes a
+few seconds, so if you don't actually have any video sources hooked up, you
+should consider turning off video grabbing by setting
+\fBgrabVideoProbability\fP to 0.0.)
+.TP 8
+.B videoGain \fR(Float)\fP
+The amount by which to brighten the grabbed image. This defaults to 2.2.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 3-dec-92.
--- /dev/null
+.TH XScreenSaver 1 "24-Nov-97" "X Version 11"
+.SH NAME
+slip - sucks your screen into a jet engine
+.SH SYNOPSIS
+.B slip
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-iterations \fIinteger\fP] [\-points \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-delay2 \fImicroseconds\fP]
+.SH DESCRIPTION
+The \fIslip\fP program does lots of blits and chews up your screen image.
+.SH OPTIONS
+.I slip
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 128.
+The colors used cycle through the hue, making N stops around
+the color wheel.
+.TP 8
+.B \-count \fIinteger\fP
+How many whooziwhatsis to generate. Default 35.
+.TP 8
+.B \-cycles \fIinteger\fP
+How long to frobnicate. Default 50.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How long we should wait between drawing each step. Default 50000,
+or about 1/20th second.
+
+.SH RESOURCES
+On some systems (currently, only SGIs), this program can, instead of grabbing
+a desktop image, grab a frame of video from an external camera and manipulate
+that instead. The following resources control that.
+.PP
+.TP 8
+.B grabVideoProbability \fR(Float)\fP
+What portion of the time to grab video rather than a screen image,
+between 0.0 and 1.0. Defaults to 0.5, or half the time.
+.TP 8
+.B videoDevice \fR(Integer)\fP
+The number of the default video input device to check first. If unspecified,
+the default camera (from videopanel(1)) will be checked first. After that, all
+other available video input devices will be checked in order.
+
+The first one which produces a non-black image will be used. If all images
+are black, the others will be re-checked a few times before giving up and
+falling back to simply grabbing a desktop image (but note that this takes a
+few seconds, so if you don't actually have any video sources hooked up, you
+should consider turning off video grabbing by setting
+\fBgrabVideoProbability\fP to 0.0.)
+.TP 8
+.B videoGain \fR(Float)\fP
+The amount by which to brighten the grabbed image. This defaults to 2.2.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1992 by Scott Draves.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Scott Graves <spot@cs.cmu.edu>.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 18-Oct-93.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH Sonar 1 "3-Nov-98" "X Version 11"
+.SH NAME
+sonar - display a sonar scope
+.SH SYNOPSIS
+.B sonar
+[\-background \fIcolor\fP]
+[\-sweep\-color \fIcolor\fP]
+[\-low\-color \fIcolor\fP]
+[\-scope\-color \fIcolor\fP]
+[\-grid\-color \fIcolor\fP]
+[\-text\-color \fIcolor\fP]
+[\-ttl \fIinteger\fP]
+[\-mode ping]
+[\-font \fIfont\fP]
+[\-ping\-timeout \fIint\fP]
+[\-ping\-source list | file | subnet ]
+[\-ping\-file \fIhosts-file\fP]
+[\-ping\-list \fIhost-name-list\fP]
+[\-team-a-name \fIstring\fP]
+[\-team-b-name \fIstring\fP]
+[\-team-a-count \fIint\fP]
+[\-team-b-count \fIint\fP]
+.SH DESCRIPTION
+The \fIsonar\fP program displays a sonar scope on the computer's screen.
+This scope polls a sensor as the sweep goes around the scope and displays
+what it finds as bogies on the screen. The program is designed to support
+different modes representing different types of sensors. Currently the
+only implemented sensors are a simulator, and a network ping function that
+pings hosts and plots the results on the scope.
+.SH OPTIONS
+.I sonar
+understands the following options:
+.TP 8
+.B \-background \fIColor\fP
+The background Color of the screen not covered by the scope.
+.TP 8
+.B \-sweep\-color \fIColor\fP
+The color of the brightest part of the sweep.
+.TP 8
+.B \-scope\-color \fIColor\fP
+The color of the circular part of the scope.
+.TP 8
+.B \-grid\-color \fIColor\fP
+The color to the grid lines overlaying the scope.
+.TP 8
+.B \-text\-color \fIColor\fP
+The color of the text identifying bogies on the scope.
+.TP 8
+.B \-ttl \fIinteger\fP
+"Time to live": visible time of a Bogie. Try values between 10 (very short)
+and 100.
+.TP 8
+.B \-mode \fIsimulation | ping\fP
+The sensor mode to use, the currently supported modes \fIsimulate\fP (the
+default) and \fIping\fP.
+.TP 8
+.B \-font \fIfont\fP
+The font used to display text on the scope. Default "fixed".
+.TP 8
+.B \-ping\-timeout \fIint\fP
+The amount of time in milliseconds the program will wait for an answer
+to a ping.
+.TP 8
+.B \-ping\-source list | file | subnet
+Th source of the list of hosts to ping. Valid values are: \fIlist\fP,
+\fIfile\fP, \fIsubnet\fP. The first two values are described below;
+and \fIsubnet\fP indicates that the sonar should ping all hosts in the
+same subnet as the current machine. (All addresses are treated
+as class C nets, therefore this will at most ping 254 hosts.)
+.TP 8
+.B \-ping\-file \fIfilename\fP
+The path to a file listing the hosts to ping. This file can be in the
+format used by \fI/etc/hosts\fP, or it can be any file that has host
+names as the first element on each line. If you use ssh, try this:
+.EX
+sonar -mode ping -ping-file $HOME/.ssh/known_hosts
+.EE
+This is used only used when \fIpingSource\fP is set to \fBfile\fP.
+.TP 8
+.B \-ping\-list \fIlist\fP
+A comma separated list of hostnames, eg \fI"pinky,brain,dot"\fP.
+Only used when \fIpingSource\fP is set to \fBlist\fP.
+.TP 8
+.B \-team-a-name \fIstring\fP
+The name of team A, in simulation-mode.
+.TP 8
+.B \-team-b-name \fIstring\fP
+The name of team B, in simulation-mode.
+.TP 8
+.B \-team-a-count \fIint\fP
+The number of bogies on team A, in simulation-mode.
+.TP 8
+.B \-team-b-count \fIint\fP
+The number of bogies on team B, in simulation-mode.
+.SH RESOURCES
+Configuration of the targets to ping is best done by setting X Resources.
+.PP
+.TP 8
+.B background \fI(Color)\fP
+See option \-background, above; default value is \fIblack\fP.
+.TP 8
+.B sweepColor \fI(Color)\fP
+See option \-sweep\-color, above; default value is \fI#00ff00\fP.
+.TP 8
+.B scopeColor \fI(Color)\fP
+See option \-scope\-color, above; default value is \fI#003300\fP.
+.TP 8
+.B gridColor \fI(Color)\fP
+See option \-grid\-color, above; default value is \fI#00aa00\fP.
+.TP 8
+.B textColor \fI(Color)\fP
+See option \-text\-color, above; default value is \fI#ffff00\fP.
+.TP 8
+.B ttl \fI(integer)\fP
+See option \-ttl, above; default value is \fI90\fP or one sweep.
+.TP 8
+.B mode \fI(ping)\fP
+See option \-mode, above. If set to \fBdefault\fP, it will ping hosts if
+possible, otherwise, will run in simulation-mode.
+.TP 8
+.B font \fI(font)\fP
+See option \-font, above; default value is \fIfixed\fP.
+.TP 8
+.B pingTimeout \fI(Integer)\fP
+See option \-pingtimeout, above; default value is 3000.
+.TP 8
+.B pingSource \fIlist | file | subnet\fP
+See option \-ping\-source, above. Default value is \fIfile\fP.
+.TP 8
+.B pingFile \fIpathname\fP
+See option \-ping\-file, above. Default value is \fI/etc/hosts\fP.
+.TP 8
+.B pingList \fIhost,host,host...\fP
+See option \-ping\-list, above; default value is \fBlocalhost\fP.
+.TP 8
+.B teamAName \fIstring\fP
+See option \-team\-a\-name, above. Default value is \fBF18\fP.
+.TP 8
+.B teamBName \fIstring\fP
+See option \-teamBName, above. Default value is \fBMIG\fP.
+.TP 8
+.B teamACount \fIint\fP
+See option \-teamACount, above. Default value is 4.
+.TP 8
+.B teamBCount \fIint\fP
+See option \-teamBCount, above. Default value is 4.
+.SH NOTES
+In order to use the ping sensor, this program must be installed as
+setuid root, so that it can create an ICMP socket.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR ping (8)
+.SH COPYRIGHT
+Copyright \(co 1998 by Stephen Martin. (smartin@canada.com)
+
+Permission to use, copy, modify, distribute, and sell this software and its
+documentation for any purpose is hereby granted without fee, provided that
+the above copyright notice appear in all copies and that both that
+copyright notice and this permission notice appear in supporting
+documentation. No representations are made about the suitability of this
+software for any purpose. It is provided "as is" without express or
+implied warranty.
+
+.SH AUTHORS
+Stephen Martin <smartin@canada.com>, 3-nov-98.
+
+Thanks to Tom Kelly for suggesting a modular approach to the sensor
+amoung other things.
+
+Thomas Bahls <thommy@cs.tu-berlin.de> hacked the "ttl" option, 12-jul-98.
+
--- /dev/null
+.TH XScreenSaver 1 "27-May-97" "X Version 11"
+.SH NAME
+sphere - draws shaded spheres
+.SH SYNOPSIS
+.B sphere
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP]
+
+.SH DESCRIPTION
+The \fIsphere\fP program draws shaded spheres.
+.SH OPTIONS
+.I sphere
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors are chosen randomly.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1988 by Sun Microsystems, Inc.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Sun Microsystems, Inc, 1988.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 27-May-97.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+spiral - draws moving circular spiral patterns
+.SH SYNOPSIS
+.B spiral
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-count \fIinteger\fP]
+
+.SH DESCRIPTION
+The \fIspiral\fP program draws moving circular spiral patterns
+.SH OPTIONS
+.I spiral
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors are chosen randomly.
+.TP 8
+.B \-count \fIinteger\fP
+Default 40.
+.TP 8
+.B \-cycles \fIinteger\fP
+Default 350.
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1994 by Darrick Brown.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Darrick Brown, 1994.
+
+Improved by Peter Schmitzberger <schmitz@coma.sbg.ac.at>, 24-Jul-95.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.TH XScreenSaver 1 "05-Apr-1999" "X Version 11"
+.SH NAME
+spotlight - move spotlight around desktop
+.SH SYNOPSIS
+.B spotlight
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-delay \fIusecs\fP] [\-radius \fIpixels\fP]
+.SH DESCRIPTION
+The \fIspotlight\fP program draws random rectangles.
+.SH OPTIONS
+.I spotlight
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fImicroseconds\fP
+Slow it down.
+.TP 8
+.B \-radius \fIpixels\fP
+Radius of the spotlight in pixels.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1999 by Rick Schultz. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH CREDITS
+Hacked together by Rick Schultz <rick@skapunx.net>, based on StefView for
+BackSpace by Darcy Brockbank and on several other xscreensaver hacks.
+
--- /dev/null
+.TH XScreenSaver 1 "18-mar-1999" "X Version 11"
+.SH NAME
+squiral - square spirals screensaver
+.SH SYNOPSIS
+.B squiral
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP]
+[\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install]
+[\-noinstall] [\-visual \fIvisual\fP] [\-fill \fIpercent\fP] [-count
+\fInumber\fP] [-delay \fIusec\fP] [-disorder \fIfraction\fP] [-handedness
+\fIfraction\fP] [-cycle]
+.SH DESCRIPTION
+The \fIsquiral\fP program displays interacting, spiral-producing automata
+
+.SH OPTIONS
+.I squiral
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-fill \fIpercent\fP
+Specify the percent (0-100) of the screen which must be filled before
+the screen is cleared. 60-80 percent are good values.
+.TP 8
+.B \-count \fInumber\fP
+The number of squiralies. By default, the screen width divided by 32.
+.TP 8
+.B \-delay \fIusec\fP
+The wait between steps. The default is 1000.
+.TP 8
+.B \-disorder \fIfraction\fP
+The fraction of the time a squiraly will choose a new direction.
+The default is 0.005.
+.TP 8
+.B \-handedness \fIfraction\fP
+The fraction of the time a squiraly will choose to enter lefthanded
+mode. 0.0 means exclusively right-handed behavior, 0.5 (the default) is
+a balance between the two, and 1.0 is exclusively left-handed behaviour.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH BUGS
+None known
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1999, by Jeff Epler. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided fnord that the above copyright notice
+appear in all copies and that both that copyright notice and this permission
+notice appear in supporting documentation. No representations are made about
+the suitability of fnord this software for any purpose. It is provided "as
+is" without express or fnord implied warranty.
+.SH AUTHOR
+Jeff Epler <jepler@inetnebr.com>, 18-mar-1999
+
--- /dev/null
+.TH XScreenSaver 1 "14-Jun-97" "X Version 11"
+.SH NAME
+starfish - radially-symmetric throbbing colormap-hacking graphics demo
+.SH SYNOPSIS
+.B starfish
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-delay \fIusecs\fP] [\-delay2 \fIsecs\fP] [\-cycle\-delay2 \fIusecs\fP] [\-thickness \fIpixels\fP] [\-rotation \fIdegrees\fP] [\-duration \fIseconds\fP] [\-colors \fIint\fP] [\-cycle] [\-no\-cycle] [\-blob] [\-no\-blob]
+.SH DESCRIPTION
+The \fIstarfish\fP program draws radially symmetric objects, which expand,
+contract, rotate, and turn inside out. It uses these shapes to lay down a
+field of smooth colors, and then rotates the colormap.
+.SH OPTIONS
+.I starfish
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-delay \fImicroseconds\fP
+How much of a delay should be introduced between steps of the animation.
+Default 10000, or about 1/100th second.
+.TP 8
+.B \-cycle\-delay \fImicroseconds\fP
+How long to wait between shifing the colormap by one step.
+Default 100000, or about 1/10th second.
+.TP 8
+.B \-thickness \fIpixels\fP
+How wide each color band should be. Default 0, meaning random (the chosen
+value will be between 0 and 15.)
+.TP 8
+.B \-rotation \fIdegrees\fP
+How quickly the objects should rotate at each step. Default 0, meaning
+random (the chosen value will be between 0 and 12 degrees.)
+.TP 8
+.B \-colors \fIint\fP
+How many colors to use. Default 200. The more colors, the smoother the
+transitions will be, and the nicer the resultant images.
+.TP 8
+.B \-cycle
+.TP 8
+.B \-no\-cycle
+Whether to do colormap cycling. Default true.
+.TP 8
+.B \-duration \fIseconds\fP
+How long to run before choosing a new shape. Default 30 seconds.
+.TP 8
+.B \-delay2 \fIseconds\fP
+When \fIduration\fP expires, how long to wait before starting a new run.
+Default 5 seconds.
+.TP 8
+.B \-blob
+.TP 8
+.B \-no\-blob
+If \fIblob\fP option is specified, then the raw shapes will be shown,
+instead of a field of colors generated from them.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 14-Jun-97.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+strange - draws strange attractors
+.SH SYNOPSIS
+.B strange
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP]
+
+.SH DESCRIPTION
+The \fIstrange\fP program draws strange attractors
+.SH OPTIONS
+.I strange
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 64.
+The colors are chosen randomly.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Massimino Pascal.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Massimino Pascal <Pascal.Massimon@ens.fr>, 1997.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.TH XScreenSaver 1 "13-May-97" "X Version 11"
+.SH NAME
+swirl - draws swirly color-cycling patterns
+.SH SYNOPSIS
+.B swirl
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP]
+
+.SH DESCRIPTION
+The \fIswirl\fP program draws swirly color-cycling patterns.
+.SH OPTIONS
+.I swirl
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 200.
+.TP 8
+.B \-cycles \fIinteger\fP
+
+.TP 8
+.B \-count \fIinteger\fP
+
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1994 M. Dobie.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+
+.SH AUTHOR
+M.Dobie <mrd@ecs.soton.ac.uk>, 1994.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 13-May-97.
--- /dev/null
+.TH t3d 1 "Version 1.1" "Time 3D"
+.SH NAME
+t3d \- clock using flying balls to display the time
+.SH SYNOPSIS
+t3d [ \f2 options\f1 ]...
+.SH DESCRIPTION
+.PP
+Time 3D is a clock. It uses flying balls to display the time. This
+balls move and wobble around to give you the impression your
+graphic workstation with its many XStones is doing something.
+.PP
+t3d uses mouse and keyboard to let you fly through the balls. Hit
+.B S
+to speed up,
+.B A
+to slow down,
+.B Z
+to zoom in and
+.B X
+to zoom out.
+Use the
+.B left mouse button
+to rotate to the left and the
+.B right mouse button
+to rotate the view to the right. Use the
+.B middle mouse button
+to change the optical axis and the moving direction.
+.B 0
+(zero) will stop you.
+.B Q
+quits.
+.PP
+.SH OPTIONS
+.TP
+.BI "-move " "factor"
+Modifies the direction move of t3d. The clock looks 30 degrees*
+.I factor
+to the left and to the right periodically.
+.TP
+.BI "-wobble " "factor"
+Modifies the wobbling (sounds nice :-) of t3d by multiplying the
+default deformation of the clock with
+.I factor.
+.TP
+.B -minutes
+Shows one small ball for every minute, instead of one for every 2.5 minutes.
+.TP
+.BI "-mag " "factor"
+Changes the magnification of t3d. By default, t3d draws a 200x200 image.
+A .I factor
+of 2 means, it will use a 400x400 image.
+.TP
+.BI "-cycle " "period"
+Sets the moving cycle to
+.I period
+seconds. By default, this value is 10 seconds.
+.TP
+.BI "-wait " "microsec"
+Inserts a wait after drawing one view of the clock. By default, t3d waits
+40 ms after each drawing. This helps you to keep the performance loss
+small.
+.TP
+.BI "-fast " "precalc_radius"
+t3d uses bitmap copy to draw precalculated balls. You can specify the radius
+in pixels up to which t3d should precalculate balls. t3d will set a useful
+range by itself using the magnification when it is started.
+.TP
+.B -colcycle
+Draws cyclic the color scale used for the balls in the background instead
+of the normal black.
+.TP
+.BI "-rgb " "red green blue"
+Selects the color in RGB color space of the lightning spot on the balls.
+All the other colors used for balls or
+.B -colcycle
+are less intensive colors of the same hue and saturation. All values
+in range of 0 to 1.
+.TP
+.BI "-hsv " "hue saturation value"
+Selects the color in HSV color space.
+.I hue
+is in degrees from 0 to 360, all other values in range from 0 to 1. It gives
+nice but rather unpredictable results, if you use a saturation of e.g. 2.
+Try it at your own risk.
+.TP
+.BI "-hsvcycle " "speed"
+Rotates the hue axis every 10 seconds*
+.I speed.
+.TP
+.B -help
+Prints a short usage message.
+
+.PP
+.SH AUTHOR
+.PP
+Bernd Paysan
+
+Email: bernd.paysan@gmx.de
+
+Hacked on by jwz@jwz.org for xscreensaver.
+
+.SH ACKNOWLEDGEMENT
+.PP
+Acknowledgement to Georg Acher, who wrote the initial program displaying
+balls.
+
+.SH COPYING
+.PP
+Copy, modify, and distribute T3D either under GPL version 2 or newer, or
+under the standard MIT/X license notice.
+
+.SH DISCLAIMER
+.PP
+T3D is not related to T3D(tm), the massive parallel Alpha--based
+supercomputer from Cray Research. T3D's name was invented in 1991,
+years before the project at Cray Research started. There is no
+relation from T3D to Cray's T3D, even the balls surrounding T3D on
+some posters weren't an inspiration for T3D. I don't know anything
+about the other way round.
+
+The programming style of T3D isn't intented as example of good style,
+but as example of how a fast prototyped demo may look like. T3D wasn't
+created to be useful, it was created to be nice.
+
+.SH KNOWN BUGS
+.PP
+There are no known bugs in T3D. Maybe there are bugs in X. Slight
+changes in the T3D sources are known to show these bugs, e.g. if
+you remove the (int) casting at the XFillArc x,y,w,h-coordinates...
--- /dev/null
+.TH XScreenSaver 1 "17-Jun-99" "X Version 11"
+.SH NAME
+vidwhacker - grab images and apply random filters to them
+.SH SYNOPSIS
+.B vidwhacker
+[\-display \fIhost:display.screen\fP] [\-root] [\-window] [\-verbose] [\-stdin] [\-stdout] [\-delay seconds]
+.SH DESCRIPTION
+The \fIvidwhacker\fP program grabs a image from the system's video input,
+applies random image filters to it, and displays the result.
+The \fIvidwhacker\fP program does not terminate until killed.
+It depends heavily on
+.BR xv (1)
+and the various PBM tools
+(e.g.,
+.BR ppmrelief (1).)
+.SH OPTIONS
+.I vidwhacker
+accepts the following options:
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-window
+Pop up a new window displaying the image. When a new image has been fully
+processed, destroy that window and pop up a new one. This is the default.
+.TP 8
+.B \-verbose
+Print diagnostics.
+.TP 8
+.B \-stdin
+Instead of grabbing an image from the system's video input, read an image
+to maniupulate from stdin. This image must be in
+.TP 8
+.B \-delay \fIseconds\fP
+How long to sleep between images. Default 3 seconds (the actual
+elapsed time is significantly longer, due to processing time.)
+.BR ppm (5)
+format. The program will still perform repeated random image
+transformations, but it will always use this one image as its starting point.
+.TP 8
+.B \-stdout
+Instead of displaying the image on a window or on the root, write the new
+image on stdout, and exit.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH BUGS
+Grabbing video images is, of course, very system-dependent. It works
+on SGIs, and on Linux systems that have the
+.BR qcam (1)
+program. If your system does things differently, you'll need to edit
+the vidwhacker script (look for the \fIgrab()\fP function.)
+
+It's slow.
+.SH TO DO
+It might be interesting to rewrite this to use
+.BR gimp (1)
+plugins instead of the pbm tools. It probably wouldn't be any faster,
+but there would be a wider variety of effects available.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xv (1),
+.BR ppmtogif (1),
+.BR cjpeg (1)
+.SH COPYRIGHT
+Copyright \(co 1998, 1999 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 18-Jan-98.
--- /dev/null
+.TH XScreenSaver 1 "10-May-97" "X Version 11"
+.SH NAME
+vines - draws pseudo-fractal geometric patterns
+.SH SYNOPSIS
+.B vines
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP]
+
+.SH DESCRIPTION
+The \fIvines\fP program is yet another geometric pattern generator, this
+one's claim to fame being a pseudo-fractal looking vine like pattern that
+creates nifty whorls and loops.
+.SH OPTIONS
+.I vines
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 200.
+The colors are chosen randomly.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Tracy Camp.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Tracy Camp <campt@hurrah.com>, 1997.
+
+Tweaked by David Hansen <dhansen@metapath.com>, 21-Mar-97.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH XScreenSaver 1 "17-Jun-99" "X Version 11"
+.SH NAME
+webcollage - decorate the screen with random images from the web
+.SH SYNOPSIS
+.B webcollage
+[\-display \fIhost:display.screen\fP] [\-root] [\-verbose]
+[\-delay \fIsecs\fP] [\-timeout \fIsecs\fP] [\-background \fIbg\fP]
+[\-filter \fIcommand\fP] [\-filter2 \fIcommand\fP]
+.SH DESCRIPTION
+The \fIwebcollage\fP program pulls random image off of the World Wide Web
+and scatters them on the root window. It finds these images by doing
+random web searches, and extracting images from the returned pages.
+It places the images on the root window by using the
+.BR xv (1),
+.BR giftopnm (1),
+and
+.BR djpeg (1)
+tools.
+
+\fIwebcollage\fP also works as a CGI program: simply make a symbolic
+link to the \fIwebcollage\fP executable called \fInph-webcollage.cgi\fP.
+If this program sees that it is being run as a CGI, then it will behave
+appropriately. (The generated web page will list the images one after
+another, rather than tiling them together.)
+
+\fIwebcollage\fP is written in
+.BR perl (1)
+and requires Perl 5.
+.SH OPTIONS
+.I webcollage
+accepts the following options:
+.TP 8
+.B \-root
+Draw on the root window. This option is manditory: drawing to a window
+other than the root window is not yet supported.
+.TP 8
+.B \-verbose \fRor\fP \-v
+Print diagnostics to stderr. Multiple \fI-v\fP switches increase the
+amount of output. \fI-v\fP will print out only the URLs of the
+images; \fI-vv\fP will print all the commands being run; and \fI-vvv\fP
+will print more than you care about.
+.TP 8
+.B \-delay \fIseconds\fP
+How long to sleep between images. Default 1 second. (Remember that
+this program probably spends a lot of time waiting for the network.)
+.TP 8
+.B \-background \fIcolor-or-ppm\fP
+What to use for the background onto which images are pasted. This may be
+a color name, a hexadecimal RGB specification in the form '#rrggbb', or
+the name of a PPM file.
+.TP 8
+.B \-timeout \fIseconds\fP
+How long to wait for a URL to complete before giving up on it and
+moving on to the next one.
+Default 30 seconds.
+.TP 8
+.B \-filter \fIcommand\fP
+Filter all source images through this command. The command must take
+a PPM file on stdin, and write a new PPM file to stdout. One good
+choice for a filter would be:
+.EX
+webcollage -root -filter 'vidwhacker -stdin -stdout'
+.EE
+.TP 8
+.B \-filter2 \fIcommand\fP
+Filter the \fIcomposite\fP image through this command. The \fI-filter\fP
+option applies to the sub-images; the \fI-filter2\fP applies to the
+final, full-screen image.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH FILES AND URLS
+.TP
+.I /usr/dict/words \fRor\fP /usr/share/lib/dict/words
+To find the random words to feed to search engines.
+.PP
+.I http://random.yahoo.com/bin/ryl, http://image.altavista.com/
+To find random web pages.
+.SH BUGS
+When drawing on the root window, it always uses the default colormap.
+This is actually a limitation of xv. But regardless, when using this
+program with xscreensaver, it must be given the \fBdefault-n\fP
+visual specification (see the
+.BR xscreensaver (1)
+manual for more details.)
+
+Only the GIF and JPEG image formats are supported.
+
+Transparent and animating GIFs are not supported.
+
+It's slow.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xv (1),
+.BR giftopnm (1),
+.BR djpeg (1),
+.BR vidwhacker (1),
+.BR perl (1)
+.SH COPYRIGHT
+Copyright \(co 1998, 1999 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided that the above copyright notice appear
+in all copies and that both that copyright notice and this permission notice
+appear in supporting documentation. No representations are made about the
+suitability of this software for any purpose. It is provided "as is" without
+express or implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 24-May-98.
--- /dev/null
+.TH XScreenSaver 1 "18-sep-97" "X Version 11"
+.SH NAME
+xjack - all work and no play makes jack a dull boy
+.SH SYNOPSIS
+.B xjack
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-delay \fIusecs\fP]
+.SH DESCRIPTION
+All work and no play makes jack a dull boy. All work and no play makes jack
+a dull boy. All work and no play makes jack a dull boy. All work and no
+play makes jack a dull boy. All work and no play makes jack a dull boy.
+All work and no play makes jack a dull boy.
+.PP
+.RS 8
+All work and no play makes jack a dull boy. All work and no play makes jack
+a dull boy. All work and no play makes jack a dull boy. All work and no
+play makes jack a dull boy. All work and no play makes jack a dull boy.
+All work and no play makes jack a dull boy.
+.PP
+All work and no play makes jack a dull boy. All work and no play makes jack
+a dull boy. All work and no play makes jack a dull boy. All work and no
+play makes jack a dull boy. All work and no play makes jack a dull boy. All
+work and no play makes jack a dull boy. All work and no play makes jack a
+dull boy. All work and no play makes jack a dull boy.
+.PP
+.RE
+All work and no play makes jack a dull boy.
+All work and no play makes jack a dull boy. All work and no play makes jack
+a dull boy. All work and no play makes jack a dull boy. All work and no
+play makes jack a dull boy. All work and no play makes jack a dull boy.
+All work and no play makes jack a dull boy. All work and no play makes jack
+a dull boy.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+All work and no play makes jack a dull boy.
+.TP 8
+.B XENVIRONMENT
+All work and no play makes jack a dull boy. All work and no play makes jack
+a dull boy.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1997 by Jamie Zawinski. All work and no play makes jack a
+dull boy. All work and no play makes jack a dull boy. All work and no play
+makes jack a dull boy. All work and no play makes jack a dull boy. All work
+and no play makes jack a fnord dull boy. All work and no play makes jack a
+dull boy.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 15-Nov-97.
--- /dev/null
+.TH XScreenSaver 1 "28-May-97" "X Version 11"
+.SH NAME
+julia - draws spinning, animating julia-set fractals
+.SH SYNOPSIS
+.B julia
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP] [\-ncolors \fIinteger\fP] [\-delay \fImicroseconds\fP] [\-cycles \fIinteger\fP] [\-count \fIinteger\fP] [\-mouse] [\-nomouse]
+
+.SH DESCRIPTION
+The \fIjulia\fP program draws spinning, animating julia-set fractals.
+
+It uses ifs {w0 = sqrt(x-c), w1 = -sqrt(x-c)} with random iteration
+to plot the julia set, and sinusoidially varied parameters for the set,
+and plots parameters with a circle.
+
+One thing to note is that count is the \fIdepth\fP of the search tree,
+so the number of points computed is (2^count)-1. I use 8 or 9 on a
+dx266 and it looks okay. The sinusoidal variation of the parameter
+might not be as interesting as it could, but it still gives an idea
+of the effect of the parameter.
+
+.SH OPTIONS
+.I julia
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.TP 8
+.B \-ncolors \fIinteger\fP
+How many colors should be used (if possible). Default 200.
+The colors used cycle through the hue, making N stops around
+the color wheel.
+.TP 8
+.B \-cycles \fIinteger\fP
+
+.TP 8
+.B \-count \fIinteger\fP
+
+.TP 8
+.B \-mouse
+.TP 8
+.B \-nomouse
+If \fI\-mouse\fP is specified, the control point of the Julia set will
+be derived from the position of the mouse in the window. When the mouse
+is not in the window, the control point is chosen the normal way.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xlock (1)
+.SH COPYRIGHT
+Copyright \(co 1995 by Sean McCullough.
+
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation.
+.SH AUTHOR
+Sean McCullough <bankshot@mailhost.nmt.edu>, 1995.
+
+Ability to run standalone or with \fIxscreensaver\fP added by
+Jamie Zawinski <jwz@jwz.org>, 10-May-97.
--- /dev/null
+.TH XLYAP 6X
+.SH NAME
+xlyap \- display an array of Lyapunov exponents graphically
+.SH SYNOPSIS
+.in +8n
+.ti -8n
+\fIxlyap\fR
+[-BLps][-W width][-H height][-o filename][-a
+\fIn\fR ]
+[-b
+\fIn\fR ]
+[-w
+\fIn\fR ]
+[-h
+\fIn\fR ]
+[-i xstart]
+[-M
+\fIn\fR ]
+[-R
+\fIp\fR ]
+[-S
+\fIn\fR ]
+[-D
+\fIn\fR ]
+[-F string][-f string][-r
+\fIn\fR ]
+[-O
+\fIn\fR ]
+[-C
+\fIn\fR ]
+[-c
+\fIn\fR ]
+[-m
+\fIn\fR ]
+[-x xpos]
+[-y ypos]
+.in -8n
+.SH DESCRIPTION
+\fIxlyap\fR
+generates and graphically displays an array of Lyapunov exponents for a
+variety of iterated periodically forced non-linear maps of the unit interval.
+.SH OPTIONS
+.TP 8
+-random
+A good choice for use with xscreensaver: picks random parameters from
+a built-in list.
+.TP 8
+-C \fIn\fP
+Specifies the minimum color index to be used for negative exponents
+.TP
+-D \fIn\fP
+Specifies the "dwell" or number of iterations over which to average in order
+to calculate the Lyapunov exponent. Default is 400.
+.TP
+-B
+Causes the stop, go, spin and quit buttons to be displayed.
+.TP
+-H \fIn\fP
+Specifies the height of the window. Default is 256.
+.TP
+-L
+Indicates use log(x) + log(y) rather than log(xy).
+.TP
+-M \fIr\fP
+Specifies the real value to compare exponent values to for indexing into
+a color wheel. The default value is 1.0.
+.TP
+-O \fIn\fP
+Specifies the minimum color index to be used for positive exponents
+.TP
+-R \fIp\fP
+Specifies pseudo-random forcing with probability \fIp\fP of using parameter
+value 'a'.
+.TP
+-S \fIn\fP
+Specifies the "settle" or number of iterations prior to the beginning of
+the calculation of the Lyapunov exponent. Default is 200.
+.TP
+-W \fIn\fP
+Specifies the width of the window. Default is 256.
+.TP
+-a \fIr\fP
+Specifies the real value to use as the minimum parameter value of the
+horizontal axis. Default is 3.0 for the logistic map.
+.TP
+-b \fIn\fP
+Specifies the real value to use as the minimum parameter value of the
+vertical axis. Default is 3.0 for the logistic map.
+.TP
+-c \fIn\fP
+Selects one of six different color wheels to use. The default color
+wheel is a rainbow palette.
+.TP
+-F \fI10101010\fP
+Specifies the "Function" forcing function to use. The example above would
+alternate between iterating the circle and logistic maps. An argument of
+"-F 2323" would alternate between left and right logistic maps. The default
+is to only use the single specified map (see the description of -m).
+.TP
+-f \fIabbabaab\fP
+Specifies the forcing function to use. The default is to alternate between
+the "a" parameter and the "b" parameter.
+.TP
+-h \fIr\fP
+Specifies the real value to be used as the range over which the vertical
+parameter values vary. The default is 1.0.
+.TP
+-i \fIr\fP
+Specifies the real value of the initial condition to use. Default is 0.05.
+.TP
+-m \fIn\fP
+Selects between available non-linear maps of the unit interval. A value of
+0 specifies the logistic map. A value of 1, the circle map. A value of 2,
+the left-logistic. A value of 3, the right-logistic. A value of 4, the
+double-logistic. The default is 0, the logistic map.
+.TP
+-o \fIfilename\fP
+Specifies the output filename to be used. If the -o option is given, this
+file will automatically be written out at the completion of the drawing.
+If it is not specified, a default filename of lyap.out is used and only
+written if the 'f' or 'F' keys are pressed during a run. The format of the
+output file is PPM for color and PGM for monochrom. The parameters used to
+calculate the picture are included as comments at the beginning of the output
+file.
+.TP
+-p
+Switches color indices for negative and positive exponents. Generally,
+causes negative exponents to be displayed in more detail while darkening
+and narrowing the color range for positive exponents. This can be toggled
+during runtime by pressing the 'p' key.
+.TP
+-r \fIn\fP
+Specifies the maximum rgb value to be used. Default is 35000.
+.TP
+-s \fIn\fP
+Specifies the length of the color wheel spin.
+.TP
+-u
+Produces a usage message.
+.TP
+-v
+Prints out the various values to be used and exits.
+.TP
+-w \fIr\fP
+Specifies the real value to be used as the range over which the horizontal
+parameter values vary. The default is 1.0.
+.TP
+-x \fIn\fP
+Specifies the x screen coordinate of the window (default is 256).
+.TP
+-y \fIn\fP
+Specifies the y screen coordinate of the window (default is 256).
+.sp 2
+.SH NOTES
+.sp
+During display, pressing any mouse button allows you to select the area to
+be investigated with the mouse. The upper left hand corner of the desired
+area is the location of the cursor when the button is pressed. The lower
+right hand corner is specified by the cursor when the button is released.
+.sp 2
+Use of the keys
+\fIbBeEfFkKjJmnrRsSwWxXqQ\fP
+indicates:
+.sp
+.ti 10
+(<) Halve dwell value.
+.ti 10
+(>) Double dwell value.
+.ti 10
+([) Halve settle value.
+.ti 10
+(]) Double settle value.
+.ti 10
+(B or b) Toggle button display on/off
+.ti 10
+(E or e) Recalculate the indices into the color wheel using a different method
+.ti 10
+(F or f) Save current screen to ouput file (not yet implemented)
+.ti 10
+(H or h or ?) Display brief help message
+.ti 10
+(i) Decrement the interval between stripes for the striped color map.
+.ti 10
+(I) Increment the interval between stripes for the striped color map.
+.ti 10
+(K) Decrease value exponents are compared against by 0.05.
+.ti 10
+(J) Increase value exponents are compared against by 0.05.
+.ti 10
+(M) Decrease value exponents are compared against by 0.005.
+.ti 10
+(N) Increase value exponents are compared against by 0.005.
+.ti 10
+(m) Increment the map index, changing the map to be iterated.
+.ti 10
+(P or p) Toggle positive/negative exponent display.
+.ti 10
+(r) Redraw the window using previously calculated exponents.
+.ti 10
+(R) Redraw the window using the newly set dwell and/or settle values.
+.ti 10
+(S) Spin the color wheel
+.ti 10
+(s) Halve the length of the spin and spin the color wheel
+.ti 10
+(u) Go up to the window just prior to the most recent zoom.
+.ti 10
+(U) Go all the way up to the original window.
+.ti 10
+(V or v) Display values of various parameters currently in use
+.ti 10
+(W or w) Use next color map.
+.ti 10
+(X or x) Clear window
+.ti 10
+(Q or q) quit
+.sp 2
+.SH AUTHOR
+.nf
+ Ronald Joe Record
+ The Santa Cruz Operation
+ P.O. Box 1900
+ Santa Cruz, CA 95061
+ rr@sco.com
+.fi
+.sp 2
+.SH ACKNOWLEDGEMENTS
+.PP
+The algorithm was taken from the September 1991 Scientific American article
+by A. K. Dewdney who gives credit to Mario Markus of the Max Planck Institute
+for its creation. Additional information and ideas were gleaned from the
+discussion on alt.fractals involving Stephen Hall, Ed Kubaitis, Dave Platt
+and Baback Moghaddam. Assistance with colormaps and spinning color wheels
+and X was gleaned from Hiram Clawson. Rubber banding code was adapted from
+an existing Mandelbrot program written by Stacey Campbell.
+
+Viciously hacked for xscreensaver by Jamie Zawinski, 20-Nov-97.
--- /dev/null
+.TH XScreenSaver 1 "22-mar-93" "X Version 11"
+.SH NAME
+xroger - throbbing X logo, of a sort
+.SH SYNOPSIS
+.B xroger
+[\-display \fIhost:display.screen\fP] [\-foreground \fIcolor\fP] [\-background \fIcolor\fP] [\-window] [\-root] [\-mono] [\-install] [\-visual \fIvisual\fP]
+.SH DESCRIPTION
+The \fIxroger\fP program displays a replacement for the X logo with a more
+accurate Look and Feel.
+.SH OPTIONS
+.I xroger
+accepts the following options:
+.TP 8
+.B \-window
+Draw on a newly-created window. This is the default.
+.TP 8
+.B \-root
+Draw on the root window.
+.TP 8
+.B \-mono
+If on a color display, pretend we're on a monochrome display.
+.TP 8
+.B \-install
+Install a private colormap for the window.
+.TP 8
+.B \-visual \fIvisual\fP
+Specify which visual to use. Legal values are the name of a visual class,
+or the id number (decimal or hex) of a specific visual.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH BUGS
+It should also drip blood while making a horrible screeching noise.
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1)
+.SH COPYRIGHT
+Copyright \(co 1992, 1993 by Jamie Zawinski. Permission to use, copy, modify,
+distribute, and sell this software and its documentation for any purpose is
+hereby granted without fee, provided fnord that the above copyright notice
+appear in all copies and that both that copyright notice and this permission
+notice appear in supporting documentation. No representations are made about
+the suitability of fnord this software for any purpose. It is provided "as
+is" without express or fnord implied warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH XScreenSaver 1 "20-Jun-99 (3.15)" "X Version 11"
+.SH NAME
+xscreensaver-command - control a running xscreensaver process
+.SH SYNOPSIS
+.B xscreensaver-command
+[\-help] \
+[\-demo] \
+[\-prefs] \
+[\-activate] \
+[\-deactivate] \
+[\-cycle] \
+[\-next] \
+[\-prev] \
+[\-select \fIn\fP] \
+[\-exit] \
+[\-restart] \
+[\-lock] \
+[\-throttle] \
+[\-unthrottle] \
+[\-version] \
+[\-time]
+.SH DESCRIPTION
+The \fIxscreensaver\-command\fP program controls a running \fIxscreensaver\fP
+process by sending it client-messages.
+
+.BR xscreensaver (1)
+has a client-server model: the xscreensaver process is a
+daemon that runs in the background; it is controlled by other
+foreground programs such as \fIxscreensaver-command\fP and
+.BR xscreensaver\-demo (1).
+
+This program, \fIxscreensaver-command\fP, is a command-line-oriented tool; the
+.BR xscreensaver\-demo (1).
+program is a graphical tool.
+.SH OPTIONS
+.I xscreensaver-command
+accepts the following command-line options:
+.TP 8
+.B \-help
+Prints a brief summary of command-line options.
+.TP 8
+.B \-demo
+This just launches the
+.BR xscreensaver\-demo (1)
+program, in which one can experiment with the various graphics hacks
+available, and edit parameters.
+.TP 8
+.B \-demo \fP\fInumber\fP
+When the \fI\-demo\fP option is followed by an integer, it instructs
+the \fIxscreensaver\fP daemon to run that hack, and wait for the user
+to click the mouse before deactivating (i.e., mouse motion does not
+deactivate.) This is the mechanism by which
+.BR xscreensaver\-demo (1)
+communicates with the
+.BR xscreensaver (1)
+daemon. (The first hack in the list is numbered 1, not 0.)
+.TP 8
+.B \-prefs
+Like the no-argument form of \fI\-demo\fP, but brings up that program's
+Preferences panel by default.
+.TP 8
+.B \-activate
+Tell xscreensaver to turn on immediately (that is, blank the screen, as if
+the user had been idle for long enough.) The screensaver will deactivate as
+soon as there is any user activity, as usual.
+
+It is useful to run this from a menu; you may wish to run it as
+.EX
+sleep 5 ; xscreensaver-command -activate
+.EE
+to be sure that you have time to take your hand off the mouse before
+the screensaver comes on. (Because if you jiggle the mouse, xscreensaver
+will notice, and deactivate.)
+.TP 8
+.B \-deactivate
+If the screensaver is active (the screen is blanked), this command will
+deactivate it just as if there had been keyboard or mouse activity.
+If locking is enabled, then the screensaver will prompt for a password
+as usual.
+.TP 8
+.B \-cycle
+If the screensaver is active (the screen is blanked), then stop the current
+graphics demo and run a new one (chosen randomly.)
+.TP 8
+.B \-next
+This is like either \fI\-activate\fP or \fI\-cycle\fP, depending on which is
+more appropriate, except that the graphics hack that will be run is the next
+one in the list, instead of a randomly-chosen one. In other words,
+repeatedly executing -next will cause the xscreensaver process to invoke each
+graphics demo sequentially. (Though using the \fI\-demo\fP option is probably
+an easier way to accomplish that.)
+.TP 8
+.B \-prev
+This is like \fI\-next\fP, but cycles in the other direction.
+.TP 8
+.B \-select \fInumber\fP
+Like \fI\-activate\fP, but runs the \fIN\fPth element in the list of hacks.
+By knowing what is in the \fIprograms\fP list, and in what order, you can use
+this to activate the screensaver with a particular graphics demo. (The first
+element in the list is numbered 1, not 0.)
+.TP 8
+.B \-exit
+Causes the xscreensaver process to exit gracefully. This is roughly the same
+as killing the process with
+.BR kill (1),
+but it is easier, since you don't need to first figure out the pid.
+
+.B Warning:
+never use \fIkill -9\fP with \fIxscreensaver\fP while the screensaver is
+active. If you are using a virtual root window manager, that can leave
+things in an inconsistent state, and you may need to restart your window
+manager to repair the damage.
+.TP 8
+.B \-lock
+Tells the running xscreensaver process to lock the screen immediately.
+This is like \fI\-activate\fP, but forces locking as well, even if locking
+is not the default (that is, even if xscreensaver's \fIlock\fP resource is
+false, and even if the \fIlockTimeout\fP resource is non-zero.)
+
+Note that locking doesn't work unless the \fIxscreensaver\fP process is
+running as you. See
+.BR xscreensaver (1)
+for details.
+.TP 8
+.B \-throttle
+Temporarily switch to ``blank screen'' mode, and don't run any display modes
+at all, until the screensaver is next de-activated. This is useful if you're
+using a machine remotely, and you find that some display modes are using too
+much CPU.
+
+(If you want to do this \fIpermanently\fP, that is, you want the screen saver
+to only blank the screen and not run demos at all, then set the \fIprograms\fP
+resource to an empty list: See
+.BR xscreensaver (1)
+for details.)
+.TP 8
+.B \-unthrottle
+Turn `-throttle' mode off and resume normal behavior.
+.TP 8
+.B \-version
+Prints the version of xscreensaver that is currently running on the display:
+that is, the actual version number of the running xscreensaver background
+process, rather than the version number of xscreensaver-command. (To see
+the version number of \fIxscreensaver-command\fP itself, use
+the \fI\-help\fP option.)
+.TP 8
+.B \-time
+Prints the time at which the screensaver last activated or
+deactivated (roughly, how long the user has been idle or non-idle: but
+not quite, since it only tells you when the screen became blanked or
+un-blanked.)
+.TP 8
+.B \-restart
+Causes the screensaver process to exit and then restart with the same command
+line arguments as last time. Do this after you've changed the resource
+database, to cause xscreensaver to notice the changes.
+
+.B Warning:
+if you have a \fI.xscreensaver\fP file, this might not do what you
+expect. You're probably better off killing the existing
+xscreensaver (with \fIxscreensaver\-command -exit\fP) and then
+launching it again.
+
+The important point is, you need to make sure that the xscreensaver
+process is running as you. If it's not, it won't be reading the
+right \fI.xscreensaver\fP file.
+.SH DIAGNOSTICS
+If an error occurs while communicating with the \fIxscreensaver\fP daemon, or
+if the daemon reports an error, a diagnostic message will be printed to
+stderr, and \fIxscreensaver-command\fP will exit with a non-zero value. If
+the command is accepted, an indication of this will be printed to stdout, and
+the exit value will be zero.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the host and display number of the screen whose saver is
+to be manipulated.
+.TP 8
+.B PATH
+to find the executable to restart (for the \fI\-restart\fP command).
+Note that this variable is consulted in the environment of
+the \fIxscreensaver\fP process, not the \fIxscreensaver-command\fP process.
+.SH UPGRADES
+The latest version of
+.BR xscreensaver (1)
+and related tools can always be found at http://www.jwz.org/xscreensaver/
+.SH "SEE ALSO"
+.BR X (1),
+.BR xscreensaver (1)
+.BR xscreensaver\-demo (1)
+.SH COPYRIGHT
+Copyright \(co 1992, 1993, 1997, 1998, 1999
+by Jamie Zawinski. Permission to use, copy, modify, distribute, and sell
+this software and its documentation for any purpose is hereby granted without
+fee, provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in supporting
+documentation. No representations are made about the suitability of this
+software for any purpose. It is provided "as is" without express or implied
+warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+Please let me know if you find any bugs or make any improvements.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH XScreenSaver 1 "20-Jun-99 (3.15)" "X Version 11"
+.SH NAME
+xscreensaver-demo - interactively control the background xscreensaver daemon
+.SH SYNOPSIS
+.B xscreensaver\-demo
+[\-display \fIhost:display.screen\fP] [\-prefs] [\-xrm \fIresources\fP]
+.SH DESCRIPTION
+The \fIxscreensaver\-demo\fP program is a graphical front-end for
+setting the parameters used by the background
+.BR xscreensaver (1)
+daemon.
+It is essentially two things: a tool for editing the \fI~/.xscreensaver\fP
+file; and a tool for demoing the various graphics hacks that
+the \fIxscreensaver\fP daemon will launch.
+
+The main dialog box contains a scrolling list, a text field, and a number
+of buttons.
+
+Double-clicking on one of the programs in the list will run it. The screen
+will go black, and the program will run in full-screen mode, just as it would
+if the \fIxscreensaver\fP daemon had launched it. Clicking the mouse again
+will stop the demo and un-blank the screen, making the dialog box visible
+again.
+
+Single-clicking in the list will place the indicated program and its args
+in the text field to be edited. Edit the arguments and hit return to run
+the program with the parameters you have specified. This will also save
+your changes to your \fI~/.xscreensaver\fP file: so any changes you make
+in this way are persistent.
+
+If one of the lines in the scrolling list begins with the character "-",
+then that means that the program is disabled: \fIxscreensaver\fP will not
+select it to be run (though you can still try it out by clicking on it.)
+Rather than just deleting the programs you don't want to run, you might
+want to disable them in this way instead, so that you can more easily change
+your mind later.
+
+If the line begins with the name of a visual, followed by a colon, then
+that program will only be run on that kind of visual. For example, you can
+specify that a particular program should only be run if color is available,
+and another should only be run in monochrome. See the discussion of
+the \fIprograms\fP parameter in the \fIConfiguration\fP section of the
+.BR xscreensaver (1)
+manual.
+
+The buttons are:
+.TP 8
+.B Run Next
+Clicking this button will run the next program in the list after the
+currently-selected one, and will wrap around to the top when it reaches
+the bottom.
+.TP 8
+.B Run Previous
+Opposite of Run Next; at the top, it wraps around to the bottom.
+.TP 8
+.B Preferences
+This pops up a second dialog box, in which you have the option to
+interactively change most of the screensaver's operational parameters,
+such as its timeouts, and whether it should lock the screen. When you
+click OK, your chosen settings will take effect immediately, and will
+also be saved to the \fI~/.xscreensaver\fP file in your home directory,
+so that the settings will persist next time.
+.TP 8
+.B Quit
+Exits the \fIxscreensaver-demo\fP program. The background \fIxscreensaver\fP
+daemon will continue running as before.
+.P
+The Preferences dialog box lets you change the following settings.
+
+(There are more settings available, but these are the most commonly used
+ones; see the manual for
+.BR xscreensaver (1)
+for other parameters that can be set by editing the \fI~/.xscreensaver\fP
+file, or the X resource database.)
+.TP 8
+.B Saver Timeout
+After the user has been idle this long, the \fIxscreensaver\fP daemon
+will blank the screen.
+.TP 8
+.B Cycle Timeout
+After the screensaver has been running for this long, the currently
+running graphics demo will be killed, and a new one started.
+If this is 0, then the graphics demo will never be changed:
+only one demo will run until the screensaver is deactivated by user
+activity.
+.TP 8
+.B Verbose\
+Whether to print lots of debugging information.
+.TP 8
+.B Install Colormap
+Whether to install a private colormap while the screensaver is active, so
+that the graphics hacks can get as many colors as possible. (This only
+applies when the screen's default visual is being used, since non-default
+visuals get their own colormaps automatically.) This can also be overridden
+on a per-demo basis.
+.TP 8
+.B Fade Colormap
+If selected, then when the screensaver activates, the current contents
+of the screen will fade to black instead of simply winking out. This only
+works on displays with writable colormaps, that is, if the screen's default
+visual is a PseudoColor visual. A fade will also be done when
+switching graphics hacks (when the \fICycle Timeout\fP expires.)
+.TP 8
+.B Unfade Colormap
+The complement to \fIFade Colormap\fP: if selected, then when the screensaver
+deactivates, the original contents of the screen will fade in from black
+instead of appearing immediately. This only works on displays with writable
+colormaps, and when \fIFade Colormap\fP is also selected.
+.TP 8
+.B Fade Duration
+When fading or unfading are selected, this controls how long the fade will
+take.
+.TP 8
+.B Fade Ticks
+This controls how many times a second the colormap will be changed to
+effect a fade. Higher numbers yield smoother fades, but may make the
+fades take longer than the specified number of seconds, if your server
+isn't fast enough to keep up.
+.TP 8
+.B Require Password
+Whether the screen saver should lock the screen when it activates.
+.TP 8
+.B Lock Timeout
+If \fIRequire Password\fP is selected, this controls the length of
+the ``grace period'' between when the screensaver activates, and when the
+screen becomes locked. For example, if this is 0:05:00,
+and \fISaver Timeout\fP is 0:10:00, then after 10 minutes, the screen
+would blank. If there was user activity at 12 minutes, no password
+would be required to un-blank the screen. But, if there was user activity
+at 15 minutes or later (that is, \fILock Timeout\fP minutes after
+activation) then a password would be required. The default is 0, meaning
+that if locking is enabled, then a password will be required as soon as the
+screen blanks.
+.TP 8
+.B Password Timeout
+When the screensaver is prompting for a password, the prompt dialog box will
+stay on the screen for this long before giving up, and reverting to
+screen-saving mode.
+.SH COMMAND-LINE OPTIONS
+.I xscreensaver\-demo
+accepts the following command line options.
+.TP 8
+.B \-display \fIhost:display.screen\fP
+The X display to use. The \fIxscreensaver\-demo\fP program will open its
+window on that display, and also control the \fIxscreensaver\fP daemon that
+is managing that same display.
+.TP 8
+.B \-prefs
+Start up in Preferences mode: this is just like launching the program with
+no arguments, and then pressing the \fIPreferences\fP button.
+.P
+It is important that the \fIxscreensaver\fP and \fIxscreensaver\-demo\fP
+processes be running on the same machine, or at least, on two machines
+that share a file system. When \fIxscreensaver\-demo\fP writes a new version
+of the \fI~/.xscreensaver\fP file, it's important that the \fIxscreensaver\fP
+see that same file. If the two processes are seeing
+different \fI~/.xscreensaver\fP files, things will malfunction.
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number.
+.TP 8
+.B PATH
+to find the sub-programs to run. However, note that the sub-programs
+are actually launched by the \fIxscreensaver\fP daemon, not
+by \fIxscreensaver-demo\fP itself. So, what matters is what \fB$PATH\fP
+the \fIxscreensaver\fP program sees.
+.TP 8
+.B HOME
+for the directory in which to read and write the \fI.xscreensaver\fP file.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH UPGRADES
+The latest version can always be found at
+http://www.jwz.org/xscreensaver/
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver (1),
+.BR xscreensaver\-command (1)
+.SH COPYRIGHT
+Copyright \(co 1992, 1993, 1997, 1998, 1999
+by Jamie Zawinski. Permission to use, copy, modify, distribute, and sell
+this software and its documentation for any purpose is hereby granted without
+fee, provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in supporting
+documentation. No representations are made about the suitability of this
+software for any purpose. It is provided "as is" without express or implied
+warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>, 13-aug-92.
+
+Please let me know if you find any bugs or make any improvements.
--- /dev/null
+.de EX \"Begin example
+.ne 5
+.if n .sp 1
+.if t .sp .5
+.nf
+.in +.5i
+..
+.de EE
+.fi
+.in -.5i
+.if n .sp 1
+.if t .sp .5
+..
+.TH XScreenSaver 1 "20-Jun-99 (3.15)" "X Version 11"
+.SH NAME
+xscreensaver - graphics hack and screen locker, launched when the user is idle
+.SH SYNOPSIS
+.B xscreensaver
+[\-display \fIhost:display.screen\fP] \
+[\-timeout \fIint\fP] \
+[\-cycle \fIint\fP] \
+[\-lock\-mode] \
+[\-no\-lock\-mode] \
+[\-lock\-timeout \fIint\fP] \
+[\-visual \fIvisual\fP] \
+[\-install] \
+[\-no\-install] \
+[\-verbose] \
+[\-silent] \
+[\-timestamp] \
+[\-capture\-stderr] \
+[\-no\-capture\-stderr] \
+[\-splash] \
+[\-no\-splash] \
+[\-nice \fIint\fP] \
+[\-mit\-extension] \
+[\-no\-mit\-extension] \
+[\-sgi\-extension] \
+[\-no\-sgi\-extension] \
+[\-xidle\-extension] \
+[\-no\-xidle\-extension] \
+[\-proc\-interrupts] \
+[\-no\-proc\-interrupts] \
+[\-xrm \fIresources\fP]
+.SH DESCRIPTION
+The \fIxscreensaver\fP program waits until the keyboard and mouse have been
+idle for a period, and then runs a graphics demo chosen at random. It
+turns off as soon as there is any mouse or keyboard activity.
+
+This program can lock your terminal in order to prevent others from using it,
+though its default mode of operation is merely to display pretty pictures on
+your screen when it is not in use.
+
+The benefit that this program has over the combination of the
+.BR xlock (1)
+and
+.BR xautolock (1)
+programs is the ease with which new graphics hacks can be installed. You
+don't need to recompile (or even re-run) this program to add a new display
+mode.
+.SH GETTING STARTED
+For the impatient, try this:
+.EX
+xscreensaver &
+xscreensaver-demo
+.EE
+The
+.BR xscreensaver-demo (1)
+program should pop up a dialog box that lets you experiment with the
+xscreensaver settings and graphics modes.
+
+.B Note:
+unlike
+.BR xlock (1),
+xscreensaver has a client-server model: the \fIxscreensaver\fP program is a
+daemon that runs in the background; it is controlled by the foreground
+.BR xscreensaver-demo (1)
+and
+.BR xscreensaver-command (1)
+programs.
+.SH CONFIGURATION
+Options to \fIxscreensaver\fP are specified in one of two places: in
+a \fI.xscreensaver\fP file in your home directory; or in the X resource
+database. If the \fI.xscreensaver\fP file exists, it overrides any settings
+in the resource database.
+
+The syntax of the \fI.xscreensaver\fP file is similar to that of
+the \fI.Xdefaults\fP file; for example, to set the \fItimeout\fP paramter
+in the \fI.xscreensaver\fP file, you would write the following:
+.EX
+timeout: 5
+.EE
+whereas, in the \fI.Xdefaults\fP file, you would write
+.EX
+xscreensaver.timeout: 5
+.EE
+If you change a setting in the \fI.xscreensaver\fP file while xscreensaver
+is already running, it will notice this, and reload the file. (The file will
+be reloaded the next time the screen saver needs to take some action, such as
+blanking or unblanking the screen, or picking a new graphics mode.)
+
+If you change a setting in your X resource database, or if you want
+xscreensaver to notice your changes immediately instead of the next time
+it wakes up, then you will need to tell the running xscreensaver process
+to re-initialize itself, like so:
+.EX
+xscreensaver-command -restart
+.EE
+Note that if you changed the \fI.Xdefaults\fP file, you might also need to run
+.BR xrdb (1):
+.EX
+xrdb < ~/.Xdefaults
+.EE
+If you want to set the system-wide defaults, then make your edits to
+the xscreensaver app-defaults file, which should have been installed
+when xscreensaver itself was installed. The app-defaults file will
+usually be named /usr/lib/X11/app-defaults/XScreenSaver, but different
+systems might keep it in a different place (for example,
+/usr/openwin/lib/app-defaults/XScreenSaver on Solaris.)
+
+When settings are changed in the Preferences dialog box (see above)
+the current settings will be written to the \fI.xscreensaver\fP file.
+(The \fI.Xdefaults\fP file and the app-defaults file will never be
+written by xscreensaver itself.)
+.PP
+.TP 8
+.B timeout\fP (class \fBTime\fP)
+The screensaver will activate (blank the screen) after the keyboard and
+mouse have been idle for this many minutes. Default 10 minutes.
+.TP 8
+.B cycle\fP (class \fBTime\fP)
+After the screensaver has been running for this many minutes, the currently
+running graphics-hack sub-process will be killed (with \fBSIGTERM\fP), and a
+new one started. If this is 0, then the graphics hack will never be changed:
+only one demo will run until the screensaver is deactivated by user activity.
+Default 10 minutes.
+.TP 8
+.B lock\fP (class \fBBoolean\fP)
+Enable locking: before the screensaver will turn off, it will require you
+to type the password of the logged-in user (really, the person who ran
+xscreensaver), or the root password. (\fBNote:\fP this doesn't work if the
+screensaver is launched by
+.BR xdm (1)
+because it can't know the user-id of the logged-in user. See
+the ``\fIUsing XDM(1)\fP'' section, below.
+.TP 8
+.B lockTimeout\fP (class \fBTime\fP)
+If locking is enabled, this controls the length of the ``grace period''
+between when the screensaver activates, and when the screen becomes locked.
+For example, if this is 5, and \fI\-timeout\fP is 10, then after 10 minutes,
+the screen would blank. If there was user activity at 12 minutes, no password
+would be required to un-blank the screen. But, if there was user activity
+at 15 minutes or later (that is, \fI\-lock\-timeout\fP minutes after
+activation) then a password would be required. The default is 0, meaning
+that if locking is enabled, then a password will be required as soon as the
+screen blanks.
+.TP 8
+.B passwdTimeout\fP (class \fBTime\fP)
+If the screen is locked, then this is how many seconds the password dialog box
+should be left on the screen before giving up (default 30 seconds.) This
+should not be too large: the X server is grabbed for the duration that the
+password dialog box is up (for security purposes) and leaving the server
+grabbed for too long can cause problems.
+.TP 8
+.B visualID\fP (class \fBVisualID\fP)
+Specify which X visual to use by default. (Note carefully that this resource
+is called \fBvisualID\fP, not merely \fBvisual\fP; if you set the \fBvisual\fP
+resource instead, things will malfunction in obscure ways for obscure reasons.)
+
+Legal values for the \fBVisualID\fP resource are:
+.RS 8
+.TP 8
+.B default
+Use the screen's default visual (the visual of the root window.)
+This is the default.
+.TP 8
+.B best
+Use the visual which supports the most colors. Note, however, that the
+visual with the most colors might be a TrueColor visual, which does not
+support colormap animation. Some programs have more interesting behavior
+when run on PseudoColor visuals than on TrueColor.
+.TP 8
+.B mono
+Use a monochrome visual, if there is one.
+.TP 8
+.B gray
+Use a grayscale or staticgray visual, if there is one and it has more than
+one plane (that is, it's not monochrome.)
+.TP 8
+.B color
+Use the best of the color visuals, if there are any.
+.TP 8
+.B GL
+Use the visual that is best for OpenGL programs. (OpenGL programs have
+somewhat different requirements than other X programs.)
+.TP 8
+.I class
+where \fIclass\fP is one of \fBStaticGray\fP, \fBStaticColor\fP,
+\fBTrueColor\fP, \fBGrayScale\fP, \fBPseudoColor\fP, or \fBDirectColor\fP.
+Selects the deepest visual of the given class.
+.TP 8
+.I number
+where \fInumber\fP (decimal or hex) is interpreted as a visual id number,
+as reported by the
+.BR xdpyinfo (1)
+program; in this way you can have finer control over exactly which visual
+gets used, for example, to select a shallower one than would otherwise
+have been chosen.
+
+.RE
+.RS 8
+Note that this option specifies only the \fIdefault\fP visual that will
+be used: the visual used may be overridden on a program-by-program basis.
+See the description of the \fBprograms\fP resource, below.
+.RE
+.TP 8
+.B installColormap\fP (class \fBBoolean\fP)
+Install a private colormap while the screensaver is active, so that the
+graphics hacks can get as many colors as possible. This is the
+default. (This only applies when the screen's default visual is being
+used, since non-default visuals get their own colormaps automatically.)
+This can also be overridden on a per-hack basis: see the discussion of
+the \fBdefault\-n\fP name in the section about the \fBprograms\fP resource.
+.TP 8
+.B verbose\fP (class \fBBoolean\fP)
+Whether to print diagnostics. Default false.
+.TP 8
+.B timestamp\fP (class \fBBoolean\fP)
+Whether to print the time of day along with any other diagnostic messages.
+Default false.
+.TP 8
+.B splash\fP (class \fBBoolean\fP)
+Whether to display a splash screen at startup. Default true.
+.TP 8
+.B splashDuration\fP (class \fBTime\fP)
+How long the splash screen should remain visible; default 5 seconds.
+.TP 8
+.B helpURL\fP (class \fBURL\fP)
+The splash screen has a \fIHelp\fP button on it. When you press it, it will
+display the web page indicated here in your web browser.
+.TP 8
+.B loadURL\fP (class \fBLoadURL\fP)
+This is the shell command used to load a URL into your web browser.
+The default setting will load it into Netscape if it is already running,
+otherwise, will launch a new Netscape looking at the \fIhelpURL\fP.
+.TP 8
+.B demoCommand\fP (class \fBDemoCommand\fP)
+This is the shell command run when the \fIDemo\fP button on the splash window
+is pressed. It defaults to \fIxscreensaver\-demo\fP.
+.TP 8
+.B prefsCommand\fP (class \fBPrefsCommand\fP)
+This is the shell command run when the \fIPrefs\fP button on the splash window
+is pressed. It defaults to \fIxscreensaver\-demo\ \-prefs\fP.
+.TP 8
+.B nice\fP (class \fBNice\fP)
+The sub-processes created by \fIxscreensaver\fP will be ``niced'' to this
+level, so that they are given lower priority than other processes on the
+system, and don't increase the load unnecessarily. The default is 10.
+
+(Higher numbers mean lower priority; see
+.BR nice (1)
+for details.)
+.TP 8
+.B fade\fP (class \fBBoolean\fP)
+If this is true, then when the screensaver activates, the current contents
+of the screen will fade to black instead of simply winking out. This only
+works on displays with writable colormaps, that is, if the screen's default
+visual is a PseudoColor visual. A fade will also be done when
+switching graphics hacks (when the \fIcycle\fP timer expires.)
+Default: true.
+.TP 8
+.B unfade\fP (class \fBBoolean\fP)
+If this is true, then when the screensaver deactivates, the original contents
+of the screen will fade in from black instead of appearing immediately. This
+only works on displays with writable colormaps, and if \fIfade\fP is true
+as well. Default false.
+.TP 8
+.B fadeSeconds\fP (class \fBTime\fP)
+If \fIfade\fP is true, this is how long the fade will be in
+seconds (default 3 seconds.)
+.TP 8
+.B fadeTicks\fP (class \fBInteger\fP)
+If \fIfade\fP is true, this is how many times a second the colormap will
+be changed to effect a fade. Higher numbers yield smoother fades, but
+may make the fades take longer than the specified \fIfadeSeconds\fP if
+your server isn't fast enough to keep up. Default 20.
+.TP 8
+.B captureStderr\fP (class \fBBoolean\fP)
+Whether \fIxscreensaver\fP should redirect its stdout and stderr streams to
+the window itself. Since its nature is to take over the screen, you would not
+normally see error messages generated by xscreensaver or the sub-programs it
+runs; this resource will cause the output of all relevant programs to be
+drawn on the screensaver window itself, as well as being written to the
+controlling terminal of the screensaver driver process. Default true.
+.TP 8
+.B font\fP (class \fBFont\fP)
+The font used for the stdout/stderr text, if \fBcaptureStderr\fP is true.
+Default \fB*\-medium\-r\-*\-140\-*\-m\-*\fP (a 14 point fixed-width font.)
+.TP 8
+.B programs\fP (class \fBPrograms\fP)
+The graphics hacks which \fIxscreensaver\fP runs when the user is idle.
+The value of this resource is a string, one \fIsh\fP-syntax command per line.
+Each line must contain exactly one command: no semicolons, no ampersands.
+
+When the screensaver starts up, one of these is selected at random, and
+run. After the \fIcycle\fP period expires, it is killed, and another
+is selected and run.
+
+If the value of this resource is empty, then no programs will be run; the
+screen will simply be made black.
+
+If the display has multiple screens, then a different program will be run
+for each screen. (All screens are blanked and unblanked simultaniously.)
+
+Note that you must escape the newlines; here is an example of how you
+might set this in your \fI~/.xscreensaver\fP file:
+
+.RS 8
+.EX
+programs: \\
+ qix -root \\n\\
+ ico -r -faces -sleep 1 -obj ico \\n\\
+ xdaliclock -builtin2 -root \\n\\
+ xv -root -rmode 5 image.gif -quit \\n
+.EE
+.RE
+.RS 8
+Make sure your \fB$PATH\fP environment variable is set up correctly
+\fIbefore\fP xscreensaver is launched, or it won't be able to find the
+programs listed in the \fIprograms\fP resource.
+
+To use a program as a screensaver, two things are required: that that
+program draw on the root window (or be able to be configured to draw on
+the root window); and that that program understand ``virtual root''
+windows, as used by virtual window managers such as
+.BR tvtwm (1).
+(Generally, this is accomplished by just including the \fI"vroot.h"\fP
+header file in the program's source.)
+
+If there are some programs that you want to run only when using a color
+display, and others that you want to run only when using a monochrome
+display, you can specify that like this:
+.EX
+ mono: mono-program -root \\n\\
+ color: color-program -root \\n\\
+.EE
+.RE
+.RS 8
+More generally, you can specify the kind of visual that should be used for
+the window on which the program will be drawing. For example, if one
+program works best if it has a colormap, but another works best if it has
+a 24-bit visual, both can be accommodated:
+.EX
+ PseudoColor: cmap-program -root \\n\\
+ TrueColor: 24bit-program -root \\n\\
+.EE
+.RE
+.RS 8
+In addition to the symbolic visual names described above (in the discussion
+of the \fIvisualID\fP resource) one other visual name is supported in
+the \fIprograms\fP list:
+.RS 1
+.TP 4
+.B default-n
+This is like \fBdefault\fP, but also requests the use of the default colormap,
+instead of a private colormap. (That is, it behaves as if
+the \fI\-no\-install\fP command-line option was specified, but only for
+this particular hack.) This is provided because some third-party programs
+that draw on the root window (notably:
+.BR xv (1),
+and
+.BR xearth (1))
+make assumptions about the visual and colormap of the root window:
+assumptions which xscreensaver can violate.
+
+.RE
+If you specify a particular visual for a program, and that visual does not
+exist on the screen, then that program will not be chosen to run. This
+means that on displays with multiple screens of different depths, you can
+arrange for appropriate hacks to be run on each. For example, if one screen
+is color and the other is monochrome, hacks that look good in mono can be
+run on one, and hacks that only look good in color will show up on the other.
+.RE
+.PP
+.PP
+Normally you won't need to change the following resources:
+.PP
+.TP 8
+.B pointerPollTime\fP (class \fBTime\fP)
+When server extensions are not in use, this controls how
+frequently \fIxscreensaver\fP checks to see if the mouse position or buttons
+have changed. Default 5 seconds.
+.TP 8
+.B windowCreationTimeout\fP (class \fBTime\fP)
+When server extensions are not in use, this controls the delay between when
+windows are created and when \fIxscreensaver\fP selects events on them.
+Default 30 seconds.
+.TP 8
+.B initialDelay\fP (class \fBTime\fP)
+When server extensions are not in use, \fIxscreensaver\fP will wait this many
+seconds before selecting events on existing windows, under the assumption that
+\fIxscreensaver\fP is started during your login procedure, and the window
+state may be in flux. Default 0. (This used to default to 30, but that was
+back in the days when slow machines and X terminals were more common...)
+.TP 8
+.B sgiSaverExtension\fP (class \fBBoolean\fP)
+There are a number of different X server extensions which can make
+xscreensaver's job easier. The next few resources specify whether these
+extensions should be utilized if they are available.
+
+This resource controls whether the SGI \fBSCREEN_SAVER\fP server extension
+will be used to decide whether the user is idle. This is the default
+if \fIxscreensaver\fP has been compiled with support for this
+extension (which is the default on SGI systems.). If it is available,
+the \fBSCREEN_SAVER\fP method is faster and more reliable than what will
+be done otherwise, so use it if you can. (This extension is only available
+on Silicon Graphics systems, unfortunately.)
+.TP 8
+.B mitSaverExtension\fP (class \fBBoolean\fP)
+This resource controls whether the \fBMIT\-SCREEN\-SAVER\fP server extension
+will be used to decide whether the user is idle. However, the default for
+this resource is \fIfalse\fP, because even if this extension is available,
+it is flaky (and it also makes the \fBfade\fP option not work properly.)
+Use of this extension is not recommended.
+.TP 8
+.B xidleExtension\fP (class \fBBoolean\fP)
+This resource controls whether the \fBXIDLE\fP server extension will be
+used to decide whether the user is idle. This is the default
+if \fIxscreensaver\fP has been compiled with support for this extension.
+(This extension is only available for X11R4 and X11R5 systems, unfortunately.)
+.TP 8
+.B procInterrupts\fP (class \fBBoolean\fP)
+This resource controls whether the \fB/proc/interrupts\fP file should be
+consulted to decide whether the user is idle. This is the default
+if \fIxscreensaver\fP has been compiled on a system which supports this
+mechanism (i.e., Linux systems.)
+
+The benefit to doing this is that \fIxscreensaver\fP can note that the user
+is active even when the X console is not the active one: if the user is
+typing in another virtual console, xscreensaver will notice that and will
+fail to activate. For example, if you're playing Quake in VGA-mode,
+xscreensaver won't wake up in the middle of your game and start competing
+for CPU.
+
+The drawback to doing this is that perhaps you \fIreally do\fP want idleness
+on the X console to cause the X display to lock, even if there is activity
+on other virtual consoles. If you want that, then set this option to False.
+(Or just lock the X console manually.)
+
+The default value for this resource is True, on systems where it works.
+.TP 8
+.B overlayStderr\fP (class \fBBoolean\fP)
+If \fBcaptureStderr\fP is True, and your server supports ``overlay'' visuals,
+then the text will be written into one of the higher layers instead of into
+the same layer as the running screenhack. Set this to False to disable
+that (though you shouldn't need to.)
+.TP 8
+.B overlayTextForeground\fP (class \fBForeground\fP)
+The foreground color used for the stdout/stderr text, if \fBcaptureStderr\fP
+is true. Default: Yellow.
+.TP 8
+.B overlayTextBackground\fP (class \fBBackground\fP)
+The background color used for the stdout/stderr text, if \fBcaptureStderr\fP
+is true. Default: Black.
+.TP 8
+.B bourneShell\fP (class \fBBourneShell\fP)
+The pathname of the shell that \fIxscreensaver\fP uses to start subprocesses.
+This must be whatever your local variant of \fB/bin/sh\fP is: in particular,
+it must not be \fBcsh\fP.
+.SH COMMAND-LINE OPTIONS
+.I xscreensaver
+also accepts the following command line options. Except for
+the \fI\-display\fP option, these command-line options are all
+simply shorthand for the X resources described in
+the \fIConfiguration\fP section, above.
+.TP 8
+.B \-display \fIhost:display.screen\fP
+The X display to use. For displays with multiple screens, XScreenSaver
+will manage all screens on the display simultaniously; the \fIscreen\fP
+argument (the ``default'' screen) says which screen should be used for
+dialog boxes (the password window, \fIDemo Mode\fP, etc.)
+.TP 8
+.B \-timeout \fIminutes\fP
+Same as the \fItimeout\fP resource.
+.TP 8
+.B \-cycle \fIminutes\fP
+Same as the \fIcycle\fP resource.
+.TP 8
+.B \-lock\-mode
+Same as setting the \fIlock\fP resource to \fItrue\fP.
+.TP 8
+.B \-no\-lock\-mode
+Same as setting the \fIlock\fP resource to \fIfalse\fP.
+.TP 8
+.B \-lock\-timeout \fIminutes\fP
+Same as the \fIlockTimeout\fP resource.
+.TP 8
+.B \-visual \fIvisual\fP
+Same as the \fIvisualID\fP resource.
+.TP 8
+.B \-install
+Same as setting the \fIinstallColormap\fP resource to \fItrue\fP.
+.TP 8
+.B \-no\-install
+Same as setting the \fIinstallColormap\fP resource to \fIfalse\fP.
+.TP 8
+.B \-verbose
+Same as setting the \fIverbose\fP resource to \fItrue\fP.
+.TP 8
+.B \-silent
+Same as setting the \fIverbose\fP resource to \fIfalse\fP.
+.TP 8
+.B \-timestamp
+Same as setting the \fItimestamp\fP resource to \fItrue\fP.
+.TP 8
+.B \-capture\-stderr
+Same as setting the \fIcaptureStderr\fP resource to \fItrue\fP.
+.TP 8
+.B \-no\-capture\-stderr
+Same as setting the \fIcaptureStderr\fP resource to \fIfalse\fP.
+.TP 8
+.B \-splash
+Same as setting the \fIsplash\fP resource to \fItrue\fP.
+.TP 8
+.B \-no\-splash
+Same as setting the \fIsplash\fP resource to \fIfalse\fP.
+.TP 8
+.B \-nice \fIinteger\fP
+Same as the \fInice\fP resource.
+.TP 8
+.B \-sgi\-extension
+Same as setting the \fIsgiSaverExtension\fP resource to \fItrue\fP.
+.TP 8
+.B \-no\-sgi\-extension
+Same as setting the \fIsgiSaverExtension\fP resource to \fIfalse\fP.
+.TP 8
+.B \-mit\-extension
+Same as setting the \fImitSaverExtension\fP resource to \fItrue\fP.
+.TP 8
+.B \-no\-mit\-extension
+Same as setting the \fImitSaverExtension\fP resource to \fIfalse\fP.
+.TP 8
+.B \-xidle\-extension
+Same as setting the \fIxidleExtension\fP resource to \fItrue\fP.
+.TP 8
+.B \-no\-xidle\-extension
+Same as setting the \fIxidleExtension\fP resource to \fIfalse\fP.
+.TP 8
+.B \-proc\-interrupts
+Same as setting the \fIprocInterrupts\fP resource to \fItrue\fP.
+.TP 8
+.B \-no\-proc\-interrupts
+Same as setting the \fIprocInterrupts\fP resource to \fIfalse\fP.
+.TP 8
+.B \-xrm \fIresource-specification\fP
+As with all other Xt programs, you can specify X resources on the command-line
+using the \fI\-xrm\fP argument. Most of the interesting resources have
+command-line equivalents, however.
+.SH HOW IT WORKS
+When it is time to activate the screensaver, a full-screen black window is
+created on each screen of the display. Each window is created in such a way
+that, to any subsequently-created programs, it will appear to be a ``virtual
+root'' window. Because of this, any program which draws on the root
+window (and which understands virtual roots) can be used as a screensaver.
+
+When the user becomes active again, the screensaver windows are unmapped, and
+the running subprocesses are killed by sending them \fBSIGTERM\fP. This is
+also how the subprocesses are killed when the screensaver decides that it's
+time to run a different demo: the old one is killed and a new one is launched.
+
+Before launching a subprocess, \fIxscreensaver\fP stores an appropriate value
+for \fB$DISPLAY\fP in the environment that the child will recieve. (This is
+so that if you start \fIxscreensaver\fP with a \fI-display\fP argument, the
+programs which \fIxscreensaver\fP launches will draw on the same display;
+and so that the child will end up drawing on the appropriate screen of a
+multi-headed display.)
+
+When the screensaver turns off, or is killed, care is taken to restore
+the ``real'' virtual root window if there is one. Because of this, it is
+important that you not kill the screensaver process with \fIkill -9\fP if
+you are running a virtual-root window manager. If you kill it with \-9,
+you may need to restart your window manager to repair the damage. This
+isn't an issue if you aren't running a virtual-root window manager.
+
+For all the gory details, see the commentary at the top of xscreensaver.c.
+
+You can control a running screensaver process by using the
+.BR xscreensaver\-command (1)
+program (which see.)
+.SH POWER MANAGEMENT
+Modern X servers contain support to power down the monitor after an idle
+period. If the monitor has powered down, then \fIxscreensaver\fP will
+notice this, and will not waste CPU by drawing graphics demos on a black
+screen. An attempt will also be made to explicitly power the monitor
+back up as soon as user activity is detected.
+
+If your X server supports power management, then
+.BR xset (1)
+will accept a \fBdpms\fP option. So, if you wanted \fIxscreensaver\fP
+to activate after 5 minutes, but you wanted your monitor to power down
+after one hour (3600 seconds) you would do this:
+.EX
+xset dpms 3600
+.EE
+See the man page for the
+.BR xset (1)
+program for details. (Note that power management requires both software
+support in the X server, and hardware support in the monitor itself.)
+.SH USING XDM(1)
+You can run \fIxscreensaver\fP from your
+.BR xdm (1)
+session, so that the screensaver will run even when nobody is logged
+in on the console.
+
+The trick to using xscreensaver with \fIxdm\fP is this: keep in mind the
+two very different states in which xscreensaver will be running:
+.RS 4
+.TP 3
+.B 1: Nobody logged in.
+
+If you're thinking of running xscreensaver from XDM at all, then it's
+probably because you want graphics demos to be running on the console
+when nobody is logged in there. In this case, xscreensaver will function
+only as a screen saver, not a screen locker: it doesn't make sense
+for xscreensaver to lock the screen, since nobody is logged in yet!
+The only thing on the screen is the XDM login prompt.
+.TP 3
+.B 2: Somebody logged in.
+
+Once someone has logged in through the XDM login window, the situation is
+very different. For example: now it makes sense to lock the screen (and
+prompt for the logged in user's password); and now xscreensaver should
+consult that user's \fI~/.xscreensaver\fP file; and so on.
+.RE
+
+The difference between these two states comes down to a question of,
+which user is the \fIxscreensaver\fP process running as? For the first
+state, it doesn't matter. If you start \fIxscreensaver\fP in the usual
+XDM way, then xscreensaver will probably end up running as root, which
+is fine for the first case (the ``nobody logged in'' case.)
+
+However, once someone is logged in, running as root is no longer fine:
+because xscreensaver will be consulting root's \fI.xscreensaver\fP file
+instead of that of the logged in user, and won't be prompting for the
+logged in user's password, and so on. (This is not a security problem,
+it's just not what you want.)
+
+So, once someone has logged in, you want xscreensaver to be running as that
+user. The way to accomplish this is to kill the old xscreensaver process
+and start a new one (as the new user.)
+
+The simplest way to accomplish all of this is as follows:
+.RS 4
+.TP 3
+.B 1: Launch xscreensaver before anyone logs in.
+
+To the file \fI/usr/lib/X11/xdm/Xsetup\fP, add the lines
+.EX
+xscreensaver-command -exit
+xscreensaver &
+.EE
+This will run xscreensaver as root, over the XDM login window.
+Moving the mouse will cause the screen to un-blank, and allow the user
+to type their password at XDM to log in.
+.TP 3
+.B 2: Restart xscreensaver when someone logs in.
+
+Near the top of the file \fI/usr/lib/X11/xdm/Xsession\fP, add those same lines:
+.EX
+xscreensaver-command -exit
+xscreensaver &
+.EE
+When someone logs in, this will kill off the existing (root) xscreensaver
+process, and start a new one, running as the user who has just logged in.
+If the user's .xscreensaver file requests locking, they'll get it. They
+will also get their own choice of timeouts, and graphics demos, and so on.
+
+Alternately, each user could just put those lines in their
+personal \fI~/.xsession\fP files.
+.RE
+
+Make sure you have \fB$PATH\fP set up correctly in the \fIXsetup\fP
+and \fIXsession\fP scripts, or \fIxdm\fP won't be able to
+find \fIxscreensaver\fP, and/or \fIxscreensaver\fP won't be able to
+find its graphics demos.
+
+(If your system does not seem to be executing the \fIXsetup\fP file, you
+may need to configure it to do so: the traditional way to do this is
+to make that file the value of the \fIDisplayManager*setup\fP resource
+in the \fI/usr/lib/X11/xdm/xdm-config\fP file. See the man page for
+.BR xdm (1)
+for more details.)
+
+It is safe to run \fIxscreensaver\fP as root (as \fIxdm\fP is likely to do.)
+If run as root, \fIxscreensaver\fP changes its effective user and group ids
+to something safe (like \fI"nobody"\fP) before connecting to the X server
+or launching user-specified programs.
+
+An unfortunate side effect of this (important) security precaution is that
+it may conflict with cookie-based authentication.
+
+If you get "connection refused" errors when running \fIxscreensaver\fP
+from \fIxdm\fP, then this probably means that you have
+.BR xauth (1)
+or some other security mechanism turned on. One way around this is to
+add \fB"xhost\ +localhost"\fP to \fIXsetup\fP, just before \fIxscreensaver\fP
+is launched.
+
+Note that this will give access to the X server to anyone capable of logging
+in to the local machine, so in some environments, this might not be
+appropriate. If turning off file-system-based access control is not
+acceptable, then running \fIxscreensaver\fP from the \fIXsetup\fP file
+might not be possible, and xscreensaver will only work when running as
+a normal, unprivileged user.
+
+For more information on the X server's access control mechanisms, see the
+man pages for
+.BR X (1),
+.BR Xsecurity (1),
+.BR xauth (1),
+and
+.BR xhost (1).
+.SH USING CDE (COMMON DESKTOP ENVIRONMENT)
+The easiest way to use \fIxscreensaver\fP on a system with CDE is to simply
+switch off the built-in CDE screensaver, and use \fIxscreensaver\fP instead;
+and second, to tell the front panel to run
+.BR xscreensaver\-command (1)
+with the \fI\-lock\fP option when the \fILock\fP icon is clicked.
+
+To accomplish this involves five steps:
+.RS 4
+.TP 3
+\fB1: Switch off CDE's locker\fP
+Do this by turning off ``\fIScreen Saver and Screen Lock\fP'' in the
+Screen section of the Style Manager.
+.TP 3
+\fB2: Edit sessionetc\fP
+Edit the file \fI~/.dt/sessions/sessionetc\fP and add to it the line
+.EX
+xscreensaver &
+.EE
+This will cause \fIxscreensaver\fP to be launched when you log in.
+(As always, make sure that xscreensaver and the graphics demos are on
+your \fB$PATH\fP; the path needs to be set in \fI.cshrc\fP
+and/or \fI.dtprofile\fP, not \fI.login\fP.)
+.TP 3
+\fB3: Create XScreenSaver.dt\fP
+Create a file called \fI~/.dt/types/XScreenSaver.dt\fP with the following
+contents:
+.EX
+ACTION XScreenSaver
+{
+ LABEL XScreenSaver
+ TYPE COMMAND
+ EXEC_STRING xscreensaver-command -lock
+ ICON Dtkey
+ WINDOW_TYPE NO_STDIO
+}
+.EE
+This defines a ``lock'' command for the CDE front panel, that knows how
+to talk to \fIxscreensaver\fP.
+.TP 3
+\fB4: Create Lock.fp\fP
+Create a file called \fI~/.dt/types/Lock.fp\fP with the following
+contents:
+.EX
+CONTROL Lock
+{
+ TYPE icon
+ CONTAINER_NAME Switch
+ CONTAINER_TYPE SWITCH
+ POSITION_HINTS 1
+ ICON Fplock
+ LABEL Lock
+ PUSH_ACTION XScreenSaver
+ HELP_TOPIC FPOnItemLock
+ HELP_VOLUME FPanel
+}
+.EE
+This associates the CDE front panel ``Lock'' icon with the lock command
+we just defined in step 3.
+.TP 3
+\fB5: Restart\fP
+Select ``\fIRestart Workspace Manager\fP'' from the popup menu to make
+your changes take effect. If things seem not to be working, check the
+file \fI~/.dt/errorlog\fP for error messages.
+.RE
+.SH USING HP VUE (VISUAL USER ENVIRONMENT)
+Since CDE is a descendant of VUE, the instructions for using xscreensaver
+under VUE are similar to the above:
+.RS 4
+.TP 3
+\fB1: Switch off VUE's locker\fP
+Open the ``\fIStyle Manager\fP'' and select ``\fIScreen\fP.''
+Turn off ``\fIScreen Saver and Screen Lock\fP'' option.
+.TP 3
+\fB2: Make sure you have a Session\fP
+Next, go to the Style Manager's, ``\fIStartup\fP'' page.
+Click on ``\fISet Home Session\fP'' to create a session, then
+on ``\fIReturn to Home Session\fP'' to select this session each
+time you log in.
+.TP 3
+\fB3: Edit vue.session\fP
+Edit the file \fI~/.vue/sessions/home/vue.session\fP and add to it
+the line
+.EX
+vuesmcmd -screen 0 -cmd "xscreensaver"
+.EE
+This will cause \fIxscreensaver\fP to be launched when you log in.
+(As always, make sure that xscreensaver and the graphics demos are on
+your \fB$PATH\fP; the path needs to be set in \fI.cshrc\fP
+and/or \fI.profile\fP, not \fI.login\fP.)
+.TP 3
+\fB3: Edit vuewmrc\fP
+Edit the file \fI~/.vue/vuewmrc\fP and add (or change) the Lock control:
+.EX
+CONTROL Lock
+{
+ TYPE button
+ IMAGE lock
+ PUSH_ACTION f.exec "xscreensaver-command -lock"
+ HELP_TOPIC FPLock
+}
+.EE
+This associates the VUE front panel ``Lock'' icon with the xscreensaver
+lock command.
+.RE
+.PP
+.SH ADDING TO MENUS
+The
+.BR xscreensaver-command (1)
+program is a perfect candidate for something to add to your window manager's
+popup menus. If you use
+.BR mwm (1),
+.BR 4Dwm (1),
+.BR twm (1),
+or (probably) any of \fItwm\fP's many descendants, you can do it like this:
+.RS 0
+.TP 3
+\fB1. Create ~/.mwmrc (or ~/.twmrc or ...)\fP
+If you don't have a \fI~/.mwmrc\fP file (or, on SGIs, a \fI~/.4Dwmrc\fP file;
+or, with twm, a \fI~/.twmrc\fP file) then create one by making a copy of
+the \fI/usr/lib/X11/system.mwmrc\fP
+file (or \fI/usr/lib/X11/twm/system.twmrc\fP, and so on.)
+.TP 3
+\fB2. Add a menu definition.\fP
+Something like this:
+.EX
+menu XScreenSaver
+{
+ "Blank Screen Now" !"sleep 3; xscreensaver-command -activate"
+ "Lock Screen Now" !"sleep 3; xscreensaver-command -lock"
+ "Screen Saver Demo" !"xscreensaver-demo"
+ "Screen Saver Preferences" !"xscreensaver-demo -prefs"
+ "Reinitialize Screen Saver" !"xscreensaver-command -restart"
+ "Kill Screen Saver" !"xscreensaver-command -exit"
+ "Launch Screen Saver" !"xscreensaver &"
+}
+.EE
+.TP 3
+\fB3. Add the menu\fP
+For
+.BR mwm (1)
+and
+.BR 4Dwm (1),
+find the section of the file that says \fIMenu DefaultRootMenu\fP.
+For
+.BR twm (1),
+it will probably be \fImenu "defops"\fP. If you add a line somewhere
+in that menu definition that reads
+.EX
+ "XScreenSaver" f.menu XScreenSaver
+.EE
+then this will add an XScreenSaver sub-menu to your default root-window
+popup menu. Alternately, you could just put the xscreensaver menu items
+directly into the root menu.
+.RE
+
+Other window managers are guaranteed to do things gratuitously differently.
+.SH BUGS
+Bugs? There are no bugs. Ok, well, maybe. If you find one, please let
+me know. http://www.jwz.org/xscreensaver/bugs.html explains how to
+construct the most useful bug reports.
+.TP 8
+.B Locking and XDM
+If xscreensaver has been launched from
+.BR xdm (1)
+before anyone has logged in, you will need to kill and then restart the
+xscreensaver daemon after you have logged in, or you will be confused by
+the results. (For example, locking won't work, and your \fI~/.xscreensaver\fP
+file will be ignored.)
+
+When you are logged in, you want the \fIxscreensaver\fP daemon to be
+running under \fIyour\fP user id, not as root or some other user.
+
+If it has already been started by \fIxdm\fP, you can kill it by sending
+it the \fBexit\fP command, and then re-launching it as you, by putting
+something like the following in your personal X startup script:
+.EX
+xscreensaver-command -exit
+xscreensaver &
+.EE
+The ``\fIUsing XDM(1)\fP'' section, above, goes into more detail, and explains
+how to configure the system to do this for all users automatically.
+.TP 8
+.B Locking and root logins
+In order for it to be safe for xscreensaver to be launched by \fIxdm\fP,
+certain precautions had to be taken, among them that xscreensaver never
+runs as \fIroot\fP. In particular, if it is launched as root (as \fIxdm\fP
+is likely to do), xscreensaver will disavow its privileges, and switch
+itself to a safe user id (such as \fInobody\fP.)
+
+An implication of this is that if you log in as \fIroot\fP on the console,
+xscreensaver will refuse to lock the screen (because it can't tell
+the difference between \fIroot\fP being logged in on the console, and a
+normal user being logged in on the console but xscreensaver having been
+launched by the
+.BR xdm (1)
+.I Xsetup
+file.)
+
+The solution to this is simple: you shouldn't be logging in on the console
+as \fIroot\fP in the first place! (What, are you crazy or something?)
+
+Proper Unix hygiene dictates that you should log in as yourself, and
+.BR su (1)
+to \fIroot\fP as necessary. People who spend their day logged in
+as \fIroot\fP are just begging for disaster.
+.TP 8
+.B XAUTH and XDM
+For xscreensaver to work when launched by
+.BR xdm (1),
+programs running on the local machine as user \fI"nobody"\fP must be
+able to connect to the X server. This means that if you want to run
+xscreensaver on the console while nobody is logged in, you may need
+to disable cookie-based access control (and allow all users who can log
+in to the local machine to connect to the display.)
+
+You should be sure that this is an acceptable thing to do in your
+environment before doing it. See the ``\fIUsing XDM(1)\fP'' section,
+above, for more details.
+
+If anyone has suggestions on how xscreensaver could be made to work with
+.BR xdm (1)
+without first turning off \fI.Xauthority\fP-based access control, please
+let me know.
+.TP 8
+.B Passwords
+If you get an error message at startup like ``couldn't get password
+of \fIuser\fP'' then this probably means that you're on a system in which
+the
+.BR getpwent (3)
+library routine can only be effectively used by root. If this is the case,
+then \fIxscreensaver\fP must be installed as setuid to root in order for
+locking to work. Care has been taken to make this a safe thing to do.
+
+It also may mean that your system uses shadow passwords instead of the standard
+.BR getpwent (3)
+interface; in that case, you may need to change some options
+with \fIconfigure\fP and recompile.
+
+If you change your password after xscreensaver has been launched, it will
+continue using your old password to unlock the screen until xscreensaver
+is restarted. So, after you change your password, you'll have to do
+.EX
+xscreensaver-command -restart
+.EE
+to make \fIxscreensaver\fP notice.
+.TP 8
+.B PAM Passwords
+If your system uses PAM (Pluggable Authentication Modules), then in order
+for xscreensaver to use PAM properly, PAM must be told about xscreensaver.
+The xscreensaver installation process should update the PAM data (on Linux,
+by creating the file \fI/etc/pam.d/xscreensaver\fP for you, and on Solaris,
+by telling you what lines to add to the \fI/etc/pam.conf\fP file.)
+
+If the PAM configuration files do not know about xscreensaver, then
+you \fImight\fP be in a situation where xscreensaver will refuse to ever
+unlock the screen.
+
+This is a design flaw in PAM (there is no way for a client to tell the
+difference between PAM responding ``I have never heard of your module,''
+and responding, ``you typed the wrong password.'') As far as I can tell,
+there is no way for xscreensaver to automatically work around this, or
+detect the problem in advance, so if you have PAM, make sure it is
+configured correctly!
+.TP 8
+.B Colormap lossage: TWM
+The \fBinstallColormap\fP option doesn't work very well with the
+.BR twm (1)
+window manager and its descendants.
+
+There is a race condition between the screensaver and this window manager,
+which can result in the screensaver's colormap not getting installed
+properly, meaning the graphics hacks will appear in essentially random
+colors. (If the screen goes white instead of black, this is probably why.)
+
+The
+.BR mwm (1)
+and
+.BR olwm (1)
+window managers don't have this problem. The race condition exists
+because X (really, ICCCM) does not provide a way for an OverrideRedirect
+window to have its own colormap, short of grabbing the server (which is
+neither a good idea, nor really possible with the current design.) What
+happens is that, as soon as xscreensaver installs its colormap, \fBtwm\fP
+responds to the resultant \fBColormapNotify\fP event by re-instaling the
+default colormap. Apparently, \fBtwm\fP doesn't \fIalways\fP do this; it
+seems to do it regularly if the screensaver is activated from a menu item,
+but seems to not do it if the screensaver comes on of its own volition, or
+is activated from another console.
+.RS 8
+.TP 4
+.B Attention, window manager authors!
+You should only call
+.BR XInstallColormap (3)
+in response to user events. That is, it is appropriate to install a colormap
+in response to \fBFocusIn\fP, \fBFocusOut\fP, \fBEnterNotify\fP,
+and \fBLeaveNotify\fP events; but it is not appropriate to call it in
+response to \fBColormapNotify\fP events. If you install colormaps in
+response to \fIapplication\fP actions as well as in response to \fIuser\fP
+actions, then you create the situation where it is impossible for
+override-redirect applications (such as xscreensaver) to display their
+windows in the proper colors.
+.RE
+.TP 8
+.B Colormap lossage: XV, XAnim, XEarth
+Some programs don't operate properly on visuals other than the default one,
+or with colormaps other than the default one. See the discussion of the
+magic "default-n" visual name in the description of the \fBprograms\fP
+resource in the \fIConfiguration\fP section. When programs only work with
+the default colormap, you need to use a syntax like this:
+.EX
+ default-n: xv -root image-1.gif -quit \\n\\
+ default-n: xearth -nostars -wait 0 \\n\\
+.EE
+It would also work to turn off the \fBinstallColormap\fP option altogether,
+but that would deny extra colors to those programs that \fIcan\fP take
+advantage of them.
+.TP 8
+.B Machine Load
+Although this program ``nices'' the subprocesses that it starts,
+graphics-intensive subprograms can still overload the machine by causing
+the X server process itself (which is not ``niced'') to suck a lot of
+cycles. Care should be taken to slow down programs intended for use as
+screensavers by inserting strategic calls to
+.BR sleep (3)
+or
+.BR usleep (3)
+(or making liberal use of any \fI\-delay\fP options which the programs
+may provide.)
+
+Note that the OpenGL-based graphics demos are real pigs on machines that
+don't have texture hardware.
+
+Also, an active screensaver will cause your X server to be pretty much
+permanently swapped in; but the same is true of any program that draws
+periodically, like
+.BR xclock (1)
+or
+.BR xload (1).
+.TP 8
+.B Latency and Responsiveness
+If the subprocess is drawing too quickly and the connection to the X
+server is a slow one (such as an X terminal running over a phone line) then
+the screensaver might not turn off right away when the user becomes active
+again (the
+.BR ico (1)
+demo has this problem if being run in full-speed mode). This can be
+alleviated by inserting strategic calls to
+.BR XSync (3)
+in code intended for use as a screensaver. This prevents too much graphics
+activity from being buffered up.
+.TP 8
+.B XFree86's Magic Keystrokes
+The XFree86 X server traps certain magic keystrokes before client programs ever
+see them. Two that are of note are Ctrl+Alt+Backspace, which causes
+the X server to exit; and Ctrl+Alt+F\fIn\fP, which switches virtual consoles.
+The X server will respond to these keystrokes even if xscreensaver has the
+screen locked. Depending on your setup, you might consider this a problem.
+
+Unfortunately, there is no way for xscreensaver itself to override the
+interpretation of these keys. If you want to disable Ctrl+Alt+Backspace
+globally, you need to set the \fIDontZap\fP flag in
+your \fI/etc/X11/XF86Config\fP file. See the
+.BR XF86Config (5)
+manual for details.
+
+There is no way (as far as I can tell) to disable the VT-switching keystrokes.
+
+Some Linux systems come with a VT_LOCKSWITCH ioctl, that one could
+theoretically use to prevent VT-switching while the screen is locked;
+but unfortunately, this ioctl can only be used by root, which means
+that xscreensaver can't use it (since xscreensaver disavows its privileges
+shortly after startup, for security reasons.)
+
+Any suggestions for other solutions to this problem are welcome.
+.TP 8
+.B XView Clients
+Apparently there are some problems with XView programs getting confused
+and thinking that the screensaver window is the real root window even when
+the screensaver is not active: ClientMessages intended for the window manager
+are sent to the screensaver window instead. This could be solved by making
+xscreensaver forward all unrecognised ClientMessages to the real root window,
+but there may be other problems as well. If anyone has any insight on the
+cause of this problem, please let me know. (XView is an X11 toolkit that
+implements the (quite abominable) Sun OpenLook look-and-feel.)
+.TP 8
+.B MIT Extension and Fading
+The \fBMIT-SCREEN-SAVER\fP extension is junk. Don't use it.
+
+When using the \fBMIT-SCREEN-SAVER\fP extension in conjunction with
+the \fBfade\fP option, you'll notice an unattractive flicker just before
+the fade begins. This is because the server maps a black window just before
+it tells the \fIxscreensaver\fP process to activate. The \fIxscreensaver\fP
+process immediately unmaps that window, but this results in a flicker. I
+haven't figured a way to get around this; it seems to be a fundamental
+property of the (mis-) design of this server extension.
+
+It sure would be nice if someone would implement the \fBSGI SCREEN_SAVER\fP
+extension in XFree86; it's dead simple, and works far better than the
+overengineered and broken \fBMIT-SCREEN-SAVER\fP extension.
+.TP 8
+.B SGI Power Saver
+If you're running Irix 6.3, you might find that your monitor is powering down
+after an hour or two even if you've told it not to. This is fixed by SGI
+patches 2447 and 2537.
+
+If you're running Irix 6.5, this bug is back. I don't know a fix.
+.TP 8
+.B MesaGL and Voodoo Cards
+If you have a 3Dfx/Voodoo card, the default settings for xscreensaver will
+run the GL-based graphics demos in such a way that they will not take
+advantage of the 3D acceleration hardware. The solution is to change
+the \fBprograms\fP entries for the GL hacks from this:
+.EX
+ gears -root \\n\\
+.EE
+to this:
+.EX
+ MESA_GLX_FX=fullscreen gears \\n\\
+.EE
+That is, make sure that \fB$MESA_GLX_FX\fP is set to \fIfullscreen\fP, and
+don't tell the program to draw on the root window. This may seem strange,
+but the setup used by Mesa and these kinds of cards \fIis\fP strange!
+
+For those who don't know, these cards work by sitting between your normal
+video card and the monitor, and seizing control of the monitor when it's
+time to do 3D. But this means that accelerated 3D only happens in full-screen
+mode (you can't do it in a window, and you can't see the output of 3D and 2D
+programs simultaniously), and that 3D will probably drive your monitor at a
+lower resolution, as well. It's bizarre.
+
+If you find that GL programs only work properly when run as root, and not
+as normal users, then the problem is that your \fI/dev/3dfx\fP file is not
+configured properly. Check the Linux 3Dfx FAQ.
+.TP 8
+.B Keyboard LEDs
+If \fIprocInterrupts\fP is on (which is the default on Linux systems) and
+you're using some program that toggles the state of your keyboard LEDs,
+xscreensaver won't work right: turning those LEDs on or off causes a
+keyboard interrupt, which xscreensaver will interpret as user activity.
+So if you're using such a program, set the \fIprocInterrupts\fP resource
+to False.
+.TP 8
+.B Extensions
+If you are not making use of one of the server extensions (\fBXIDLE\fP,
+\fBSGI SCREEN_SAVER\fP, or \fBMIT-SCREEN-SAVER\fP), then it is possible, in
+rare situations, for \fIxscreensaver\fP to interfere with event propagation
+and make another X program malfunction. For this to occur, that other
+application would need to \fInot\fP select \fBKeyPress\fP events on its
+non-leaf windows within the first 30 seconds of their existence, but then
+select for them later. In this case, that client \fImight\fP fail to receive
+those events. This isn't very likely, since programs generally select a
+constant set of events immediately after creating their windows and then
+don't change them, but this is the reason that it's a good idea to install
+and use one of the server extensions instead, to work around this shortcoming
+in the X protocol.
+
+In all these years, I've not heard of even a single case of this happening,
+but it is theoretically possible, so I'm mentioning it for completeness...
+.TP 8
+.B Red Hot Lava
+There need to be a lot more graphics hacks. In particular, there should be
+a simulation of a Lavalite (tm).
+.SH ENVIRONMENT
+.PP
+.TP 8
+.B DISPLAY
+to get the default host and display number, and to inform the sub-programs
+of the screen on which to draw.
+.TP 8
+.B PATH
+to find the sub-programs to run.
+.TP 8
+.B HOME
+for the directory in which to read and write the \fI.xscreensaver\fP file.
+.TP 8
+.B XENVIRONMENT
+to get the name of a resource file that overrides the global resources
+stored in the RESOURCE_MANAGER property.
+.SH UPGRADES
+The latest version can always be found at
+http://www.jwz.org/xscreensaver/
+.SH SEE ALSO
+.BR X (1),
+.BR xscreensaver\-demo (1),
+.BR xscreensaver\-command (1),
+.BR xdm (1),
+.BR xset (1),
+.BR Xsecurity (1),
+.BR xauth (1),
+.BR xhost (1).
+.BR ant (1),
+.BR atlantis (1),
+.BR attraction (1),
+.BR blitspin (1),
+.BR bouboule (1),
+.BR braid (1),
+.BR bsod (1),
+.BR bubble3d (1),
+.BR bubbles (1),
+.BR cage (1),
+.BR compass (1),
+.BR coral (1),
+.BR critical (1),
+.BR crystal (1),
+.BR cynosure (1),
+.BR decayscreen (1),
+.BR deco (1),
+.BR deluxe (1),
+.BR demon (1),
+.BR discrete (1),
+.BR distort (1),
+.BR drift (1),
+.BR epicycle (1),
+.BR fadeplot (1),
+.BR flag (1),
+.BR flame (1),
+.BR flow (1),
+.BR forest (1),
+.BR galaxy (1),
+.BR gears (1),
+.BR glplanet (1),
+.BR goop (1),
+.BR grav (1),
+.BR greynetic (1),
+.BR halo (1),
+.BR helix (1),
+.BR hopalong (1),
+.BR hypercube (1),
+.BR ifs (1),
+.BR imsmap (1),
+.BR interference (1),
+.BR jigsaw (1),
+.BR julia (1),
+.BR kaleidescope (1),
+.BR kumppa (1),
+.BR lament (1),
+.BR laser (1),
+.BR lightning (1),
+.BR lisa (1),
+.BR lissie (1),
+.BR lmorph (1),
+.BR loop (1),
+.BR maze (1),
+.BR moebius (1),
+.BR moire (1),
+.BR moire2 (1),
+.BR morph3d (1),
+.BR mountain (1),
+.BR munch (1),
+.BR noseguy (1),
+.BR pedal (1),
+.BR penetrate (1),
+.BR penrose (1),
+.BR petri (1),
+.BR phosphor (1),
+.BR pipes (1),
+.BR pulsar (1),
+.BR pyro (1),
+.BR qix (1),
+.BR rd-bomb (1),
+.BR rocks (1),
+.BR rorschach (1),
+.BR rotor (1),
+.BR rubik (1),
+.BR sierpinski (1),
+.BR slidescreen (1),
+.BR slip (1),
+.BR sonar (1),
+.BR sphere (1),
+.BR spiral (1),
+.BR spotlight (1),
+.BR sproingies (1),
+.BR squiral (1),
+.BR stairs (1),
+.BR starfish (1),
+.BR strange (1),
+.BR superquadrics (1),
+.BR swirl (1),
+.BR t3d (1),
+.BR triangle (1),
+.BR truchet (1),
+.BR vines (1),
+.BR wander (1),
+.BR worm (1),
+.BR xflame (1),
+.BR xjack (1),
+.BR xlyap (1),
+.BR xmatrix (1),
+.BR xroger (1),
+.BR bongo (1),
+.BR ico (1),
+.BR xaos (1),
+.BR xbouncebits (1),
+.BR xcthugha (1),
+.BR xdaliclock (1),
+.BR xfishtank (1),
+.BR xmountains (1),
+.BR xsplinefun (1),
+.BR xswarm (1),
+.BR xtacy (1),
+.BR xv (1),
+.BR xwave (1).
+.SH COPYRIGHT
+Copyright \(co 1991, 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999
+by Jamie Zawinski. Permission to use, copy, modify, distribute, and sell
+this software and its documentation for any purpose is hereby granted without
+fee, provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in supporting
+documentation. No representations are made about the suitability of this
+software for any purpose. It is provided "as is" without express or implied
+warranty.
+.SH AUTHOR
+Jamie Zawinski <jwz@jwz.org>. Written in late 1991; first posted
+to comp.sources.x on 13-Aug-1992.
+
+Please let me know if you find any bugs or make any improvements.
+.SH ACKNOWLEDGEMENTS
+Thanks to the many people who have contributed graphics demos to the package.
+
+Thanks to David Wojtowicz for implementing \fIlockTimeout\fP.
+
+Thanks to Martin Kraemer for adding support for shadow passwords and
+locking-disabled diagnostics.
+
+Thanks to Patrick Moreau for the VMS port.
+
+Thanks to Mark Bowyer for figuring out how to hook it up to CDE.
+
+Thanks to Nat Lanza for the Kerberos support.
+
+Thanks to Bill Nottingham for the initial PAM support.
+
+And thanks to Jon A. Christopher for implementing the Athena dialog
+support, back in the days before Lesstif or Gtk were viable alternatives
+to Motif.
projects / xscreensaver / commitdiff